From e470c2150abf4179f873cabad23945bbc920cc5f Mon Sep 17 00:00:00 2001 From: Przemek Strzelczyk <41076710+nvpstr@users.noreply.github.com> Date: Mon, 21 Oct 2019 19:20:40 +0200 Subject: [PATCH] Updating RN50/MxNet --- MxNet/Classification/RN50v1.5/Dockerfile | 3 + MxNet/Classification/RN50v1.5/LICENSE | 1 + MxNet/Classification/RN50v1.5/README.md | 767 ++++++++++--- MxNet/Classification/RN50v1.5/__init__.py | 0 MxNet/Classification/RN50v1.5/benchmark.py | 97 +- MxNet/Classification/RN50v1.5/benchmarking.py | 7 +- MxNet/Classification/RN50v1.5/dali.py | 194 ++-- MxNet/Classification/RN50v1.5/data.py | 408 ++++--- .../RN50v1.5/examples/BENCHMARK_FP16.sh | 19 - .../RN50v1.5/examples/BENCHMARK_FP32.sh | 19 - .../RN50v1.5/examples/INFER_BENCHMARK_FP16.sh | 19 - .../RN50v1.5/examples/RN50_FP16_1GPU.sh | 19 - .../RN50v1.5/examples/RN50_FP16_4GPU.sh | 19 - .../RN50v1.5/examples/RN50_FP16_8GPU.sh | 19 - .../RN50v1.5/examples/RN50_FP32_1GPU.sh | 19 - .../RN50v1.5/examples/RN50_FP32_4GPU.sh | 19 - .../RN50v1.5/examples/RN50_FP32_8GPU.sh | 19 - .../RN50v1.5/examples/SCORE_FP16.sh | 19 - .../RN50v1.5/examples/SCORE_FP32.sh | 19 - MxNet/Classification/RN50v1.5/fit.py | 781 +++++++------ .../RN50v1.5/imagenet_classes.py | 1002 +++++++++++++++++ ...ss.png => dgx1-16g_250e_training_loss.png} | Bin .../img/dgx1-16g_250e_validation_top1.png | Bin 0 -> 19038 bytes .../img/dgx1-16g_250e_validation_top5.png | Bin 0 -> 18304 bytes .../RN50v1.5/img/training_accuracy.png | Bin 16190 -> 0 bytes .../RN50v1.5/img/validation_accuracy.png | Bin 21074 -> 0 bytes MxNet/Classification/RN50v1.5/models.py | 522 +++++++++ MxNet/Classification/RN50v1.5/report.py | 31 +- MxNet/Classification/RN50v1.5/resnet.py | 376 ------- MxNet/Classification/RN50v1.5/runner | 105 +- .../prepare_imagenet.sh} | 15 +- MxNet/Classification/RN50v1.5/train.py | 59 +- .../Detection/SSD/csrc/box_encoder_cuda.cu | 2 +- PyTorch/Detection/SSD/csrc/interface.cpp | 2 +- .../Detection/SSD/csrc/random_horiz_flip.cu | 2 +- PyTorch/Detection/SSD/dle/inference.py | 14 + .../SSD/examples/SSD300_inference.py | 14 + PyTorch/Detection/SSD/main.py | 14 + PyTorch/Detection/SSD/setup.py | 2 +- PyTorch/Detection/SSD/src/coco.py | 14 + PyTorch/Detection/SSD/src/coco_pipeline.py | 2 +- PyTorch/Detection/SSD/src/data.py | 16 +- PyTorch/Detection/SSD/src/evaluate.py | 14 + PyTorch/Detection/SSD/src/logger.py | 14 + PyTorch/Detection/SSD/src/model.py | 14 + PyTorch/Detection/SSD/src/train.py | 14 + PyTorch/Detection/SSD/src/utils.py | 14 + 47 files changed, 3226 insertions(+), 1503 deletions(-) create mode 100644 MxNet/Classification/RN50v1.5/Dockerfile delete mode 100644 MxNet/Classification/RN50v1.5/__init__.py mode change 100644 => 100755 MxNet/Classification/RN50v1.5/benchmark.py delete mode 100644 MxNet/Classification/RN50v1.5/examples/BENCHMARK_FP16.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/BENCHMARK_FP32.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/INFER_BENCHMARK_FP16.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/RN50_FP16_1GPU.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/RN50_FP16_4GPU.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/RN50_FP16_8GPU.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/RN50_FP32_1GPU.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/RN50_FP32_4GPU.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/RN50_FP32_8GPU.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/SCORE_FP16.sh delete mode 100644 MxNet/Classification/RN50v1.5/examples/SCORE_FP32.sh create mode 100644 MxNet/Classification/RN50v1.5/imagenet_classes.py rename MxNet/Classification/RN50v1.5/img/{training_loss.png => dgx1-16g_250e_training_loss.png} (100%) create mode 100644 MxNet/Classification/RN50v1.5/img/dgx1-16g_250e_validation_top1.png create mode 100644 MxNet/Classification/RN50v1.5/img/dgx1-16g_250e_validation_top5.png delete mode 100644 MxNet/Classification/RN50v1.5/img/training_accuracy.png delete mode 100644 MxNet/Classification/RN50v1.5/img/validation_accuracy.png create mode 100644 MxNet/Classification/RN50v1.5/models.py delete mode 100644 MxNet/Classification/RN50v1.5/resnet.py rename MxNet/Classification/RN50v1.5/{examples/INFER_BENCHMARK_FP32.sh => scripts/prepare_imagenet.sh} (57%) mode change 100644 => 100755 mode change 100755 => 100644 PyTorch/Detection/SSD/src/coco.py diff --git a/MxNet/Classification/RN50v1.5/Dockerfile b/MxNet/Classification/RN50v1.5/Dockerfile new file mode 100644 index 00000000..8d8f0226 --- /dev/null +++ b/MxNet/Classification/RN50v1.5/Dockerfile @@ -0,0 +1,3 @@ +FROM nvcr.io/nvidia/mxnet:19.07-py3 +COPY . /workspace/rn50 +WORKDIR /workspace/rn50 diff --git a/MxNet/Classification/RN50v1.5/LICENSE b/MxNet/Classification/RN50v1.5/LICENSE index 261eeb9e..d6456956 100644 --- a/MxNet/Classification/RN50v1.5/LICENSE +++ b/MxNet/Classification/RN50v1.5/LICENSE @@ -1,3 +1,4 @@ + Apache License Version 2.0, January 2004 http://www.apache.org/licenses/ diff --git a/MxNet/Classification/RN50v1.5/README.md b/MxNet/Classification/RN50v1.5/README.md index 9198a0ff..ff131bfc 100644 --- a/MxNet/Classification/RN50v1.5/README.md +++ b/MxNet/Classification/RN50v1.5/README.md @@ -1,6 +1,46 @@ -# ResNet50 v1.5 For MXNet +# ResNet50 v1.5 for MXNet -## The model +This repository provides a script and recipe to train the ResNet50 v1.5 model to achieve state of the art accuracy, and is tested and maintained by NVIDIA. + +## Table Of Contents +- [Model overview](#model-overview) + * [Default configuration](#default-configuration) + * [Feature support matrix](#feature-support-matrix) + * [Features](#features) + * [Mixed precision training](#mixed-precision-training) + * [Enabling mixed precision](#enabling-mixed-precision) +- [Setup](#setup) + * [Requirements](#requirements) +- [Quick Start Guide](#quick-start-guide) +- [Advanced](#advanced) + * [Scripts and sample code](#scripts-and-sample-code) + * [Parameters](#parameters) + * [Command-line options](#command-line-options) + * [Getting the data](#getting-the-data) + * [Dataset guidelines](#dataset-guidelines) + * [Multi-dataset](#multi-dataset) + * [Training process](#training-process) + * [Inference process](#inference-process) +- [Performance](#performance) + * [Benchmarking](#benchmarking) + * [Training performance benchmark](#training-performance-benchmark) + * [Inference performance benchmark](#inference-performance-benchmark) + * [Results](#results) + * [Training accuracy results](#training-accuracy-results) + * [Training accuracy: NVIDIA DGX-1 (8x V100 16G)](#training-accuracy-nvidia-dgx-1-(8x-v100-16G)) + * [Training stability test](#training-stability-test) + * [Training performance results](#training-performance-results) + * [Training performance: NVIDIA DGX-1 (8x V100 16G)](#training-performance-nvidia-dgx-1-(8x-v100-16G)) + * [Training performance: NVIDIA DGX-2 (16x V100 32G)](#training-performance-nvidia-dgx-2-(16x-v100-32G)) + * [Inference performance results](#inference-performance-results) + * [Inference performance: NVIDIA DGX-1 (8x V100 16G)](#inference-performance-nvidia-dgx-1-(8x-v100-16G)) + * [Inference performance: NVIDIA T4](#inference-performance-nvidia-t4) +- [Release notes](#release-notes) + * [Changelog](#changelog) + * [Known issues](#known-issues) + + +## Model overview The ResNet50 v1.5 model is a modified version of the [original ResNet50 v1 model](https://arxiv.org/abs/1512.03385). The difference between v1 and v1.5 is in the bottleneck blocks which require @@ -9,96 +49,448 @@ v1.5 has stride = 2 in the 3x3 convolution This difference makes ResNet50 v1.5 slightly more accurate (~0.5% top1) than v1, but comes with a small performance drawback (~5% imgs/sec). -## Training procedure +This model is trained with mixed precision using Tensor Cores on NVIDIA Volta and Turing GPUs. Therefore, researchers can get results 3.5x faster than training without Tensor Cores, while experiencing the benefits of mixed precision training. This model is tested against each NGC monthly container release to ensure consistent accuracy and performance over time. -### Optimizer +### Default configuration -This model trains for 90 epochs, with the standard ResNet v1.5 setup: +**Optimizer:** -* SGD with momentum (0.9) +* SGD with momentum (0.875) +* Learning rate = 0.256 for 256 batch size, for other batch sizes we lineary scale the learning rate. +* Learning rate schedule -- we use cosine LR schedule +* Linear warmup of the learning rate during first 5 epochs according to [Accurate, Large Minibatch SGD: Training ImageNet in 1 Hour](https://arxiv.org/abs/1706.02677). +* Weight decay: 3.0517578125e-05 (1/32768). +* We do not apply WD on Batch Norm trainable parameters (gamma/bias) +* Label Smoothing: 0.1 +* We train for: + * 50 Epochs -> configuration that reaches 75.9% top1 accuracy + * 90 Epochs -> 90 epochs is a standard for ResNet50 + * 250 Epochs -> best possible accuracy. For 250 epoch training we also use [MixUp regularization](https://arxiv.org/pdf/1710.09412.pdf). -* Learning rate = 0.1 for 256 batch size, for other batch sizes we linearly -scale the learning rate. +**Data augmentation:** -* Learning rate decay - multiply by 0.1 after 30, 60, and 80 epochs +This model uses the following data augmentation: -* Linear warmup of the learning rate during first 5 epochs -according to [Accurate, Large Minibatch SGD: Training ImageNet in 1 Hour](https://arxiv.org/abs/1706.02677). - -* Weight decay: 1e-4 - -### Data Augmentation - -During training, we perform the following augmentation techniques: +For training: * Normalization * Random resized crop to 224x224 -* Scale from 5% to 100% +* Scale from 8% to 100% * Aspect ratio from 3/4 to 4/3 * Random horizontal flip -During inference, we perform the following augmentation techniques: +For inference: * Normalization * Scale to 256x256 * Center crop to 224x224 -See `data.py` for more info. +### Feature support matrix -# Setup - -## Requirements - -Ensure your environment meets the following requirements: - -* [NVIDIA Docker](https://github.com/NVIDIA/nvidia-docker) -* [MXNet 18.12-py3 NGC container](https://ngc.nvidia.com/catalog/containers/nvidia%2Fmxnet) or newer -* [NVIDIA-DALI 0.5.0](https://github.com/NVIDIA/DALI) -- included in the MXNet container -* [Python 3.5](https://www.python.org) -- included in the MXNet container -* [CUDA 10](https://developer.nvidia.com/cuda-toolkit) -- included in the MXNet container -* [cuDNN 7.4.1](https://developer.nvidia.com/cudnn) -- included in the the MXNet container -* (optional) NVIDIA Volta or Turing GPU (see section below) -- for best training performance using FP16 - -For more information about how to get started with NGC containers, see the -following sections from the NVIDIA GPU Cloud Documentation and the Deep Learning Documentation: -* [Getting Started Using NVIDIA GPU Cloud](https://docs.nvidia.com/ngc/ngc-getting-started-guide/index.html) -* [Accessing And Pulling From The NGC Container Registry](https://docs.nvidia.com/deeplearning/dgx/user-guide/index.html#accessing_registry) -* [Running MXNet](https://docs.nvidia.com/deeplearning/dgx/mxnet-release-notes/running.html#running) - -## Training using mixed precision with Tensor Cores - -### Hardware requirements -Training with mixed precision on NVIDIA Tensor Cores, requires an NVIDIA Volta-based or Turing-based GPU. +| **Feature** | **ResNet50 MXNet** | +|:---:|:--------:| +|[DALI](https://docs.nvidia.com/deeplearning/sdk/dali-release-notes/index.html)|yes| +|Horovod Multi-GPU|yes| -### Software changes +#### Features +The following features are supported by this model. -For information about how to train using mixed precision, see the -[Mixed Precision Training paper](https://arxiv.org/abs/1710.03740) -and -[Training With Mixed Precision documentation](https://docs.nvidia.com/deeplearning/sdk/mixed-precision-training/index.html). +NVIDIA DALI - NVIDIA Data Loading Library (DALI) is a collection of highly optimized building blocks, and an execution engine, to accelerate the pre-processing of the input data for deep learning applications. DALI provides both the performance and the flexibility for accelerating different data pipelines as a single library. This single library can then be easily integrated into different deep learning training and inference applications. + +Horovod Multi-GPU - Horovod is a distributed training framework for TensorFlow, Keras, PyTorch and MXNet. The goal of Horovod is to make distributed deep learning fast and easy to use. For more information about how to get started with Horovod, see the [Horovod: Official repository](https://github.com/horovod/horovod). -# Quick start guide -## Docker +### Mixed precision training -To run docker MXNet container, run: +Mixed precision is the combined use of different numerical precisions in a computational method. [Mixed precision](https://arxiv.org/abs/1710.03740) training offers significant computational speedup by performing operations in half-precision format, while storing minimal information in single-precision to retain as much information as possible in critical parts of the network. Since the introduction of [Tensor Cores](https://developer.nvidia.com/tensor-cores) in the Volta and Turing architecture, significant training speedups are experienced by switching to mixed precision -- up to 3x overall speedup on the most arithmetically intense model architectures. Using mixed precision training requires two steps: +1. Porting the model to use the FP16 data type where appropriate. +2. Adding loss scaling to preserve small gradient values. -`nvidia-docker run --rm -it --ipc=host -v :/workspace/resnet50 -v :/data/imagenet/train-val-recordio-passthrough nvcr.io/nvidia/mxnet:18.12-py3` +The ability to train deep learning networks with lower precision was introduced in the Pascal architecture and first supported in [CUDA 8](https://devblogs.nvidia.com/parallelforall/tag/fp16/) in the NVIDIA Deep Learning SDK. -It will also automatically start downloading the MXNet container if you haven't downloaded it yet. You can also download it manually by running: +For information about: +- How to train using mixed precision, see the [Mixed Precision Training](https://arxiv.org/abs/1710.03740) paper and [Training With Mixed Precision](https://docs.nvidia.com/deeplearning/sdk/mixed-precision-training/index.html) documentation. +- Techniques used for mixed precision training, see the [Mixed-Precision Training of Deep Neural Networks](https://devblogs.nvidia.com/mixed-precision-training-deep-neural-networks/) blog. -`nvidia-docker pull nvcr.io/nvidia/mxnet:18.12-py3` -If you haven't prepared dataset yet (see section below), download raw ImageNet dataset (see section below), and run: -`nvidia-docker run --rm -it --ipc=host -v :/workspace/resnet50 -v :/data/imagenet/train-val-recordio-passthrough -v :/data/imagenet/raw nvcr.io/nvidia/mxnet:18.12-py3` +#### Enabling mixed precision +Using the Gluon API, ensure you perform the following steps to convert a model that supports computation with float16. -and follow step from Prepare Dataset section. +1. Cast Gluon Blockā€˜s parameters and expected input type to float16 by calling the cast method of the Block representing the network. + ```python + net = net.cast('float16') + ``` -## Prepare Dataset +2. Ensure the data input to the network is of float16 type. If your DataLoader or Iterator produces output in another datatype, then you have to cast your data. There are different ways you can do this. The easiest way is to use the `astype` method of NDArrays. + ```python + data = data.astype('float16', copy=False) + ``` + +3. If you are using images and DataLoader, you can also use a Cast transform. It is preferable to use multi_precision mode of optimizer when training in float16. This mode of optimizer maintains a master copy of the weights in float32 even when the training (forward and backward pass) is in float16. This helps increase precision of the weight updates and can lead to faster convergence in some scenarios. + ```python + optimizer = mx.optimizer.create('sgd', multi_precision=True, lr=0.01) + ``` + +## Setup +The following section lists the requirements in order to start training the ResNet50 v1.5 model. + +### Requirements + +This repository contains Dockerfile which extends the MXNet NGC container and encapsulates some dependencies. Aside from these dependencies, ensure you have the following components: +- [NVIDIA Docker](https://github.com/NVIDIA/nvidia-docker) +- [MXNet 19.07-py3 NGC container](https://ngc.nvidia.com/catalog/containers/nvidia%2Fmxnet) +- [NVIDIA Volta](https://www.nvidia.com/en-us/data-center/volta-gpu-architecture/) or [Turing](https://www.nvidia.com/en-us/geforce/turing/) based GPU + +For more information about how to get started with NGC containers, see the following sections from the NVIDIA GPU Cloud Documentation and the Deep Learning Documentation: +- [Getting Started Using NVIDIA GPU Cloud](https://docs.nvidia.com/ngc/ngc-getting-started-guide/index.html) +- [Accessing And Pulling From The NGC Container Registry](https://docs.nvidia.com/deeplearning/frameworks/user-guide/index.html#accessing_registry) +- [Running MXNet](https://docs.nvidia.com/deeplearning/dgx/mxnet-release-notes/running.html#running) + +For those unable to use the MXNet NGC container, to set up the required environment or create your own container, see the versioned [NVIDIA Container Support Matrix](https://docs.nvidia.com/deeplearning/frameworks/support-matrix/index.html). + + +## Quick Start Guide + +**1. Clone the repository.** +```bash +git clone https://github.com/NVIDIA/DeepLearningExamples +cd DeepLearningExamples/MxNet/Classification/RN50v1.5 +``` + +**2. Build the ResNet50 MXNet NGC container.** +After Docker is setup, you can build the ResNet50 image with: +```bash +docker build . -t nvidia_rn50_mx +``` + +**3. Start an interactive session in the NGC container to run preprocessing/training/inference.** +```bash +nvidia-docker run --rm -it --ipc=host :/data/imagenet/train-val-recordio-passthrough nvidia_rn50_mx +``` + +**4. Download and preprocess the data.** +* Download the images from http://image-net.org/download-images. +* Extract the training and validation data: + ```bash + mkdir train && mv ILSVRC2012_img_train.tar train/ && cd train + tar -xvf ILSVRC2012_img_train.tar && rm -f ILSVRC2012_img_train.tar + find . -name "*.tar" | while read NAME ; do mkdir -p "${NAME%.tar}"; tar -xvf "${NAME}" -C "${NAME%.tar}"; rm -f "${NAME}"; done + cd .. + ``` + +**5. Extract the validation data and move the images to subfolders.** +```bash +mkdir val && mv ILSVRC2012_img_val.tar val/ && cd val && tar -xvf ILSVRC2012_img_val.tar +wget -qO- https://raw.githubusercontent.com/soumith/imagenetloader.torch/master/valprep.sh | bash +``` + +**6. Preprocess the dataset.** +```bash +./scripts/prepare_imagenet.sh +``` + +**7. Start training.** +```bash +./runner -n -b +``` + +**8. Start validation/evaluation.** +```bash +./runner -n -b --load --mode val +``` + +**9. Start inference/predictions.** +```bash +./runner --load --mode pred --data-pred +``` + + +## Advanced + +The following sections provide greater details of the dataset, running training and inference, and the training results. + +### Scripts and sample code + +In the root directory, the most important files are: +* `runner`: A wrapper on the `train.py` script which is the main executable script for training/validation/predicting +* `benchmark.py`: A script for benchmarking +* `Dockerfile`: Container to build the container +* `fit.py`: A file containing most of the training and validation logic +* `data.py`: Data loading and preprocessing code +* `dali.py`: Data loading and preprocessing code using DALI +* `models.py`: The model architecture +* `report.py`: A file containing JSON report structure and description of fields + +In the `scripts` directory, the most important files are: +* `prepare_imagenet.sh`: A script that converts raw dataset format to RecordIO format + + + + +### Parameters + +The complete list of available parameters contains: +``` +Model: + --arch {resnetv1,resnetv15,resnextv1,resnextv15,xception} + model architecture (default: resnetv15) + --num-layers NUM_LAYERS + number of layers in the neural network, required by + some networks such as resnet (default: 50) + --num-groups NUM_GROUPS + number of groups for grouped convolutions, required by + some networks such as resnext (default: 32) + --num-classes NUM_CLASSES + the number of classes (default: 1000) + --batchnorm-eps BATCHNORM_EPS + the amount added to the batchnorm variance to prevent + output explosion. (default: 1e-05) + --batchnorm-mom BATCHNORM_MOM + the leaky-integrator factor controling the batchnorm + mean and variance. (default: 0.9) + --fuse-bn-relu FUSE_BN_RELU + have batchnorm kernel perform activation relu + (default: 0) + --fuse-bn-add-relu FUSE_BN_ADD_RELU + have batchnorm kernel perform add followed by + activation relu (default: 0) + +Training: + --mode {train_val,train,val,pred} + mode (default: train_val) + --seed SEED random seed (default: None) + -n NGPUS, --ngpus NGPUS + number of GPUs to use (default: 1) + --kv-store {device,horovod} + key-value store type (default: horovod) + --dtype {float32,float16} + Precision (default: float16) + --amp If enabled, turn on AMP (Automatic Mixed Precision) + (default: False) + -b BATCH_SIZE, --batch-size BATCH_SIZE + batch size per GPU (default: 192) + -e NUM_EPOCHS, --num-epochs NUM_EPOCHS + number of epochs (default: 90) + -l LR, --lr LR learning rate; IMPORTANT: true learning rate will be + calculated as `lr * batch_size / 256` (default: 0.256) + --lr-schedule {multistep,cosine} + learning rate schedule (default: cosine) + --lr-factor LR_FACTOR + the ratio to reduce lr on each step (default: 0.256) + --lr-steps LR_STEPS the epochs to reduce the lr, e.g. 30,60 (default: []) + --warmup-epochs WARMUP_EPOCHS + the epochs to ramp-up lr to scaled large-batch value + (default: 5) + --optimizer OPTIMIZER + the optimizer type (default: sgd) + --mom MOM momentum for sgd (default: 0.875) + --wd WD weight decay for sgd (default: 3.0517578125e-05) + --label-smoothing LABEL_SMOOTHING + label smoothing factor (default: 0.1) + --mixup MIXUP alpha parameter for mixup (if 0 then mixup is not + applied) (default: 0) + --disp-batches DISP_BATCHES + show progress for every n batches (default: 20) + --model-prefix MODEL_PREFIX + model checkpoint prefix (default: model) + --save-frequency SAVE_FREQUENCY + frequency of saving model in epochs (--model-prefix + must be specified). If -1 then save only best model. + If 0 then do not save anything. (default: -1) + --begin-epoch BEGIN_EPOCH + start the model from an epoch (default: 0) + --load LOAD checkpoint to load (default: None) + --test-io test reading speed without training (default: False) + --test-io-mode {train,val} + data to test (default: train) + --log LOG file where to save the log from the experiment + (default: log.log) + --report REPORT file where to save report (default: report.json) + --no-metrics do not calculate evaluation metrics (for benchmarking) + (default: False) + --benchmark-iters BENCHMARK_ITERS + run only benchmark-iters iterations from each epoch + (default: None) + +Data: + --data-root DATA_ROOT + Directory with RecordIO data files (default: + /data/imagenet/train-val-recordio-passthrough) + --data-backend {dali,mxnet,synthetic} + data backend (default: dali) + --image-shape IMAGE_SHAPE + the image shape feed into the network (default: [3, + 224, 224]) + --rgb-mean RGB_MEAN a tuple of size 3 for the mean rgb (default: [123.68, + 116.779, 103.939]) + --rgb-std RGB_STD a tuple of size 3 for the std rgb (default: [58.393, + 57.12, 57.375]) + --input-layout {NCHW,NHWC} + the layout of the input data (default: NCHW) + --conv-layout {NCHW,NHWC} + the layout of the data assumed by the conv operation + (default: NCHW) + --batchnorm-layout {NCHW,NHWC} + the layout of the data assumed by the batchnorm + operation (default: NCHW) + --pooling-layout {NCHW,NHWC} + the layout of the data assumed by the pooling + operation (default: NCHW) + --num-examples NUM_EXAMPLES + the number of training examples (doesn't work with + mxnet data backend) (default: 1281167) + --data-val-resize DATA_VAL_RESIZE + base length of shorter edge for validation dataset + (default: 256) + +DALI data backend: + entire group applies only to dali data backend + + --dali-separ-val each process will perform independent validation on + whole val-set (default: False) + --dali-threads DALI_THREADS + number of threadsper GPU for DALI (default: 3) + --dali-validation-threads DALI_VALIDATION_THREADS + number of threadsper GPU for DALI for validation + (default: 10) + --dali-prefetch-queue DALI_PREFETCH_QUEUE + DALI prefetch queue depth (default: 2) + --dali-nvjpeg-memory-padding DALI_NVJPEG_MEMORY_PADDING + Memory padding value for nvJPEG (in MB) (default: 64) + +MXNet data backend: + entire group applies only to mxnet data backend + + --data-mxnet-threads DATA_MXNET_THREADS + number of threads for data decoding for mxnet data + backend (default: 40) + --random-crop RANDOM_CROP + if or not randomly crop the image (default: 0) + --random-mirror RANDOM_MIRROR + if or not randomly flip horizontally (default: 1) + --max-random-h MAX_RANDOM_H + max change of hue, whose range is [0, 180] (default: + 0) + --max-random-s MAX_RANDOM_S + max change of saturation, whose range is [0, 255] + (default: 0) + --max-random-l MAX_RANDOM_L + max change of intensity, whose range is [0, 255] + (default: 0) + --min-random-aspect-ratio MIN_RANDOM_ASPECT_RATIO + min value of aspect ratio, whose value is either None + or a positive value. (default: 0.75) + --max-random-aspect-ratio MAX_RANDOM_ASPECT_RATIO + max value of aspect ratio. If min_random_aspect_ratio + is None, the aspect ratio range is + [1-max_random_aspect_ratio, + 1+max_random_aspect_ratio], otherwise it is + [min_random_aspect_ratio, max_random_aspect_ratio]. + (default: 1.33) + --max-random-rotate-angle MAX_RANDOM_ROTATE_ANGLE + max angle to rotate, whose range is [0, 360] (default: + 0) + --max-random-shear-ratio MAX_RANDOM_SHEAR_RATIO + max ratio to shear, whose range is [0, 1] (default: 0) + --max-random-scale MAX_RANDOM_SCALE + max ratio to scale (default: 1) + --min-random-scale MIN_RANDOM_SCALE + min ratio to scale, should >= img_size/input_shape. + otherwise use --pad-size (default: 1) + --max-random-area MAX_RANDOM_AREA + max area to crop in random resized crop, whose range + is [0, 1] (default: 1) + --min-random-area MIN_RANDOM_AREA + min area to crop in random resized crop, whose range + is [0, 1] (default: 0.05) + --min-crop-size MIN_CROP_SIZE + Crop both width and height into a random size in + [min_crop_size, max_crop_size] (default: -1) + --max-crop-size MAX_CROP_SIZE + Crop both width and height into a random size in + [min_crop_size, max_crop_size] (default: -1) + --brightness BRIGHTNESS + brightness jittering, whose range is [0, 1] (default: + 0) + --contrast CONTRAST contrast jittering, whose range is [0, 1] (default: 0) + --saturation SATURATION + saturation jittering, whose range is [0, 1] (default: + 0) + --pca-noise PCA_NOISE + pca noise, whose range is [0, 1] (default: 0) + --random-resized-crop RANDOM_RESIZED_CROP + whether to use random resized crop (default: 1) +``` + +### Command-line options + +To see the full list of available options and their descriptions, use the `-h` or `--help` command line option: `./runner --help` and `python train.py --help`. `./runner` acts as a wrapper on `train.py` and all additional flags will be passed to `train.py`. + +`./runner` command-line options: +``` +usage: runner [-h] [-n NGPUS] [-b BATCH_SIZE] [-e NUM_EPOCHS] [-l LR] + [--data-root DATA_ROOT] [--dtype {float32,float16}] + [--kv-store {device,horovod}] + [--data-backend {dali,mxnet,synthetic}] +``` + +`train.py` command-line options: +``` +usage: train.py [-h] + [--arch {resnetv1,resnetv15,resnextv1,resnextv15,xception}] + [--num-layers NUM_LAYERS] [--num-groups NUM_GROUPS] + [--num-classes NUM_CLASSES] [--batchnorm-eps BATCHNORM_EPS] + [--batchnorm-mom BATCHNORM_MOM] [--fuse-bn-relu FUSE_BN_RELU] + [--fuse-bn-add-relu FUSE_BN_ADD_RELU] + [--mode {train_val,train,val,pred}] [--seed SEED] + [--gpus GPUS] [--kv-store {device,horovod}] + [--dtype {float32,float16}] [--amp] [--batch-size BATCH_SIZE] + [--num-epochs NUM_EPOCHS] [--lr LR] + [--lr-schedule {multistep,cosine}] [--lr-factor LR_FACTOR] + [--lr-steps LR_STEPS] [--warmup-epochs WARMUP_EPOCHS] + [--optimizer OPTIMIZER] [--mom MOM] [--wd WD] + [--label-smoothing LABEL_SMOOTHING] [--mixup MIXUP] + [--disp-batches DISP_BATCHES] [--model-prefix MODEL_PREFIX] + [--save-frequency SAVE_FREQUENCY] [--begin-epoch BEGIN_EPOCH] + [--load LOAD] [--test-io] [--test-io-mode {train,val}] + [--log LOG] [--report REPORT] [--no-metrics] + [--benchmark-iters BENCHMARK_ITERS] [--data-train DATA_TRAIN] + [--data-train-idx DATA_TRAIN_IDX] [--data-val DATA_VAL] + [--data-val-idx DATA_VAL_IDX] [--data-pred DATA_PRED] + [--data-backend {dali,mxnet,synthetic}] + [--image-shape IMAGE_SHAPE] [--rgb-mean RGB_MEAN] + [--rgb-std RGB_STD] [--input-layout {NCHW,NHWC}] + [--conv-layout {NCHW,NHWC}] [--batchnorm-layout {NCHW,NHWC}] + [--pooling-layout {NCHW,NHWC}] [--num-examples NUM_EXAMPLES] + [--data-val-resize DATA_VAL_RESIZE] [--dali-separ-val] + [--dali-threads DALI_THREADS] + [--dali-validation-threads DALI_VALIDATION_THREADS] + [--dali-prefetch-queue DALI_PREFETCH_QUEUE] + [--dali-nvjpeg-memory-padding DALI_NVJPEG_MEMORY_PADDING] + [--data-mxnet-threads DATA_MXNET_THREADS] + [--random-crop RANDOM_CROP] [--random-mirror RANDOM_MIRROR] + [--max-random-h MAX_RANDOM_H] [--max-random-s MAX_RANDOM_S] + [--max-random-l MAX_RANDOM_L] + [--min-random-aspect-ratio MIN_RANDOM_ASPECT_RATIO] + [--max-random-aspect-ratio MAX_RANDOM_ASPECT_RATIO] + [--max-random-rotate-angle MAX_RANDOM_ROTATE_ANGLE] + [--max-random-shear-ratio MAX_RANDOM_SHEAR_RATIO] + [--max-random-scale MAX_RANDOM_SCALE] + [--min-random-scale MIN_RANDOM_SCALE] + [--max-random-area MAX_RANDOM_AREA] + [--min-random-area MIN_RANDOM_AREA] + [--min-crop-size MIN_CROP_SIZE] + [--max-crop-size MAX_CROP_SIZE] [--brightness BRIGHTNESS] + [--contrast CONTRAST] [--saturation SATURATION] + [--pca-noise PCA_NOISE] + [--random-resized-crop RANDOM_RESIZED_CROP] +``` + +### Getting the data The MXNet ResNet50 v1.5 script operates on ImageNet 1k, a widely popular image classification dataset from ILSVRC challenge. -You can download the images from http://image-net.org/download-images +You can download the images from http://image-net.org/download-images. The recommended data format is [RecordIO](http://mxnet.io/architecture/note_data_loading.html), which @@ -106,7 +498,7 @@ concatenates multiple examples into seekable binary files for better read efficiency. MXNet provides a tool called `im2rec.py` located in the `/opt/mxnet/tools/` directory. The tool converts individual images into `.rec` files. -To prepare RecordIO file containing ImageNet data, we first need to create .lst files +To prepare a RecordIO file containing ImageNet data, we first need to create `.lst` files which consist of the labels and image paths. We assume that the original images were downloaded to `/data/imagenet/raw/train-jpeg` and `/data/imagenet/raw/val-jpeg`. @@ -115,121 +507,216 @@ python /opt/mxnet/tools/im2rec.py --list --recursive train /data/imagenet/raw/tr python /opt/mxnet/tools/im2rec.py --list --recursive val /data/imagenet/raw/val-jpeg ``` -Then we generate the `.rec` (RecordIO files with data) and `.idx` (indexes required by DALI +Next, we generate the `.rec` (RecordIO files with data) and `.idx` (indexes required by DALI to speed up data loading) files. To obtain the best training accuracy -we do not preprocess the images when creating RecordIO file. +we do not preprocess the images when creating the RecordIO file. ```bash python /opt/mxnet/tools/im2rec.py --pass-through --num-thread 40 train /data/imagenet/raw/train-jpeg python /opt/mxnet/tools/im2rec.py --pass-through --num-thread 40 val /data/imagenet/raw/val-jpeg ``` -## Running training +#### Dataset guidelines +The process of loading, normalizing and augmenting the data contained in the dataset can be found in the `data.py` and `dali.py` files. -To run training for a standard configuration (1/4/8 GPUs, FP16/FP32), -run one of the scripts in the `./examples` directory -called `./examples/RN50_{FP16, FP32}_{1, 4, 8}GPU.sh`. -By default the training scripts run the validation and save checkpoint after each epoch. -Checkpoints will be stored in `model-symbol.json` and `model-.params` files. +The data is read from RecordIO format, which concatenates multiple examples into seekable binary files for better read efficiency. -If imagenet is mounted in the `/data/imagenet/train-val-recordio-passthrough` directory, you don't have to specify `--data-root` flag. +Data augmentation techniques are described in the [Default configuration](#default-configuration) section. -To run a non standard configuration use: +#### Multi-dataset -`./runner -n -b --data-root --dtype --model-prefix ` +In most cases, to train a model on a different dataset, no changes in the code are required, but the dataset has to be converted into RecordIO format. -Checkpoints will be stored in `-symbol.json` and `-.params` files. -To generate JSON report with performance and accuracy stats, use `--report ` flag (see `report.py` for info about JSON report file structure). -Use `./runner -h` and `python ./train.py -h` to obtain the list of available options. - -## Running inference - -To run inference on a checkpointed model run: -* For FP16 - `./examples/SCORE_FP16.sh ` -* For FP32 - `./examples/SCORE_FP32.sh ` +To convert a custom dataset, follow the steps from [Getting the data](#getting-the-data) section, and refer to the `scripts/prepare_dataset.py` script. -## Benchmark scripts +### Training process + +To start training, run: +`./runner -n -b --data-root --dtype ` + +By default the training script runs the validation after each epoch: +* the best checkpoint will be stored in the `model_best.params` file in the working directory +* the log from training will be saved in the `log.log` file in the working directory +* the JSON report with statistics will be saved in the `report.json` file in the working directory + +If ImageNet is mounted in the `/data/imagenet/train-val-recordio-passthrough` directory, you don't have to specify the `--data-root` flag. + +### Inference process + +To start validation, run: +`./runner -n -b --data-root --dtype --mode val` + +By default: +* the log from validation will be saved in the `log.log` file in the working directory +* the JSON report with statistics will be saved in the `report.json` file in the working directory + +## Performance + +### Benchmarking To benchmark training and inference, run: +`python benchmark.py -n -b --data-root --dtype -o ` -`python benchmark.py -n -b --data-root --dtype -o ` - -To control benchmark length per epoch, use `-i` flag (defaults to 100 iterations). -To control number of epochs, use `-e` flag. -To control number of warmup epochs (epochs which are not taken into account), use `-w` flag. -To limit length of dataset, use `--num-examples` flag. -To benchmark only inference, use `--only-inference` flag. +To control the benchmark length per epoch, use the `-i` flag (defaults to 100 iterations). +To control the number of epochs, use the `-e` flag. +To control the number of warmup epochs (epochs which are not taken into account), use the `-w` flag. +To limit the length of the dataset, use the `--num-examples` flag. By default, the same parameters as in `./runner` will be used. Additional flags will be passed to `./runner`. +#### Training performance benchmark +To benchmark only training, use the `--mode train` flag. -## Training accuracy results - -The following results were obtained by running the `./examples/RN50_{FP16, FP32}_{1, 4, 8}GPU.sh` scripts in the -mxnet-18.12-py3 Docker container on NVIDIA DGX-1 with 8 V100 16G GPUs. - -| **number of GPUs** | **FP16 top1** | **FP16 training time** | **FP32 top1** | **FP32 training time** | -|:------------------:|:-------------:|:----------------------:|:-------------:|:----------------------:| -| 1 | 76.424 | 22.9h | 76.462 | 82.0h | -| 4 | 76.328 | 6.2h | 76.448 | 21.1h | -| 8 | 76.490 | 3.3h | 76.668 | 11.1h | - -Here are example graphs of FP32 and FP16 training on 8 GPU configuration: - -![TrainingLoss](./img/training_loss.png) - -![TrainingAccuracy](./img/training_accuracy.png) - -![ValidationAccuracy](./img/validation_accuracy.png) +#### Inference performance benchmark +To benchmark only inference, use the `--mode val` flag. -## Training performance results +### Results + +The following sections provide details on how we achieved our performance and accuracy in training and inference. + +#### Training accuracy results + +##### Training accuracy: NVIDIA DGX-1 (8x V100 16G) + +90 epochs configuration +Our results were obtained by running the `./runner -n -b 96 --dtype float32` script for FP32 and the `./runner -n -b 192` script for mixed precision in the in the mxnet-19.07-py3 NGC container on NVIDIA DGX-1 with (8x V100 16G) GPUs. + on NVIDIA DGX-1 with (8x V100 16G) GPUs. + +| **GPUs** | **Accuracy - mixed precision** | **Accuracy - FP32** | **Time to train - mixed precision** | **Time to train - FP32** | **Time to train - speedup** | +|:---:|:---:|:---:|:---:|:---:|:---:| +|1|77.208|77.160|24.2|84.5|3.49| +|4|77.296|77.280|6.0|21.4|3.59| +|8|77.308|77.292|3.0|10.7|3.54| + +##### Training stability test + +Our results were obtained by running the following commands 8 times with different seeds. + +* For 50 epochs + * `./runner -n 8 -b 96 --dtype float32 --num-epochs 50` for FP32 + * `./runner -n 8 -b 192 --num-epochs 50` for mixed precision +* For 90 epochs + * `./runner -n 8 -b 96 --dtype float32` for FP32 + * `./runner -n 8 -b 192` for mixed precision +* For 250 epochs + * `./runner -n 8 -b 96 --dtype float32 --num-epochs 250 --mixup 0.2` for FP32 + * `./runner -n 8 -b 192 --num-epochs 250 --mixup 0.2` for mixed precision + +| **# of epochs** | **mixed precision avg top1** | **FP32 avg top1** | **mixed precision standard deviation** | **FP32 standard deviation** | **mixed precision minimum top1** | **FP32 minimum top1** | **mixed precision maximum top1** | **FP32 maximum top1** | +|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:| +|50|76.156|76.185|0.118|0.082|76.010|76.062|76.370|76.304| +|90|77.105|77.224|0.097|0.060|76.982|77.134|77.308|77.292| +|250|78.317|78.400|0.073|0.102|78.202|78.316|78.432|78.570| + + +Plots for 250 epoch configuration +Here are example graphs of FP32 and mixed precision training on 8 GPU 250 epochs configuration: + +![TrainingLoss](./img/dgx1-16g_250e_training_loss.png) + +![TrainingAccuracy](./img/dgx1-16g_250e_validation_top1.png) + +![ValidationAccuracy](./img/dgx1-16g_250e_validation_top5.png) + + +#### Training performance results + +##### Training performance: NVIDIA DGX-1 (8x V100 16G) + +The following results were obtained by running the +`python benchmark.py -n 1,2,4,8 -b 192 --dtype float16 -o benchmark_report_fp16.json -i 500 -e 3 -w 1 --num-examples 32000 --mode train` script for mixed precision and the +`python benchmark.py -n 1,2,4,8 -b 96 --dtype float32 -o benchmark_report_fp32.json -i 500 -e 3 -w 1 --num-examples 32000 --mode train` script for FP32 in the mxnet-19.07-py3 NGC container on NVIDIA DGX-1 with (8x V100 16G) GPUs. -The following results were obtained by running -`python benchmark.py -n 1,4,8 -b 208 --dtype float16 -o benchmark_report_fp16.json --data-root -i 100 -e 12 -w 4 --num-examples 25600` for FP16, and -`python benchmark.py -n 1,4,8 -b 96 --dtype float32 -o benchmark_report_fp32.json --data-root -i 100 -e 12 -w 4 --num-examples 12800` for FP32 -in the mxnet-18.12-py3 Docker container on NVIDIA DGX-1 with V100 16G GPUs. Training performance reported as Total IPS (data + compute time taken into account). Weak scaling is calculated as a ratio of speed for given number of GPUs to speed for 1 GPU. -| **number of GPUs** | **FP16 img/s** | **FP32 img/s** | **FP16 speedup** | **FP16 weak scaling** | **FP32 weak scaling** | -|:------------------:|:--------------:|:--------------:|:----------------:|:---------------------:|:---------------------:| -| 1 | 1442.6 | 400.2 | 3.60 | 1.00 | 1.00 | -| 4 | 5391.8 | 1558.6 | 3.46 | 3.74 | 3.89 | -| 8 | 10263.2 | 2957.4 | 3.47 | 7.11 | 7.39 | +| **GPUs** | **Throughput - mixed precision** | **Throughput - FP32** | **Throughput speedup (FP32 - mixed precision)** | **Weak scaling - mixed precision** | **Weak scaling - FP32** | +|:---:|:---:|:---:|:---:|:---:|:---:| +|1|1427|385|3.71|1.00|1.00| +|2|2820|768|3.67|1.98|2.00| +|4|5560|1513|3.68|3.90|3.93| +|8|10931|3023|3.62|7.66|7.86| +##### Training performance: NVIDIA DGX-2 (16x V100 32G) -## Inference performance results +The following results were obtained by running the +`python benchmark.py -n 1,4,8,16 -b 256 --dtype float16 -o benchmark_report_fp16.json -i 500 -e 3 -w 1 --num-examples 32000 --mode train` script for mixed precision and the +`python benchmark.py -n 1,4,8,16 -b 128 --dtype float32 -o benchmark_report_fp32.json -i 500 -e 3 -w 1 --num-examples 32000 --mode train` script for FP32 in the mxnet-19.07-py3 NGC container on NVIDIA DGX-1 with (8x V100 16G) GPUs. + +Training performance reported as Total IPS (data + compute time taken into account). +Weak scaling is calculated as a ratio of speed for given number of GPUs to speed for 1 GPU. + +| **GPUs** | **Throughput - mixed precision** | **Throughput - FP32** | **Throughput speedup (FP32 - mixed precision)** | **Weak scaling - mixed precision** | **Weak scaling - FP32** | +|:---:|:---:|:---:|:---:|:---:|:---:| +|1|1438|409|3.52|1.00|1.00| +|2|2868|817|3.51|1.99|2.00| +|4|5624|1617|3.48|3.91|3.96| +|8|11174|3214|3.48|7.77|7.86| +|16|20530|6356|3.23|14.28|15.54| + +#### Inference performance results + +##### Inference performance: NVIDIA DGX-1 (8x V100 16G) + +The following results were obtained by running the +`python benchmark.py -n 1 -b 1,2,4,8,16,32,64,128,192,256 --dtype float16 -o inferbenchmark_report_fp16.json -i 500 -e 3 -w 1 --mode val` script for mixed precision and the +`python benchmark.py -n 1 -b 1,2,4,8,16,32,64,128,192,256 --dtype float32 -o inferbenchmark_report_fp32.json -i 500 -e 3 -w 1 --mode val` script for FP32 in the mxnet-19.07-py3 NGC container on NVIDIA DGX-1 with (8x V100 16G) GPUs. -The following results were obtained by running -`python benchmark.py -n 1 -b 1,2,4,8,16,32,64,96,128,192,208 --dtype float16 -o inferbenchmark_report_fp16.json --data-root -i 200 -e 12 -w 4 --only-inference` for FP16, and -`python benchmark.py -n 1 -b 1,2,4,8,16,32,64,96 --dtype float32 -o inferbenchmark_report_fp32.json --data-root -i 200 -e 12 -w 4 --only-inference` for FP32 -in the mxnet-18.12-py3 Docker container on NVIDIA DGX-1 using one V100 16G GPU. Inference performance reported as Total IPS (data + compute time taken into account). -| **batch size** | **FP16 img/s** | **FP32 img/s** | -|:--------------:|:--------------:|:--------------:| -| 1 | 314 | 252 | -| 2 | 555 | 393 | -| 4 | 1024 | 601 | -| 8 | 1642 | 824 | -| 16 | 2144 | 1028 | -| 32 | 2954 | 1138 | -| 64 | 3428 | 1236 | -| 96 | 3546 | 1282 | -| 128 | 3690 | | -| 192 | 3828 | | -| 208 | 3832 | | +Reported mixed precision speedups are relative to FP32 numbers for corresponding configuration. +| **Batch size** | **Throughput (img/sec) - mixed precision** | **Throughput - speedup** | **Avg latency (ms) - mixed precision** | **Avg latency - speedup** | **50% latency (ms) - mixed precision** | **50% latency - speedup** | **90% latency (ms) - mixed precision** | **90% latency - speedup** | **95% latency (ms) - mixed precision** | **95% latency - speedup** | **99% latency (ms) - mixed precision** | **99% latency - speedup** | **100% latency (ms) - mixed precision** | **100% latency - speedup** | +|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:| +| 1 | 397 | 1.65 | 2.5 | 1.65 | 2.5 | 1.67 | 2.7 | 1.59 | 2.8 | 1.56 | 3.2 | 1.51 | 15.8 | 0.84 | +| 2 | 732 | 1.81 | 2.7 | 1.81 | 2.6 | 1.88 | 3.0 | 1.67 | 3.3 | 1.52 | 4.9 | 1.10 | 18.8 | 0.83 | +| 4 | 1269 | 2.08 | 3.2 | 2.08 | 3.0 | 2.21 | 3.5 | 1.92 | 4.0 | 1.72 | 7.5 | 0.97 | 14.5 | 0.54 | +| 8 | 2012 | 2.53 | 4.0 | 2.53 | 3.9 | 2.59 | 4.2 | 2.45 | 4.4 | 2.37 | 8.3 | 1.29 | 15.3 | 0.72 | +| 16 | 2667 | 2.64 | 6.0 | 2.64 | 5.9 | 2.66 | 6.3 | 2.54 | 6.4 | 2.52 | 8.3 | 2.02 | 16.9 | 1.05 | +| 32 | 3240 | 2.86 | 9.9 | 2.86 | 9.8 | 2.87 | 10.3 | 2.79 | 10.4 | 2.76 | 11.5 | 2.53 | 28.4 | 1.12 | +| 64 | 3776 | 3.10 | 17.0 | 3.10 | 17.0 | 3.09 | 17.5 | 3.03 | 17.7 | 3.01 | 18.1 | 3.01 | 18.7 | 2.99 | +| 128 | 3734 | 3.02 | 34.3 | 3.02 | 33.8 | 3.05 | 35.5 | 2.93 | 36.3 | 2.88 | 42.4 | 2.79 | 51.7 | 2.38 | +| 192 | 3641 | 2.90 | 52.7 | 2.90 | 52.4 | 2.90 | 55.2 | 2.77 | 56.2 | 2.74 | 65.4 | 2.76 | 77.1 | 2.41 | +| 256 | 3463 | 2.73 | 73.9 | 2.73 | 72.8 | 2.75 | 77.3 | 2.61 | 79.9 | 2.54 | 100.8 | 2.39 | 104.1 | 2.35 | -# Changelog +##### Inference performance: NVIDIA T4 -1. Dec 19, 2018 +The following results were obtained by running the +`python benchmark.py -n 1 -b 1,2,4,8,16,32,64,128,192,256 --dtype float16 -o inferbenchmark_report_fp16.json -i 500 -e 3 -w 1 --mode val` script for mixed precision and the +`python benchmark.py -n 1 -b 1,2,4,8,16,32,64,128,192,256 --dtype float32 -o inferbenchmark_report_fp32.json -i 500 -e 3 -w 1 --mode val` script for FP32 in the mxnet-19.07-py3 NGC container on an NVIDIA T4 GPU. + +Inference performance reported as Total IPS (data + compute time taken into account). + +Reported mixed precision speedups are relative to FP32 numbers for corresponding configuration. + +| **Batch size** | **Throughput (img/sec) - mixed precision** | **Throughput - speedup** | **Avg latency (ms) - mixed precision** | **Avg latency - speedup** | **50% latency (ms) - mixed precision** | **50% latency - speedup** | **90% latency (ms) - mixed precision** | **90% latency - speedup** | **95% latency (ms) - mixed precision** | **95% latency - speedup** | **99% latency (ms) - mixed precision** | **99% latency - speedup** | **100% latency (ms) - mixed precision** | **100% latency - speedup** | +|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:|:---:| +| 1 | 348 | 1.88 | 2.9 | 1.88 | 2.8 | 1.91 | 2.9 | 1.88 | 3.0 | 1.90 | 3.9 | 1.82 | 17.6 | 0.74 | +| 2 | 594 | 2.30 | 3.4 | 2.30 | 3.3 | 2.35 | 3.4 | 2.34 | 3.5 | 2.38 | 5.7 | 1.55 | 20.2 | 0.74 | +| 4 | 858 | 2.93 | 4.7 | 2.93 | 4.6 | 2.97 | 4.9 | 2.86 | 5.0 | 2.81 | 6.0 | 2.46 | 13.7 | 1.12 | +| 8 | 1047 | 3.17 | 7.6 | 3.17 | 7.6 | 3.19 | 7.9 | 3.10 | 8.2 | 3.02 | 9.1 | 2.77 | 15.0 | 1.72 | +| 16 | 1163 | 3.16 | 13.8 | 3.16 | 13.7 | 3.17 | 14.1 | 3.13 | 14.4 | 3.07 | 15.4 | 2.90 | 17.5 | 2.62 | +| 32 | 1225 | 3.22 | 26.1 | 3.22 | 26.1 | 3.22 | 27.0 | 3.15 | 27.3 | 3.12 | 28.3 | 3.05 | 30.5 | 2.89 | +| 64 | 1230 | 3.15 | 52.0 | 3.15 | 51.8 | 3.16 | 52.9 | 3.12 | 53.3 | 3.10 | 54.4 | 3.08 | 58.8 | 2.90 | +| 128 | 1260 | 3.21 | 101.6 | 3.21 | 101.3 | 3.22 | 102.7 | 3.21 | 103.2 | 3.20 | 115.0 | 2.89 | 121.8 | 2.86 | +| 192 | 1252 | 3.20 | 153.3 | 3.20 | 153.1 | 3.20 | 154.7 | 3.19 | 155.5 | 3.21 | 156.9 | 3.20 | 182.3 | 2.81 | +| 256 | 1251 | 3.22 | 204.6 | 3.22 | 204.3 | 3.23 | 206.4 | 3.21 | 207.1 | 3.21 | 209.3 | 3.18 | 241.9 | 2.76 | + +## Release notes + +### Changelog + +1. Dec, 2018 * Initial release (based on https://github.com/apache/incubator-mxnet/tree/master/example/image-classification) +2. June, 2019 + * Code refactor + * Label smoothing + * Cosine LR schedule + * MixUp regularization + * Better configurations -# Known Issues +### Known Issues There are no known issues with this model. diff --git a/MxNet/Classification/RN50v1.5/__init__.py b/MxNet/Classification/RN50v1.5/__init__.py deleted file mode 100644 index e69de29b..00000000 diff --git a/MxNet/Classification/RN50v1.5/benchmark.py b/MxNet/Classification/RN50v1.5/benchmark.py old mode 100644 new mode 100755 index 68471333..1bcc9b1e --- a/MxNet/Classification/RN50v1.5/benchmark.py +++ b/MxNet/Classification/RN50v1.5/benchmark.py @@ -1,3 +1,5 @@ +#!/usr/bin/env python3 + # Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); @@ -18,14 +20,21 @@ import sys import tempfile import json import os +import traceback +import numpy as np from collections import OrderedDict from subprocess import Popen -parser = argparse.ArgumentParser(description='Benchmark') +def int_list(x): + return list(map(int, x.split(','))) + +parser = argparse.ArgumentParser(description='Benchmark', + formatter_class=argparse.ArgumentDefaultsHelpFormatter) parser.add_argument('--executable', default='./runner', help='path to runner') -parser.add_argument('-n', '--ngpus', metavar='N1,[N2,...]', +parser.add_argument('-o', '--output', metavar='OUT', required=True, help="path to benchmark report") +parser.add_argument('-n', '--ngpus', metavar='N1,[N2,...]', type=int_list, required=True, help='numbers of gpus separated by comma') -parser.add_argument('-b', '--batch-sizes', metavar='B1,[B2,...]', +parser.add_argument('-b', '--batch-sizes', metavar='B1,[B2,...]', type=int_list, required=True, help='batch sizes separated by comma') parser.add_argument('-i', '--benchmark-iters', metavar='I', type=int, default=100, help='iterations') @@ -33,57 +42,83 @@ parser.add_argument('-e', '--epochs', metavar='E', type=int, default=1, help='number of epochs') parser.add_argument('-w', '--warmup', metavar='N', type=int, default=0, help='warmup epochs') -parser.add_argument('-o', '--output', metavar='OUT', required=True, help="path to benchmark report") -parser.add_argument('--only-inference', action='store_true', help="benchmark inference only") +parser.add_argument('--timeout', metavar='T', + type=str, default='inf', help='timeout for each run') +parser.add_argument('--mode', metavar='MODE', choices=('train_val', 'train', 'val'), default='train_val', + help="benchmark mode") args, other_args = parser.parse_known_args() -ngpus = list(map(int, args.ngpus.split(','))) -batch_sizes = list(map(int, args.batch_sizes.split(','))) - +latency_percentiles = ['avg', 50, 90, 95, 99, 100] +harmonic_mean_metrics = ['train.total_ips', 'val.total_ips'] res = OrderedDict() res['model'] = '' -res['ngpus'] = ngpus -res['bs'] = batch_sizes -if args.only_inference: - res['metric_keys'] = ['val.total_ips'] -else: - res['metric_keys'] = ['train.total_ips', 'val.total_ips'] +res['ngpus'] = args.ngpus +res['bs'] = args.batch_sizes +res['metric_keys'] = [] +if args.mode == 'train' or args.mode == 'train_val': + res['metric_keys'].append('train.total_ips') + for percentile in latency_percentiles: + res['metric_keys'].append('train.latency_{}'.format(percentile)) +if args.mode == 'val' or args.mode == 'train_val': + res['metric_keys'].append('val.total_ips') + for percentile in latency_percentiles: + res['metric_keys'].append('val.latency_{}'.format(percentile)) + res['metrics'] = OrderedDict() -for n in ngpus: +for n in args.ngpus: res['metrics'][str(n)] = OrderedDict() - for bs in batch_sizes: + for bs in args.batch_sizes: res['metrics'][str(n)][str(bs)] = OrderedDict() report_file = args.output + '-{},{}'.format(n, bs) - Popen([args.executable, '-n', str(n), '-b', str(bs), + Popen(['timeout', args.timeout, args.executable, '-n', str(n), '-b', str(bs), '--benchmark-iters', str(args.benchmark_iters), '-e', str(args.epochs), '--report', report_file, - *([] if not args.only_inference else ['--only-inference']), - '--no-metrics'] + other_args, stdout=sys.stderr).wait() + '--mode', args.mode, '--no-metrics'] + other_args, + stdout=sys.stderr).wait() - with open(report_file, 'r') as f: - report = json.load(f) + try: + for suffix in ['', *['-{}'.format(i) for i in range(1, n)]]: + try: + with open(report_file + suffix, 'r') as f: + report = json.load(f) + break + except FileNotFoundError: + pass + else: + with open(report_file, 'r') as f: + report = json.load(f) - for metric in res['metric_keys']: - data = report['metrics'][metric][args.warmup:] - avg = len(data) / sum(map(lambda x: 1 / x, data)) - res['metrics'][str(n)][str(bs)][metric] = avg + for metric in res['metric_keys']: + if len(report['metrics'][metric]) != args.epochs: + raise ValueError('Wrong number epochs in report') + data = report['metrics'][metric][args.warmup:] + if metric in harmonic_mean_metrics: + avg = len(data) / sum(map(lambda x: 1 / x, data)) + else: + avg = np.mean(data) + res['metrics'][str(n)][str(bs)][metric] = avg + except Exception as e: + traceback.print_exc() + + for metric in res['metric_keys']: + res['metrics'][str(n)][str(bs)][metric] = float('nan') -column_len = 7 +column_len = 11 for m in res['metric_keys']: print(m, file=sys.stderr) print(' ' * column_len, end='|', file=sys.stderr) - for bs in batch_sizes: + for bs in args.batch_sizes: print(str(bs).center(column_len), end='|', file=sys.stderr) print(file=sys.stderr) - print('-' * (len(batch_sizes) + 1) * (column_len + 1), file=sys.stderr) - for n in ngpus: + print('-' * (len(args.batch_sizes) + 1) * (column_len + 1), file=sys.stderr) + for n in args.ngpus: print(str(n).center(column_len), end='|', file=sys.stderr) - for bs in batch_sizes: - print(str(round(res['metrics'][str(n)][str(bs)][m])).center(column_len), end='|', file=sys.stderr) + for bs in args.batch_sizes: + print('{:.5g}'.format(res['metrics'][str(n)][str(bs)][m]).center(column_len), end='|', file=sys.stderr) print(file=sys.stderr) print(file=sys.stderr) diff --git a/MxNet/Classification/RN50v1.5/benchmarking.py b/MxNet/Classification/RN50v1.5/benchmarking.py index 2d40b36a..94ccc3e9 100644 --- a/MxNet/Classification/RN50v1.5/benchmarking.py +++ b/MxNet/Classification/RN50v1.5/benchmarking.py @@ -52,11 +52,14 @@ class BenchmarkingDataIter: def __getattr__(self, attr): return getattr(self.data_iter, attr) - def get_avg_time_and_clear(self): + def get_avg_time(self): if self.num <= 1: avg = float('nan') else: avg = self.overall_time / (self.num - 1) + return avg + + def reset(self): self.overall_time = 0 self.num = 0 - return avg + self.data_iter.reset() diff --git a/MxNet/Classification/RN50v1.5/dali.py b/MxNet/Classification/RN50v1.5/dali.py index f600491a..fbd047b9 100644 --- a/MxNet/Classification/RN50v1.5/dali.py +++ b/MxNet/Classification/RN50v1.5/dali.py @@ -18,146 +18,166 @@ from nvidia.dali.pipeline import Pipeline import nvidia.dali.ops as ops import nvidia.dali.types as types from nvidia.dali.plugin.mxnet import DALIClassificationIterator +import horovod.mxnet as hvd def add_dali_args(parser): - group = parser.add_argument_group('DALI', 'pipeline and augumentation') - group.add_argument('--use-dali', action='store_true', - help='use dalli pipeline and augunetation') - group.add_argument('--separ-val', action='store_true', + group = parser.add_argument_group('DALI data backend', 'entire group applies only to dali data backend') + group.add_argument('--dali-separ-val', action='store_true', help='each process will perform independent validation on whole val-set') group.add_argument('--dali-threads', type=int, default=3, help="number of threads" +\ "per GPU for DALI") - group.add_argument('--validation-dali-threads', type=int, default=10, help="number of threads" +\ + group.add_argument('--dali-validation-threads', type=int, default=10, help="number of threads" +\ "per GPU for DALI for validation") - group.add_argument('--dali-prefetch-queue', type=int, default=3, help="DALI prefetch queue depth") - group.add_argument('--dali-nvjpeg-memory-padding', type=int, default=16, help="Memory padding value for nvJPEG (in MB)") + group.add_argument('--dali-prefetch-queue', type=int, default=2, help="DALI prefetch queue depth") + group.add_argument('--dali-nvjpeg-memory-padding', type=int, default=64, help="Memory padding value for nvJPEG (in MB)") + group.add_argument('--dali-fuse-decoder', type=int, default=1, help="0 or 1 whether to fuse decoder or not") return parser -_mean_pixel = [255 * x for x in (0.485, 0.456, 0.406)] -_std_pixel = [255 * x for x in (0.229, 0.224, 0.225)] - class HybridTrainPipe(Pipeline): - def __init__(self, batch_size, num_threads, device_id, rec_path, idx_path, - shard_id, num_shards, crop_shape, - nvjpeg_padding, prefetch_queue=3, - output_layout=types.NCHW, pad_output=True, dtype='float16'): - super(HybridTrainPipe, self).__init__(batch_size, num_threads, device_id, seed = 12 + device_id, prefetch_queue_depth = prefetch_queue) - self.input = ops.MXNetReader(path = [rec_path], index_path=[idx_path], + def __init__(self, args, batch_size, num_threads, device_id, rec_path, idx_path, + shard_id, num_shards, crop_shape, nvjpeg_padding, prefetch_queue=3, + output_layout=types.NCHW, pad_output=True, dtype='float16', dali_cpu=False): + super(HybridTrainPipe, self).__init__(batch_size, num_threads, device_id, seed=12 + device_id, prefetch_queue_depth = prefetch_queue) + self.input = ops.MXNetReader(path=[rec_path], index_path=[idx_path], random_shuffle=True, shard_id=shard_id, num_shards=num_shards) - self.decode = ops.nvJPEGDecoder(device = "mixed", output_type = types.RGB, - device_memory_padding = nvjpeg_padding, - host_memory_padding = nvjpeg_padding) - self.rrc = ops.RandomResizedCrop(device = "gpu", size = crop_shape) - self.cmnp = ops.CropMirrorNormalize(device = "gpu", - output_dtype = types.FLOAT16 if dtype == 'float16' else types.FLOAT, - output_layout = output_layout, - crop = crop_shape, - pad_output = pad_output, - image_type = types.RGB, - mean = _mean_pixel, - std = _std_pixel) - self.coin = ops.CoinFlip(probability = 0.5) + if dali_cpu: + dali_device = "cpu" + if args.dali_fuse_decoder: + self.decode = ops.HostDecoderRandomCrop(device=dali_device, output_type=types.RGB) + else: + self.decode = ops.HostDecoder(device=dali_device, output_type=types.RGB) + else: + dali_device = "gpu" + if args.dali_fuse_decoder: + self.decode = ops.nvJPEGDecoderRandomCrop(device="mixed", output_type=types.RGB, + device_memory_padding=nvjpeg_padding, host_memory_padding=nvjpeg_padding) + else: + self.decode = ops.nvJPEGDecoder(device="mixed", output_type=types.RGB, + device_memory_padding=nvjpeg_padding, host_memory_padding=nvjpeg_padding) + + if args.dali_fuse_decoder: + self.resize = ops.Resize(device=dali_device, resize_x=crop_shape[1], resize_y=crop_shape[0]) + else: + self.resize = ops.RandomResizedCrop(device=dali_device, size=crop_shape) + + self.cmnp = ops.CropMirrorNormalize(device="gpu", + output_dtype=types.FLOAT16 if dtype == 'float16' else types.FLOAT, + output_layout=output_layout, crop=crop_shape, pad_output=pad_output, + image_type=types.RGB, mean=args.rgb_mean, std=args.rgb_std) + self.coin = ops.CoinFlip(probability=0.5) def define_graph(self): rng = self.coin() - self.jpegs, self.labels = self.input(name = "Reader") + self.jpegs, self.labels = self.input(name="Reader") images = self.decode(self.jpegs) - images = self.rrc(images) - output = self.cmnp(images, mirror = rng) + images = self.resize(images) + output = self.cmnp(images.gpu(), mirror=rng) return [output, self.labels] class HybridValPipe(Pipeline): - def __init__(self, batch_size, num_threads, device_id, rec_path, idx_path, - shard_id, num_shards, crop_shape, - nvjpeg_padding, prefetch_queue=3, - resize_shp=None, - output_layout=types.NCHW, pad_output=True, dtype='float16'): - super(HybridValPipe, self).__init__(batch_size, num_threads, device_id, seed = 12 + device_id, prefetch_queue_depth = prefetch_queue) - self.input = ops.MXNetReader(path = [rec_path], index_path=[idx_path], + def __init__(self, args, batch_size, num_threads, device_id, rec_path, idx_path, + shard_id, num_shards, crop_shape, nvjpeg_padding, prefetch_queue=3, resize_shp=None, + output_layout=types.NCHW, pad_output=True, dtype='float16', dali_cpu=False): + super(HybridValPipe, self).__init__(batch_size, num_threads, device_id, seed=12 + device_id, prefetch_queue_depth=prefetch_queue) + self.input = ops.MXNetReader(path=[rec_path], index_path=[idx_path], random_shuffle=False, shard_id=shard_id, num_shards=num_shards) - self.decode = ops.nvJPEGDecoder(device = "mixed", output_type = types.RGB, - device_memory_padding = nvjpeg_padding, - host_memory_padding = nvjpeg_padding) - self.resize = ops.Resize(device = "gpu", resize_shorter=resize_shp) if resize_shp else None - self.cmnp = ops.CropMirrorNormalize(device = "gpu", - output_dtype = types.FLOAT16 if dtype == 'float16' else types.FLOAT, - output_layout = output_layout, - crop = crop_shape, - pad_output = pad_output, - image_type = types.RGB, - mean = _mean_pixel, - std = _std_pixel) + + if dali_cpu: + dali_device = "cpu" + self.decode = ops.HostDecoder(device=dali_device, output_type=types.RGB) + else: + dali_device = "gpu" + self.decode = ops.nvJPEGDecoder(device="mixed", output_type=types.RGB, + device_memory_padding=nvjpeg_padding, + host_memory_padding=nvjpeg_padding) + self.resize = ops.Resize(device=dali_device, resize_shorter=resize_shp) if resize_shp else None + self.cmnp = ops.CropMirrorNormalize(device="gpu", + output_dtype=types.FLOAT16 if dtype == 'float16' else types.FLOAT, + output_layout=output_layout, crop=crop_shape, pad_output=pad_output, + image_type=types.RGB, mean=args.rgb_mean, std=args.rgb_std) def define_graph(self): - self.jpegs, self.labels = self.input(name = "Reader") + self.jpegs, self.labels = self.input(name="Reader") images = self.decode(self.jpegs) if self.resize: images = self.resize(images) - output = self.cmnp(images) + output = self.cmnp(images.gpu()) return [output, self.labels] -def get_rec_iter(args, kv=None): - # resize is default base length of shorter edge for dataset; - # all images will be reshaped to this size - resize = int(args.resize) - # target shape is final shape of images pipelined to network; - # all images will be cropped to this size - target_shape = tuple([int(l) for l in args.image_shape.split(',')]) - pad_output = target_shape[0] == 4 - gpus = list(map(int, filter(None, args.gpus.split(',')))) # filter to not encount eventually empty strings - batch_size = args.batch_size//len(gpus) +def get_rec_iter(args, kv=None, dali_cpu=False): + gpus = args.gpus num_threads = args.dali_threads - num_validation_threads = args.validation_dali_threads - #db_folder = "/data/imagenet/train-480-val-256-recordio/" + num_validation_threads = args.dali_validation_threads + pad_output = (args.image_shape[0] == 4) # the input_layout w.r.t. the model is the output_layout of the image pipeline output_layout = types.NHWC if args.input_layout == 'NHWC' else types.NCHW - rank = kv.rank if kv else 0 - nWrk = kv.num_workers if kv else 1 + if 'horovod' in args.kv_store: + rank = hvd.rank() + nWrk = hvd.size() + else: + rank = kv.rank if kv else 0 + nWrk = kv.num_workers if kv else 1 - trainpipes = [HybridTrainPipe(batch_size = batch_size, + batch_size = args.batch_size // nWrk // len(gpus) + + trainpipes = [HybridTrainPipe(args = args, + batch_size = batch_size, num_threads = num_threads, device_id = gpu_id, rec_path = args.data_train, idx_path = args.data_train_idx, shard_id = gpus.index(gpu_id) + len(gpus)*rank, num_shards = len(gpus)*nWrk, - crop_shape = target_shape[1:], + crop_shape = args.image_shape[1:], output_layout = output_layout, - pad_output = pad_output, dtype = args.dtype, + pad_output = pad_output, + dali_cpu = dali_cpu, nvjpeg_padding = args.dali_nvjpeg_memory_padding * 1024 * 1024, prefetch_queue = args.dali_prefetch_queue) for gpu_id in gpus] - valpipes = [HybridValPipe(batch_size = batch_size, - num_threads = num_validation_threads, - device_id = gpu_id, - rec_path = args.data_val, - idx_path = args.data_val_idx, - shard_id = 0 if args.separ_val - else gpus.index(gpu_id) + len(gpus)*rank, - num_shards = 1 if args.separ_val else len(gpus)*nWrk, - crop_shape = target_shape[1:], - resize_shp = resize, - output_layout = output_layout, - pad_output = pad_output, - dtype = args.dtype, - nvjpeg_padding = args.dali_nvjpeg_memory_padding * 1024 * 1024, - prefetch_queue = args.dali_prefetch_queue) for gpu_id in gpus] if args.data_val else None + if args.data_val: + valpipes = [HybridValPipe(args = args, + batch_size = batch_size, + num_threads = num_validation_threads, + device_id = gpu_id, + rec_path = args.data_val, + idx_path = args.data_val_idx, + shard_id = 0 if args.dali_separ_val + else gpus.index(gpu_id) + len(gpus)*rank, + num_shards = 1 if args.dali_separ_val else len(gpus)*nWrk, + crop_shape = args.image_shape[1:], + resize_shp = args.data_val_resize, + output_layout = output_layout, + dtype = args.dtype, + pad_output = pad_output, + dali_cpu = dali_cpu, + nvjpeg_padding = args.dali_nvjpeg_memory_padding * 1024 * 1024, + prefetch_queue = args.dali_prefetch_queue) for gpu_id in gpus] if args.data_val else None trainpipes[0].build() if args.data_val: valpipes[0].build() + worker_val_examples = valpipes[0].epoch_size("Reader") + if not args.dali_separ_val: + worker_val_examples = worker_val_examples // nWrk + if rank < valpipes[0].epoch_size("Reader") % nWrk: + worker_val_examples += 1 if args.num_examples < trainpipes[0].epoch_size("Reader"): warnings.warn("{} training examples will be used, although full training set contains {} examples".format(args.num_examples, trainpipes[0].epoch_size("Reader"))) dali_train_iter = DALIClassificationIterator(trainpipes, args.num_examples // nWrk) - dali_val_iter = DALIClassificationIterator(valpipes, valpipes[0].epoch_size("Reader") // (1 if args.separ_val else nWrk), fill_last_batch = False) if args.data_val else None - return dali_train_iter, dali_val_iter + if args.data_val: + dali_val_iter = DALIClassificationIterator(valpipes, worker_val_examples, fill_last_batch = False) if args.data_val else None + else: + dali_val_iter = None + + return dali_train_iter, dali_val_iter diff --git a/MxNet/Classification/RN50v1.5/data.py b/MxNet/Classification/RN50v1.5/data.py index f3fd7812..36d3d3c0 100644 --- a/MxNet/Classification/RN50v1.5/data.py +++ b/MxNet/Classification/RN50v1.5/data.py @@ -1,7 +1,5 @@ -# ----------------------------------------------------------------------- # Copyright 2017-2018 The Apache Software Foundation # -# # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information @@ -36,128 +34,61 @@ # limitations under the License. import mxnet as mx +import mxnet.ndarray as nd import random import argparse from mxnet.io import DataBatch, DataIter import numpy as np +import horovod.mxnet as hvd + +import dali def add_data_args(parser): - data = parser.add_argument_group('Data', 'the input images') + def float_list(x): + return list(map(float, x.split(','))) + def int_list(x): + return list(map(int, x.split(','))) + + data = parser.add_argument_group('Data') data.add_argument('--data-train', type=str, help='the training data') data.add_argument('--data-train-idx', type=str, default='', help='the index of training data') data.add_argument('--data-val', type=str, help='the validation data') data.add_argument('--data-val-idx', type=str, default='', help='the index of validation data') - data.add_argument('--rgb-mean', type=str, default='123.68,116.779,103.939', + data.add_argument('--data-pred', type=str, help='the image on which run inference (only for pred mode)') + + data.add_argument('--data-backend', choices=('dali-gpu', 'dali-cpu', 'mxnet', 'synthetic'), default='dali-gpu', + help='set data loading & augmentation backend') + data.add_argument('--image-shape', type=int_list, default=[3, 224, 224], + help='the image shape feed into the network') + data.add_argument('--rgb-mean', type=float_list, default=[123.68, 116.779, 103.939], help='a tuple of size 3 for the mean rgb') - data.add_argument('--rgb-std', type=str, default='1,1,1', + data.add_argument('--rgb-std', type=float_list, default=[58.393, 57.12, 57.375], help='a tuple of size 3 for the std rgb') - data.add_argument('--pad-size', type=int, default=0, - help='padding the input image') - data.add_argument('--fill-value', type=int, default=127, - help='Set the padding pixels value to fill_value') - data.add_argument('--image-shape', type=str, - help='the image shape feed into the network, e.g. (3,224,224)') - data.add_argument('--num-classes', type=int, help='the number of classes') - data.add_argument('--num-examples', type=int, help='the number of training examples') - data.add_argument('--data-nthreads', type=int, default=4, - help='number of threads for data decoding') - data.add_argument('--benchmark-iters', type=int, default=None, - help='run only benchmark-iters iterations from each epoch') - data.add_argument('--input-layout', type=str, default='NCHW', - help='the layout of the input data (e.g. NCHW)') - data.add_argument('--conv-layout', type=str, default='NCHW', - help='the layout of the data assumed by the conv operation (e.g. NCHW)') - data.add_argument('--conv-algo', type=int, default=-1, - help='set the convolution algos (fwd, dgrad, wgrad)') - data.add_argument('--batchnorm-layout', type=str, default='NCHW', - help='the layout of the data assumed by the batchnorm operation (e.g. NCHW)') - data.add_argument('--batchnorm-eps', type=float, default=2e-5, - help='the amount added to the batchnorm variance to prevent output explosion.') - data.add_argument('--batchnorm-mom', type=float, default=0.9, - help='the leaky-integrator factor controling the batchnorm mean and variance.') - data.add_argument('--pooling-layout', type=str, default='NCHW', - help='the layout of the data assumed by the pooling operation (e.g. NCHW)') - data.add_argument('--verbose', type=int, default=0, - help='turn on reporting of chosen algos for convolution, etc.') - data.add_argument('--seed', type=int, default=None, - help='set the seed for python, nd and mxnet rngs') - data.add_argument('--custom-bn-off', type=int, default=0, - help='disable use of custom batchnorm kernel') - data.add_argument('--fuse-bn-relu', type=int, default=0, - help='have batchnorm kernel perform activation relu') - data.add_argument('--fuse-bn-add-relu', type=int, default=0, - help='have batchnorm kernel perform add followed by activation relu') - data.add_argument('--force-tensor-core', type=int, default=0, - help='require conv algos to be tensor core') + + data.add_argument('--input-layout', type=str, default='NCHW', choices=('NCHW', 'NHWC'), + help='the layout of the input data') + data.add_argument('--conv-layout', type=str, default='NCHW', choices=('NCHW', 'NHWC'), + help='the layout of the data assumed by the conv operation') + data.add_argument('--batchnorm-layout', type=str, default='NCHW', choices=('NCHW', 'NHWC'), + help='the layout of the data assumed by the batchnorm operation') + data.add_argument('--pooling-layout', type=str, default='NCHW', choices=('NCHW', 'NHWC'), + help='the layout of the data assumed by the pooling operation') + + data.add_argument('--num-examples', type=int, default=1281167, + help="the number of training examples (doesn't work with mxnet data backend)") + data.add_argument('--data-val-resize', type=int, default=256, + help='base length of shorter edge for validation dataset') + return data -# Action to translate --set-resnet-aug flag to its component settings. -class SetResnetAugAction(argparse.Action): - def __init__(self, nargs=0, **kwargs): - if nargs != 0: - raise ValueError('nargs for SetResnetAug must be 0.') - super(SetResnetAugAction, self).__init__(nargs=nargs, **kwargs) - def __call__(self, parser, namespace, values, option_string=None): - # standard data augmentation setting for resnet training - setattr(namespace, 'random_crop', 1) - setattr(namespace, 'random_resized_crop', 1) - setattr(namespace, 'random_mirror', 1) - setattr(namespace, 'min_random_area', 0.08) - setattr(namespace, 'max_random_aspect_ratio', 4./3.) - setattr(namespace, 'min_random_aspect_ratio', 3./4.) - setattr(namespace, 'brightness', 0.4) - setattr(namespace, 'contrast', 0.4) - setattr(namespace, 'saturation', 0.4) - setattr(namespace, 'pca_noise', 0.1) - # record that this --set-resnet-aug 'macro arg' has been invoked - setattr(namespace, self.dest, 1) - -# Similar to the above, but suitable for calling within a training script to set the defaults. -def set_resnet_aug(aug): - # standard data augmentation setting for resnet training - aug.set_defaults(random_crop=0, random_resized_crop=1) - aug.set_defaults(random_mirror=1) - aug.set_defaults(min_random_area=0.08) - aug.set_defaults(max_random_aspect_ratio=4./3., min_random_aspect_ratio=3./4.) - aug.set_defaults(brightness=0.4, contrast=0.4, saturation=0.4, pca_noise=0.1) - -# Action to translate --set-data-aug-level arg to its component settings. -class SetDataAugLevelAction(argparse.Action): - def __init__(self, option_strings, dest, nargs=None, **kwargs): - if nargs is not None: - raise ValueError("nargs not allowed") - super(SetDataAugLevelAction, self).__init__(option_strings, dest, **kwargs) - def __call__(self, parser, namespace, values, option_string=None): - level = values - # record that this --set-data-aug-level 'macro arg' has been invoked - setattr(namespace, self.dest, level) - if level >= 1: - setattr(namespace, 'random_crop', 1) - setattr(namespace, 'random_mirror', 1) - if level >= 2: - setattr(namespace, 'max_random_h', 36) - setattr(namespace, 'max_random_s', 50) - setattr(namespace, 'max_random_l', 50) - if level >= 3: - setattr(namespace, 'max_random_rotate_angle', 10) - setattr(namespace, 'max_random_shear_ratio', 0.1) - setattr(namespace, 'max_random_aspect_ratio', 0.25) - -# Similar to the above, but suitable for calling within a training script to set the defaults. -def set_data_aug_level(aug, level): - if level >= 1: - aug.set_defaults(random_crop=1, random_mirror=1) - if level >= 2: - aug.set_defaults(max_random_h=36, max_random_s=50, max_random_l=50) - if level >= 3: - aug.set_defaults(max_random_rotate_angle=10, max_random_shear_ratio=0.1, max_random_aspect_ratio=0.25) - def add_data_aug_args(parser): aug = parser.add_argument_group( - 'Image augmentations', 'implemented in src/io/image_aug_default.cc') + 'MXNet data backend', 'entire group applies only to mxnet data backend') + aug.add_argument('--data-mxnet-threads', type=int, default=40, + help='number of threads for data decoding for mxnet data backend') aug.add_argument('--random-crop', type=int, default=0, help='if or not randomly crop the image') - aug.add_argument('--random-mirror', type=int, default=0, + aug.add_argument('--random-mirror', type=int, default=1, help='if or not randomly flip horizontally') aug.add_argument('--max-random-h', type=int, default=0, help='max change of hue, whose range is [0, 180]') @@ -165,9 +96,9 @@ def add_data_aug_args(parser): help='max change of saturation, whose range is [0, 255]') aug.add_argument('--max-random-l', type=int, default=0, help='max change of intensity, whose range is [0, 255]') - aug.add_argument('--min-random-aspect-ratio', type=float, default=None, + aug.add_argument('--min-random-aspect-ratio', type=float, default=0.75, help='min value of aspect ratio, whose value is either None or a positive value.') - aug.add_argument('--max-random-aspect-ratio', type=float, default=0, + aug.add_argument('--max-random-aspect-ratio', type=float, default=1.33, help='max value of aspect ratio. If min_random_aspect_ratio is None, ' 'the aspect ratio range is [1-max_random_aspect_ratio, ' '1+max_random_aspect_ratio], otherwise it is ' @@ -183,7 +114,7 @@ def add_data_aug_args(parser): 'otherwise use --pad-size') aug.add_argument('--max-random-area', type=float, default=1, help='max area to crop in random resized crop, whose range is [0, 1]') - aug.add_argument('--min-random-area', type=float, default=1, + aug.add_argument('--min-random-area', type=float, default=0.05, help='min area to crop in random resized crop, whose range is [0, 1]') aug.add_argument('--min-crop-size', type=int, default=-1, help='Crop both width and height into a random size in ' @@ -199,87 +130,200 @@ def add_data_aug_args(parser): help='saturation jittering, whose range is [0, 1]') aug.add_argument('--pca-noise', type=float, default=0, help='pca noise, whose range is [0, 1]') - aug.add_argument('--random-resized-crop', type=int, default=0, + aug.add_argument('--random-resized-crop', type=int, default=1, help='whether to use random resized crop') - aug.add_argument('--set-resnet-aug', action=SetResnetAugAction, - help='whether to employ standard resnet augmentations (see data.py)') - aug.add_argument('--set-data-aug-level', type=int, default=None, action=SetDataAugLevelAction, - help='set multiple data augmentations based on a `level` (see data.py)') return aug +def get_data_loader(args): + if args.data_backend == 'dali-gpu': + return (lambda *args, **kwargs: dali.get_rec_iter(*args, **kwargs, dali_cpu=False)) + if args.data_backend == 'dali-cpu': + return (lambda *args, **kwargs: dali.get_rec_iter(*args, **kwargs, dali_cpu=True)) + if args.data_backend == 'synthetic': + return get_synthetic_rec_iter + if args.data_backend == 'mxnet': + return get_rec_iter + raise ValueError('Wrong data backend') + +class DataGPUSplit: + def __init__(self, dataloader, ctx, dtype): + self.dataloader = dataloader + self.ctx = ctx + self.dtype = dtype + self.batch_size = dataloader.batch_size // len(ctx) + self._num_gpus = len(ctx) + + def __iter__(self): + return DataGPUSplit(iter(self.dataloader), self.ctx, self.dtype) + + def __next__(self): + data = next(self.dataloader) + ret = [] + for i in range(len(self.ctx)): + start = i * len(data.data[0]) // len(self.ctx) + end = (i + 1) * len(data.data[0]) // len(self.ctx) + pad = max(0, min(data.pad - (len(self.ctx) - i - 1) * self.batch_size, self.batch_size)) + ret.append(mx.io.DataBatch( + [data.data[0][start:end].as_in_context(self.ctx[i]).astype(self.dtype)], + [data.label[0][start:end].as_in_context(self.ctx[i])], + pad=pad)) + return ret + + def next(self): + return next(self) + + def reset(self): + self.dataloader.reset() + def get_rec_iter(args, kv=None): - image_shape = tuple([int(l) for l in args.image_shape.split(',')]) - if args.input_layout == 'NHWC': - image_shape = image_shape[1:] + (image_shape[0],) - if kv: - (rank, nworker) = (kv.rank, kv.num_workers) + gpus = args.gpus + if 'horovod' in args.kv_store: + rank = hvd.rank() + nworker = hvd.size() + gpus = [gpus[0]] + batch_size = args.batch_size // hvd.size() else: - (rank, nworker) = (0, 1) - rgb_mean = [float(i) for i in args.rgb_mean.split(',')] - rgb_std = [float(i) for i in args.rgb_std.split(',')] + rank = kv.rank if kv else 0 + nworker = kv.num_workers if kv else 1 + batch_size = args.batch_size + if args.input_layout == 'NHWC': raise ValueError('ImageRecordIter cannot handle layout {}'.format(args.input_layout)) - train = mx.io.ImageRecordIter( - path_imgrec = args.data_train, - path_imgidx = args.data_train_idx, - label_width = 1, - mean_r = rgb_mean[0], - mean_g = rgb_mean[1], - mean_b = rgb_mean[2], - std_r = rgb_std[0], - std_g = rgb_std[1], - std_b = rgb_std[2], - data_name = 'data', - label_name = 'softmax_label', - data_shape = image_shape, - batch_size = args.batch_size, - rand_crop = args.random_crop, - max_random_scale = args.max_random_scale, - pad = args.pad_size, - fill_value = args.fill_value, - random_resized_crop = args.random_resized_crop, - min_random_scale = args.min_random_scale, - max_aspect_ratio = args.max_random_aspect_ratio, - min_aspect_ratio = args.min_random_aspect_ratio, - max_random_area = args.max_random_area, - min_random_area = args.min_random_area, - min_crop_size = args.min_crop_size, - max_crop_size = args.max_crop_size, - brightness = args.brightness, - contrast = args.contrast, - saturation = args.saturation, - pca_noise = args.pca_noise, - random_h = args.max_random_h, - random_s = args.max_random_s, - random_l = args.max_random_l, - max_rotate_angle = args.max_random_rotate_angle, - max_shear_ratio = args.max_random_shear_ratio, - rand_mirror = args.random_mirror, - preprocess_threads = args.data_nthreads, - shuffle = True, - num_parts = nworker, - part_index = rank) + + train = DataGPUSplit(mx.io.ImageRecordIter( + path_imgrec = args.data_train, + path_imgidx = args.data_train_idx, + label_width = 1, + mean_r = args.rgb_mean[0], + mean_g = args.rgb_mean[1], + mean_b = args.rgb_mean[2], + std_r = args.rgb_std[0], + std_g = args.rgb_std[1], + std_b = args.rgb_std[2], + data_name = 'data', + label_name = 'softmax_label', + data_shape = args.image_shape, + batch_size = batch_size, + rand_crop = args.random_crop, + max_random_scale = args.max_random_scale, + random_resized_crop = args.random_resized_crop, + min_random_scale = args.min_random_scale, + max_aspect_ratio = args.max_random_aspect_ratio, + min_aspect_ratio = args.min_random_aspect_ratio, + max_random_area = args.max_random_area, + min_random_area = args.min_random_area, + min_crop_size = args.min_crop_size, + max_crop_size = args.max_crop_size, + brightness = args.brightness, + contrast = args.contrast, + saturation = args.saturation, + pca_noise = args.pca_noise, + random_h = args.max_random_h, + random_s = args.max_random_s, + random_l = args.max_random_l, + max_rotate_angle = args.max_random_rotate_angle, + max_shear_ratio = args.max_random_shear_ratio, + rand_mirror = args.random_mirror, + preprocess_threads = args.data_mxnet_threads, + shuffle = True, + num_parts = nworker, + part_index = rank, + seed = args.seed or '0', + ), [mx.gpu(gpu) for gpu in gpus], args.dtype) if args.data_val is None: return (train, None) - val = mx.io.ImageRecordIter( - path_imgrec = args.data_val, - path_imgidx = args.data_val_idx, - label_width = 1, - mean_r = rgb_mean[0], - mean_g = rgb_mean[1], - mean_b = rgb_mean[2], - std_r = rgb_std[0], - std_g = rgb_std[1], - std_b = rgb_std[2], - data_name = 'data', - label_name = 'softmax_label', - batch_size = args.batch_size, - round_batch = False, - data_shape = image_shape, - preprocess_threads = args.data_nthreads, - rand_crop = False, - rand_mirror = False, - num_parts = nworker, - part_index = rank) + val = DataGPUSplit(mx.io.ImageRecordIter( + path_imgrec = args.data_val, + path_imgidx = args.data_val_idx, + label_width = 1, + mean_r = args.rgb_mean[0], + mean_g = args.rgb_mean[1], + mean_b = args.rgb_mean[2], + std_r = args.rgb_std[0], + std_g = args.rgb_std[1], + std_b = args.rgb_std[2], + data_name = 'data', + label_name = 'softmax_label', + batch_size = batch_size, + round_batch = False, + data_shape = args.image_shape, + preprocess_threads = args.data_mxnet_threads, + rand_crop = False, + rand_mirror = False, + num_parts = nworker, + part_index = rank, + resize = args.data_val_resize, + ), [mx.gpu(gpu) for gpu in gpus], args.dtype) return (train, val) + + +class SyntheticDataIter(DataIter): + def __init__(self, num_classes, data_shape, max_iter, ctx, dtype): + self.batch_size = data_shape[0] + self.cur_iter = 0 + self.max_iter = max_iter + self.dtype = dtype + label = np.random.randint(0, num_classes, [self.batch_size,]) + data = np.random.uniform(-1, 1, data_shape) + self.data = [] + self.label = [] + self._num_gpus = len(ctx) + for dev in ctx: + self.data.append(mx.nd.array(data, dtype=self.dtype, ctx=dev)) + self.label.append(mx.nd.array(label, dtype=self.dtype, ctx=dev)) + + def __iter__(self): + return self + + def next(self): + self.cur_iter += 1 + if self.cur_iter <= self.max_iter: + return [DataBatch(data=(data,), label=(label,), pad=0) for data, label in zip(self.data, self.label)] + else: + raise StopIteration + + def __next__(self): + return self.next() + + def reset(self): + self.cur_iter = 0 + +def get_synthetic_rec_iter(args, kv=None): + gpus = args.gpus + if 'horovod' in args.kv_store: + gpus = [gpus[0]] + batch_size = args.batch_size // hvd.size() + else: + batch_size = args.batch_size + + if args.input_layout == 'NCHW': + data_shape = (batch_size, *args.image_shape) + elif args.input_layout == 'NHWC': + data_shape = (batch_size, *args.image_shape[1:], args.image_shape[0]) + else: + raise ValueError('Wrong input layout') + + train = SyntheticDataIter(args.num_classes, data_shape, + args.num_examples // args.batch_size, + [mx.gpu(gpu) for gpu in gpus], args.dtype) + if args.data_val is None: + return (train, None) + + val = SyntheticDataIter(args.num_classes, data_shape, + args.num_examples // args.batch_size, + [mx.gpu(gpu) for gpu in gpus], args.dtype) + return (train, val) + +def load_image(args, path, ctx=mx.cpu()): + image = mx.image.imread(path).astype('float32') + image = mx.image.imresize(image, *args.image_shape[1:]) + image = (image - nd.array(args.rgb_mean)) / nd.array(args.rgb_std) + image = image.as_in_context(ctx) + if args.input_layout == 'NCHW': + image = image.transpose((2, 0, 1)) + image = image.astype(args.dtype) + if args.image_shape[0] == 4: + dim = 0 if args.input_layout == 'NCHW' else 2 + image = nd.concat(image, nd.zeros((1, *image.shape[1:]), dtype=image.dtype, ctx=image.context), dim=dim) + return image diff --git a/MxNet/Classification/RN50v1.5/examples/BENCHMARK_FP16.sh b/MxNet/Classification/RN50v1.5/examples/BENCHMARK_FP16.sh deleted file mode 100644 index 797b7e36..00000000 --- a/MxNet/Classification/RN50v1.5/examples/BENCHMARK_FP16.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 benchmark in FP16 on 1,4,8 GPUs with 64,128,192,208 batch size -# Usage ./BENCHMARK_FP16.sh - -python benchmark.py -n 1,4,8 -b 64,128,192,208 -e 2 -w 1 -i 100 -o report.json $@ diff --git a/MxNet/Classification/RN50v1.5/examples/BENCHMARK_FP32.sh b/MxNet/Classification/RN50v1.5/examples/BENCHMARK_FP32.sh deleted file mode 100644 index d1b70ee6..00000000 --- a/MxNet/Classification/RN50v1.5/examples/BENCHMARK_FP32.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 benchmark in FP32 on 1,4,8 GPUs with 32,64,96 batch size -# Usage ./BENCHMARK_FP32.sh - -python benchmark.py -n 1,4,8 -b 32,64,96 -e 2 -w 1 -i 100 --dtype float32 -o report.json $@ diff --git a/MxNet/Classification/RN50v1.5/examples/INFER_BENCHMARK_FP16.sh b/MxNet/Classification/RN50v1.5/examples/INFER_BENCHMARK_FP16.sh deleted file mode 100644 index e395640b..00000000 --- a/MxNet/Classification/RN50v1.5/examples/INFER_BENCHMARK_FP16.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 inference benchmark in FP16 on 1 GPU with 1,2,4,64,128,192,208 batch size -# Usage ./INFER_BENCHMARK_FP16.sh - -python benchmark.py -n 1 -b 1,2,4,64,128,192,208 --only-inference -e 3 -w 1 -i 100 -o report.json $@ diff --git a/MxNet/Classification/RN50v1.5/examples/RN50_FP16_1GPU.sh b/MxNet/Classification/RN50v1.5/examples/RN50_FP16_1GPU.sh deleted file mode 100644 index d69f486e..00000000 --- a/MxNet/Classification/RN50v1.5/examples/RN50_FP16_1GPU.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 training in FP16 on 1 GPUs using 208 batch size (208 per GPU) -# Usage ./RN50_FP16_1GPU.sh - -"$1/runner" -n 1 -b 208 --model-prefix model ${@:2} diff --git a/MxNet/Classification/RN50v1.5/examples/RN50_FP16_4GPU.sh b/MxNet/Classification/RN50v1.5/examples/RN50_FP16_4GPU.sh deleted file mode 100644 index 7b1eef4e..00000000 --- a/MxNet/Classification/RN50v1.5/examples/RN50_FP16_4GPU.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 training in FP16 on 4 GPUs using 832 batch size (208 per GPU) -# Usage ./RN50_FP16_4GPU.sh - -"$1/runner" -n 4 -b 208 --model-prefix model ${@:2} diff --git a/MxNet/Classification/RN50v1.5/examples/RN50_FP16_8GPU.sh b/MxNet/Classification/RN50v1.5/examples/RN50_FP16_8GPU.sh deleted file mode 100644 index 4a53c347..00000000 --- a/MxNet/Classification/RN50v1.5/examples/RN50_FP16_8GPU.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 training in FP16 on 8 GPUs using 1664 batch size (208 per GPU) -# Usage ./RN50_FP16_8GPU.sh - -"$1/runner" -n 8 -b 208 --model-prefix model ${@:2} diff --git a/MxNet/Classification/RN50v1.5/examples/RN50_FP32_1GPU.sh b/MxNet/Classification/RN50v1.5/examples/RN50_FP32_1GPU.sh deleted file mode 100644 index da266b44..00000000 --- a/MxNet/Classification/RN50v1.5/examples/RN50_FP32_1GPU.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 training in FP32 on 1 GPUs using 96 batch size (96 per GPU) -# Usage ./RN50_FP32_1GPU.sh - -"$1/runner" -n 1 -b 96 --dtype float32 --model-prefix model ${@:2} diff --git a/MxNet/Classification/RN50v1.5/examples/RN50_FP32_4GPU.sh b/MxNet/Classification/RN50v1.5/examples/RN50_FP32_4GPU.sh deleted file mode 100644 index d9eae80b..00000000 --- a/MxNet/Classification/RN50v1.5/examples/RN50_FP32_4GPU.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 training in FP32 on 4 GPUs using 384 batch size (96 per GPU) -# Usage ./RN50_FP32_4GPU.sh - -"$1/runner" -n 4 -b 96 --dtype float32 --model-prefix model ${@:2} diff --git a/MxNet/Classification/RN50v1.5/examples/RN50_FP32_8GPU.sh b/MxNet/Classification/RN50v1.5/examples/RN50_FP32_8GPU.sh deleted file mode 100644 index 47ce7bf6..00000000 --- a/MxNet/Classification/RN50v1.5/examples/RN50_FP32_8GPU.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script launches ResNet50 training in FP32 on 8 GPUs using 768 batch size (96 per GPU) -# Usage ./RN50_FP32_8GPU.sh - -"$1/runner" -n 8 -b 96 --dtype float32 --model-prefix model ${@:2} diff --git a/MxNet/Classification/RN50v1.5/examples/SCORE_FP16.sh b/MxNet/Classification/RN50v1.5/examples/SCORE_FP16.sh deleted file mode 100644 index bd3740b5..00000000 --- a/MxNet/Classification/RN50v1.5/examples/SCORE_FP16.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script score ResNet50 checkpoint in FP16 on 1 GPUs using 128 batch size -# Usage ./SCORE_FP16.sh - -./runner -n 1 -b 128 --only-inference --model-prefix $1 --load-epoch $2 -e 1 ${@:3} diff --git a/MxNet/Classification/RN50v1.5/examples/SCORE_FP32.sh b/MxNet/Classification/RN50v1.5/examples/SCORE_FP32.sh deleted file mode 100644 index 8b7dd3d4..00000000 --- a/MxNet/Classification/RN50v1.5/examples/SCORE_FP32.sh +++ /dev/null @@ -1,19 +0,0 @@ -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - - -# This script score ResNet50 checkpoint in FP32 on 1 GPUs using 64 batch size -# Usage ./SCORE_FP32.sh - -./runner -n 1 -b 64 --dtype float32 --only-inference --model-prefix $1 --load-epoch $2 -e 1 ${@:3} diff --git a/MxNet/Classification/RN50v1.5/fit.py b/MxNet/Classification/RN50v1.5/fit.py index 17267ab9..69404784 100644 --- a/MxNet/Classification/RN50v1.5/fit.py +++ b/MxNet/Classification/RN50v1.5/fit.py @@ -33,197 +33,408 @@ # See the License for the specific language governing permissions and # limitations under the License. -""" example train fit utility """ +""" train fit utility """ import logging import os import time import re import math import sys +import random +from itertools import starmap +import numpy as np import mxnet as mx +import mxnet.ndarray as nd +import horovod.mxnet as hvd +import mxnet.contrib.amp as amp +from mxnet import autograd as ag +from mxnet import gluon from report import Report from benchmarking import BenchmarkingDataIter - -def get_epoch_size(args, kv): - return math.ceil(int(args.num_examples / kv.num_workers) / args.batch_size) - -def _get_lr_scheduler(args, kv): - if 'lr_factor' not in args or args.lr_factor >= 1: - return (args.lr, None) - epoch_size = get_epoch_size(args, kv) - begin_epoch = args.load_epoch if args.load_epoch else 0 - if 'pow' in args.lr_step_epochs: - lr = args.lr - max_up = args.num_epochs * epoch_size - pwr = float(re.sub('pow[- ]*', '', args.lr_step_epochs)) - poly_sched = mx.lr_scheduler.PolyScheduler(max_up, lr, pwr) - return (lr, poly_sched) - step_epochs = [int(l) for l in args.lr_step_epochs.split(',')] - lr = args.lr - for s in step_epochs: - if begin_epoch >= s: - lr *= args.lr_factor - if lr != args.lr: - logging.info('Adjust learning rate to %e for epoch %d', - lr, begin_epoch) - - steps = [epoch_size * (x - begin_epoch) - for x in step_epochs if x - begin_epoch > 0] - if steps: - if kv: - num_workers = kv.num_workers - else: - num_workers = 1 - epoch_size = math.ceil(int(args.num_examples/num_workers)/args.batch_size) - return (lr, mx.lr_scheduler.MultiFactorScheduler(step=steps, factor=args.lr_factor, - base_lr=args.lr, warmup_steps=epoch_size * args.warmup_epochs, - warmup_mode=args.warmup_strategy)) - else: - return (lr, None) - -def _load_model(args, rank=0): - if 'load_epoch' not in args or args.load_epoch is None: - return (None, None, None) - assert args.model_prefix is not None - model_prefix = args.model_prefix - if rank > 0 and os.path.exists("%s-%d-symbol.json" % (model_prefix, rank)): - model_prefix += "-%d" % (rank) - sym, arg_params, aux_params = mx.model.load_checkpoint( - model_prefix, args.load_epoch) - logging.info('Loaded model %s_%04d.params', model_prefix, args.load_epoch) - return (sym, arg_params, aux_params) - - -def _save_model(args, rank=0): - if args.model_prefix is None: - return None - return mx.callback.do_checkpoint(args.model_prefix if rank == 0 else "%s-%d" % ( - args.model_prefix, rank), period=args.save_period) - +import data def add_fit_args(parser): - """ - parser : argparse.ArgumentParser - return a parser added with args required by fit - """ - train = parser.add_argument_group('Training', 'model training') - train.add_argument('--num-layers', type=int, - help='number of layers in the neural network, \ - required by some networks such as resnet') - train.add_argument('--gpus', type=str, - help='list of gpus to run, e.g. 0 or 0,2,5. empty means using cpu') - train.add_argument('--kv-store', type=str, default='device', + def int_list(x): + return list(map(int, x.split(','))) + + def float_list(x): + return list(map(float, x.split(','))) + + train = parser.add_argument_group('Training') + train.add_argument('--mode', default='train_val', choices=('train_val', 'train', 'val', 'pred'), + help='mode') + train.add_argument('--seed', type=int, default=None, + help='random seed') + + train.add_argument('--gpus', type=int_list, default=[0], + help='list of gpus to run, e.g. 0 or 0,2,5') + train.add_argument('--kv-store', type=str, default='device', choices=('device', 'horovod'), help='key-value store type') - train.add_argument('--num-epochs', type=int, default=100, - help='max num of epochs') + + train.add_argument('--dtype', type=str, default='float16', choices=('float32', 'float16'), + help='precision') + train.add_argument('--amp', action='store_true', + help='If enabled, turn on AMP (Automatic Mixed Precision)') + train.add_argument('--batch-size', type=int, default=192, + help='the batch size') + train.add_argument('--num-epochs', type=int, default=90, + help='number of epochs') train.add_argument('--lr', type=float, default=0.1, help='initial learning rate') - train.add_argument('--lr-factor', type=float, default=0.1, + train.add_argument('--lr-schedule', choices=('multistep', 'cosine'), default='cosine', + help='learning rate schedule') + train.add_argument('--lr-factor', type=float, default=0.256, help='the ratio to reduce lr on each step') - train.add_argument('--lr-step-epochs', type=str, + train.add_argument('--lr-steps', type=float_list, default=[], help='the epochs to reduce the lr, e.g. 30,60') - train.add_argument('--initializer', type=str, default='default', - help='the initializer type') - train.add_argument('--optimizer', type=str, default='sgd', - help='the optimizer type') - train.add_argument('--mom', type=float, default=0.9, - help='momentum for sgd') - train.add_argument('--wd', type=float, default=0.0001, - help='weight decay for sgd') - train.add_argument('--batch-size', type=int, default=208, - help='the batch size') - train.add_argument('--disp-batches', type=int, default=20, - help='show progress for every n batches') - train.add_argument('--model-prefix', type=str, - help='model prefix') - train.add_argument('--save-period', type=int, default=1, help='params saving period') - parser.add_argument('--monitor', dest='monitor', type=int, default=0, - help='log network parameters every N iters if larger than 0') - train.add_argument('--load-epoch', type=int, - help='load the model on an epoch using the model-load-prefix') - train.add_argument('--loss', type=str, default='', - help='show the cross-entropy or nll loss. ce strands for cross-entropy, nll-loss stands for likelihood loss') - train.add_argument('--test-io', type=int, default=0, - help='1 means test reading speed without training') - train.add_argument('--dtype', type=str, default='float16', - help='precision: float32 or float16') - train.add_argument('--gc-type', type=str, default='none', - help='type of gradient compression to use, \ - takes `2bit` or `none` for now') - train.add_argument('--gc-threshold', type=float, default=0.5, - help='threshold for 2bit gradient compression') - # additional parameters for large batch sgd - train.add_argument('--macrobatch-size', type=int, default=0, - help='distributed effective batch size') train.add_argument('--warmup-epochs', type=int, default=5, help='the epochs to ramp-up lr to scaled large-batch value') - train.add_argument('--warmup-strategy', type=str, default='linear', - help='the ramping-up strategy for large batch sgd') - train.add_argument('--logging-dir', type=str, default='logs') - train.add_argument('--log', type=str, default='') - train.add_argument('--bn-gamma-init0', action='store_true') - train.add_argument('--epoch-size',type=int, default=0, - help='set number of batches in an epoch. useful for debugging') - #train.add_argument('--tensorboard', type=str, default='', - # help='log parameters to visualize in tensorboard every epoch. takes name to specify as tensorboard run. Empty means tensorboard logging is disabled') - train.add_argument('--profile-worker-suffix', type=str, default='', - help='profile workers actions into this file. During distributed training\ - filename saved will be rank1_ followed by this suffix') - train.add_argument('--profile-server-suffix', type=str, default='', - help='profile server actions into a file with name like rank1_ followed by this suffix \ - during distributed training') - train.add_argument('--report', type=str, help='file where to save report') - train.add_argument('--only-inference', action='store_true', help='do not train, only inference (for benchmarking)') + train.add_argument('--optimizer', type=str, default='sgd', + help='the optimizer type') + train.add_argument('--mom', type=float, default=0.875, + help='momentum for sgd') + train.add_argument('--wd', type=float, default=1 / 32768, + help='weight decay for sgd') + train.add_argument('--label-smoothing', type=float, default=0.1, + help='label smoothing factor') + train.add_argument('--mixup', type=float, default=0, + help='alpha parameter for mixup (if 0 then mixup is not applied)') + + train.add_argument('--disp-batches', type=int, default=20, + help='show progress for every n batches') + train.add_argument('--model-prefix', type=str, default='model', + help='model checkpoint prefix') + train.add_argument('--save-frequency', type=int, default=-1, + help='frequency of saving model in epochs (--model-prefix must be specified). ' + 'If -1 then save only best model. If 0 then do not save anything.') + train.add_argument('--begin-epoch', type=int, default=0, + help='start the model from an epoch') + train.add_argument('--load', help='checkpoint to load') + + train.add_argument('--test-io', action='store_true', + help='test reading speed without training') + train.add_argument('--test-io-mode', default='train', choices=('train', 'val'), + help='data to test') + + train.add_argument('--log', type=str, default='log.log', + help='file where to save the log from the experiment') + train.add_argument('--report', default='report.json', help='file where to save report') + train.add_argument('--no-metrics', action='store_true', help='do not calculate evaluation metrics (for benchmarking)') + train.add_argument('--benchmark-iters', type=int, default=None, + help='run only benchmark-iters iterations from each epoch') return train +def get_epoch_size(args, kv): + return math.ceil(args.num_examples / args.batch_size) -def fit(args, network, data_loader, **kwargs): +def get_lr_scheduler(args): + def multistep_schedule(x): + lr = args.lr * (args.lr_factor ** (len(list(filter(lambda step: step <= x, args.lr_steps))))) + warmup_coeff = min(1, x / args.warmup_epochs) + return warmup_coeff * lr + + def cosine_schedule(x): + steps = args.lr_steps + if not steps or steps[0] > args.warmup_epochs: + steps = [args.warmup_epochs] + steps + elif not steps or steps[0] != 0: + steps = [0] + steps + + if steps[-1] != args.num_epochs: + steps.append(args.num_epochs) + + if x < args.warmup_epochs: + return args.lr * x / args.warmup_epochs + + for i, (step, next_step) in enumerate(zip(steps, steps[1:])): + if next_step > x: + return args.lr * 0.5 * (1 + math.cos(math.pi * (x - step) / (next_step - step))) * (args.lr_factor ** i) + return 0 + + schedules = { + 'multistep': multistep_schedule, + 'cosine': cosine_schedule, + } + return schedules[args.lr_schedule] + +def load_model(args, model): + if args.load is None: + return False + model.load_parameters(args.load) + logging.info('Loaded model {}'.format(args.load)) + return True + +def save_checkpoint(net, epoch, top1, best_acc, model_prefix, save_frequency, kvstore): + if model_prefix is None or save_frequency == 0 or ('horovod' in kvstore and hvd.rank() != 0): + return + if save_frequency > 0 and (epoch + 1) % save_frequency == 0: + fname = '{}_{:04}.params'.format(model_prefix, epoch) + net.save_parameters(fname) + logging.info('[Epoch {}] Saving checkpoint to {} with Accuracy: {:.4f}'.format(epoch, fname, top1)) + if top1 > best_acc: + fname = '{}_best.params'.format(model_prefix) + net.save_parameters(fname) + logging.info('[Epoch {}] Saving checkpoint to {} with Accuracy: {:.4f}'.format(epoch, fname, top1)) + +def add_metrics_to_report(report, mode, metric, durations, total_batch_size, loss=None, warmup=20): + if report is None: + return + + top1 = metric.get('accuracy', None) + if top1 is not None: + report.add_value('{}.top1'.format(mode), top1) + + top5 = metric.get('top_k_accuracy_5', None) + if top5 is not None: + report.add_value('{}.top5'.format(mode), top5) + + if loss is not None: + report.add_value('{}.loss'.format(mode), loss.get_global()[1]) + + if len(durations) > warmup: + durations = durations[warmup:] + duration = np.mean(durations) + total_ips = total_batch_size / duration + report.add_value('{}.latency_avg'.format(mode), duration) + for percentile in [50, 90, 95, 99, 100]: + report.add_value('{}.latency_{}'.format(mode, percentile), np.percentile(durations, percentile)) + report.add_value('{}.total_ips'.format(mode), total_ips) + +def model_pred(args, model, image): + from imagenet_classes import classes + output = model(image.reshape(-1, *image.shape))[0].softmax().as_in_context(mx.cpu()) + top = output.argsort(is_ascend=False)[:10] + for i, ind in enumerate(top): + ind = int(ind.asscalar()) + logging.info('{:2d}. {:5.2f}% -> {}'.format(i + 1, output[ind].asscalar() * 100, classes[ind])) + +def reduce_metrics(args, metrics, kvstore): + if 'horovod' not in kvstore or not metrics[0] or hvd.size() == 1: + return metrics + + m = mx.ndarray.array(metrics[1], ctx=mx.gpu(args.gpus[0])) + reduced = hvd.allreduce(m) + values = reduced.as_in_context(mx.cpu()).asnumpy().tolist() + return (metrics[0], values) + +def model_score(args, net, val_data, metric, kvstore, report=None): + if val_data is None: + logging.info('Omitting validation: no data') + return [], [] + + if not isinstance(metric, mx.metric.EvalMetric): + metric = mx.metric.create(metric) + metric.reset() + + val_data.reset() + + total_batch_size = val_data.batch_size * val_data._num_gpus * (hvd.size() if 'horovod' in kvstore else 1) + + durations = [] + tic = time.time() + outputs = [] + for batches in val_data: + # synchronize to previous iteration + for o in outputs: + o.wait_to_read() + + data = [b.data[0] for b in batches] + label = [b.label[0][:len(b.data[0]) - b.pad] for b in batches if len(b.data[0]) != b.pad] + outputs = [net(X) for X, b in zip(data, batches)] + outputs = [o[:len(b.data[0]) - b.pad] for o, b in zip(outputs, batches) if len(b.data[0]) != b.pad] + metric.update(label, outputs) + + durations.append(time.time() - tic) + tic = time.time() + + metric = reduce_metrics(args, metric.get_global(), kvstore) + add_metrics_to_report(report, 'val', dict(zip(*metric)), durations, total_batch_size) + return metric + +class ScalarMetric(mx.metric.Loss): + def update(self, _, scalar): + self.sum_metric += scalar + self.global_sum_metric += scalar + self.num_inst += 1 + self.global_num_inst += 1 + +def label_smoothing(labels, classes, eta): + return labels.one_hot(classes, on_value=1 - eta + eta / classes, off_value=eta / classes) + +def model_fit(args, net, train_data, eval_metric, optimizer, + optimizer_params, lr_scheduler, eval_data, kvstore, kv, + begin_epoch, num_epoch, model_prefix, report, print_loss): + + if not isinstance(eval_metric, mx.metric.EvalMetric): + eval_metric = mx.metric.create(eval_metric) + loss_metric = ScalarMetric() + + if 'horovod' in kvstore: + trainer = hvd.DistributedTrainer(net.collect_params(), optimizer, optimizer_params) + else: + trainer = gluon.Trainer(net.collect_params(), optimizer, optimizer_params, + kvstore=kv, update_on_kvstore=False) + + if args.amp: + amp.init_trainer(trainer) + + sparse_label_loss = (args.label_smoothing == 0 and args.mixup == 0) + loss = gluon.loss.SoftmaxCrossEntropyLoss(sparse_label=sparse_label_loss) + loss.hybridize(static_shape=True, static_alloc=True) + + local_batch_size = train_data.batch_size + total_batch_size = local_batch_size * train_data._num_gpus * (hvd.size() if 'horovod' in kvstore else 1) + durations = [] + + epoch_size = get_epoch_size(args, kv) + + def transform_data(images, labels): + if args.mixup != 0: + coeffs = mx.nd.array(np.random.beta(args.mixup, args.mixup, size=images.shape[0])).as_in_context(images.context) + image_coeffs = coeffs.astype(images.dtype, copy=False).reshape(*coeffs.shape, 1, 1, 1) + ret_images = image_coeffs * images + (1 - image_coeffs) * images[::-1] + + ret_labels = label_smoothing(labels, args.num_classes, args.label_smoothing) + label_coeffs = coeffs.reshape(*coeffs.shape, 1) + ret_labels = label_coeffs * ret_labels + (1 - label_coeffs) * ret_labels[::-1] + else: + ret_images = images + if not sparse_label_loss: + ret_labels = label_smoothing(labels, args.num_classes, args.label_smoothing) + else: + ret_labels = labels + + return ret_images, ret_labels + + + best_accuracy = -1 + for epoch in range(begin_epoch, num_epoch): + tic = time.time() + train_data.reset() + eval_metric.reset() + loss_metric.reset() + btic = time.time() + + logging.info('Starting epoch {}'.format(epoch)) + outputs = [] + for i, batches in enumerate(train_data): + # synchronize to previous iteration + for o in outputs: + o.wait_to_read() + + trainer.set_learning_rate(lr_scheduler(epoch + i / epoch_size)) + + data = [b.data[0] for b in batches] + label = [b.label[0].as_in_context(b.data[0].context) for b in batches] + orig_label = label + + data, label = zip(*starmap(transform_data, zip(data, label))) + + outputs = [] + Ls = [] + with ag.record(): + for x, y in zip(data, label): + z = net(x) + L = loss(z, y) + # store the loss and do backward after we have done forward + # on all GPUs for better speed on multiple GPUs. + Ls.append(L) + outputs.append(z) + + if args.amp: + with amp.scale_loss(Ls, trainer) as scaled_loss: + ag.backward(scaled_loss) + else: + ag.backward(Ls) + + if 'horovod' in kvstore: + trainer.step(local_batch_size) + else: + trainer.step(total_batch_size) + + if print_loss: + loss_metric.update(..., np.mean([l.asnumpy() for l in Ls]).item()) + eval_metric.update(orig_label, outputs) + + if args.disp_batches and not (i + 1) % args.disp_batches: + name, acc = eval_metric.get() + if print_loss: + name = [loss_metric.get()[0]] + name + acc = [loss_metric.get()[1]] + acc + + logging.info('Epoch[{}] Batch [{}-{}]\tSpeed: {} samples/sec\tLR: {}\t{}'.format( + epoch, (i // args.disp_batches) * args.disp_batches, i, + args.disp_batches * total_batch_size / (time.time() - btic), trainer.learning_rate, + '\t'.join(list(map(lambda x: '{}: {:.6f}'.format(*x), zip(name, acc)))))) + eval_metric.reset_local() + loss_metric.reset_local() + btic = time.time() + + durations.append(time.time() - tic) + tic = time.time() + + + add_metrics_to_report(report, 'train', dict(eval_metric.get_global_name_value()), durations, total_batch_size, loss_metric if print_loss else None) + + if args.mode == 'train_val': + logging.info('Validating epoch {}'.format(epoch)) + score = model_score(args, net, eval_data, eval_metric, kvstore, report) + for name, value in zip(*score): + logging.info('Epoch[{}] Validation {:20}: {}'.format(epoch, name, value)) + + score = dict(zip(*score)) + accuracy = score.get('accuracy', -1) + save_checkpoint(net, epoch, accuracy, best_accuracy, model_prefix, args.save_frequency, kvstore) + best_accuracy = max(best_accuracy, accuracy) + + +def fit(args, model, data_loader): """ train a model args : argparse returns - network : the symbol definition of the nerual network + model : the the neural network model data_loader : function that returns the train and val data iterators """ start_time = time.time() + report = Report(args.arch, len(args.gpus), sys.argv) + + # select gpu for horovod process + if 'horovod' in args.kv_store: + hvd.init() + args.gpus = [args.gpus[hvd.local_rank()]] + + if args.amp: + amp.init() + + if args.seed is not None: + logging.info('Setting seeds to {}'.format(args.seed)) + random.seed(args.seed) + np.random.seed(args.seed) + mx.random.seed(args.seed) + # kvstore - kv = mx.kvstore.create(args.kv_store) - if args.gc_type != 'none': - kv.set_gradient_compression({'type': args.gc_type, - 'threshold': args.gc_threshold}) - if args.profile_server_suffix: - mx.profiler.set_config(filename=args.profile_server_suffix, profile_all=True, profile_process='server') - mx.profiler.set_state(state='run', profile_process='server') - - if args.profile_worker_suffix: - if kv.num_workers > 1: - filename = 'rank' + str(kv.rank) + '_' + args.profile_worker_suffix - else: - filename = args.profile_worker_suffix - mx.profiler.set_config(filename=filename, profile_all=True, profile_process='worker') - mx.profiler.set_state(state='run', profile_process='worker') - - # logging - head = '%(asctime)-15s Node[' + str(kv.rank) + '] %(message)s' - logging.basicConfig(level=logging.DEBUG, format=head) - logging.info('start with arguments %s', args) - - epoch_size = get_epoch_size(args, kv) - - # data iterators - (train, val) = data_loader(args, kv) - if 'dist' in args.kv_store and not 'async' in args.kv_store: - logging.info('Resizing training data to %d batches per machine', epoch_size) - # resize train iter to ensure each machine has same number of batches per epoch - # if not, dist_sync can hang at the end with one machine waiting for other machines - if not args.use_dali: - train = mx.io.ResizeIter(train, epoch_size) + if 'horovod' in args.kv_store: + kv = None + rank = hvd.rank() + num_workers = hvd.size() + else: + kv = mx.kvstore.create(args.kv_store) + rank = kv.rank + num_workers = kv.num_workers if args.test_io: + train, val = data_loader(args, kv) + + if args.test_io_mode == 'train': + data_iter = train + else: + data_iter = val + tic = time.time() - for i, batch in enumerate(train): + for i, batch in enumerate(data_iter): if isinstance(batch, list): for b in batch: for j in b.data: @@ -232,232 +443,90 @@ def fit(args, network, data_loader, **kwargs): for j in batch.data: j.wait_to_read() if (i + 1) % args.disp_batches == 0: - logging.info('Batch [%d]\tSpeed: %.2f samples/sec', i, - args.disp_batches * args.batch_size / (time.time() - tic)) + logging.info('Batch [{}]\tSpeed: {:.2f} samples/sec'.format( + i, args.disp_batches * args.batch_size / (time.time() - tic))) tic = time.time() return - # load model - if 'arg_params' in kwargs and 'aux_params' in kwargs: - arg_params = kwargs['arg_params'] - aux_params = kwargs['aux_params'] - else: - sym, arg_params, aux_params = _load_model(args, kv.rank) - - # save model - checkpoint = _save_model(args, kv.rank) - epoch_end_callbacks = [] - if checkpoint: - epoch_end_callbacks.append(checkpoint) + if not load_model(args, model): + # all initializers should be specified in the model definition. + # if not, this will raise an error + model.initialize(mx.init.Initializer()) # devices for training - devs = mx.cpu() if args.gpus is None or args.gpus == "" else [ - mx.gpu(int(i)) for i in args.gpus.split(',')] + devs = list(map(mx.gpu, args.gpus)) + model.collect_params().reset_ctx(devs) + + if args.mode == 'pred': + logging.info('Infering image {}'.format(args.data_pred)) + model_pred(args, model, data.load_image(args, args.data_pred, devs[0])) + return # learning rate - lr, lr_scheduler = _get_lr_scheduler(args, kv) - - # create model - model = mx.mod.Module( - context=devs, - symbol=network - ) + lr_scheduler = get_lr_scheduler(args) optimizer_params = { - 'learning_rate': lr, + 'learning_rate': 0, 'wd': args.wd, - 'lr_scheduler': lr_scheduler, - 'multi_precision': True} + 'multi_precision': True, + } # Only a limited number of optimizers have 'momentum' property has_momentum = {'sgd', 'dcasgd', 'nag', 'signum', 'lbsgd'} if args.optimizer in has_momentum: optimizer_params['momentum'] = args.mom - monitor = mx.mon.Monitor( - args.monitor, pattern=".*") if args.monitor > 0 else None - - # A limited number of optimizers have a warmup period - has_warmup = {'lbsgd', 'lbnag'} - if args.optimizer in has_warmup: - if 'dist' in args.kv_store: - nworkers = kv.num_workers - else: - nworkers = 1 - epoch_size = args.num_examples / args.batch_size / nworkers - - if epoch_size < 1: - epoch_size = 1 - macrobatch_size = args.macrobatch_size - if macrobatch_size < args.batch_size * nworkers: - macrobatch_size = args.batch_size * nworkers - #batch_scale = round(float(macrobatch_size) / args.batch_size / nworkers +0.4999) - batch_scale = math.ceil( - float(macrobatch_size) / args.batch_size / nworkers) - optimizer_params['updates_per_epoch'] = epoch_size - optimizer_params['begin_epoch'] = args.load_epoch if args.load_epoch else 0 - optimizer_params['batch_scale'] = batch_scale - optimizer_params['warmup_strategy'] = args.warmup_strategy - optimizer_params['warmup_epochs'] = args.warmup_epochs - optimizer_params['num_epochs'] = args.num_epochs - - if args.initializer == 'default': - initializer = mx.init.Xavier( - rnd_type='gaussian', factor_type="in", magnitude=2) - # initializer = mx.init.Xavier(factor_type="in", magnitude=2.34), - elif args.initializer == 'xavier': - initializer = mx.init.Xavier() - elif args.initializer == 'msra': - initializer = mx.init.MSRAPrelu() - elif args.initializer == 'orthogonal': - initializer = mx.init.Orthogonal() - elif args.initializer == 'normal': - initializer = mx.init.Normal() - elif args.initializer == 'uniform': - initializer = mx.init.Uniform() - elif args.initializer == 'one': - initializer = mx.init.One() - elif args.initializer == 'zero': - initializer = mx.init.Zero() - # evaluation metrices if not args.no_metrics: - eval_metrics = ['crossentropy', 'accuracy'] + eval_metrics = ['accuracy'] eval_metrics.append(mx.metric.create( 'top_k_accuracy', top_k=5)) else: eval_metrics = [] - supported_loss = ['ce', 'nll_loss'] - if len(args.loss) > 0: - # ce or nll loss is only applicable to softmax output - loss_type_list = args.loss.split(',') - if 'softmax_output' in network.list_outputs(): - for loss_type in loss_type_list: - loss_type = loss_type.strip() - if loss_type == 'nll': - loss_type = 'nll_loss' - if loss_type not in supported_loss: - logging.warning(loss_type + ' is not an valid loss type, only cross-entropy or ' \ - 'negative likelihood loss is supported!') - else: - eval_metrics.append(mx.metric.create(loss_type)) - else: - logging.warning("The output is not softmax_output, loss argument will be skipped!") - - # callbacks that run after each batch - batch_end_callbacks = [] - batch_end_callbacks.append(mx.callback.Speedometer( - args.batch_size, args.disp_batches)) - - if 'batch_end_callback' in kwargs: - cbs = kwargs['batch_end_callback'] - batch_end_callbacks += cbs if isinstance(cbs, list) else [cbs] - - - report = Report('resnet{}'.format(args.num_layers), len(args.gpus.split(',')), sys.argv) - + train, val = data_loader(args, kv) train = BenchmarkingDataIter(train, args.benchmark_iters) - val = BenchmarkingDataIter(val, args.benchmark_iters) + if val is not None: + val = BenchmarkingDataIter(val, args.benchmark_iters) - class Gatherer: - def __init__(self, report, mode, data_iter, total_bs=None): - self.report = report - self.mode = mode - self.total_bs = total_bs - self.data_iter = data_iter - self.clear() - - def clear(self): - self.num = 0 - self.top1 = 0 - self.top5 = 0 - self.loss = 0 - self.time = 0 - self.tic = 0 - - def gather_metrics(self, data): - params = dict(data.eval_metric.get_global_name_value()) - - if self.num != 0: - self.time += time.time() - self.tic - self.num += 1 - if not args.no_metrics: - self.top1 = params['accuracy'] - self.top5 = params['top_k_accuracy_5'] - self.loss = params['cross-entropy'] - - self.tic = time.time() - - def add_metrics(self, *a, **k): - top1 = self.top1 * 100 - top5 = self.top5 * 100 - loss = self.loss - if self.num <= 1: - time = float('nan') - else: - time = self.time / (self.num - 1) - data = self.data_iter.get_avg_time_and_clear() - if self.total_bs is not None: - compute_ips = self.total_bs / (time - data) - total_ips = self.total_bs / time - - if not args.no_metrics: - self.report.add_value('{}.top1'.format(self.mode), top1) - self.report.add_value('{}.top5'.format(self.mode), top5) - self.report.add_value('{}.loss'.format(self.mode), loss) - self.report.add_value('{}.time'.format(self.mode), time) - # self.report.add_value('{}.data'.format(self.mode), data) - if self.total_bs is not None: - # self.report.add_value('{}.compute_ips'.format(self.mode), compute_ips) - self.report.add_value('{}.total_ips'.format(self.mode), total_ips) - self.clear() - - def save_report(*a, **k): - report.set_total_duration(time.time() - start_time) - if args.report: - report.save(args.report) - - train_gatherer = Gatherer(report, 'train', train, args.batch_size) - eval_gatherer = Gatherer(report, 'val', val, args.batch_size) - - batch_end_callbacks = [train_gatherer.gather_metrics] + batch_end_callbacks - epoch_end_callbacks = [train_gatherer.add_metrics, save_report] + epoch_end_callbacks - - eval_batch_end_callbacks = [eval_gatherer.gather_metrics] - eval_end_callbacks = [eval_gatherer.add_metrics, save_report] + if 'horovod' in args.kv_store: + # Fetch and broadcast parameters + params = model.collect_params() + if params is not None: + hvd.broadcast_parameters(params, root_rank=0) # run - model.fit(train, - begin_epoch=args.load_epoch if args.load_epoch else 0, - num_epoch=args.num_epochs if not args.only_inference else 0, - eval_data=val, - eval_metric=eval_metrics, - kvstore=kv, - optimizer=args.optimizer, - optimizer_params=optimizer_params, - initializer=initializer, - arg_params=arg_params, - aux_params=aux_params, - batch_end_callback=batch_end_callbacks, - epoch_end_callback=epoch_end_callbacks, #checkpoint if args.use_dali else ,, - eval_batch_end_callback=eval_batch_end_callbacks, - eval_end_callback=eval_end_callbacks, - allow_missing=True, - monitor=monitor) + if args.mode in ['train_val', 'train']: + model_fit( + args, + model, + train, + begin_epoch=args.begin_epoch, + num_epoch=args.num_epochs, + eval_data=val, + eval_metric=eval_metrics, + kvstore=args.kv_store, + kv=kv, + optimizer=args.optimizer, + optimizer_params=optimizer_params, + lr_scheduler=lr_scheduler, + report=report, + model_prefix=args.model_prefix, + print_loss=not args.no_metrics, + ) + elif args.mode == 'val': + for epoch in range(args.num_epochs): # loop for benchmarking + score = model_score(args, model, val, eval_metrics, args.kv_store, report=report) + for name, value in zip(*score): + logging.info('Validation {:20}: {}'.format(name, value)) + else: + raise ValueError('Wrong mode') - if args.only_inference: - for epoch in range(args.num_epochs): - score = model.score(val, eval_metrics, batch_end_callback=eval_batch_end_callbacks, score_end_callback=eval_end_callbacks, epoch=epoch) - print('-------------') - for name, value in score: - print('{}: {}'.format(name, value)) + mx.nd.waitall() - if args.profile_server_suffix: - mx.profiler.set_state(state='run', profile_process='server') - if args.profile_worker_suffix: - mx.profiler.set_state(state='run', profile_process='worker') + report.set_total_duration(time.time() - start_time) + if args.report: + suffix = '-{}'.format(hvd.rank()) if 'horovod' in args.kv_store and hvd.rank() != 0 else '' + report.save(args.report + suffix) - save_report() - - print('Experiment took: {} sec'.format(report.total_duration)) + logging.info('Experiment took: {} sec'.format(report.total_duration)) diff --git a/MxNet/Classification/RN50v1.5/imagenet_classes.py b/MxNet/Classification/RN50v1.5/imagenet_classes.py new file mode 100644 index 00000000..82e6888b --- /dev/null +++ b/MxNet/Classification/RN50v1.5/imagenet_classes.py @@ -0,0 +1,1002 @@ +classes = { + 0: 'tench, Tinca tinca', + 1: 'goldfish, Carassius auratus', + 2: 'great white shark, white shark, man-eater, man-eating shark, Carcharodon carcharias', + 3: 'tiger shark, Galeocerdo cuvieri', + 4: 'hammerhead, hammerhead shark', + 5: 'electric ray, crampfish, numbfish, torpedo', + 6: 'stingray', + 7: 'cock', + 8: 'hen', + 9: 'ostrich, Struthio camelus', + 10: 'brambling, Fringilla montifringilla', + 11: 'goldfinch, Carduelis carduelis', + 12: 'house finch, linnet, Carpodacus mexicanus', + 13: 'junco, snowbird', + 14: 'indigo bunting, indigo finch, indigo bird, Passerina cyanea', + 15: 'robin, American robin, Turdus migratorius', + 16: 'bulbul', + 17: 'jay', + 18: 'magpie', + 19: 'chickadee', + 20: 'water ouzel, dipper', + 21: 'kite', + 22: 'bald eagle, American eagle, Haliaeetus leucocephalus', + 23: 'vulture', + 24: 'great grey owl, great gray owl, Strix nebulosa', + 25: 'European fire salamander, Salamandra salamandra', + 26: 'common newt, Triturus vulgaris', + 27: 'eft', + 28: 'spotted salamander, Ambystoma maculatum', + 29: 'axolotl, mud puppy, Ambystoma mexicanum', + 30: 'bullfrog, Rana catesbeiana', + 31: 'tree frog, tree-frog', + 32: 'tailed frog, bell toad, ribbed toad, tailed toad, Ascaphus trui', + 33: 'loggerhead, loggerhead turtle, Caretta caretta', + 34: 'leatherback turtle, leatherback, leathery turtle, Dermochelys coriacea', + 35: 'mud turtle', + 36: 'terrapin', + 37: 'box turtle, box tortoise', + 38: 'banded gecko', + 39: 'common iguana, iguana, Iguana iguana', + 40: 'American chameleon, anole, Anolis carolinensis', + 41: 'whiptail, whiptail lizard', + 42: 'agama', + 43: 'frilled lizard, Chlamydosaurus kingi', + 44: 'alligator lizard', + 45: 'Gila monster, Heloderma suspectum', + 46: 'green lizard, Lacerta viridis', + 47: 'African chameleon, Chamaeleo chamaeleon', + 48: 'Komodo dragon, Komodo lizard, dragon lizard, giant lizard, Varanus komodoensis', + 49: 'African crocodile, Nile crocodile, Crocodylus niloticus', + 50: 'American alligator, Alligator mississipiensis', + 51: 'triceratops', + 52: 'thunder snake, worm snake, Carphophis amoenus', + 53: 'ringneck snake, ring-necked snake, ring snake', + 54: 'hognose snake, puff adder, sand viper', + 55: 'green snake, grass snake', + 56: 'king snake, kingsnake', + 57: 'garter snake, grass snake', + 58: 'water snake', + 59: 'vine snake', + 60: 'night snake, Hypsiglena torquata', + 61: 'boa constrictor, Constrictor constrictor', + 62: 'rock python, rock snake, Python sebae', + 63: 'Indian cobra, Naja naja', + 64: 'green mamba', + 65: 'sea snake', + 66: 'horned viper, cerastes, sand viper, horned asp, Cerastes cornutus', + 67: 'diamondback, diamondback rattlesnake, Crotalus adamanteus', + 68: 'sidewinder, horned rattlesnake, Crotalus cerastes', + 69: 'trilobite', + 70: 'harvestman, daddy longlegs, Phalangium opilio', + 71: 'scorpion', + 72: 'black and gold garden spider, Argiope aurantia', + 73: 'barn spider, Araneus cavaticus', + 74: 'garden spider, Aranea diademata', + 75: 'black widow, Latrodectus mactans', + 76: 'tarantula', + 77: 'wolf spider, hunting spider', + 78: 'tick', + 79: 'centipede', + 80: 'black grouse', + 81: 'ptarmigan', + 82: 'ruffed grouse, partridge, Bonasa umbellus', + 83: 'prairie chicken, prairie grouse, prairie fowl', + 84: 'peacock', + 85: 'quail', + 86: 'partridge', + 87: 'African grey, African gray, Psittacus erithacus', + 88: 'macaw', + 89: 'sulphur-crested cockatoo, Kakatoe galerita, Cacatua galerita', + 90: 'lorikeet', + 91: 'coucal', + 92: 'bee eater', + 93: 'hornbill', + 94: 'hummingbird', + 95: 'jacamar', + 96: 'toucan', + 97: 'drake', + 98: 'red-breasted merganser, Mergus serrator', + 99: 'goose', + 100: 'black swan, Cygnus atratus', + 101: 'tusker', + 102: 'echidna, spiny anteater, anteater', + 103: 'platypus, duckbill, duckbilled platypus, duck-billed platypus, Ornithorhynchus anatinus', + 104: 'wallaby, brush kangaroo', + 105: 'koala, koala bear, kangaroo bear, native bear, Phascolarctos cinereus', + 106: 'wombat', + 107: 'jellyfish', + 108: 'sea anemone, anemone', + 109: 'brain coral', + 110: 'flatworm, platyhelminth', + 111: 'nematode, nematode worm, roundworm', + 112: 'conch', + 113: 'snail', + 114: 'slug', + 115: 'sea slug, nudibranch', + 116: 'chiton, coat-of-mail shell, sea cradle, polyplacophore', + 117: 'chambered nautilus, pearly nautilus, nautilus', + 118: 'Dungeness crab, Cancer magister', + 119: 'rock crab, Cancer irroratus', + 120: 'fiddler crab', + 121: 'king crab, Alaska crab, Alaskan king crab, Alaska king crab, Paralithodes camtschatica', + 122: 'American lobster, Northern lobster, Maine lobster, Homarus americanus', + 123: 'spiny lobster, langouste, rock lobster, crawfish, crayfish, sea crawfish', + 124: 'crayfish, crawfish, crawdad, crawdaddy', + 125: 'hermit crab', + 126: 'isopod', + 127: 'white stork, Ciconia ciconia', + 128: 'black stork, Ciconia nigra', + 129: 'spoonbill', + 130: 'flamingo', + 131: 'little blue heron, Egretta caerulea', + 132: 'American egret, great white heron, Egretta albus', + 133: 'bittern', + 134: 'crane', + 135: 'limpkin, Aramus pictus', + 136: 'European gallinule, Porphyrio porphyrio', + 137: 'American coot, marsh hen, mud hen, water hen, Fulica americana', + 138: 'bustard', + 139: 'ruddy turnstone, Arenaria interpres', + 140: 'red-backed sandpiper, dunlin, Erolia alpina', + 141: 'redshank, Tringa totanus', + 142: 'dowitcher', + 143: 'oystercatcher, oyster catcher', + 144: 'pelican', + 145: 'king penguin, Aptenodytes patagonica', + 146: 'albatross, mollymawk', + 147: 'grey whale, gray whale, devilfish, Eschrichtius gibbosus, Eschrichtius robustus', + 148: 'killer whale, killer, orca, grampus, sea wolf, Orcinus orca', + 149: 'dugong, Dugong dugon', + 150: 'sea lion', + 151: 'Chihuahua', + 152: 'Japanese spaniel', + 153: 'Maltese dog, Maltese terrier, Maltese', + 154: 'Pekinese, Pekingese, Peke', + 155: 'Shih-Tzu', + 156: 'Blenheim spaniel', + 157: 'papillon', + 158: 'toy terrier', + 159: 'Rhodesian ridgeback', + 160: 'Afghan hound, Afghan', + 161: 'basset, basset hound', + 162: 'beagle', + 163: 'bloodhound, sleuthhound', + 164: 'bluetick', + 165: 'black-and-tan coonhound', + 166: 'Walker hound, Walker foxhound', + 167: 'English foxhound', + 168: 'redbone', + 169: 'borzoi, Russian wolfhound', + 170: 'Irish wolfhound', + 171: 'Italian greyhound', + 172: 'whippet', + 173: 'Ibizan hound, Ibizan Podenco', + 174: 'Norwegian elkhound, elkhound', + 175: 'otterhound, otter hound', + 176: 'Saluki, gazelle hound', + 177: 'Scottish deerhound, deerhound', + 178: 'Weimaraner', + 179: 'Staffordshire bullterrier, Staffordshire bull terrier', + 180: 'American Staffordshire terrier, Staffordshire terrier, American pit bull terrier, pit bull terrier', + 181: 'Bedlington terrier', + 182: 'Border terrier', + 183: 'Kerry blue terrier', + 184: 'Irish terrier', + 185: 'Norfolk terrier', + 186: 'Norwich terrier', + 187: 'Yorkshire terrier', + 188: 'wire-haired fox terrier', + 189: 'Lakeland terrier', + 190: 'Sealyham terrier, Sealyham', + 191: 'Airedale, Airedale terrier', + 192: 'cairn, cairn terrier', + 193: 'Australian terrier', + 194: 'Dandie Dinmont, Dandie Dinmont terrier', + 195: 'Boston bull, Boston terrier', + 196: 'miniature schnauzer', + 197: 'giant schnauzer', + 198: 'standard schnauzer', + 199: 'Scotch terrier, Scottish terrier, Scottie', + 200: 'Tibetan terrier, chrysanthemum dog', + 201: 'silky terrier, Sydney silky', + 202: 'soft-coated wheaten terrier', + 203: 'West Highland white terrier', + 204: 'Lhasa, Lhasa apso', + 205: 'flat-coated retriever', + 206: 'curly-coated retriever', + 207: 'golden retriever', + 208: 'Labrador retriever', + 209: 'Chesapeake Bay retriever', + 210: 'German short-haired pointer', + 211: 'vizsla, Hungarian pointer', + 212: 'English setter', + 213: 'Irish setter, red setter', + 214: 'Gordon setter', + 215: 'Brittany spaniel', + 216: 'clumber, clumber spaniel', + 217: 'English springer, English springer spaniel', + 218: 'Welsh springer spaniel', + 219: 'cocker spaniel, English cocker spaniel, cocker', + 220: 'Sussex spaniel', + 221: 'Irish water spaniel', + 222: 'kuvasz', + 223: 'schipperke', + 224: 'groenendael', + 225: 'malinois', + 226: 'briard', + 227: 'kelpie', + 228: 'komondor', + 229: 'Old English sheepdog, bobtail', + 230: 'Shetland sheepdog, Shetland sheep dog, Shetland', + 231: 'collie', + 232: 'Border collie', + 233: 'Bouvier des Flandres, Bouviers des Flandres', + 234: 'Rottweiler', + 235: 'German shepherd, German shepherd dog, German police dog, alsatian', + 236: 'Doberman, Doberman pinscher', + 237: 'miniature pinscher', + 238: 'Greater Swiss Mountain dog', + 239: 'Bernese mountain dog', + 240: 'Appenzeller', + 241: 'EntleBucher', + 242: 'boxer', + 243: 'bull mastiff', + 244: 'Tibetan mastiff', + 245: 'French bulldog', + 246: 'Great Dane', + 247: 'Saint Bernard, St Bernard', + 248: 'Eskimo dog, husky', + 249: 'malamute, malemute, Alaskan malamute', + 250: 'Siberian husky', + 251: 'dalmatian, coach dog, carriage dog', + 252: 'affenpinscher, monkey pinscher, monkey dog', + 253: 'basenji', + 254: 'pug, pug-dog', + 255: 'Leonberg', + 256: 'Newfoundland, Newfoundland dog', + 257: 'Great Pyrenees', + 258: 'Samoyed, Samoyede', + 259: 'Pomeranian', + 260: 'chow, chow chow', + 261: 'keeshond', + 262: 'Brabancon griffon', + 263: 'Pembroke, Pembroke Welsh corgi', + 264: 'Cardigan, Cardigan Welsh corgi', + 265: 'toy poodle', + 266: 'miniature poodle', + 267: 'standard poodle', + 268: 'Mexican hairless', + 269: 'timber wolf, grey wolf, gray wolf, Canis lupus', + 270: 'white wolf, Arctic wolf, Canis lupus tundrarum', + 271: 'red wolf, maned wolf, Canis rufus, Canis niger', + 272: 'coyote, prairie wolf, brush wolf, Canis latrans', + 273: 'dingo, warrigal, warragal, Canis dingo', + 274: 'dhole, Cuon alpinus', + 275: 'African hunting dog, hyena dog, Cape hunting dog, Lycaon pictus', + 276: 'hyena, hyaena', + 277: 'red fox, Vulpes vulpes', + 278: 'kit fox, Vulpes macrotis', + 279: 'Arctic fox, white fox, Alopex lagopus', + 280: 'grey fox, gray fox, Urocyon cinereoargenteus', + 281: 'tabby, tabby cat', + 282: 'tiger cat', + 283: 'Persian cat', + 284: 'Siamese cat, Siamese', + 285: 'Egyptian cat', + 286: 'cougar, puma, catamount, mountain lion, painter, panther, Felis concolor', + 287: 'lynx, catamount', + 288: 'leopard, Panthera pardus', + 289: 'snow leopard, ounce, Panthera uncia', + 290: 'jaguar, panther, Panthera onca, Felis onca', + 291: 'lion, king of beasts, Panthera leo', + 292: 'tiger, Panthera tigris', + 293: 'cheetah, chetah, Acinonyx jubatus', + 294: 'brown bear, bruin, Ursus arctos', + 295: 'American black bear, black bear, Ursus americanus, Euarctos americanus', + 296: 'ice bear, polar bear, Ursus Maritimus, Thalarctos maritimus', + 297: 'sloth bear, Melursus ursinus, Ursus ursinus', + 298: 'mongoose', + 299: 'meerkat, mierkat', + 300: 'tiger beetle', + 301: 'ladybug, ladybeetle, lady beetle, ladybird, ladybird beetle', + 302: 'ground beetle, carabid beetle', + 303: 'long-horned beetle, longicorn, longicorn beetle', + 304: 'leaf beetle, chrysomelid', + 305: 'dung beetle', + 306: 'rhinoceros beetle', + 307: 'weevil', + 308: 'fly', + 309: 'bee', + 310: 'ant, emmet, pismire', + 311: 'grasshopper, hopper', + 312: 'cricket', + 313: 'walking stick, walkingstick, stick insect', + 314: 'cockroach, roach', + 315: 'mantis, mantid', + 316: 'cicada, cicala', + 317: 'leafhopper', + 318: 'lacewing, lacewing fly', + 319: "dragonfly, darning needle, devil's darning needle, sewing needle, snake feeder, snake doctor, mosquito hawk, skeeter hawk", + 320: 'damselfly', + 321: 'admiral', + 322: 'ringlet, ringlet butterfly', + 323: 'monarch, monarch butterfly, milkweed butterfly, Danaus plexippus', + 324: 'cabbage butterfly', + 325: 'sulphur butterfly, sulfur butterfly', + 326: 'lycaenid, lycaenid butterfly', + 327: 'starfish, sea star', + 328: 'sea urchin', + 329: 'sea cucumber, holothurian', + 330: 'wood rabbit, cottontail, cottontail rabbit', + 331: 'hare', + 332: 'Angora, Angora rabbit', + 333: 'hamster', + 334: 'porcupine, hedgehog', + 335: 'fox squirrel, eastern fox squirrel, Sciurus niger', + 336: 'marmot', + 337: 'beaver', + 338: 'guinea pig, Cavia cobaya', + 339: 'sorrel', + 340: 'zebra', + 341: 'hog, pig, grunter, squealer, Sus scrofa', + 342: 'wild boar, boar, Sus scrofa', + 343: 'warthog', + 344: 'hippopotamus, hippo, river horse, Hippopotamus amphibius', + 345: 'ox', + 346: 'water buffalo, water ox, Asiatic buffalo, Bubalus bubalis', + 347: 'bison', + 348: 'ram, tup', + 349: 'bighorn, bighorn sheep, cimarron, Rocky Mountain bighorn, Rocky Mountain sheep, Ovis canadensis', + 350: 'ibex, Capra ibex', + 351: 'hartebeest', + 352: 'impala, Aepyceros melampus', + 353: 'gazelle', + 354: 'Arabian camel, dromedary, Camelus dromedarius', + 355: 'llama', + 356: 'weasel', + 357: 'mink', + 358: 'polecat, fitch, foulmart, foumart, Mustela putorius', + 359: 'black-footed ferret, ferret, Mustela nigripes', + 360: 'otter', + 361: 'skunk, polecat, wood pussy', + 362: 'badger', + 363: 'armadillo', + 364: 'three-toed sloth, ai, Bradypus tridactylus', + 365: 'orangutan, orang, orangutang, Pongo pygmaeus', + 366: 'gorilla, Gorilla gorilla', + 367: 'chimpanzee, chimp, Pan troglodytes', + 368: 'gibbon, Hylobates lar', + 369: 'siamang, Hylobates syndactylus, Symphalangus syndactylus', + 370: 'guenon, guenon monkey', + 371: 'patas, hussar monkey, Erythrocebus patas', + 372: 'baboon', + 373: 'macaque', + 374: 'langur', + 375: 'colobus, colobus monkey', + 376: 'proboscis monkey, Nasalis larvatus', + 377: 'marmoset', + 378: 'capuchin, ringtail, Cebus capucinus', + 379: 'howler monkey, howler', + 380: 'titi, titi monkey', + 381: 'spider monkey, Ateles geoffroyi', + 382: 'squirrel monkey, Saimiri sciureus', + 383: 'Madagascar cat, ring-tailed lemur, Lemur catta', + 384: 'indri, indris, Indri indri, Indri brevicaudatus', + 385: 'Indian elephant, Elephas maximus', + 386: 'African elephant, Loxodonta africana', + 387: 'lesser panda, red panda, panda, bear cat, cat bear, Ailurus fulgens', + 388: 'giant panda, panda, panda bear, coon bear, Ailuropoda melanoleuca', + 389: 'barracouta, snoek', + 390: 'eel', + 391: 'coho, cohoe, coho salmon, blue jack, silver salmon, Oncorhynchus kisutch', + 392: 'rock beauty, Holocanthus tricolor', + 393: 'anemone fish', + 394: 'sturgeon', + 395: 'gar, garfish, garpike, billfish, Lepisosteus osseus', + 396: 'lionfish', + 397: 'puffer, pufferfish, blowfish, globefish', + 398: 'abacus', + 399: 'abaya', + 400: "academic gown, academic robe, judge's robe", + 401: 'accordion, piano accordion, squeeze box', + 402: 'acoustic guitar', + 403: 'aircraft carrier, carrier, flattop, attack aircraft carrier', + 404: 'airliner', + 405: 'airship, dirigible', + 406: 'altar', + 407: 'ambulance', + 408: 'amphibian, amphibious vehicle', + 409: 'analog clock', + 410: 'apiary, bee house', + 411: 'apron', + 412: 'ashcan, trash can, garbage can, wastebin, ash bin, ash-bin, ashbin, dustbin, trash barrel, trash bin', + 413: 'assault rifle, assault gun', + 414: 'backpack, back pack, knapsack, packsack, rucksack, haversack', + 415: 'bakery, bakeshop, bakehouse', + 416: 'balance beam, beam', + 417: 'balloon', + 418: 'ballpoint, ballpoint pen, ballpen, Biro', + 419: 'Band Aid', + 420: 'banjo', + 421: 'bannister, banister, balustrade, balusters, handrail', + 422: 'barbell', + 423: 'barber chair', + 424: 'barbershop', + 425: 'barn', + 426: 'barometer', + 427: 'barrel, cask', + 428: 'barrow, garden cart, lawn cart, wheelbarrow', + 429: 'baseball', + 430: 'basketball', + 431: 'bassinet', + 432: 'bassoon', + 433: 'bathing cap, swimming cap', + 434: 'bath towel', + 435: 'bathtub, bathing tub, bath, tub', + 436: 'beach wagon, station wagon, wagon, estate car, beach waggon, station waggon, waggon', + 437: 'beacon, lighthouse, beacon light, pharos', + 438: 'beaker', + 439: 'bearskin, busby, shako', + 440: 'beer bottle', + 441: 'beer glass', + 442: 'bell cote, bell cot', + 443: 'bib', + 444: 'bicycle-built-for-two, tandem bicycle, tandem', + 445: 'bikini, two-piece', + 446: 'binder, ring-binder', + 447: 'binoculars, field glasses, opera glasses', + 448: 'birdhouse', + 449: 'boathouse', + 450: 'bobsled, bobsleigh, bob', + 451: 'bolo tie, bolo, bola tie, bola', + 452: 'bonnet, poke bonnet', + 453: 'bookcase', + 454: 'bookshop, bookstore, bookstall', + 455: 'bottlecap', + 456: 'bow', + 457: 'bow tie, bow-tie, bowtie', + 458: 'brass, memorial tablet, plaque', + 459: 'brassiere, bra, bandeau', + 460: 'breakwater, groin, groyne, mole, bulwark, seawall, jetty', + 461: 'breastplate, aegis, egis', + 462: 'broom', + 463: 'bucket, pail', + 464: 'buckle', + 465: 'bulletproof vest', + 466: 'bullet train, bullet', + 467: 'butcher shop, meat market', + 468: 'cab, hack, taxi, taxicab', + 469: 'caldron, cauldron', + 470: 'candle, taper, wax light', + 471: 'cannon', + 472: 'canoe', + 473: 'can opener, tin opener', + 474: 'cardigan', + 475: 'car mirror', + 476: 'carousel, carrousel, merry-go-round, roundabout, whirligig', + 477: "carpenter's kit, tool kit", + 478: 'carton', + 479: 'car wheel', + 480: 'cash machine, cash dispenser, automated teller machine, automatic teller machine, automated teller, automatic teller, ATM', + 481: 'cassette', + 482: 'cassette player', + 483: 'castle', + 484: 'catamaran', + 485: 'CD player', + 486: 'cello, violoncello', + 487: 'cellular telephone, cellular phone, cellphone, cell, mobile phone', + 488: 'chain', + 489: 'chainlink fence', + 490: 'chain mail, ring mail, mail, chain armor, chain armour, ring armor, ring armour', + 491: 'chain saw, chainsaw', + 492: 'chest', + 493: 'chiffonier, commode', + 494: 'chime, bell, gong', + 495: 'china cabinet, china closet', + 496: 'Christmas stocking', + 497: 'church, church building', + 498: 'cinema, movie theater, movie theatre, movie house, picture palace', + 499: 'cleaver, meat cleaver, chopper', + 500: 'cliff dwelling', + 501: 'cloak', + 502: 'clog, geta, patten, sabot', + 503: 'cocktail shaker', + 504: 'coffee mug', + 505: 'coffeepot', + 506: 'coil, spiral, volute, whorl, helix', + 507: 'combination lock', + 508: 'computer keyboard, keypad', + 509: 'confectionery, confectionary, candy store', + 510: 'container ship, containership, container vessel', + 511: 'convertible', + 512: 'corkscrew, bottle screw', + 513: 'cornet, horn, trumpet, trump', + 514: 'cowboy boot', + 515: 'cowboy hat, ten-gallon hat', + 516: 'cradle', + 517: 'crane', + 518: 'crash helmet', + 519: 'crate', + 520: 'crib, cot', + 521: 'Crock Pot', + 522: 'croquet ball', + 523: 'crutch', + 524: 'cuirass', + 525: 'dam, dike, dyke', + 526: 'desk', + 527: 'desktop computer', + 528: 'dial telephone, dial phone', + 529: 'diaper, nappy, napkin', + 530: 'digital clock', + 531: 'digital watch', + 532: 'dining table, board', + 533: 'dishrag, dishcloth', + 534: 'dishwasher, dish washer, dishwashing machine', + 535: 'disk brake, disc brake', + 536: 'dock, dockage, docking facility', + 537: 'dogsled, dog sled, dog sleigh', + 538: 'dome', + 539: 'doormat, welcome mat', + 540: 'drilling platform, offshore rig', + 541: 'drum, membranophone, tympan', + 542: 'drumstick', + 543: 'dumbbell', + 544: 'Dutch oven', + 545: 'electric fan, blower', + 546: 'electric guitar', + 547: 'electric locomotive', + 548: 'entertainment center', + 549: 'envelope', + 550: 'espresso maker', + 551: 'face powder', + 552: 'feather boa, boa', + 553: 'file, file cabinet, filing cabinet', + 554: 'fireboat', + 555: 'fire engine, fire truck', + 556: 'fire screen, fireguard', + 557: 'flagpole, flagstaff', + 558: 'flute, transverse flute', + 559: 'folding chair', + 560: 'football helmet', + 561: 'forklift', + 562: 'fountain', + 563: 'fountain pen', + 564: 'four-poster', + 565: 'freight car', + 566: 'French horn, horn', + 567: 'frying pan, frypan, skillet', + 568: 'fur coat', + 569: 'garbage truck, dustcart', + 570: 'gasmask, respirator, gas helmet', + 571: 'gas pump, gasoline pump, petrol pump, island dispenser', + 572: 'goblet', + 573: 'go-kart', + 574: 'golf ball', + 575: 'golfcart, golf cart', + 576: 'gondola', + 577: 'gong, tam-tam', + 578: 'gown', + 579: 'grand piano, grand', + 580: 'greenhouse, nursery, glasshouse', + 581: 'grille, radiator grille', + 582: 'grocery store, grocery, food market, market', + 583: 'guillotine', + 584: 'hair slide', + 585: 'hair spray', + 586: 'half track', + 587: 'hammer', + 588: 'hamper', + 589: 'hand blower, blow dryer, blow drier, hair dryer, hair drier', + 590: 'hand-held computer, hand-held microcomputer', + 591: 'handkerchief, hankie, hanky, hankey', + 592: 'hard disc, hard disk, fixed disk', + 593: 'harmonica, mouth organ, harp, mouth harp', + 594: 'harp', + 595: 'harvester, reaper', + 596: 'hatchet', + 597: 'holster', + 598: 'home theater, home theatre', + 599: 'honeycomb', + 600: 'hook, claw', + 601: 'hoopskirt, crinoline', + 602: 'horizontal bar, high bar', + 603: 'horse cart, horse-cart', + 604: 'hourglass', + 605: 'iPod', + 606: 'iron, smoothing iron', + 607: "jack-o'-lantern", + 608: 'jean, blue jean, denim', + 609: 'jeep, landrover', + 610: 'jersey, T-shirt, tee shirt', + 611: 'jigsaw puzzle', + 612: 'jinrikisha, ricksha, rickshaw', + 613: 'joystick', + 614: 'kimono', + 615: 'knee pad', + 616: 'knot', + 617: 'lab coat, laboratory coat', + 618: 'ladle', + 619: 'lampshade, lamp shade', + 620: 'laptop, laptop computer', + 621: 'lawn mower, mower', + 622: 'lens cap, lens cover', + 623: 'letter opener, paper knife, paperknife', + 624: 'library', + 625: 'lifeboat', + 626: 'lighter, light, igniter, ignitor', + 627: 'limousine, limo', + 628: 'liner, ocean liner', + 629: 'lipstick, lip rouge', + 630: 'Loafer', + 631: 'lotion', + 632: 'loudspeaker, speaker, speaker unit, loudspeaker system, speaker system', + 633: "loupe, jeweler's loupe", + 634: 'lumbermill, sawmill', + 635: 'magnetic compass', + 636: 'mailbag, postbag', + 637: 'mailbox, letter box', + 638: 'maillot', + 639: 'maillot, tank suit', + 640: 'manhole cover', + 641: 'maraca', + 642: 'marimba, xylophone', + 643: 'mask', + 644: 'matchstick', + 645: 'maypole', + 646: 'maze, labyrinth', + 647: 'measuring cup', + 648: 'medicine chest, medicine cabinet', + 649: 'megalith, megalithic structure', + 650: 'microphone, mike', + 651: 'microwave, microwave oven', + 652: 'military uniform', + 653: 'milk can', + 654: 'minibus', + 655: 'miniskirt, mini', + 656: 'minivan', + 657: 'missile', + 658: 'mitten', + 659: 'mixing bowl', + 660: 'mobile home, manufactured home', + 661: 'Model T', + 662: 'modem', + 663: 'monastery', + 664: 'monitor', + 665: 'moped', + 666: 'mortar', + 667: 'mortarboard', + 668: 'mosque', + 669: 'mosquito net', + 670: 'motor scooter, scooter', + 671: 'mountain bike, all-terrain bike, off-roader', + 672: 'mountain tent', + 673: 'mouse, computer mouse', + 674: 'mousetrap', + 675: 'moving van', + 676: 'muzzle', + 677: 'nail', + 678: 'neck brace', + 679: 'necklace', + 680: 'nipple', + 681: 'notebook, notebook computer', + 682: 'obelisk', + 683: 'oboe, hautboy, hautbois', + 684: 'ocarina, sweet potato', + 685: 'odometer, hodometer, mileometer, milometer', + 686: 'oil filter', + 687: 'organ, pipe organ', + 688: 'oscilloscope, scope, cathode-ray oscilloscope, CRO', + 689: 'overskirt', + 690: 'oxcart', + 691: 'oxygen mask', + 692: 'packet', + 693: 'paddle, boat paddle', + 694: 'paddlewheel, paddle wheel', + 695: 'padlock', + 696: 'paintbrush', + 697: "pajama, pyjama, pj's, jammies", + 698: 'palace', + 699: 'panpipe, pandean pipe, syrinx', + 700: 'paper towel', + 701: 'parachute, chute', + 702: 'parallel bars, bars', + 703: 'park bench', + 704: 'parking meter', + 705: 'passenger car, coach, carriage', + 706: 'patio, terrace', + 707: 'pay-phone, pay-station', + 708: 'pedestal, plinth, footstall', + 709: 'pencil box, pencil case', + 710: 'pencil sharpener', + 711: 'perfume, essence', + 712: 'Petri dish', + 713: 'photocopier', + 714: 'pick, plectrum, plectron', + 715: 'pickelhaube', + 716: 'picket fence, paling', + 717: 'pickup, pickup truck', + 718: 'pier', + 719: 'piggy bank, penny bank', + 720: 'pill bottle', + 721: 'pillow', + 722: 'ping-pong ball', + 723: 'pinwheel', + 724: 'pirate, pirate ship', + 725: 'pitcher, ewer', + 726: "plane, carpenter's plane, woodworking plane", + 727: 'planetarium', + 728: 'plastic bag', + 729: 'plate rack', + 730: 'plow, plough', + 731: "plunger, plumber's helper", + 732: 'Polaroid camera, Polaroid Land camera', + 733: 'pole', + 734: 'police van, police wagon, paddy wagon, patrol wagon, wagon, black Maria', + 735: 'poncho', + 736: 'pool table, billiard table, snooker table', + 737: 'pop bottle, soda bottle', + 738: 'pot, flowerpot', + 739: "potter's wheel", + 740: 'power drill', + 741: 'prayer rug, prayer mat', + 742: 'printer', + 743: 'prison, prison house', + 744: 'projectile, missile', + 745: 'projector', + 746: 'puck, hockey puck', + 747: 'punching bag, punch bag, punching ball, punchball', + 748: 'purse', + 749: 'quill, quill pen', + 750: 'quilt, comforter, comfort, puff', + 751: 'racer, race car, racing car', + 752: 'racket, racquet', + 753: 'radiator', + 754: 'radio, wireless', + 755: 'radio telescope, radio reflector', + 756: 'rain barrel', + 757: 'recreational vehicle, RV, R.V.', + 758: 'reel', + 759: 'reflex camera', + 760: 'refrigerator, icebox', + 761: 'remote control, remote', + 762: 'restaurant, eating house, eating place, eatery', + 763: 'revolver, six-gun, six-shooter', + 764: 'rifle', + 765: 'rocking chair, rocker', + 766: 'rotisserie', + 767: 'rubber eraser, rubber, pencil eraser', + 768: 'rugby ball', + 769: 'rule, ruler', + 770: 'running shoe', + 771: 'safe', + 772: 'safety pin', + 773: 'saltshaker, salt shaker', + 774: 'sandal', + 775: 'sarong', + 776: 'sax, saxophone', + 777: 'scabbard', + 778: 'scale, weighing machine', + 779: 'school bus', + 780: 'schooner', + 781: 'scoreboard', + 782: 'screen, CRT screen', + 783: 'screw', + 784: 'screwdriver', + 785: 'seat belt, seatbelt', + 786: 'sewing machine', + 787: 'shield, buckler', + 788: 'shoe shop, shoe-shop, shoe store', + 789: 'shoji', + 790: 'shopping basket', + 791: 'shopping cart', + 792: 'shovel', + 793: 'shower cap', + 794: 'shower curtain', + 795: 'ski', + 796: 'ski mask', + 797: 'sleeping bag', + 798: 'slide rule, slipstick', + 799: 'sliding door', + 800: 'slot, one-armed bandit', + 801: 'snorkel', + 802: 'snowmobile', + 803: 'snowplow, snowplough', + 804: 'soap dispenser', + 805: 'soccer ball', + 806: 'sock', + 807: 'solar dish, solar collector, solar furnace', + 808: 'sombrero', + 809: 'soup bowl', + 810: 'space bar', + 811: 'space heater', + 812: 'space shuttle', + 813: 'spatula', + 814: 'speedboat', + 815: "spider web, spider's web", + 816: 'spindle', + 817: 'sports car, sport car', + 818: 'spotlight, spot', + 819: 'stage', + 820: 'steam locomotive', + 821: 'steel arch bridge', + 822: 'steel drum', + 823: 'stethoscope', + 824: 'stole', + 825: 'stone wall', + 826: 'stopwatch, stop watch', + 827: 'stove', + 828: 'strainer', + 829: 'streetcar, tram, tramcar, trolley, trolley car', + 830: 'stretcher', + 831: 'studio couch, day bed', + 832: 'stupa, tope', + 833: 'submarine, pigboat, sub, U-boat', + 834: 'suit, suit of clothes', + 835: 'sundial', + 836: 'sunglass', + 837: 'sunglasses, dark glasses, shades', + 838: 'sunscreen, sunblock, sun blocker', + 839: 'suspension bridge', + 840: 'swab, swob, mop', + 841: 'sweatshirt', + 842: 'swimming trunks, bathing trunks', + 843: 'swing', + 844: 'switch, electric switch, electrical switch', + 845: 'syringe', + 846: 'table lamp', + 847: 'tank, army tank, armored combat vehicle, armoured combat vehicle', + 848: 'tape player', + 849: 'teapot', + 850: 'teddy, teddy bear', + 851: 'television, television system', + 852: 'tennis ball', + 853: 'thatch, thatched roof', + 854: 'theater curtain, theatre curtain', + 855: 'thimble', + 856: 'thresher, thrasher, threshing machine', + 857: 'throne', + 858: 'tile roof', + 859: 'toaster', + 860: 'tobacco shop, tobacconist shop, tobacconist', + 861: 'toilet seat', + 862: 'torch', + 863: 'totem pole', + 864: 'tow truck, tow car, wrecker', + 865: 'toyshop', + 866: 'tractor', + 867: 'trailer truck, tractor trailer, trucking rig, rig, articulated lorry, semi', + 868: 'tray', + 869: 'trench coat', + 870: 'tricycle, trike, velocipede', + 871: 'trimaran', + 872: 'tripod', + 873: 'triumphal arch', + 874: 'trolleybus, trolley coach, trackless trolley', + 875: 'trombone', + 876: 'tub, vat', + 877: 'turnstile', + 878: 'typewriter keyboard', + 879: 'umbrella', + 880: 'unicycle, monocycle', + 881: 'upright, upright piano', + 882: 'vacuum, vacuum cleaner', + 883: 'vase', + 884: 'vault', + 885: 'velvet', + 886: 'vending machine', + 887: 'vestment', + 888: 'viaduct', + 889: 'violin, fiddle', + 890: 'volleyball', + 891: 'waffle iron', + 892: 'wall clock', + 893: 'wallet, billfold, notecase, pocketbook', + 894: 'wardrobe, closet, press', + 895: 'warplane, military plane', + 896: 'washbasin, handbasin, washbowl, lavabo, wash-hand basin', + 897: 'washer, automatic washer, washing machine', + 898: 'water bottle', + 899: 'water jug', + 900: 'water tower', + 901: 'whiskey jug', + 902: 'whistle', + 903: 'wig', + 904: 'window screen', + 905: 'window shade', + 906: 'Windsor tie', + 907: 'wine bottle', + 908: 'wing', + 909: 'wok', + 910: 'wooden spoon', + 911: 'wool, woolen, woollen', + 912: 'worm fence, snake fence, snake-rail fence, Virginia fence', + 913: 'wreck', + 914: 'yawl', + 915: 'yurt', + 916: 'web site, website, internet site, site', + 917: 'comic book', + 918: 'crossword puzzle, crossword', + 919: 'street sign', + 920: 'traffic light, traffic signal, stoplight', + 921: 'book jacket, dust cover, dust jacket, dust wrapper', + 922: 'menu', + 923: 'plate', + 924: 'guacamole', + 925: 'consomme', + 926: 'hot pot, hotpot', + 927: 'trifle', + 928: 'ice cream, icecream', + 929: 'ice lolly, lolly, lollipop, popsicle', + 930: 'French loaf', + 931: 'bagel, beigel', + 932: 'pretzel', + 933: 'cheeseburger', + 934: 'hotdog, hot dog, red hot', + 935: 'mashed potato', + 936: 'head cabbage', + 937: 'broccoli', + 938: 'cauliflower', + 939: 'zucchini, courgette', + 940: 'spaghetti squash', + 941: 'acorn squash', + 942: 'butternut squash', + 943: 'cucumber, cuke', + 944: 'artichoke, globe artichoke', + 945: 'bell pepper', + 946: 'cardoon', + 947: 'mushroom', + 948: 'Granny Smith', + 949: 'strawberry', + 950: 'orange', + 951: 'lemon', + 952: 'fig', + 953: 'pineapple, ananas', + 954: 'banana', + 955: 'jackfruit, jak, jack', + 956: 'custard apple', + 957: 'pomegranate', + 958: 'hay', + 959: 'carbonara', + 960: 'chocolate sauce, chocolate syrup', + 961: 'dough', + 962: 'meat loaf, meatloaf', + 963: 'pizza, pizza pie', + 964: 'potpie', + 965: 'burrito', + 966: 'red wine', + 967: 'espresso', + 968: 'cup', + 969: 'eggnog', + 970: 'alp', + 971: 'bubble', + 972: 'cliff, drop, drop-off', + 973: 'coral reef', + 974: 'geyser', + 975: 'lakeside, lakeshore', + 976: 'promontory, headland, head, foreland', + 977: 'sandbar, sand bar', + 978: 'seashore, coast, seacoast, sea-coast', + 979: 'valley, vale', + 980: 'volcano', + 981: 'ballplayer, baseball player', + 982: 'groom, bridegroom', + 983: 'scuba diver', + 984: 'rapeseed', + 985: 'daisy', + 986: "yellow lady's slipper, yellow lady-slipper, Cypripedium calceolus, Cypripedium parviflorum", + 987: 'corn', + 988: 'acorn', + 989: 'hip, rose hip, rosehip', + 990: 'buckeye, horse chestnut, conker', + 991: 'coral fungus', + 992: 'agaric', + 993: 'gyromitra', + 994: 'stinkhorn, carrion fungus', + 995: 'earthstar', + 996: 'hen-of-the-woods, hen of the woods, Polyporus frondosus, Grifola frondosa', + 997: 'bolete', + 998: 'ear, spike, capitulum', + 999: 'toilet tissue, toilet paper, bathroom tissue' +} diff --git a/MxNet/Classification/RN50v1.5/img/training_loss.png b/MxNet/Classification/RN50v1.5/img/dgx1-16g_250e_training_loss.png similarity index 100% rename from MxNet/Classification/RN50v1.5/img/training_loss.png rename to MxNet/Classification/RN50v1.5/img/dgx1-16g_250e_training_loss.png diff --git a/MxNet/Classification/RN50v1.5/img/dgx1-16g_250e_validation_top1.png b/MxNet/Classification/RN50v1.5/img/dgx1-16g_250e_validation_top1.png new file mode 100644 index 0000000000000000000000000000000000000000..5ac6716d8fa5cf48a2a7ea4e994f3031405f16b1 GIT binary patch literal 19038 zcmb_^1yq&G+plp1lu`i^5IBN#N=l2mLAtxUyIVm*5KvOOySqV38l+>>U7PN`fjist zKOWC_zxA!V?!7M8Uhpz|-e+c>d1`*Y`6w+ZjCqgn-i;eKFh$~!lr}7&&L@7kx2+BK8!4l5x`d>y|MLEQvT!sVG&%iyuW!9)_9eJ=_vwdYo84;cES`k>Z~eu`6)Na9__L&( zl6Z`gc+83#POe$O3vUF_U5Cmce|Xn?3w(alz6n0Hi;+)m_}l>>zdyf$g8pBg-@tf; zeDZ(r{KjK?WXs>%GlPNO_}BB1&&^ZiCgI00XqBi1w9=wzTWq$*uA|a?Qdh4dq(ZIA zGKCv_WrWnn;b2(={HpPWh*|p`CLvq)^x@>>B>P1>iGZiMa41Pdjoq5+_0{EVJ%8lD z-nkkS>ppkh(yJ(9=w~`ntaAdjYMM+J3I8d}4`&QT6O)|F%hNdyPlPi* zjF8{Gnn9(s&2qZ>LCIXHK~KC$_rO3^dk{YKN6PD&tKlrED!a9Q$hO=5B810wIUq>? zqs!rHLviyEoJp&3IxH;AeE!?}lci9Bsf**Sg6!<<>BdkJzEXi}#4s$)LpbD#NuFXs zDg1P|Y0ne=5xsR1`vrWt%BVlSB+2V)k{G-sf&GA3R!(llt*c&$)%D02 zzkr^eemNHm4nxs`D4$9yaRPCEI1}s!W{@#dEK`uvj38SqnlX|UCs0%(fqQhUP-9CI zTBIdlgw~%VptS(6&u*@DKQF~3U}<~!@L_zHG}bs%6Jjysx!D-~X$>EX%?0n&$*`2b zq#q`c_ilPUlNEPv?Oe}e`WV>+CgSUF?{5QPVwvj3x59 zP4}tDL^0RK^t_H zU$lifEPc&@P)oll`nmFjXW+}xWv9?ior7@O5={?YQ|#_)E*b zos&v}Lr&ZXd@`O6D(w^Ne>I$cdX4OC{Wxgtla;*!UXk=K}LpwKD*V?)m zczkLghN82YJ)@!n##mn*=gg1TUVn@?)x971)y{Z2_2q>WPTf>|@V4UH;5=vzp_+LE z)cT)}r+m@zZP~%T8oA@+ush4=RHkU_NFR}22otUMOpK9UtgJLJFlcYrHaQdbdz0j` z^gWodM9qNO^ZN1>%`P<{h9vLF8v}WVCTGHYXD`%&4|j2<5FHqKb3A&_K58O5lvSqWJqYRGSveOP_cUX7pImJBaId1_iZu8 zCu1N##%1tKN6bp{LpNck{u`>8Ejt>n={0Tz2LUatr`$!G5KKi0chr>bGr~tBT#=6a z0!XW|8PI%CHWERFyV~N5j@M6i^xBVvLVfEzhSf;%jGxK0*uBfUzP^5*3lhN=#2AlH z$ze6SohT+I7WBf8$?>9t)T{o7C;uzlhWH z^7{5C+mky&e0tw8j1mZee7qfM1L(;qxbV&H!*DFH_SigIq!iu=%2fwH1!fCvzT64%!2y2JoG)>zO zqX%PcPWK5ZN1p5Zfnm<$5#>7{@Uq@4!cqu|e#G8j%n1ZQLH8M@{_#n$4nuRO%W#mj-YG;PWX;n8gi zP`cpDJ2+oDC*F!}9E2@*g|AdnJbN}VAaHH2RHTWi={5iDCK0RQCn$&4l{+0ZHCiPx zuk(-ZA;e}rsMwW2siwdNtw{!IapQjDO>AJ|0)v9cD+|=B`Y%p*cQF)sb1;2ICypC{ zWwomkxh^kfGm8E2X{=bMb$hWr$PyZeM@P@jK59`1EF{$N3URItovyLtS^y(`cOh)J zqX$3U6;`mEYRcu*hA^JMp!oas;y<=0%Y4wHPH?8I5NG=*%UwA5Fambd2x30h5sP6= zr?BH$pq6pr6NY7V*Pykv{AE4 ztGS(Cf9JEk6jsTYm>5NQdHtrVi#&^|@~(U6=m}rAfLE-u+4_n{Ko9A~BIV!KOuIxF z9kfQW2u&#tx^38PHXNNBJOa+i3>}~G(;0#VcS?9wVql98>|~sh(An3kB6Bhw<0Zhs zZ8z3k)3ZDV4%9YDZdXP_KenIke2$hAM!JhOR%rpHr=iK2ZXA-BlUaNE=z?f}kO4Us z?c%G3uGt2+ae_yr&o5S@wbau^2h)vxC>YhN=gE{7#yekjMfj4x45yT^9V{>z&V)S9 z0fzp}B_`YR@`B3;r=cMAl-qv&a}Vl0QgR+1p2b7DP~#uTg8iMo{*YGq`iq67EnZAg z{%OoOh*uO2mE?;0izRy6$xA_we}|BJ{0<~5ogWumg<*Z=h>|DJ3WW*Hd*X1wm<0jVVxee&;`2dYNZwq0q^B7Xx(i#fhUYnzY+nl@JfIE3lxcKNY)vh?gDkFt2C7?H7rEJ;>Yd3A_ zLz*Rbh}2mjjgJDpZE?%;+8R#+-vvBiOt{85Rss!aE3%g<^K_m=9QqS@lv0|*1Vuzd zY$%0m#8}9>C1evr{07;MG6Oz~cdz!v%>*ldpPdtgOr9)gGsvaIc^B{%4H zKAp4F5n8t(u!3RomL73lAd9EE{Ofz3X#Kd*t!J zC!^`6hZKQvLeKHmI4bL%W6t?t8l-ia=i*eM_ySjP1*$qD@8KDy$+Yz4%a;WbxO(>c z+o-km=^&b_S!*prW5-qb(j4|+_;W(okK>Cy`j+)^`6JEP19GQ} z1i|na^>X7ctoH}u)c7JDqc&{u&cM5WP0C0iq(}PdXtS(CHW1`#Q)V1}QqU4RH%2bW zJMKS@OOPJzXYl<$hvfe+q59uOd+e|a1houml@lNk-tLWIeSowCW?*KkK79Bij?b-f zropXB6bc;14Z@0MQ4x_6pxV%{&-H$qki(3O3=Z4nw>)5r;Njt^n40DS6SrLRSNn$M z1M#oSPg}HCR#qn02h)5y#tSvdQeOM>I}sr}M9I75bzId?G;|QDpVX#ozpfP4Tu#)$D@CMMLdgTqE z$(CtBw|@Nb;}3~sMw6jzjIj){XkZ*@obxCBTKzEHb~uv5Z?OsDyu@K^)>hCiW|Nct zxJ^JnV3|1&?7sPAslmVuioNVRO5m`*hC9>_`EpGzpK&OATjMXmw*%aCMzcdBIKuUn|$Xf75>3rbto0-MRUzX>#~0S*7ps@dH ziktu-0t$NdpUAf0KTu?Q*?-#pn)sXefBbCx*L?k)t-qUsj*;E|)AV0ci<~VW0qFJb z75YD3g`pSJ4An-Vg_@PAIKnW`3#_{6%GnAcqA``(*n3mEL>2>?0?&WRiy7MCWC?AR zqsnJKOlB319=kGo$AK`(@`Mj#W%U-f-uADnEZVh(PP$cF>`r%JRaxp7#UiXKrfQ#; z{nN{FI8`Vqv~^o9s=_eOBKE7P*NIrk?Sxuo#k|Z>4iVFi*sCO%#o!c2(`ikH=YbEy znR&KZkN~M^j#j&69uG$OoTqB=uUXEi=w_7q|rUWGAa~;j+K~Nx|7c%+0Ai0|B)et5^oOO|V&$gtDH=@YvK2Bo3x56q3*+ zV~RS!S4pfw;dr8&gBSf350}pdreKELH?+myWfSp|dK|eVjZR7IP>cqO_Z>H({ZYq)W;|1i1+?r)n_OEOsw^DjkFq&3Le9O3h9a*^DKC zu~MzE&45jmkUQ7ApW8yKtVosk5^#amz4RG>vno;}oqG1F(0~G?0zI5^YDQpeDpKZd z)C}(l^X!75)nvcoZrzhCVhjEX*c@i*obZ)tnh>mfK_ICNwxI;;PM|ueF1IloGR7PO zL8tlI-h!gC@?&03w-a+BPRn>umFSd}m8GYm@+bMr9wg72kS)pYopR7&&Me)-Hkhc$ zp>fRBfPSN2DR-a2a@^F-x`HR!3W*MMy~!!Ks?O@WG^{VUGN>|G#pSu3;Rh^{t@%vt zDDcHkKqyvPRt6hP6Rxydll)Kg{I#eFgsV8-NRwDzJK`u2W0J*BOQ&LeaJhPNIKl3i z4R>0>82R$!6JJaYM2li7ov}<^_k3AWt^oGg?qs12dU6?0#{oYbjw-pFLRJ4>%sZhQ)>16-z-Z!sR_Odk)bG138LU7_Pj^*K|-vr(CMm)y#Q!}w8D{i~l_3VUZ7z#7-R)$B56%?P{ z1r|p0(`$dMN#KLX6Nk;4Tm7;1imPpq_GBcMG8fZ9uirjezHrWp@vDW)49}D=!7zi} zl_;kelcMHG%A-E|!%Ggq7@y`DMU~+%RqD?+kG!szL`gcuyW|6Ry&hr?2L}BWV@?vu%3BvZirWr3T2BN$H8+tjO-<5dPWHA(KX)Fb&ewDEegD#J1^w_MY z&V8=o%5ig1d#+4_dm;&ybmBxnYBF&{%zWtzb<9Xa=61=c3EJ-87{j)fc#T<5T~R;D0U zd9{uqaWvR9FF$0Y7Q0rptc|GuG0nv@yK)QdKw_)&s0yMl8kPZ4u!fJou;lu$B#KS$ z(Pss2{o$ivQK;3lV=4vG#2zdXUSkkWy@t$xe-Avo&Dz-F`2*HN{n7)WC?>CD0@qy3 z6;i8X^zPVA}DMQ0CoI|(U z2H$t+zE+)yfkQg3%+wbJ-8>eO$#bF%<691M+I_L?dEH{Y%PT82f4yn5iBgnN2`gf( zN6sSKI6}Vg_((sO4Jv7Xb>QmgSR;GIH5&I&^*cl;$Em2?HUnD{i%6%#pQ`3b?q20G zquumgg5S;s6GJH<{17&H+0r>6-R*Gectl&_1DO&?earLn^KE4qkP+nji@cA$Ukt|$ zIK3EJ&{jgl?0q>ZG(=V#86%|VPbF3`N4zPt_^-cTcr?w{UKh`VG-)WBi7NDQ_D|~@ zl@(T##RtCOqo%j{xOKiHJX!J_C%$HrH|qzav05^D@G*S>Ec)|j?MwKnQ`2o^)HOmX z;jVDNv!w_9He4+`{Y@alj+(f1cI^BaGYfOaW$7bKl8*lNk4MmA= zSR6Z9R}2-Td^YKbep3DJGRexDjT)_M&o+l!m{9G$7}kzL%?3hV%h~#x8BpT4oNI)6 zq9OyyY+{KP7b(I@x%94Rwg7|t@@L{NT9(P=88oYsP#CM^EaFi8M8vwB+1@zoZvO!t zuMLJ4x@R+b3>U0?Rg3aEN{@UrZ3oAjp(`II52rUeCp^_09#gL(ZHmz&n6r0!9iZwe zG+-8$$f+18Yw}ncw!BjMT!1gjVsPuoCgG(ItFo$cjaHLqrEdGZs_KJ@61@UYULMO+ zVgf$>iRdj5Hh-gg$t7$;$8jeV{c3jAZyjOFH2Z=^Wg2hY-LxDxMfO%L+CV?gMP@3GW1d;Xeqi#qUNw!e zaXr{Iw~OTe(c4sbcn^5Rk3pIy0(^}w*CO{9Xc-r{-=kO-lkhrggGA&6WcoaE8Hl|2 z_$NGWC-k&P>0YwSuvABBf1$~h4{h5wXf?n4TBEsdUB#JSt9v~7z(v01wx_jBX1r66 z-!@jCrlo}NoCC!@{SZno))~I0gECLSr;>AsAtuuxN4|RxdlbgL2`9F^_FxgZ;G!t# zWy{fjMK3QUYS`^@okc0;qP%b_r^_>bm(AEGV?l7V{$eqR$$Yln#c}C7CNd}ig*{agu;?)P>gRQkkFLPhUcDb4C3B;fOF&Fa|$sAt3Ga? z@jA87VijcrZ;cdL1TK5|NTw|!3(gKd1nszUJfqXK;2n*XJ)-7K=X6smVdW*5J9R3G zettMe$+v5l#}2ISd^9)ByR;{8M9NPl4zbE(|BKEIb zs(jgrUFevF;8jMEd~>-m9`V-P%4CL}VRi2*yVbfoUAAo_Q}L-4B_nL(TjsXZ>zo*j zyrP1HHY!MBn3K@)q;Q|+ZSHA5X0SQ4bLmD##z3n~vt(221iNT8x+lgK)}e3oDI&Vuyhoy{i0HeT zTGW93CTx5=?m4ia!R4p`S2 z#RJ7nl|=k5920mMSGaFtD7F(XhEqjFMH%wB9u-&3y7s76Sz3Syr0fxcYIO&n+eta7 z2$kt$0f!-yVT_WP%E#{|;wSihVe_lbj?IgXt~KWKabJ8CMXYezP~S# zg{8I%nbVr5Thi6->S0hDU2PHSyqv9a`plXUxWc%AD7dbM!BC=CUPzqP=6`4gu@d)^ zUFo6H&VHqn0A{L6-0ZHgn_7A0CjqRQ1y0O5U;ph0;g#Shrc#=+j5%S(S`v&w8dMP| zZr4zW_YiuY7P{yQ>x3Upg14V5>jWlUow{5hTsWUNFSOioJ6eD6(}K$1C7>~i=l2*V zAW2#;pj`|!ckxLNyW_c_6~h?Gu=l+SI}RcopGq!rU4NMg(lnzQ6_*%>xSBiu0)$bp zle?O8nK>4-b~7jpOrXG-4C>md|JY`nN z6{uK(UNt*XL}yi;5B1j{)+TIB%uZo(t&s_frYp{d&q-xq)bF2Lj~MWbmWteG7?x_t zO0vnK&_!%jdR<6J`>M<28MAF?sminnXN_=QsVgt+P3|dR`*sUGg`s`RqPYGTtd&K!L zob(ET4rkX%3A%6cJ%+z*K*luMww0q2X3VAceG0*@2Z%~` z-K=cBKj&5Z636u)VPBmcFY=1^GZuU|MRT=y(ae*X6BL_*Z|11-c!gubuW*%IxLf04 zuJ#U{KOKSEAU(mK9z|iP2dgry`;wm|Jvj~;pEpZD=PGqW6Fj#BI4YK&;mh2MS*9$AzU%{v(WwJ5s>YF0+?DFetBBZ~K8&$wqikSKKwoQ*^EQcXi09VWuhTGM^eGyY&ZF&`3(A?)n~eQqb~U- zVLm9{7PEofr*NA>W-U|h3t&7;1=wyLUyZaPtA36sBAgze&`kOi#dcrX62h?Lhv(Myhr} z+#j!XZ7)+^tobo0=4awCpuf!LeFw zDqK2)Juqw5tX*#u!(vc_T8-)>08k82$Z4gh2T`d4-_*0T)RVJS%yIX~U1gLmD#s2} zT4@?PJjuP2R_9u-p8IDX_O;=1W$Ydfp1l-rL#(blD!l~gsnc_^BZ_W2lzOPh)^tC8 z6HRV?cS8zO<-2f_;+YC({oEww0Qcrt_91(szF#>aFqMnNk;X&Lr{bXHj6z@1>qJLe zAMu>6cP-WQnsJoubt<7ux5dzjHF3sXDZ|vx-GL*y$q)E~nQMr1p60E{Bs?j10#pJa z%T=&}zhOpg^;*uBgJTD1vY=1CL>vbPz;Qs!j6x$LB9bXbppvw;+4>UmVh^(u;$QS} zV8)Q}Vi6JI*Km0>OEw+4YMZm=Q`yFrlBtxgz9!XmF(*Uftj;;--+2ynZ#}xb82dJs^LXrj~{|?B=VruYe96mar?bh zpu8_mXDhTdvi)*T#{na3ph;GrA<=k)kXR|{=f+~YGa@0jh=a&UMO-kKPi zK8F__waWd%I~i}s6GH`rMXQr_X$BIu4 zpQ&tk-15Z$5r+c$?(D7=IG8A9WeU7u;;24UT#j~F;kLoS86@fVR-hFHQg-P6ss;^z z;)p?!ta{d}2Y*I`KS~paL&eA+v+~qm%UXsObAe_Pufe%E@pM&8NRmrdr(7t>>)P73 zhLm4^7^5j#ko6BO`-X+60C{|qoB~3629yEucG7@Xq%bOvI71vAe!$-^$fx0^uv<0i&!}=| znsBTiR@z~83s1`)SV;8nxm2`hQrTF;vUAu-HF{9W(brRu#pw!rZ5HL+`UvZSJ@qO) z*6@Ix*n^WAbG|PyHms{Gw(-%MHWUV0s8vsF@1Na^hqdzO)7Y)Pc1iA&@4Lh5tPHi# zFk((ldo>)MFY?j8@+(gL!xNME0!{hF0R@|T_Cj|w#1H0@1T&C+BaZ&UjmH&%tdFEF>|UT{DmLyVRD1E9 z;j3VlE$VCl^~3Zh89QY~)%R8})Zw+qHcpT z&X?GhfWuk;u;3d67!u<}IqnpgP6-$33Lm<@q#RJT6A|L6%d^p_<99MN59MfRN0e8_ zC+U*%-4+XNcz{k7>p$))Hya*$|NK@=BY*focq*M4oTwmaW)(V@$4W*9$-U2r6MlK_ zZ>bWAO~ua>P1w&fxb47s#GyBJrR^7Y;ID5V@mNzvM>OeWVc5-F=^e~K@z3JHMSt#) zv$L?wR-YM1`b{1Y!bll8KbKr57rgz7PyhA_u}+}Dz4FjhriF!9T0#ph>#P^k~lRoK4faB7B{pTE;l|CIsuGumxJa^KP0D3Pu8>`FGda%=kPS1dy=Ykqj==bW5q^-^(vy+> z#G8pTSv}jjfQEprY1em$m^{}Z57+x3vRq=0wLU&5wl_nHHdHe}*+qcmHsPu)Sp_G- z8qUR?BBjB%F~oiM<45e?Lp!7%W5N%_jx@N50`ZO#zoT5`|oh}Bae$V~HK=v86 zBAzut_^RG+Z3+YDFbp>CtxntYEYR=nv1emQ1gF$sk_dY$g3xinv3U1~cD6)O=2W9pZ(a@w)I2i_F`8?-kzHXaNh>xtYBn;*h3ZxB2th%v@J z?nG=U-)}fLe?!P3SKf`EWH0uSmt9^*E;Z+pe<}muA%qE!%?;!I4D|^kuyHw9Ts-Rd z)aI)kaG=Fmh~jj=yAJN0db?08L53W+y6#j>I*=-JpF+)$=Ur~R7jT3Aw`VGDF&~$v zt*1AoysR^YQOKOH6BB%PDeQ3bJvgnt5L?J_z>9{z#(yh!k-J~GTCnEca(2E?a{}*} zndYBeUgtYjMiIT+$A3!A>%;ho(|qvmX!rHqahsw2hUUS6^;jhxT=rr9NX#$ilC-Yb z6)f({+YmD`7k5nRq@Fv|y@P)cmN$2Ib{0o5sHqldHkglO%Z$}IS((k$Ru~u>rs^}K zsK??%UaK=koAgjR4M*G@+GZE1U#0VPvwwYU@-6I7+Klxerndx^SxpzcikJ!b^q;oS zb!fR}2#UNyizpADy{=+5i458_hvzCynpYOmI95-peKEM{7lLh=>}!U(;k0t=ykdzr z@Xs8Q@J~K|{f@np^C4;RS*L!QXrGd7Z7+_d*Ecy$=9(T^26ZmTVnvCMWh~27K6BBK zW*eqT@lTWR3}Bo>oK4!%&=o@8k(iNZ9`*#B$1_+3AX2}T{5U;^`}+4D@uj9o&wldt z|AVeYczSVC!ltMV71{|@xY+zSj1UM$ku6Tt!#TwHcP+-bd4qDBn z<&-8M5LkXxxT7HxMDl%@IZW&GxNx<8FG4!LSN;UmfC9}uAw$lj&SGdA=RHBpQR`xW zuUjj!ifYhm*QZt1o`*H@c~`M|p}c-p1NMFB&WSexZiiNnOG@_0Iz(vBqPa7mOt!VinHrvk_zlu?ktnO3sQ&!mS?~hg>Y|W%*OHc28N( z#+3|T{2Z|li?VcGCq2zn`lO9X3^sYLY{x5^$68)p*AX!?xMB||V`v1nv-IH8l$c92 z1c=pDftg^-LpK9oCQ`&9y=sp8Gf258318*84?fDO9;h7OZv8yA+Jm-~ksUMe{vu1E zEFf0;0wcC0v(0eSEKFqY?l6nX;ApLfZKc+?@p0vY8tDbX zvsZe8<(*VXJ#D6Hie*M3CoH-AM%|nqJGN`r8&6w=ic=RDDS|s<7aj%e(eqtvqy@*N z^6!hzdQM7;c3q9eBxH>%Rk7XX!~%!+Iru1IWvKY{%Gv;66ZQ4$dh8g*2%+!ZqH%UX zE(JF3^MkI@<{y*za}(J$_=y{3UZJdfItVkwUc9H!_(xgXHmV17x;P0F1-z72pRcC1 zt`1EfzioAgt5rI}5z}5e#k14xqh{Vq`h0vsgAK3niR+?cHc}aB>8wq526pT=4!69e zM_PqF*wQoSJPa%$0TE@(_|3-|Xe~WyXUjX*Z-m#F5DDDJ0|Cka`O40lPI)WvZov6}wMRaR0&0ivsmw-a+79<6i!j)vIqv&>4jIF9|yKov- zmGNq-d?3F`+({3Q%`5>X!_^iUWVhZxE4aVpHW7AYPtn6#m7eX+>h)8>xuS|YNthKN z8A5qLqotxg_|;lQBuVdCxQ*_{Zht&qwF~E0EGE_!u|MfA?5(9g4`L^rAKdU1N^SbH zCG*WL0UuoKJ2h`vuhI=AlUtXcD(pW>$tyh*{Vw_7PcMvXZb<9VWGj1GeG1PPUM^}1!9gcs_)GUhe z4&?Stdo|dqyMW$;?R!3*+r8K7KZ|jm(qx>rDQ=onipbmB%N4-BV7ziWH&AdVyEraT z^P$#;;LXv!a#1YtyN}#{NSMlY*#Li;UPrgB{8WXR5kT-G>&8_aPwO8y|Co^r$CIRv zK0iOmx&>#|5oONLGLE#3ZlSgv)NLF6vvyewUEgbx(K-L&A0Ou!9fcq@0{nxjgCtr{ zr-Uupw#2^>VfLK)+8j@(GIllZGcst(TkdN@0^JK`A=%Z&l5v@1w!I9e1QGE?Q$h=5 zaV3ms5Ci?r+=s{e6-lW$v#n>wv1D#6`hyCk4O~I|Aw})aeu!3jXzM@E=Xl19?L~wCWkrw1hWZMqAnIb0MGg81Ch-7$deW zd-;Tp>LAOE)sszfXOzpzoZs`M$p0547WG0WY~SeZwRBKPw?y>wtiixhX(EDX2JqE%&{TGQ-$ zY1+wZK7o+VBnvI^6U=+%p&sV@^RPO(i;h_t5FT6-R3}_OWpu2{YAyf(PB^yhPPSEu z1U&1-dXxTxM;j9;68~I;RX9y6u$-RVS#x55PAIj*HX1bm#UJrJ7$lj~4{%?xoNK9h z!~aS_<#@+>sDkPJ{a{i``M4z4u}HfBR2BmMi&dQ2B?rN?rAG6@aLz(cL!F7@^ELUM zr|MKeNDLQ1MJZUwH+WoL96PKoBT=nGLqpwsOyTVRAl_;gdMU)BMrvygSg-X9al0P! z2d)@xc(B%en^|{wjXjVmcNG$Pbw0n$XaOpgX@EqR_8{0pV*?c^o8lYi$EmW=^cQ8n5M|Ab6#K1O9ZO3tYy})SWIH>a>=iB42nY^;%J|Y;l$+)yK%rqMrU_Dz%hSI4ZUTrfg{AHyA|HvlY}+!Wl1R3**7S?-(FO3U zH@Z*WeK1hT2K!LQ#dL07%qlJ1bTNXJo&_B{^2&EOAl^Fdp{SaZGAq+~1z&z(mTN!V zK;XaK`mqWYWWqVUbV@bNm}lR(6yR{Np{nxggfuJHK7X!?v`o{E?rMkIa4qKCMu3xj zvN7Is#&L%Ww`$3QcOwc@Encap|0WWKh&96GGYX)F_tZ3Aik+#~JD0SeMSW5XhU8n$ zTDN*I3a@SKG8*O1&1w@jO6u88o4-sFUJ=7Jrkt6#%p>cj;l=KoKa`&yAU|PcvWY+NP}z*V|Cll<&mczHBvkG^EyK<)#)<&{wtYpQNiO8oh9EhchimlOMZjCjsN# zKx?k)mBQ=BKNmIb2^yY2DpGzT@4jg(5K(;gLhN@`*d71`y2b8ngJpnp*G?=~Hg#lg zbl5a23(GY9tAd1T0GTAbq(5JJm=M!_SznM~I{A!QmDXx6c|Ij>V+|+MW2B1-UoL@{ z3ewn;*|+9sBiM#YP}!03w`wVggVIQaP{WX>JO7x}D= zOXt(LlhqkwU}<>HHEtbN!3a2J6$J2WMa-s}$jBN)B9k7h_t4j4c&=(Yb3FYIv@ltO zk3~7j{Xpamd_6668&)+}3HU)ArVoM!40!A^?!i%&~VjZ<~MrL~t@Ms3Lm;aJUxz@mw7Gou7s1<^klY$MPzcRk^@V z%QoX78_%9ge1jrKdDdG+hruCcCfV5czk0$V$T#eZjiejP>2Pg)E~{!iVB2xI-aEQ_ z%3pO#$)9aK8KZ2>(5!V`=(#Ln82ld~YH}iBJ{B=ZdR<-H?CKn0rIHEU?A!~1A%;_v zl@bXx+{bg*6WfAf-gn;TiFW(>+o+BC{_|D((MZ$D(v0KH(H@~-LIVJ*a-<++VPz$X zG+toy zmZ#^(aPe#QJFme9@p)yJ6B|(%g zM#Q_-b9NMl2c76Nuuy*?Y85C5;q)ynuL=6Ki8uBjkx{KTe*t?HK7Qv7+5<>Fqhdt| z_#i<(gRs~cdgf0oEwE#c@v$s+U%E zl3u0F+b}DvrWTw23p)$GL&uo?#Al$!bSV8}o{z)E5XBaNH~8RpQ&l4mgcvpv)e!=k zKZk-u9=E?A;D`5u;_a%Z)p%iofsqk3n20kUFcUE~sgvgU%UWMly=DEa^X>mO4oXL1 zlE12cV^r+tQ5Ufw_)quv1p>f4?IHj5wNx1BJ<*2!)3abjO_NhJtFjsYrqC7MPn~H`Ga_d|DH$m+&YjFbUY9 z(9!s!2mD$on^Zs=I@!odni|*g($F#MjQ51I8x>PtImR_9|1&;+!27EmdrZ^#d8>DH z_ECXFyQbm&U+YIF886^9+jy~=Cq(n(@`$)!8wvP?akXN+`qc#(NQHAFtMYIYp_S4O zv(M*WBCxjsfDQ~0m3E9?uf2LDU{s89G~1~~_iM0=p?>%3oOUg(8qYH;Oh>yfw?QVv zs)iZKy36i>l6RfXim3QUmMi;>q4rGi7+q` z7P>n5+@$zRw)P}YGl?R4L{Cj!3=Vhoh?DY z!U3o-C^Y?j=d3<|oC3h{zhuasFb0WCKH&Wd4le<825KnL!)P2&Yk-9q2nNt(8n1$1 ziytUpG?3_FY4$eWLM>|k%BIDHj`AJk*XqSC0+a2yGtJclYCC|WTi1d4#oF5qPT-5k z_%-T0!)n*#+_>jwvu?XJ$Eb52ry5EN4Ns#?_U`Tg)iLym!rzY;{in|q0EFgn+EI5y zRGW7_z68tHcnmyn^Ibc;W^<$BOviZrVNU$Re|-gzfdw(?L%TWH0DBO$q_ELexpPWl zW-;^hVewxE1sP$!wg)&iKzMwzudb@9>O;@w3ZQBI+8*rl$p)*Xovgo>)ifYYIJCAt z4|vK+Bt@*03xuR4;Z#y%-CaD+d&$AXJYy)>B<8F}{pE3-Rwz)%-C39)TWdji`DVtW z(zvEo3`Kx7bX>a`#QSRt~-^D}ESSc+pH+l{&3{HOCKvf`TmC z1MwIIddp0PDe*Pj2m+awx$PncQ++E4uirJv{-zYz0*K=NglYgt5|fg`CdosIPE|=< z>4}CmdcZX|Cr(dy?it>9g!?|k{I!<3H)oxfg1NoOJmmXW|BaoFf0{>IC5O-B!w!rM z+=lpfq5UwTOf?k7OmP~#WM#tuhK$O22bi;{gaivD!#aV-NmW-jH8P?t5i@&1=a-22_xRU^;B&ud%13$3;MiZ{kSVk47jKe5AP^);oHLI3lOZ}Fa-L;iD)!ebF=Bf^LqUVcRR zH7)E9eKKed$_)ET0kOSfIuUFMfctQG{Xx`GN#$dp9~yax+o8}T;fKDtQcj_nDzj7S z!N0g5NK-_Z>~($Ru+s)e!jXA)8IFJ~Q>F2581XbMan+u*AFHy7MPvDONX>v2HBgzK zcICI6;K*-?R$gjN*vwGI@L=hg_nLRb<=lrT~-sGkO7kibmLc z?AONJsqB{JkiPvh7y3!MkhWmF`Y}q7zk7kO00^ z7{V|kfk}@{F#clCC|1;P8!Ah;dyLbFvi-)o$qg=AoCQh%h!WjkihglY6r#&uP@o^4 zXC{&;zYieZWZ!j?`va?$Ez56wnbC~$`9xMFWbr!~5lrymH*~#r%kG1o`Y{lK+x?e_nrhJihsY=a7WT=O6JD zG(-zmcD)q?OlO-dT(}1yx(7qhkfF49?YstgulD`uMr3uZawPPHrVc8`Pbw3 zy^(}S+wqG@wP;*?QfX`vy07%xGMo|Q3qU=3KK?G&u(rh+;}@LYCl#N(Nva~l?$n0t zx7FQGul`{7H!J3UWLo{?PyIu+`kg+dcsUOo3eu{Gy?t9eS!M(Uj2kYR-$abgC@&uo z0=Gu^V-c68rjm(CNK}B@gSGB&qA-bRY9vjq4taJ2y4DQ}QN6Sw?^^WkbA zh)o{zcwE>=vb{{28vJ0E=~xZ8G@5+Mm$lAS=wClLJurca8)9HpPbHh(i@f4k%cy!eN*GvcfSdBm_X z1qjMZSDGLgtpNOU+o7At_XM|UYt%Uwe4j%Hzkm@KAEAi(ts^Vl%gg#^AUOu1_2|LD zfj11$_p88?L3wuT^+1KO41qvsL$5C31%L!KR_|hmyxeA{-es7$2niMf*RmiFCZUPp z;XXfE)bG9<6vwie=z{pV!rS{+9EjSF*9TiIK;WO)0N<%Y0ya-~=c>S6INZ09w-MCY zt%b1aBXjzemRE5c7O}yPpSKW8?H(g#K!+JL+; zAkM0B17j4#{Q2N*4?0|S8&0>ug$R~v;MkN*(+Sj`{`6h}CMy)=m3JN>$;&q|hqV=O zn*;k}OhTZX=a&ai{azLp7W2_u1rF1Z>@^Z8xGO7?3xDICkV$dNgM4Bh zM`cj`B@an^+KP81#zdM+;dMNBC4&Ksk(ZLDKSYS-Z>Jq*`j_$q^jf zfCI}bYP982?jDzYh`hH2Fp_H!`GP(uI^a?xYBPA%vWgL>l# z$kn{Z6M0>RC@MM4#(G^(wm1B+_`rn*V>xnERT8V40O0`yM5>x})xDp?`_HfcZ`URL rHyZX+Q~#Uif2llpE6{tCmTOcyPWq4O?V`d+?G}MZzA1dA?ft(1{y0n5 literal 0 HcmV?d00001 diff --git a/MxNet/Classification/RN50v1.5/img/dgx1-16g_250e_validation_top5.png b/MxNet/Classification/RN50v1.5/img/dgx1-16g_250e_validation_top5.png new file mode 100644 index 0000000000000000000000000000000000000000..fee347a63ff0d9f78ba73ef540855ce8b2e7dcb8 GIT binary patch literal 18304 zcmbunbyU<%8$WCTDkTCUpl}P)-O?5yEseku(wz&^N{FE}Vq)UYpD4bW*oa3sNE;$A>MjPCeYQ^Qa}8Z#CvQr^W3t~Tr%CveknG*{ zh*_3b%%=4i8Ir&sxmA00*Z*lumwvR@DVuyCMe%EIfsRopwX z?0Q%;n}>wuBQNfPS6&*TzwpUN{d36^4g7gqe+B&gs(l&Nf{uy$`&auVtULeJe(5eF zs^$NtofRzf(!cs^7ob}HZvR5*S!z1U?CWw|A z9nbI3Q)W3!Rv2)PcR)0l45H&|U|+XQQc5<*riw(Y&?$plAwzxPy<90qYBie|0WSyL=UfyFdTYJB7 z7Icc&>FDh(2eX`$~&wN-1|Dq!{PalFPe7nf>eP8f}>@|&%pOa(~Eu6~^Ao3l|enSn7gH5O5ntFv*lKC`jxW)mzsppnPtqbq>vCb$K2lRFQw$9FC z>-m=Pu|nPW_7@ToMdWVB^{(ed`kfRoqRx(vDa7$+8`xg-QBK#B{jYXIc6Cu~s_bbe zwRWevtwF=>TzdNYm7~Jv$GYBI5^HrA=gyn7Kxy7<7vPW!t&{cm6?yeHYP5*UF{L1g;sZ|6Ekxs6`dE=&ffO&Hj@Sban3;Q`M?ynGwaJNjHf+B)-T3v|rJne;WTm6c z>Fk1TQta8Y(~r{A($J7yiNbXrtH3P2YS&PE zrumd7D;67cXW3PeqpjHbWwEQyna^qD>@D}Io0yn9=Y7whlJ|(?ABCfD^`0iZXFc)! zd8X1!&$ezvz3Hp;&VNFk!e;`T?Ig*`x{Wa1Bk>Xv+ZyJ*NvvC=f{rpSlDG9R_lsI* zRR-QFcA0p-#WIGS6GwxmzLOJ?At5_cwi9LM>fW?coNytqpOvPZ$+xSN-Z#{Z#^Q@~ z?K>@YL=3wbNFQZOdn!$iev{+L4$5X0pKZ>L(M4IpC9FuYKBq@(?;yk&xMX&d2U~kx zO})Yw>t!O#q)P9%DE81(*u$^oxmrwB;1y~j)aQJKewfbI!NnWQx0vcD$Yi{cY{-nIlrP7?Kd}xqFP!*9DIm{Bs^Yd?>)< zk!GumqrzD`$!^x8IPy4=FkUZjPu`}Y7n-%|R(tQMo#wDVNe-+6UGC+}Z!ok7RhA7G zH`JzZ-tt@&%cPT~4X{beA`w}s!V+YcP|JU4-wRB23dvQ(8t18`s=5N_7i7WcjACr- z?#3RWOHP%uo2zC`@^Z`#v&Kwe=FPp>D4*3d5+;A(mmp)*8Og+=R{;M`B5;!D%B&&{ z(+AFiRrSEAK+jDvUji3SB^mi>4=4|H)O-p|W{x(92cKQcDfn=hFAz)dA(h!fFY=xA zmB@2tM~vv~m@e-X>DV4E5m_aqcw&;RADQ=;FTt=;7olhhA$qT@J$bJlqJx}OH+HuZ zjoi^gE%&qGz=b_=I2V^H)Eb*?w)+eF-LBQ^KuBM)BKv5$iOGl`MAJn7L+q19Uzx~j z+X5x;plxGSRBDG95zJLP?oGL|)B3>`m3^z(!*x@S;I4irw0sWg${gmYp zst0!16I#$O$${e1M+({CK>lu<$SWA>3`VN+&sQIm@&;QXtmrGJ&!dBgRWf}1TJEZ;sM`M zx^yf(mnyraQ^lH2?h%V>!B>l!YGSik0mmZ#B@ha;&QK0(vMZVcq9=lThCJF5i>rGf zE^ggA=uB9{z`&4QAS)vi)E&=1dS7g|ak|RE)3(2KeX4RW8p|~jt2J9b+43miY+GJ`HC*G@9uOj2(?wNJ=^xy;#UjiC1L#r1vo;*63KP6lS?GIICR ze*29HeGqYb+T!@2AOJ$Uvalj43}|E%?6&&d&f{Dh(gH%tln!3;$+|}NXc_3NjpQB< z$_k6b)nR!bhByv7xwgzT`cNMB8@36ol0aSVJD;B-HYd(1+qA5FpJ_9TX9)gho$TXq&eHWXGgOtFzFB& z@J^~078XrxdY?-nc=W`*Mnm4T3d+&GSAnHG4&zpJdPKhrFQ0X@Mb`rs&=Yrhy4M>) z!uVh?waKve-Bk>FfiC^$IQRJo@a8fz>u>Yn2Cn*3a{rRiv1;G_32%7}YpuFPr~=9W&^vibCE2(iO=a8fJ=GZivK?WnE**!V3l znc22r|D%$fsG~UiaI!$hbCS7OKDu6B@rC1yiP>fH%&Hy-qW5yw7^cot6+lpRQo_s0 z5|RwbwYnxbN)+#z=E4BoxFMn!$)vuN$BWvIAlT|7p}DF&Eahiy^*6&36SwRRSB~&< zgKc&=V{W1Rz{~Du%G0m?;2OY8B|ND-*-b|n4Q;}!9#SSxJzQMnad0nti+6V1;yjC?;s4K=Q|FZ6~rPO7VljwD9 zqxYQ(9?0&{UQL4Uh3&f$2M-M?9!)Gi4J6^}Sfqkf*>~sS22&`i=qaH~ib_H3C7zBV z8&j^Q%qjp`c*SA`@8;+w=(QwMT2(o0*`rGv*mTEm^*nyQm7?+RzDlc{!}pEJat6Vu z7L$UedQS{UUVLo^A%pTYO1d;d{e#l*V04te8a;kV4&XeP5(=^Zjo1Ii-~Zq3|BKgu zI`O~Te;ptM6HiZFBmu;9+*=w4c1~HQZ)iBVK3;6TK2})fg0KOL(F`m@;d4%7Pc9%T zNhv81Y}3cRF^N150NyWb52Kj`29Q%xG4_3a9$;E%?=$sO5NG^O{If)89tg1?PbN2V`02J2QhNY%9y?*^Vr=+B0!W{MO-5h$X5umGP zJKvk@*II+g`SFz$6%{wiI#BQ!goDC@A0N)p#Z$!I-JFR4?RF`pa%>WA7~Li5OVWMU zNJ6QlJG4=fOP7kiT|HvdcmtnWz=5>y#pRgKH$LBp(JshhRVAVO^866Unn&Jhz9q2C z?d)XP;wlNoboKNtvlnK!#7Zw&O4r)h+Juz@iO0bPmQG@qglV(-@ihbGWijfC3 z*v-!&Pw`RD0MP^zfUz%uSD<57Jowoc2#-_#PuDA839HqsSSD=n;>L6)l@Wp$QWD!(qc^v3GPE)9|UU5n6Yzd`W?SC*{Y-#K`E zraLpT$R-;S$JN>s6sw2vUZzACU8>-IVqj@%kL&svlF6j`)GKQ5g6mZTli|#nmZYNr ztf4cZY}(AQwbnx1Vz8f>qwb;G(CGR4SmRlZ`3woz3tSx3j)xIteBL(hgQkCwAIC3_ z3&^(L_0d}2UwX*zeC)BfdD@uQ6|Mj3S#8N)yxM3CTPR|Dv^Ewj-`<{lokDTVhpEV1 zx2|-Snz6JdEOIOn|IWlF+K&B7v^9T~MJ!~hY*L2iUa0~G`}*siXH}ZpL%S9PFpHY+ z)dCC*6_ejM>$NZc5Z`0Uz6E1(UqPuE!)4u!v1Yd#rff;|&XuF+`(%RM%uQIO>o{A= zCQbut-1#BA66V7lq3Y$B6i?J{SGicU3ksJ{Ck7X!J##OhnlBqWbgWZ@XW8hcT6|5e zc444*G>NhlF3ffpHf9Gp_*V2LP^NEOCbxrX2{IDPoa@X>F_1^9bN!9>&dsl@xLw{t zVmUjQn`H|86WufzLLNp_LE`~z9yOeGo;+U>?7A&<-ym~?|JBo|bMCFq2yW{Jq1bB1 z!AReW`cW24ZD}F;J-Y+ zcwQ4%-|lk6)M+xg9uYXWb>C@n>WQ%GdI{xWa{yy3qWj6Dz>XLx>0TA|u0#7oH&cl# zaj^N;cq_M_bRmZf?{a?C8p?0|kY*-Nc!r(n_?4>DcAv<>++2P4u>lEYeLe*nLHlt1 zveT$V>AMzaljUQ%RJPNwsiZTewY4WbFBf}1*tG%+IGb>Mi+y3@<62bkbte9_+@G~ZxVSIf!c|Y0 zoE|Edz8))k3-iYdfmAhFBzBc&LX%(cEW6I%l*%gkdax+DG12u1>3n8VMaDA%Z6DTa zQmqU$Z6A1JgxtN(`@mnkOux~+2y)f}t4_F0 zk|`%E>6x~W;;4X3dVGHdSKS$g$B{vN`@Ava{zK_Qv~KBRWw^KkPBR4%E8 z{~%#fr!d%fJx&_2j6D%7veD+P}X6Ce1(8*#U9jUmz93{gDaQMDnFFmdD_Ip*Q$voVHY zzP^s^UY8#&iy)z{>Ak2~?Of%y=~E^W`WAA2Jd;m9hykhiDn9C4UOAz8Mhlttr7v00!A$TErQog+r7y&FaWcwA7R&d ze`+-Pq3q6T$v-El?prh)MWln&&%w(~hGtumWEzl* z)C-k78FBN|)<0rkQL?Iqau7|!`ie~#kTG@o8A~k1y@rbuV!AA<+2TANn-%$^gp+5^ z!5W*xON1Cxuzpg%*$*1jo2bYFyqNga=hH?y3W|h8M6PSpZQaEDQ=2XMrBm-};;nb4 zp+a-&at|X&D)Z-$FEhwcju`@4(ppt zEmEf@$mY#8*O{ZHnDB?JHIqo`GV&^qY8_W@w+RPy+D;p5F)|b&T<=V5Q7%oy2by}C zDpFLy_Vu#%HSa%bg_oAJLA&Wp(ngh_?bg5cjU*aR-nxA`iT!d`1_8IUAK7Y6R$A)f zQp2mmV}n}$^kf;K*Qw_0GVJ16=$nFJh=+gJPBXWUAr#yu zh`pa5)a`l&;4Kn5PU8h5ugM4&C*FBVuyOAB5T*KU4N~E$9%$xRce(}4O5VYHqjLBv=cjZdgh@+D2Y;uaA z%%hGbsq@7U4%L~vOc%LdMS`o}$%l&%*Aq&I-pKBH*sj+-foNNNk*S?7I=p&z)s6OM zPBu`GJr%M57e1!+rp|vC6@O>J+BjNYi~a-WOEd>a(+gh7ek0E5w3lR| z6pC3zOeu?!m`14+m2A2m56u^Om0l2R&D2NyQ;}HE2wg)Qh)qCkLQ<0E<<~QAtgUw} zX-%IDnyaZ6(;ZDURXYi;b&{L4CT7I*W-)dUXbz=ioauQeiggf|giyxg?Q+HHxeW=H z^Olx$Y)Ndn%jrehX}F&If8HBF5}+|SH~iYmOuV#F8%oXWL%BEcSpJ~}Tx!xGpSO|w zY7is1n(bbTAP2V}PUhV-_pMSnt?~HbPNvm;-O+f$AXwWaIvwP9U@Mc9< z={UG1?!B^65f879>$Fas244*%jV^pkN!_U$?wL!`K}WOZnKrm6KRM}dt%|*)CV3JS zsj#$^vd8<ddI>KZ4+T9P&WKK0JVl zpuOL8@!pL^25(BC7#f+D$7?B7Jp^Z!Lut@$wc*;v_K7uEpdCaRGCu^KA0WiWCF}gxO*D$%BfZKnf8b3^dWq^tME{54 z{ZH?ngos95eOW%*`I(tJ;>wqtPpQemCsI`2NOK{ll3B7^)QfqM ziHNNPVp*-AcfTk7K=F((jw2OgY0u`vP#UFea$1o&pMlaBOzFy}EE4-o!~8vPViW=30En=8OX(40qajSY#Pf?u1Szj*aA8N&Dfc<63F5yq|#aPNmGM zSn-BYwz5T2Y=HDup>gDRW*Wa`{9s$n=T;lMf=noX_|$&Om|Ubxk-i=}dyrsWQ^z3Nm6xNwcAUmO z3Z-eJ+FR(vGlD1u99KTN>z!e&wa@EUw8NUQaRud@6{)`Pl~I4e*6jTN?T_yGxZ}so zH!-@*fJi!HXUOtdunA2NY>M!wRJ0m!NHVSp&QgphSjYE^aM{3=r5|mFrU>!}ZOhT9 z2>rvu^Qf*kHHDUhjEzl(gDWd2^SLp-%$wKZ{hZ>^mB% z(dz6x6}46(+nv^n(;wKaNsQC4M6gr1l}z|)(nNY|xB#8M2~?ux!h z2Z%fq>1;cyQ?}gMziGKBhS(BYQb})#<+rqg-g7-4_Dx}2Y_#b4hRCapSzyn^e7T5| zH94ACdMQY>~lg#0yx~7v^Igw2HT*u|fiyE>1 z#BBl!3Haf(@sp@Yq8diT5%jVa))t0wzZss73=2&8~G8WjG4Wx zRfT5OFQ?TZw%=WrcNZ*(8@G3QYLD!_7dAWYh=iW62#;7;s#&H)LNEh7MO*0b)b%fy z*^%Cniv6CV*sv^Wyvn=k!9mUbsP>;UDL)=XzeA&i7z$${391rijWBW1wpj5+UgK1V z|JbC3y8d9Ekzx`|Qjpz%&u}q}4sS-Q*TXB6H90Q}|a3gOMR<|xQeun(^}5h{^Z zAu55(x_GE4w*S1`ZKp*F4~O`H2*d_f3WZ2`i{WBy-5?Fehg3}#;>1$~yf}W4$Nb1L z-6ct!7?(#_gH}#m{2QO8YXa%O?CxyYVoH6zy~t-574;gUIt}zVV8KO;)e&wlBsMjN&uD zUlrT&<-(BkJn(y8Q()|7e-lPlqg9$=f=?cew01Z4w$LV9DuIC0@S8=_r?^B=Ql%)< zh0JzE%Kl?!HteJPn<5M@Jh2o){oWLW#y5J`?m+b9w*VAjr+VVC-%5_2xRoO1Cj>dR zR9sma(PGe?N9=zdORLk2uC}EVLvNKEaHyE5=u&TKg-lIZlfcPcgGjJ5m}_|xnaa8a z#a@-S^IqIdVI#&vGQV=IuRV3D>wKcdiu^n&CMt5A#}w!nhS)Y}Rapw+7S+LV<(gRJ zHcqs9*X}uu9Lt~#uF{1cpQzlJ$3sVK(cqzR=r1*R1uBkxMXZea6Ep^hLW{_NREk&QTk?q|;IV4=$Ys_2bU=dNyvoIVB#n_S4G@kng4B<4Y7`1(|)+TpTr9V=khGE7^ zcQ^~rXVaIQ;t;!G!eT`xdZnvJA+$-RDju+am}KL*HaSi|zf9`z+ue=*4DLa-v8;R; z(s;Cs1~rUuj~xFPX}=GdRZ%{?=pg3wwaKN59Qf~Bmb7PfH7VXflaEqVn&P(|8JMgy z6yfE?YsFqBL%Y%I3gc@`5s@Q@hIyA~_od2yReo(hHbyrq(OS)JU$L<=CH#GiukN$+ z=C}}F8Eo#li-h*y4 zpQmQrzbrKb$taL0%d=nC8_3T^+$7Phn7A|l$XbWnRS#3$Pu{7B{g zGlM6Ic+5D6$y$Z7*9)?nr(FH{hf0@wvR)F!ks9-qvr_P6X0<6bZP5-brtgh9Ec#p2 z(z849X>xX4&Cbzy`t0$vr$85*>f3q`o_kuvRrC!a_s-flYsA{e{Fc51g>c;K?TRX+ z+ogPV`&9NKns*RMaQS8mbL=MOg>PtTxhZkL*skx4#ELz{yI0ePQYL~hF(>Dfo@ia~ zx`st&?8HN-ghwJayP@Y;qCH9uE>!7SBpMbSZZU}j*7t=FYPe>^gq8$uuWY-bi}#OW zEA>o7toLge$HK{V9*2kLx}?7<^xYI7#2(;-3L|toA1g(!%}WOcg!3q9@dym1AxsxUy6>EAY3g>e9uw(+5GuUddS)o zA$Hif>JTp8{$^eo z5_0>JyizdDh^O0&HwV&taYcJGrQRkBH7s93gqS@|yW~Q+wdPx8EXLw|685qd89sbV1)-U-}e2H5NyZ*3JY&ap}=9t=%O6%d~*8Qs)6D?Zo zl=yXtt}V^VmKb;smHJ0!_h`;Y?lrR9fSh39sz+mz*|wH zAwafxD=^l%Ou+A8vo2?=ZD@C4_h{Dsz+dm03&mmoV(b-#6;tWeSsyg-GOH1x@{RnX z4hAQ3lR>r*MPA*($tn@VcZq3T6a1v!%MrbN#9Nic{J=8Z^*&9aBD2fuN@1e86hl8Z zB_5qT3VlCKrSjfRPWcluO?$nBZNzJ}a1}IxuKsJRsxLEW;VE*)>|)~Xf_`uM=!@|0 zN8e_bgTKZUi=|gDnWi!CyhO*IdIXJjpH)8mfNAmoEhMaDKF{p&Y9qzuqeG;7`aMLi zIydVfOH|ytbo;3g=2g!-%w(CB)2Fi%+OzSeQP9(+vOuIw3RSa))~>$oD?4aGlp!f}K<-sv|LxhjQ+e5z61uHLRCBodrwM zObZ!sIIPylg>T>36&k<)=2OZI?SjuOw1$~QtFrWgLV_GJ616x{SH>nSy`=pvXecN= zllv_@>ieHfc5iUot9tp$?@P!r5|?^xsB739A`&1Pm2azvSSsc0bgrg~a0Q*(Q5#oX z_&s6~{7RT6*WY$#-q}46$D)khpB_+~h%QHOICcAik(_NbJv#8*B%6b(yf@BvImzPL z^es2O+jX>CFQyG@B^<|8+h5RLo}f`eZc-6{WQEIPX@${$KsJQVG3WZv=3DpkyZX%B zJDw-s*fHLAi&l=8e3U6@X5Z*#%BmD4btaH9zvDX#vlrQ*C%sQYNgcKaBcZ#97bWe9 z`7TB|B5K2riv#lC_1au)dT!xX5W)^exz`oREINbuL08PTxCB;C_9n$zPIbsz7sn7d zi+I^}YTV`RSKZ5$cE$;9th@qVj`e+UHb05V-ZaRhlR(%`4!KrLYNd?2-0)agfUl4yXL)TI=>;?_ zD~>lpZtT=bRKgM(ASOa=U=3n%E{bijpW=jruX&3I!XauiaLEt_9TYkc~2xy%A~3m`9M;Xs2us#^l^Ao-v$ z@(0T{pA1^ZeOb`YIPQ0Fgr$X8INfFVp87$`j`?F~R!Ug$8LKm~$D9_;wbnrm8+Ne{ zgxpaug(_F3d8!6;RL=QE&j*+!yIntJm*(O7>naODJ$1Wn)iCCPR7eC)_mL=l^_SQ_ zQU&N>2jj`}3!=a!TD)5Bkjo*jMyxv%s)>JIqM&2KuL&-=YKD`8Gn7;^&A{+(>;AA3 zS*zG9zQE3s{k(V$J4tly4q2YK)efWC0UYXO%T`1W}Z%sI)g|_%wB({2@_QB~vorFy( zg+r~pQ$=UrDCwY4({gvl3re&fH(n;3W)mgtfKfqIJp(R|@AKL$l*R|cy!12_TfWLF z=Y+V^_t8;)6N_JL!Mct$a(X_CCO+#Yzj`^}g@$}p&OvL;$Ps^u#_M1a+e9A0Cs34| z^*YTj0U?lSHP`>%+S8$ZTOZ;%)oPMDc4QG$G0vRq1x4-Fq`TO1vCy!F_VZsmP2IXV zT?M(u0LU1Ij2s+;5|WY|U*BE5LrQ8IOs=x|aCdh%?pA(L+|+GLqSy;zN%EbD_!r01 zwQAPW;3VSCN@CSta^Ip3O`U!ESryV_a`Rv)Z4r(2$o)hlP{?rfyeMWM7{_O_u5rw6l! zsRSM^)R?N|qG`Z^?8}ZJ-N~ZZx6HdK3^*sV{crhZ{9g|8DM%l}-XE=OYufdJ;0nhV|B!QB2 zO}V&VigGuK8B$bHQ6aIWPM2>o*Wk_E?g}oXBg4WJ440E6)@l=!l)|>)me5(c%Md(T zEl&waJGMTellAWzPZZbnX-3jQe%{og!rCLn=L+a+1Hq;qC-M;@X$|PK8eFGJl9!Ca zW78Yw-e3B0rTbNzi-es&Ld9@Pcv0i!jZ?>I2{#*^2#GgJin!T@cDns9l28}Vm(a6s zD8#uu-CkKZ+t>lx)tvbsZ z=cBUASJ74THEVL9YajQNo=s0s$>*>cr?01{_`!rrxnpyRnVjqR z35Q`GxR-QElJi6*%TXI}H^-!Z$_+&!!=n_fsEfUVtANAj39UFH>d|JBrk^8{`q2^P zP@@c+{Rr*nTZGfDtCg7Lo@YgoIpy>}axNQw~e;b!W?}&HC7*#ND;DACf>#vNPpgHlP7dGSPFw zdF@s{N=LJ&iCyT`!{tPGSY0dy>XH*nd7a2~V?To3t@6)O9Zv~(xt{oL0WzCq z_*4CZtqrV^k8D0U0dTB8od|(S8f&>B(wdu_UzwO>5fX_-(!30!#;l0_C&`nTI!BfkL5Pc0VJrAEG32`r|oa` zk)J+|8D(_sC@jR8^-po9hwoS}Y&k3?{=7y+tM< zdrtWKCEp_G#z?lXM!=0}q-)qU#^1Y8&k$Cp9m%1paFSnk`)0-955q)}KQ!aJo}7Wn zKGGrALjOIENmOcTDm4d}%qL9qStz>cK!@q+YvWWDqonVer&1NxUDmJCu^b@2O_p0G zO1`mN4=0?0F2TF1E=)0RfB7c!TUGhK0oHPvZYvI{pi@by-e=xIKALpcO2a{0`htqVE1#RiRA>Yoq4Cut%yKEZ2rI!vX<4U+83o(y)Yt6x_u> z@+^fR-$-^RKfn5C&e14hJ&^L|%>dx4r-R6a$q0zL+uE$~a$8!uy%#C3XB?>Ot6Zf2 z>mfGXmJ0DihS=>_qLS!2h1U8nE_QjZ`)nL^t!((@&}a|br6udiSBy7?wBI*k+p8Uc(sa8K!$`&*f^ zT-8d9<6*E4-w z3Vgx_m*;KlKckV#D=6dwpU17&cFW)2ALLSf)PRyPGBM@K`Pu4DTr(`7cG)SuFCgoS z{%5{;4qG!&g(WlKX_ai^NTdC4@ZoH8P`m)}#@d~3$uGP&NlB@q*yAfDET(&A5?{5kMEntP zBjCqE&WBq9NjKshW(uWaxyL_0@iYT0%0QV z0M?o*>swY2om%xvma%@lEtcg^znhs4ZxBEQAPmkhX{_DfyFM-HQT5GH_!Kqbb; z61ADxLT?bJ=&hc!GrT&*KYM{K7ED$OSc0%GN}y%}3Lk1G&IOb+EqewdDU2Kk=k9}}ML1F;I7 zt8fp(VPEr>MD>qyP=?#4 z?PA>rM}mTC9B#8QZLy$xnFT`s#d)i3X?3*|nkLQ>G_T_IMEmnN$IyoI@GjrW(OE$F zHQQh5=LRG@P~>5=7C~BOHP@gmycm#)EGQ{4Xot^{s6vS3^um8jTKalKz{||*#2HsH za4I@>gUN-<6f$JSzc>4Po|VX;XMg#!>yhN>=qPi&E-prRkT_?{Nv2pfYRYe{rQyeC z*MQM7pdJpuVua+g#|p<9HBO}+*CPXzr7KGH@;FonPjZVg)id8UUtH-&c_^>z%J*$R z#mY^8*fOVDeytn@67c^RxKy(S)9M5f2n4rIgBJ-o(rKO6u%MRgvX5C6gtgi^HPpJnuV$|BRw4^=M}?m4IC7g&?f38-gDUSd6v0M z+TT)(4hX<99Zc^wMeK(2r{z5s=?4`ey1cx+_1tH<&{~|x#Ak)ndJbqmGl@Oy(bk`J`FmYZpQQ(JoW}AWHS$K`38pUwm#gVTXyoJTCx$EY zIaD3U9!jOGs;cQy3;?@wj;an|ADVJ{Od-v)IaIT&f;0U1e-R1A zr%7|}FsUihj%1Fi&8k)uJ5_S1+6t+g#S^_m4f|_lQUIDUf=zfm4PZqsfFgmSAJseW zToVyR=Fxs9LOEU3(G9phmZ?@byH8k{{e8ZSI)SM&D+@K7n#yisg=`P&Wm??g3oieq>X(c9&e?O#K!0BXl03YVo?;!9G41{(z`Qn>@eS10ZX~6gW z!5(d@vNfIi%WQuZBQAJ1rx2vGPqPC_c_#R`s&#=X6+Q7p9|v?)Qt!KfzX_y2UYLJy z9`t9O((p_v&)!Otk(}skPw2)3*BT)0r`(#apLuRrFajktem27T?{@&lH3^QKQ?r1` zTH4hmRpp8-D>WI;lKWsStmE@TRsOX?Hr4+ZS9_D~T(hdu{5q0W8kF zAT@Q$B{d_X3iHiLiFG)~Z!PQkdz%akNH_p{E3Tg8Xi-#>uluj>z}b^WmE$!)>Kxh} ze~C!Dz{E4V@dSju#Zlx2d{!##+0PULwUN9Jy5!>B23m|Y;IS-r5UPRg+9={1M)QAl z5)lz}KRbwmu8;Kt#J_$g@Zo+M>5LsS)O-y~c~m_5l->9jD;M6Y4aC^#hFFaHb^y{7 zxj<8a5W9ME0j7Q}dZ$k67r7Uu4OvU)EB(SEj}FR5xX|_TO8(eWU#cb+K#+|Ki z%fFk->#r~{GTP-6*2f6D*B)%mUIY?-cWb~g zEKqhJw~Vq>`0Zr+QWLP00T5@f!xVb6{Z*~hdJhVkO?e?Sm_lrUHuY%6j z1m%^?#6CSH9`P$%(Ql0c_Gg$$O7wxeQMl8FBu%j#Ph6Xn+EYr!>@ z{~qvQb+8qjuP8@Q89TqHDXUvNKs9!@ncO1&_%g!+fVVex^U$&GY6FODKe$u^fIbLb zM{2dz^R2;?`>TWIU7y&>>{jKgY?oyUHozw4Npe&RILbr4?V}l({ z8HI#qfN`iKbr#g3`1F7oUxB~_g#czC3^5CL6@&6#B1ra)pJz(c*&`!gyWp3%mWJ1B zyB^Q^U~l>Zq*4U<@!v{KtmtAE$A4r3<%{v&rSa^>)k_!;x8xE1mqT-yam=W94-v{* zdR6OE+5L&F5!BO|gIZ0S_c`=r`U&8)EIVmozx)8*|34uGrFD@e5T){JnSF#px>TWu zhllp`|0xeAoVR~gS#@EBZVHIzGPh7kF_0GHad)J|8Ub~?>KnVT3g@Fd>3F_jrHFhS z;)1MzZyPo4e4eFgldO!w7ns+6q;WVig*}IF(SdTN@nXZOelHzPwe5xWFfMM@$~p@N zbcXZ6ol}b6S{aj9FHeZj?~ELusc~kQ7P4KEk_0tc5HAUPl~=x5u|rF?rNyVao)?tYD3tSh_8Ce*WbdKmvZ|I+Jl*OAjuCo*SBv#ai9ywaxmC3-kzv8%c|y;>haZ?IwMI9+c&G92?jL8q zn;RAk^ay_Y_gmRj)Or>L=l<0gS&!oMLRj8({A*|?&xnDnKtb9Ta0vKapkdODioEqi ze=kwmvozaQtM>Ze(7S=N4i|my7n7=pl5SqkF?a=9#j0i0nKr} zcP5W!)3^Wiu)o81vWcAd;Q#9DJS$K_eiXI)ci*?9SAGDn|8N3- z)iYEv2uS+@O3=?U9k^2XLFD|A!${<|dQKdF*SzbaAy68@F!``z_NNy?w?`cb`t8u-7u{?3VB{!zZNP4(~T4%4>v z^q>r95}ZQKK~1Fn){I~+!JkErbb{nAKB~wu9;A`|{Qa4LGaAWNZzcK-3_yD9m5r^f zIeaLyel3>A5>?cXc>R~ySR|dCU`!entZyJ7eZ$7armUvc5%u@;#Goo$AN&jej;1gu zjV8`XPEM9M(ke5HKI^?W#l`&bk)(VD>iWIwv+}`_=jU%GtWj0iZ^VH77}cBj#6(Mc zYN>DjsOl$>Lra$PlCY7LmWHNW=K=MhYoqzg|M@EWV_2B3?NZkbxVGS%?YAtbpJ)J^ zhN@!v>vtD`On5@6nT@I>u_U^#@q*}6e?R6_>2#14`#$&c=eNkz zcP8>GKh|kv7q()cQ?xmH!J02~b>Gny-QRiXz#1fGM{Al~2MT^o3QK}pz;RbEjpuS0 zwC>!;5lZs8cdg$G^iA?I3KSS@D`f>UlKnL!w*Po)9Sy37CU!pOH1&GZ*z-D?5$G#> zPMmWIj)LJ45#!)z7tBDCGvZt<1evO1{GTb&at-%s`W-*#Zq;Hkgc zfyV(Yf48H4HzejJNTeP1@NX%q0w`j7R$NqEocqiN$7L1O^=-ON0Z7WeT2Ax^;{oC- zr=us;v!NPihge?Q^iqrIiIbx(OOT|mKP)!vRhzAK-2i2;c9$1jR#xIdpkOwUPBH1c#vHcB%X@FVQ3Om*`YF3+yJXdQnURas3)K=A09J;6;Hy=0f2H#+%J%`Juj)KsK(!3zDf}^2oPYE-D>D0$nAan za1<}#$o@gw5&TRB>h9y&&&kbmsw#;TB-^G79e=x81r)TowRIBU0m`!WPig7t6Cmfz z#LT=|**aJ|({&lOub;(9a;&bIf*s+u`u6q1{Flz{25(G@NdV3$%MkY%!IFV^Kev-I zE^2R#7q>=dp<&*+#;eM%4&PMZ#W<@m8Ky_>56VJtB6mx}n-b#U%s?)RS=bchhk(q1 zU{O2P-wEyx;vR&`#qdG1z?raPQ4&&VL-l5>(so(nwX^>nCNq%z&RgpXi;Oe?zZ7CU zsh0aW`!7wL>qGY}V% Ld7k%F+vEQM-mtt7 literal 0 HcmV?d00001 diff --git a/MxNet/Classification/RN50v1.5/img/training_accuracy.png b/MxNet/Classification/RN50v1.5/img/training_accuracy.png deleted file mode 100644 index 9673d11a04dbce0fc6df488c251d35fe90769673..0000000000000000000000000000000000000000 GIT binary patch literal 0 HcmV?d00001 literal 16190 zcmch;bySsI*FK8+AP5p0kj_m=w;-*s=~k5PZloJyBi-H7Aky7RBi#+s-Q8!QkMH}P zGk*V^F~0F*IQH1y`(8EITyxEN&1?E8$cdw&5TYO;AfQP~z+NFB+*d(BxMzoaA3U-2 z`L&3EAcQChd#U6+xt-*slwh2^yBc!Ew%VP@VfWN6JdQ7JaiY_}afjw<+_6Q8larKV z(zre!ja5|(H4WQ4$!W{SSyMRruDc|G_Xd7&;Xlqg)pOnT4Mz9?|GF#hSzQuHmqodL z$!UOXJKE!TjWhK$QT%70|TaJW(OxH4eu7k938nz-Aznr zq0px3=|tSwYP+X&bbfuST`5t?$#Q*PzkO43hq$81a`tq0uUYf(@eP?XyLjliyI;-L zyS25oafTi5?U|UHmsVC*mXySAKIpyuoFXu%zB-UDeuSC-!i$ra*Huq%!GRPF9o=X) z-+lS!##0T8kgz84@#=XxBW{3JQC*$JJ40z{>G;t@XMQC_1O%vt3nV^1KHOGALqkeR z%7h}Jhl`z^os%;om4}ImiIp{UbpPNWTq^U>w`X!PzU^pyd^|K1Q&Uruuv}bBEV|-m zco;_jwpmqELqkP%c77g)zE0Uq-Gn$-q{5gbFOJ%od%8P^fsFiR>c}imdByAKnP}Dc z-F!gr_I$Lo68jGZvAn#zBLBIY%oE5Ua-OsE1KDAdn}NwmdTn72BDMVVbbZp|umTes z<7fjTqrvdu;o;2ul<;t2Cw)D=CF?I$Rk8am-%@s-&9R<~HQeu+GLf{kJ@^>XkcAu* zJ^#%s(!f+#_vH>A@;}`o8LwP(zI}U4eGlP1va%?AW@hG4sQ$~B_ixj^Rv`%s0Y@h% zgII(YF%=C#L1;aY_O>=7ceo2z5D@k{;`+L6AuBdJ5)zW@Q&ho=c&LWO=fhh?tc-S?Q(ZYQ-ZUAV{Uo2&MkU5++fg z-ROCFvaKxC#1BneMT^i`L+qq36?}IiuB{CZ_-XS)=%+h}&iz!Df68nnB#<}mffG^? zhRnyyYqFJfOeW~AqNSy!t(_7YT4V&xaKSj-{IwZibHmNg#`eR)FX_1YP^iWL!o14F zHa;~q#DMJGbamyfR{ixW$}vz_R#Tq!-+0(MWkb*-yPv{pq%K7Zs8x7&+(|EtoxX0`3 z>+h+7F+Eq~7zorm^uh zh=@Cu3>~ZvszC{1uRV5haA0#XWj6qOCcPxykzavKCgdsOq_3}UER(&01^Rye>{--K zRz^lg$}24`IcZXU=b~Tf-Q6<#f%a@{Y^eTs{r?ymia0kcE+{~6{k>W__>(73%0iQ| zaB*>Qa9|u*`udBA7(Oa5At?XcCn6$JTiDr24h{XaxhcK-AxqrO&*lfW3^vQtr%%-u zwzp+V3u>KqH#RmVCnwp(tNLzfWo6c*Odm0Y1O(XG*yuQV#%aU5+@<|5xY^jkB&cW~ zA|Sx39HCSaYQe$5oC`zzpI2yQWo66MbaZ}A`i2f**wd^|1<7(pto1f731^g&thU?NAX~93QNb<*yjdISJlPW=@bF84BgND){Adm}}f6DsAITxRp7|EiG&Z^y;nI4HACShQ0 zEq^F_t~vqi6jTXsa%#$Yx=Po~jF5;ZAu+Lgi$l-YIGZN>EddFMVX;bgVaD@(!n-$L z1N+w0+ziaq(a{kj6B9NTmeG}GR?}m2bV7Xm*o1_xkaEzaFDCeSj|}$nfBP#Vh94~L zkp1}h*dG-Q4XwVu{_^4?_W1Jha%gann1m!DJ|0IqyQXFmC|pN}N!#Y-*;%)6Ga2zBWg9pwTVXjWcatoSanvZyF0H#aqE^+JT( zY8s!AP_2nC@t6fl#sj8t^e{5*w%^8DPj7H$Mi!Nll2Vlsm&u@XqO2%A{gdk2>S}hy zwXx=b>fFr($j2v?w9-{N>b9xu#?3ARBdX)-JNOVlh zP&znoJiE%*3{@tT{PgPSw{qW?=Z+?^)evrI>Q!ri1F!A-}!kZaPQ0@bh~_FT4^!#nIn& z>X?wHz`(!&?$~9ofQgqciWN-BReo3>&w%+y1MZ2@SK9dp`rCuL{tYeGk>#i zl!RpPP|w^v?~LdnQ(#b#=8rjNB|b7>2tIzipQ@muqGDoXRMD1Dfg2^Su1@5^%$2}| ziA;-Wgd|a{B6DtFV9ahgVco2S;>;;t2#~*mpy~AI z;$x*)5`iP6bAgSgMzvz1YL;Cx3Z`ib9q%w3`MheFaGBg!fbS5O7-6|w>+FD}&)D`R zMQuBb!7SqPgF~podl_LCwY50;bbABg_yMfIMrWIV$=s&}w$hrt$JElD2~L(Ml*wzO zb%-R3r&JXdMc$m0;l6Lmr@(OqgTA?zFijS>s}$KVtR?R>xK^AbTpv(w7?lOS9`f-N_blBW zX|7+E-T$(iS&n_7&6*$*GSgVUl>YP1RKlK<%-zP|xM=(&*AbGFFmNMq)pT^vQ8KHLbce~>AIXCyKS|!U zcQ;SGJZEgQC9CJt_})jxS!2BBpqg`?jpI@Ue89omVDb5=NVYMFohyXT27f1$Ps;|jw5Dy z1PmqW`8)#~7R$M)vSjI~UJFk$$M?TvZiB2vG-x_V$tSP<`S0W)O`{(HActKw+U zhEFM89ld%Fu8S{@$CxJ)6$#y5Jfy;Z8`U!V8?3?uJqMB;oTkqdvXl?ErIf zUZ#@&im9Jr+84%o{+^SY;iMM49!AFvTUzZ|_DvWj#dplZkI^eq6E0=-7(sRqe|L~8 z(dn3Jxq$Qpdi(T#*I6#=k1LVh2z5r9(Qn(0LkCf^J>QthKR&p-Ls-u*dD)Ly8Ep?e%)_dB4+C-3nJV|w9MHn4;^n!eHiVW z3PaxqOhEW}v1Uo+UG;g|)Z`Lmu9ue<=Xxh$^@?|b;E=Vb!&BXpx6%gU9t;XmIS72G z@+R8?>+LZ6wFqHPvxL6j`Ve6)E)DiLop#*!9LvVTnkg&{HEvdQ^hPI{#$QLFld?`i zCGn+|)Ep53j|OYJPVqV7q>V{f{6}<*tY!Df9G_Zj1mE^-2}_;xupB<{oIlA$VbV>{ z{q{`Vujc-f1ZQ$p{z$fT$+n-Fbrlmtjpmv+sK7t`C=!^pt%#NSW|#!#uT^uxnn0kA zWWZ5+MH4r&AY~wRC=)@~<9pm>j4IcG?=xT#xRtqyC3=#!vTiPOf^yVINah}Bsyfg2 zGwr6WY^BO;TWWkbqRN!|spaV$`KoM`S@?E~$2%;m8IDKVQ8hsaeynV4imQe-wY8=$ zT3X2q!hW!iFJCT;Tkh|L7KJcbf9!SC5;e7x+G26Xc)dwN^aAK2L&qN6qM4FIAGIeA zH(^KM##={_Lps5D2ztJiBTLOek#4kw+tS_HVf=`q9YsYwFP+<|)f(zkjO|(9G=()Z zt6M>QP;#4;ayvJi^)qCEQ%=FoFRs&%*F!tL?YNarZYCL*hCjkzsdkF?G_a_#aqj0& zDf+0v?WLuq$Vi;W|7`NL)b+oT$K#PKmc>~L%%)-sYOdiU-g=GwOUcN%r3?w()$gR{ z-O8$7P(wPdok-X6hNoGu@y$H&XJ}R{)-@)Xt+S6DNuN!(mgVERRZM&4UJs~7WPOTn zm|LtxbY0hj_$G&K*b=sMdtOzX8e%_hvs1U0r`>rftVfxm=_mzFnQ)!pn8Fvi&pddw z^)l9iNZ<4*`g2v!%%iUOI5zYIT$KUlk{B7CGxVWVm9ZHVmBMQxK+&VQ2T^g%bGt#Uc_o2-{`%=s&u^AgH?v6|3A z?|OUu?>Br*+EdYNuer_TpN10?6vQ4^o}4*}V|&$^WD1-WcN-Hl8q*k*@Tlfy$(WXp z!DUyvtxd7yZZ2-*9zy7;LBNrfmBmjQQoXsjsBdYRUsz~uZay_Q_z|MpYY6~av*~a4 zwnTpU%`?$71|dOxZTRk+ZjxM&YCZK?^h-1=8zSXP1#QB4wgm8cp4gAy<@A*G ziS$`x)K>{yZ3Ih@sOoD9CF#j;%Y5FPV8m!n>z^`IJXq08z#5J1EGyf|p4cL6eakmE z@q+|YvIUa@c1EB7AiSTLqUSKU_E5rEok_g0m|@Tf&FQ2f5Sc&8!P?wyx)xP__?4%e z-s0+Yl=fb=Mf6(-BUkG%+$p@$vLBpnmOpRo2w_#JE>~x4J;=*Wd3kvW2?^f9x{i(~ z`RbLhv^b*j2@6L*LWSrsEmFK|&hf^%f_W0bJOnI1ec{wAkJv+qL!7hMr?nyH+?;g(aY{n-!I^<*QN*HAM zlq!01=37QaUHdR8o*3cG9cFh^vGT z;$Azlm)|b;lTV&z$Ct>O+s!bbrbz{qV6L>mL6n1)s=~;{&Aq$5oph||>O1jC%o}o2 zY^vAZy^%ag*iPuN>gbR%FFLVnTx)H1mEAKtmRNuN^A=yWL$LbtfoxOoOrvZBYrqz{ zPxe0NgwzgWgnTKXm|KS~=TKAPgSql3w!vA&^$|>T*~^PXFRo^n5~gU;S_8M>GG3tP z2DPxS7Y!6^ne@;m5ZlSi%b#od!2k$Z@D&TnN`p!+o6NLYXBR6;@6GA$Ik*0nqVF7M>k*jyZ4?g2N_;MD@80>6@@$1*GI57Z;$HBn?sBTk}FbFl3xr68< z&Yk(SR3SbNm7^NmXM^{e52u0&cP{ddXREo4!nZ5LG)7!?3}eY)UjwWe7&ojn_9uwM zEFZH;;jQn%hm(%0s1_pD&*vh9{E&u1v0QWMeT(w*dzzZ`+QL3sa80$gifU`m&4M_l zUUOY=Sjn#0L{BCn$aK7%(iN|AyCIitv!X{Ek@!}+CA0ALwuvin>Pvn^KcXNzeoyhR zo6yvt3^n~lZ?pCw4(1g9fb<(Pu^d8V-YKLVM4I?Swno}1pXCQndz8zZEX;=;>OYd- z)|6Q|%94eAa{Z3^K#OBAW4b04o)U^EPJg7dB}2QGiJ59k`6S@{&663e;19~2jqH=h z!R;RiY6~n3*VmSj#5j$|g6-2tSzF#`ica=Z(gsCZLbiYMeo*O`rf3TKSQH|AbNIaQ zWkjR4YyEihazyBEUnUO{cZM>0rS($!++AE|=ok4k^r81O4eH6mQbQ%*opS!sv%jf=wVfh#0D@0#^*4uaP>BIjDVzXS_bE z5YBvlObw#*0-R=SmV!8D>uzu3++|J~ZMV0xJIjyax^lY`)HkHZ-gq4oZkBS9R1O!n zaJNOwVqzGle@eX@|GSc%NYT7s2=NIA%2i5H05DO*4`QXCgp{QGr2e7N?odF}Xm%dh zrm-J&lXN`b!kIq4H1@)n&~ACWI{pe}y^yOlkGszGnV`#1MPGz=bV#)l?@%lQ0b9?| zSgh*WFT;Fi@APW5(fWMEd9U=*C#Mx#-+%lxU(=y=_q8EebBnCH9VHd}K!)gvHx?e^ zs(@7G9@i|Pgh3B0>@_-~G&tx#SW2=tCM!?i`k?WkaKfm()e?jIT-dBT^CPYW$JGy% z!Q_2R{Ya@%A6d3W{b6=_2EVfmY9s8SwVlBNRc;i^yl88LaYkvnWw-Cg^tA~|A=G6`g0zf7?@n-yfMpW=(K z*0OxHOOUytv-3V$-^?(+UT-x#Pu8Zt&fM$~w6=G1oxg4LuUT*~(Y8Eb7<#*kwCMck z&#+aCx<XQdXlX{1&AQdO1+cxljC^_DawnRmI}i#y%D=&1~HW zO1L`oD>KFJc*eT7)^{*Q>w9Fb;m( z**xWKm-z}Gp(KeIO*@U1Y+eD~ymT2Rfq7eb8EL&84?H%r^caBlC{z=CrJa1|#zMCz z+t@63KA(d`ovAOe5J%I0+?&lamtO0Zby}fdvWVd&n0z?*al@{AlxIT5B+XRRv8O#J zNb3$eTCVt&JzCPdm0teO@fUk!Sl=spQ6t?EPtTg|;zrN)jit`Ur5Ms^%`69U zRo;;R5SiS?I4fnpc0EGIFr3mzBTe*~%+#7!ws1U<@j9j&@g$DMk`Xq8-D!a zvY653oTiMBWXsFHpbR%tWrvZlOi`9?+%y=!g8UmAX%J^y$cG}{_8eBZswqrtzT_R5 ziaKLqM{T=_c|rRpEGqCv2I5l%!UMZC{vhO3* zO8cj{!H?{3Ju{#5?_x&s!6&!?{#J5!KHFbxZ#-KFhhuk1Ec-hhgo{X@-O$o>qGVxGMZyCohzBj2nfgoC#XodD94C1$D^v zb#=f6UsX-b%L}+`V+D^3MVzw}dd}Y=CP2G5wNr3J4lxqjdg2ShArOh?kvFL}yqC@d zsUDD#^v8x#Q|I$WFrJ~#H505e4u1+C6=_cYMAd|Js`)1%HKzi1Acu&E2tdtiQilf~ z%h}8xU-`pKHf%{-ztkPGM$*>0!(JK+{1(0a6VbKJ&8e}m_GyrYUtL?H^=VEek|OD8 zbrUoA(Px2y+-8#`ZttP{{znNZLRT#T9}*HdS1I47-Ybp#U&**w#z@4 zyJ7$+9L0?n2D?(Xp0H=V)y1cO>9UzB*cT2vqq-paBg_qd8(Z7(u4RxY553*k+*DUn zQ&U%u;*B|Kb1(UYB!@)BPfGvNPc*hnv?5!kP4iDHdjI~hF=c7#%@#lGo0}W3#7e6f zTL*__x@w_b_<98Lv1OU!Ln#dmEWxLWj!}M&jzWLeSY@}`8@B4c--_2AURTF&XJ@yJ z=FNiJut+(@e8EY9V+aJ(KN>29`z`1O^UwNfpmmPh@jZ4R;iW_wnSnduH~?@ge;*%( zhd%e z8TuRE7?Xq3zpxSEl|`yl+nQH?Lyoqb?-RU(Tk`8gQ{Nv2$DCj2_l>f|D{su8coGoy z`CwGU>NB2S(ZP-2Z-Id;9r^RwqVF>oARFV!VPayKc2PTp@RTnIb;k?Eu#D-)CK zgnS-|BZP;30BnlJmSf;Ds*=?CJ{{kUEY>_#HssH?IzsuKcBVl_9%L}UIRV)PcB5jZ z-uJLIccTO)p1H=!QIXvorP&&BDvXi6c(>H06Qi>+QthDAeh{pSA>$9!vsQFn*g~?~{{f=bL>beWV~Q*TH&N^XP{&0Q?&`UM)mo_Hx}36=X1j zMD#&X4QNX1g_a}77m3Gg7{1L4@<$9WV@5Avt;q)2FRx~I`O=@x-r~S-gVbD>R-$8N zhc6Zl@xrtxM%BGAL>`M-g0Yq0PP?-L9v4Rinzi4)eFOG4ZgFjMW5dL;YQdV9g+*Tc zo*zsYRb5?udu!`48k&c@J0R-dUdEqLD^fMt@$$8#Z#WCM7Q-q&6z9q}b&p_m!Kke-yT7EKHMnBtw zH&DtF-K92*zAWd_2AX$JR?}N?Mde?CG*4_IKZ#uHUtIM$NQN|lxd*~OIN`x+t@zK zP9iq1&_UvRt50e?H6*31{pR9XK9}Qdwg?6{T4sa16jA4S+B3sbrIBjoD4O}vP6L_+ zy^imgpCll;Y5@xJ@_jQi9>5q|1+?mEYim=Ic`7;@SM8O$`sTs{ zyXE~4FT}--6<3|HC0nd7ItyB+u=8b<7f6yKNA0CeKCi}1?h+(yx^R!P^fS^(FaV|M z|7OLwALK&CeYKbLqf7`x@H{Zf96M?ZztZn=!9Xv;B>bQj?3VA#3_y7y=5yRq;13S9 z8VUz<_>-j0sM*@uQm?cEbO!(padTIi=J~;>nv^lj0CRxa4l^o32KNdir$n7iIv>)k zOGb&im+DHyBs(R?Df_0RSgFN|Nq1*eTX097HS$IXns}V4x=p55bRVKkL_c$BkVnOq z0=d%VFE2flL~}ATqY^F`{%Pmo;Q{0pa~)g2m)P0aQ8tDL@Y+%~PzISpruifHB9tq2(fKb-$c=Buhs>KCmG@tiz|~J>n%eP1+{eT~ zQm`NiIl$kalarHKyTL+N_Z6Q4zI4h{%ZvVavVU2Kn462lLK+bGLU^`MkfY| zXj0OK96WwPYQC|GzWj*I zOfVW>4`e_Ac0Vunp~tAUs_M?6n3}4rl-Cwdw(8ehdEV4&7CT|cIn-mpB;@_#=v$fW zR+17nvEEzE8}8P{J+a-}GVW~_5o#e{UJq*h<-QE)-xY}A%`Yt(*w_?RSD)vv#>U6r zd2V#j&|UUPJiOwEUcp^4S#SJ^7uEQ$tdvUxBfG5m*MnxoZ-3;nhuIu(`=0;KSE7(N ziN1JU+!ezDh+OdATj|RCSNi=eo{+@XfWz3?){KPx^_VTz4ny z@@4hWY6{LV-1_R%Pqw?nCvef5&c}=OkxE}49QFy}1+)qX2moWO_4P4dzad%+v^31F0RaMTby-A!9gJKmV zbYgN6US3{$(SLkYxZmo>C^Bmkh7QKMI)z+4eIa*aHL>fJgY-KA{zeia=;rCKxDsAh zUS1waVt3C!sBZzj?+jHfCl&~9gCXi>V`!|X4t1R+EyjOswOQ|5nl_X* zZVflq#Tbn1It!w@PMrEx#1?`G`;)C-H}flU;NrSjHFhMZ_tf9D)q+0_{VaOU8Y8gb za)ptrgL#bbTOrM!3R8=6yb6Kg>%24SEM#S+39NMrnjoH3cUC;6`S>5THGgMx*PYkg zt@;FWIw`KSo2$r}if6`__>cV-?$3no3jfZw0ov_F0Ejz$e6?sd^H1Sd>zZQNY0-N} zlcPIr_!Cjk3#_^1EopH91fVH*=GErmg9i_MFvwnNbsp9CZ8)Pop&TVnAhqXjpCI)xY|O0_lC^(<~`19S|Jc+uc2V z<`%T$*G~cYta`(GYc|csCHs#luS%jB-1YmH-=_$iKiK*Sp`jxI(|!%doYX5t%LUvL z9nme^VwL~zOVp^Zh$Q7=jgu}cJW6z&rl&j}SlrpQJKdlIspg;MVL<=)mp>GH5KFrN|?o%$-n&E|0wK;i!ELj$f<*;tO3U;xZ{df}G_1E;Yz z1td$Z#z0BRM0eF&dbaeE{7!}61D3F`kOIp98 z_0CVqWQ2_MQqaKKJSNQ4fBv)jvGmGHZca`mX=!tyJ#XK>r4kM^5iy7J`ZyHzEF@emSRe_jiG~}p6vI=0-mX=-p>e0 zxZ4hKY_Uc|f{aZYtENaF> z8E{bw9oYSSO@jM2NY2zWH!3RX!-o&RX6)@9ktVyixbUJ#P}%M59WbO6O29obU084> zMbl5cz*h9?rqBJI84)2@f+e7d4h&FWB10)Dudl9RmjQ#6j*bph&_lT6DQd&Ahs5}4 zlM9xdplXre1;&%@=fR}^3T=8E_%ll@aw)gp%FCm&K6h{X`uc**fOm@Es5JEIyX0$n z&v|~UPoK7~(kRrPH`4wUs7yv?X0Zz6N<~OW2)H5}8XEHRnL2F?viWm+s3D$4mxBXG z0&%sH@DC8dwWGgM8tk8$v9z)h&r{4(n5t{h;_Jl&x%lSRkl*1Yn| zaAdO2X13?gKmM`q2+-+0-&Q>qmcqcmK!Pqy3kwt!6u7Xiu5M~v+=K=mjDO257=}-5 zd)Z1el!#5$)Xz$E1kPs#TZ!x;{{4%JzsYfcE_$vULP^#1In92h!2WAY_0cOawBW=)j5~7SXTN0U znyH$KPmERya=86ru@2Uod;fTn|9jO4zsU}1r$Du`6(XPCkEOnD1qazlM7DqCKfUJy z$_2#A(fu8#hxLJYiGU#%S!!)MAlyNL>TX16#LGahd}ef43Y1#z$N?YlY_{R|I^ZWOvI7XLtU0_hBQA$Gmx80N&PWK+P^D`e}S7p zL%Q6*z4NprVE?n|yj~rk9s-4c<&c(z9Nj^PNrLg7XE#D&$mz+$sp)@3p%$u{Bn!Pt zXr`!PT6PLUyj=8pI}jYO|F>h;??0==q0_6*iB|H*Eo`fkE01gnEdOplMq>K51l(Ao z4-5=_FpHODs!M4|4n#LzesC~C>#tOdz;3i#iCxvo05831A?$(x--J@uN#9jWH| z?|pkOF(LuqbtZ*E(2vV1SG1@hvmtHC?0?!p-#mqcBhDQ}lfcHWY*77J&)*UMx1BWn zw*3uFQ)){}7&5BaWq<3RsldK!L9eFQbKvUYxE3MT$7@vRnSb^QGdJFEuPT76mJ1Gx zCCUA86ZFUPdR2}+|7N!fO`f^KlRS`H^j7R&4ymhOQRB_Jj8uU4Y7x(h(|t${_umD|!}FiqP&Hkx)vrzeU6?pz zl>a6f7JIXY&ikJi72&dv5+vcRt#to=Q3xU>n%F`Xfy{SVl>PX>U5ae6m*_}u)vita zk1n6Mb)7`|U84y6ozVtu)8JBRNkpDNiAdkyW%2qK(d~#}%@1YA{m<6H)D178OSbI; zz?BD>1|Y)*L#a@?+HM$Xp8XwH8BXmt{`%p+>)oJl`Z0gc(Hix?FDStg{{0bQ5^w-` zgW84e?GGRB0XDL|_FwvL7&747Yiel3PW=Wj#A$KTkp3JGUnNbLimK}R%1YZbF2EIp zNkh2xNr0&o0`+YQiYB4$fqR(*6ziDU%fMde1l$GZ-90^VQ-B8z$^gy^LEYFFF=(U& z6&P4lRMcHi2$YQR^Aq3Rm46INz+rA~we|G^cEl7hU9DbB;NdYA1^E0w6!@v&W@cuB zrGe6tL?k3{d_eMu zl@Da5TUs(eo`M_`CMI@qelF15*`s_vS7~EmLHGd*r7*0<9aT+51(X9Qh#N+e4;r5I z0k8j+Yosv@1_NO>FYwnt@-#kKSy}nn_;_%5k3i0<0ShG8r|aEfj93GaA?xhLm6g_J zX0J3pO2j z0c0N(7}((pYR!D@7o|_pm4tTK5rMgNp&51?u&W%-%Q`ot9QS?-$O+WC~Ulm--(Wl1W2F- zz&Jo<0iYz68Q9xLt^{|-i-(XN9~?}U8izzjzm=Bm`WS+Bets?*0#A(>;`&JUJB;6m^< zov66D`1R}8080V|uNr%buCn18AQ3b^9-E%N_!tsyBB^<_*3tq8Jv257)px9>c-@@s z>$^TUg5oi2=xD){V?p_59#}{idFCs+Yt3*&IXU!@b~^`$Od;+~B2aGj4+0~j@HwvN zhZp@rL(S8{fq?)vN=fBCh;~nQTIr5MBm+Pmm38NB|6|Bty3p0$1H0Oqn)nrWf9ubj z=M%;$VOOA{2&6pP8F2zyLCJ}wxp}&GhS_=i^73+N!#z+QhwvQ=lYohflL@%mZ;s|? zR07DgM;0|SjlPY>p}PGdOd zJASX5I(IP%mO*f?Q42Myq1qi+V#tvDpn|T55rT_{N5*5D0jhmLECGN!KvL_%q3DzW z`P+U%zx#xSNiS><>~(OF0gSC=OrinVHegAR{B6 zolIE+ImdL()Vn!ZSuv;dogN+zjg9#r1CsMy!LuZ5MjptDCGooqc6R!m8(Q%|ses2U zQDDGsZob*w6kyZY@+q?o9+wlP#-=nd7EG;e70HuY9=+p0U#(kGoS3?2=`wfDPoH;y4+@27lB7<#sFZJ@ZjJ5S{ zx_HRo1=heOUcfRxg zJM&|l>-Bk`T+fPo-HSkZSus>(eB@`(o}o&J3oAZ*2B-Gy*>eXZIN*s@!0N`cXNq_d z!k?7C&L6e7IAYDTK+|fxV80JSXC$YcRFabpwAyT*HB}3 zIWl#9lm8@0c!gXjjwF%q@(TD|eaGK#xz-sOD|l%A4GGxDLXP@4?#ge$IBhzT%I!{M zd}7kd>JEKaWd=r1?|69j7WnrY#-F(`2?AfwM3I26Ur5h^Z(Pzp4?r(~FFoHsKSSOC zU;ihK*H}rhgH;F1{`NO4sHiyZhk_Fn96XnXPV^yNAUG(*=kocLj@zirP0kaEI7346giH=C_`UW_EKM8#zSa#oU;*+o=Kax&Y{m-X;zf2s%vv%IP*=~&f}Mcv%IFg6zJF{rh* zH7$+!2%>v%aw4|{rlO(gA03s~)J!UcH#avo9yQs{@_I0=9&T~JHpRk9_w@Jm4G9Yy zHY%yB<17kM{C2#tk)@_tm|9dsYn2LtaE#C(ARvsPp`f5(p(Mq}o0^*=zkp*SfA%d1 zpY-b6q&7YQ0qruJ5np9i7AS3EdAYQxs3?`?FadA0L&1SPvAWaui>_eA(Y@w}GfFU9QW?%KD|1FcHbtVzcYJ5~OG8jiTc6BT_B;o}PSZLJWf3b8~YZ zXnyjTJk*ekbl-k?Jx&}@_A@^i`N z@msIQcXgCGrUnGsh^Qz*Zs58o(XjSpsf6T#t+U?0wVkeUU=y?lcc}_*D^a}lDJ9>1 z>su-{OH-++Au@w!D)Q`EEJsIB5b{1MxMS6U`dj+3;+}ufTf^ueW9}-9s5OOEb{3Y* z`hbKq44NZv22s;5UxeCN*x0hw{BLE1gy3!HOG-)}=EK6!C{B{`ax~P{)J!cbE?PU_ zSPBszM~f|XOnrlDQoLhlx%6Rv?|6B6MRbANhs7?KAZ=`FnqO8XhjK~Pg*~ZycY6!Q zIyg80Rb_iY8f9U2+M=S}#iHVb73+2gC85tUGz7Lfrc{6%`bueSX)S-SYP=tYojy_Qd z$kuq-s78OA%gM3>?%H4tJ|UqIr$*kQ^LEXMmG4Et+aGM%d_TJkoT(bJvtP&ndIyxe z`yGs&ogTrXo>Rf<8yt*+wR?ED>0obfp9&^ReqRK}Un{;(n?fou$=m8XQO(ZFQ{sQT ze=o}AP(uDTaQ%%6g|W{4q9|7y4fAX;GdcckPH8EF)pyDlfY!2~U0ATNu!w^|&a=2N zNnIvqW>g3D>)!7e_=cx_s3%(>ARtH@MlxA?+Ti{GA}`DFq-kyWbuaVf%LXw0;+jV1 zBYfAubv^9HZzNZ<@0t>3D&z1liJuR5A?>JB7}(lIluB7IH%n+#ybJ(T4`@@55fdK| zZ>)`vk5AHK?&kvpf(@nWV#Z`YA6YhL@9_0~amUKSq6iLK3$>koe5YEf#mvs0(vCED zD&D0aFf=q2EfzYwgk(~J#anuF^VKW5qeIY(>^m@SZwQ)?E&)D1PZ7p&mE>y^6BDRm zMI~%cUu;_mqE=BFP4GD z3ast#_e%$(tHpYWP)0X2G*s+FULP-^prK8Vk7qufD$G;?dtQ_IYhZXdj4vr$^+$Ghbsg$LQg4&v<4sccKP=D4Xn%O+u=un=<$`u}bX4%HVac(L zELIX6Ev>4gG%-3F;bnI|$TGra?l`Rx8Xm61?^k#ktV~HmBROVotRwZD*0nY)EDSjC zqpH?cFNQ499rc_Zx#O^LO2>?E-SB@5*JpA@#_*8x+FESD4D0!R+=>t<2edvW(g#UX}_`i+pDz72SoZpF(x_Uu; zK~~nr{{H;jTwlM7lM@9c<^25o^yDP~-*H zKx9HfK|S}B75E@JF3!Z^u_I|XWg`Q8-g>@z zukhAZS63Yq$Rerv`BUdfHI2;75+Wi#TGjly^KqOU91OIySsfFPqgw-U?(XhsS^i2e zvdgu=;NUD|y5Ng|Mt45Gmg#Ag{@1_<898$h3U%(cG&eU$AR;27afdZydg>hC!h>F* zbeAZf74J0=&{z~*?##~O>i(La*Qn6U5HM+3R58yF4Grbs;BbtTimQf)hmV;U8~e2M zoZSgI>G0^Nsi_HzQ}wRPBy(iJYP#Cv>J<`FZ(m=+$StUJI*pzFCqH0mn(45xupBX~ zoy|lB_=ujFInwWw)c(V5 zWKXI3#QBs7YzO@tM(G>SW`pZRt|FzjvQC>WMPy%O1c3KZSXNfHzDz?)i$y?Vx78mD$Wab41_OpC?xcb&j$Lc=9h&&Ex?E;uWlbW@`H>&&-i}#Muurb9 z8;FUC!Rlt8J@4|DBy5M%8DoU9cEshQm(bJEC7X!V&W<3tHa0d=-{=isW>FJ`#m0X2 z@`AmN^#DdN5CC}u-qH2m!t41Cq~5w*0=7cR(UGmD2slp-b_*dwV&Xgw3DhKx!0_<8 z>S|>V|4#{k!9uwSF)=#$qOTvBl0uIi3>cQzsHnQ9B_$@~c^Mf#VMQ%1+T?E|Ni3gb zE7MSTMny-Pz(_xHdFur6GhRRVV0@4L;;TG9HTC(Ak0!KN=sfM;Z;cDwQ8P2MrFy#` zTS`JL_FMgc3+U+NWHtpCcBeUaC*QWWy84k~PYf_HarOLrdwbp8-Q<2vO}qp{Y6=P& zmy}wrt_}UE0*pFoaqcj{_r4*L9ASEP>BB$zQWR-a{`tSZ00s5`k7Le7sI9FX7#LVv zTg%SQ?qTfd*%BKY3nuN=`xlni_T+UwV3aN=i!0hNh8Q00sp0vj)9GX!^_QGVH7AVm`e2qDR)qLUINfJM1Yfyh3s@*NPrP_A(Id| zknHC-%=+`01SyzYMEK@Bw7jHbsJHhgJ)kFn-Ia-ZHA+MRCP#>HM8MCGretMi?i(7y zLiY3V@qxi$z(lHFiX%%rC)f576=&n%P(*V#vNbd`^q2ky{nO{SY}$6D=kxGD2bfVE z|A)W)vY-9ipI`QfOqp%HS$5KRzFK~D&{o_vXI@QQMa=vI_4!!Kf-8o{xvOKGZjxej zv=*d4=euubwe4LTM2P_T29C~e(&P@iM_@_9D@NC;KXhDe;=A5SA^BZ2OG}kd%dtBx zMV6sUma<%zA?}Xpn*%0`MtpOxN!^`@HV&!kVq!zVK$Qma#caMNDmVPj*@{6{YaGVK z2K!$Zhh8&ENj4rW+l}4k0elmb3ycC4^BKv-E~T|A7h*jrZAp}m``x9)uC~A?n+-g` z{CRR#6cW7zo>vet34YTdh!Pw>k&rZYW~Kdk=kln>+QN&dW#hFm3p)^-;g-4FKH)mr zZdA?FewuNmItY%0*fipqqk~@T)&M6tq~zExXHDcfJ$yMtu&`3QBD!b7&_8`cjHU(C zEooCTYIG$_u$uF*y4L~uIbQ9}%hA<(;=DZ~o5=AtbDgT8m*ez~a@JB<$Z8YOr&@46 zu>4Tm0P9F_(lxV67if^)AkF6 zn+QXuu%_5!WD_(JX}VI5V%#+L^JtY~lY|R+1dJNtV*CT{^nIVTaFF|DyEdbgLLdDX z4^(9r)Mv^Z9_g;OiF~FpIfc7itHO9`S^XPl=Jz|ow(+NNq+Y(fX_07bQlpfzFL2D* z2Ok~e5RSv_APfjVIDYgzs+3Kl4`Jqo_NvyXox4ssuVK47GU$aV`p7E*>+hlA`2_pB zn6E#MQ+Pq5P`vOvf`rt9XSKqR?=Dq`+Jk-*yx+9dl z;+-}jnt$uDjzab0N8AuJjcKuA#`K;FdjY0j;pe_;SobAhVn*W=CBGlDG9HU|r6$YL zPygg3tiW7^_PlYeu$*PRy^ocT{%Y`&0mNMA36g;&nLjeMWn5MVmtqw^$r0Xba~MX# zJV#X&*=I#*z}B>Jl06nh{stgK(D!a4V_>g#?MW-HB84Q_rXaNjVBjikW@fLqcHMy$ujduP)Snn`?VLuaq}os-^Rjuo{n)(L5a4`OaKA=B-E^&W`v8cdf6vTlTT*G^W5DlZv{M|Nd)U{V&grj8 zDO$vp5-j2w%7b*Fkd~q-218dbT#vO87uorqCTK1dYLD3Uy&Ke($0dQFI#po0+FNW4 zr)U>vuWeO#F%R~Nr&Itj`7ZXFbo+asSRI)E2%bq0msEZa`X-Xt{Q;WeQhK7W&*Qz_ z;W`yYYo55`VeWG0fIKf)gT84_>~83qv(R2SvJg71r%dhCAM*mC;d|!8S)o0$q=u%s z+9E_fQe8V<=ZvJ0Z5;}-37{^sfRJK0{cw6ZbkRBsScdYQo8@n}Gr>Qq@%AX60NP6; z77x=$#AJB{EOU)kK3>UH{acUqv%i}ywuM(lp7SaTr}gRl7(0hb38B$jIsZH0T7OMT|NVsu~hw^b)OEDyfRh8Jel}HfTs;Ajx&;pW$nL zctpKQYm})75>6MQ*1mVaR>Udxj)N9Eaw)F~ELdt=we3tKi9PMxt>O^5V{*zV>(ZNB z3n%$u{IvxEAIUerAO(%9EF4WYyMkHheM4t;ChtqtQ(`ycFfRv16dS~abq4%C$-RzO zENgn#B}7MVzF1e|eAG0EOG%|MRqxJd0LoM}&|mL$Fb}@gZ55+mI6YkAg?^G~tqW?vX#s!Bnq|l& z%`-2Tp?ouX)h=!icVyUHD>*+iK#WNrZk&Co1&D(KiEEFT^7BGO*AIB)Cz_a>3SrBA za*uMBP@cLY!o0w5S2INS#nyXiD5Fn)GpckZLdESrYNOU5{yrotwZT-eFAB6SWcPEu z5j}79x3|&rDNW1&2-rvWc#@4ZzS26U#aohXsHyHqB_zf}L`_G~r=UFhC-Fp?>4%9= zIwJnU`qmRL!a)m>X>=*MneKs)xKXAFR>GTxwa@YmWeVWlZDmy**k3PkVJw zMiaHzy^mt){VG~D(FcLtc)v&R#)K=R(!joEFTJV4L?s3sDkAJiLbSy<@-y<9;z3oI z9~FVC(gi&wmR%$XUQhJ+pJxrwQAN#;A)>wJcTwwffHxqDq+G%G!jCHg!@Ak-+5dW$ z?6A7LGjYZFEt^Z~Ik_JYXj-BZs~?eoLiz*0|Mx7`0{uG_8!Ew_Gsi*-9#(uNq3`>V zVqR!kTfn}(jqAkkzlOle(=!c><7SIIFD2|CaN>YgFPtTEPO`riNs0RKKkshM|FAT? zk>k+pLn6MK6jDsi`Qu;s^w$JHt6$i+dpq6R`-cmB{P%f#kQKVmu$!T8+TsVe|J5x6 zzJsp$R7kDwf5QXwWbs*L-H5B{plpm`fyoCWJHqx7O({@ zfS$mXx1MxY zh!j~5&nCXF6692PO@SM~A}u@#*?4z% zlCu8&VrdJ;B792={Jq@C(TT;+F|60b^d~l6OAege)0>z6Gs~zIh=!r)^OB-n9eB=y zPF%6uZ^uqAUHrBvysH)kc}aytaDM0z{5ky92VcureAI7tR2BQr;l5rf|5tedT<~7c zZHqUlyiw{=U`3zrsXSf_vhCl7vVOK9q-_MZ;5Y|{`Ki?0)jMdqdPrOe|2u&-aeTJACveXiC30bw10Eeg0@QKmBzAEX2%0+MvuMt6`mL`|Hl zi+TSuq~z$FGuC4HZ2A6-Kkl8t_4F!=5|;>v=$_v0)DjPY_kO>O!Xp#NxG{|%%j)T* z4*hfuXUdna?;Qkl%0^r2Sj71tzb&n$?o=vGD5#EBy@IDEJYOxZfGB~OHz?w6FwdWl zMXL$sNi%wKvQ+94iDjI-Tj@RJGjIU-kKM$Fa!bxfXw#t<4DtCtlr0~bPG#yCZ{ZTv zb#@I#Eq+i?6ll$o;jo=baA=Vo$)t)e*;#(#xUtRr^)@w-J=)qF4_#qaWKtIfa_1m!8P(PXCQh4Dp$(j10S2!ld*nWhU?DpKpPB?ANM4quPy zqjidTdARkgNe$WXmxu?+TO%rhgLe{tKdLeHq*jB+Ip(iX%F0Y*hh~Zj41dR&Z%X_= z8-xGUT4TX2v|roOy`qH0&N*$RW94di)#hgFFC3|Bx*Hm3fCk~4u@ZFg`XxAC*v`>q z8&R9dQq|hkzAvo+qLp*ceG}~$H6#WN;#~k!wnl7mFNGRh&NFrF7~4uOGgC7b6%5fA z$$*PxMh2w%q<_jJieI1H^Vgq5-u}uWJL-=qpt;f#>1eII@!UGwN3|oS$xVz$FU-u7 zy>byqhqDSKb|&|ljUIfI8b~?w-VbsORusF`JW|jy5A`Veu)Y*^ijEKRUU++powK&9 ziYb#RaMx2zo^!m*nR^k{9zSDR*TO8I`8vz|^?hCAXx)u6_QSp9)3v%}OO-!8CL%1h z#Ojr|Pz94zENR;sXF{^Q{TJn7q@M2X%d0Dd71UN+2Zw(Er^@Q;;-VtW+?P{q<3sMa z>PRA9!0n^1Fg?*e*+6#;XHn7*Y>xO~#za%SHTenRFe2gYS0dw*RpCn*3W+p=ejkVq8=7-a&zK>R<>> zLgQYVg{N%Qm${OviY*AMNwg6BQ~CO_?S9WJwY6ZkXj5jd&9R2Wy&G6(b1K~knQYAB zH&UMF6dzsLUQDbq#CV4?H(M;)Or)z`Omtop;lTH$`ASQc-H5kbf69njTq4eC+vL%7 zKSPI*#Q=avGt0TuXj?5LS1vR>&?#BeNMadY;ZQf~Qg0PYC@$o;1qgpZqVyve}5-A?jUsqSRL+?8M zLYp%BCiXhR+x@K%IQLx~hjQtf+rz%o6W!CcZAG+I`%-+K=JqyZRx9hXme0|_m(VtP z?fdIQxu>(SQHS;}P3}H${NL#GlEFW6^`8*$vjzC1{9o5J7E-ru`gYFiU zc&t4f9v0GD+G>!nNCGd~~)Gr2+C< zehUkp{;50Z|77BNBTz^N8&=e>pZ{HM#htP61#Uzxp#!ee_l3IOOHDt-1-F;Cw7C&T zZKvXC;Apw>r;?A}RJ!w&orlJ_fPizfp2_;`#eDcpbR%j9rek0x9j0O)KCt!>zHE6R zNqUV8e-f*79#UW*SbP>VXhZ>C3X{%yzfzB^@@>3Ct@Jg;LORQQiS{ocr6*B-1+Ur1 z@sPs@3fPKFO0zj$hB6J1HQV2fzk}kG7=TP6IHXqzhHsy|?mv#~ek*Uz9$y$!J&AxN zjI@r=uQuI-IPi_AIRtsQjvf*+w?+BcvV|4W*XIFkX-VBb;T}SU;qD0Nl~Ch6O(Jy} zryHqJJPxEBRjxtNnpuyQ#E0z!w7i+6z@qU+kyvB#-VFn>*F!T+Csy?~$%{ zGRHUYk#v7`Na7O|W*L4-iL_A`@s=m7Dx~w$l^JhsjM*4!P}LyT*(D1l;D`^&tZ z!|jbi!6(l`)z-eE>l5LNaLlRH3N24h|1~#vyZ4SVp}4%b|Cox zH{939%*K}NVc}>t?qSI2&;%bh<1n%_$WbNGSK3HO*GFIo`aM#y0M?Gy%3G6SpXX+! z;up>ScDRRX*b>ZeuUf(RK!$H$Z^x-~ugLir-Au#C>Czg<$mew8r)>^+ZHa7ziY5X> z(vf`G!Z`5Q^5cv7kDK3(T-v_TaY?DBV{ovs;R5OE7Vzxy^6~0wI)IB?SuM@Z)=%z# zpvDKm_wE;ajH-0B2{Kq)kfNvGoP2U4=ZrYdy~{d$@kybzy38fAu-#hKS>5i09tiz8 zW);WS0}MdaJ83i5l|Ct#WwDQV{TZk@wS47zF%Plp9qJ}7LOAfLpT}XP>lyi~)K1RI zLfFYUw5()Wcgm=>b030c-&mYB@%F^{w>;b*!2_U0mI0}|L+McePZ=!HgkWu21qV=- zPJ=jGGHy>QFAa7C8k)TEuhyyJ!Xi+0kwDtlpY^Lp8CMU?*sx0X>|KLjaFQB$O{pF2 zm%U#`UzmVHPW{MYg21ayfU$BV8cuV!cwk&M^q)~486@5F)aj*OJw}p+)4Lz*HAHfFQGS{Y*`-B?TL#rHSvI|4C8mxfL%iaW!Cw32}3ri^Rb$Q^0L7T#0a55-ZDgN>26 zs6y81G58dig+Qm817aI!RYRCAM)HVzyCr4W{d_!UOh-{x^?Bc_vA|mwmlgy z@%BDnmE-s}vEy^HPpzHvY6?3^R*BEp7n4v{{Tr&D{u;^2I&B$WuOI#Ru&u&vUB}>c z_d2%mU8hgJ>bu8D$7GM01ZXJ>k&#(|Yb+$IEubd{>4eY4v-XTta4G=i?$oK<6wQyh zZN1qH38~f4Rd)7QFJm%EVLAXwR!etFGteG|fr=ogSd#A16eawFo@TTZBiNr!CGW?H z229>_(Z`)u5jlu1uZsjSz@-lB(pkD9Qc!@Z-<7(7uq@a6F)}=CrCUj!WE_`9Cuy^S zUo{q%hu|?Zbx78F+d+QLo)s6v8ISN-?Fs9ic{e2Y-n87Y&Owp zg}kEOOk{THQ904+vkn-7_V%67rEm@wQdh|DtQgR4SHgNZ{j+q>Vw`Gji2&z;-~wyB7D7*!W|VAVrR_%{1- z#PqPpVeto(JG(aZsBABb#0O;aEM#(j{f!07p59eXwUE7f3c$e_BYtcd_z5}XJconD z(FrhYO56EgsY$)LMq3FPrXeU<+lQ`NL4^#x)Y%p9NKs9md-I)@cz%`HWjqjUc*P<1 zr8P;M75e$pep(-_%L%gC84B(JR{@6i82i;2d;1^h`B^*04`pty!aIIw5yMu9O!?r& zaz@E1?{Hz>l^)@FnlUnQYxFtkL;Tb5Z^IjXI{G}c(s<}cpUKlKR`?2mwflq8pTv+OEiLeqS& z4Of+deavELa+dt+)b@y&b_3qn*`7KNgB>Pg)C|u`B}09gW}>xD{8nW2HbxvKVN#4O zCzydfFsY}3;r64+I2HUW8}#L;-=^JShW2#dF*$k0t&@WICZhQ~zAp}HY4w&Iba=5h zjVwL2fh25H#k_4-RjfU61D7+a=iz> zdykZP;+~>6qLE~+Ga}?dx5WZ>1%=NXUSc*QUvOL)i5|CNV-UA?8HZd8NV=DybO_SL z7)Pd(YTE^3NQ`p--CAFTiil9SCC8cgA&KrJt&7N(2i!N%)L$PXPK2e;mtGQgTNLT2 z41oo=Ot_NB%7gNVYOq!Ee4qRcW5A(xHo4w0uxHzOi$ zy&Oz$vbj8R7tA(LD7mNM(>KdWvvbUSofFEw1eRcJAhr+TV0`^R>lY};$G%^)$W*h7 zG%%n4lybBC>9S~UOg9hFD$l5}JUZ$5D|;#>Y36)!I?{W?uHGBXh5btp+L`#*idKwE z7}K?=PIZPHm^wBCJY%t!`f{7$z2SRpSS{~D-iY3OmzS$HwBbKJ>8-l%w3uldSy9;h z(Q!w3Fqa=4STKxM(AJq4%)5}+#K@z+vyF(^MdLN1-%$H9AtLRQ!09wb)34XaOAzt; zbaFGd*qG*94a~U14H3)l-jbWrbV{@z#fS6O=;ZDBv03L93FR1~Ly)+|s5tveq7~(( z?r)(gFLgsahQXgOQ>m8C1S(#hk4<~wy%NNE(PJ&E-)#s{rmPhoALFDW@aPRCr{M(+ z>c}uN;4Ji+#6>MeCI_0=uh7I<#!4&f4IpC1*tDqhcnu#whz5um$5)9AgWRYEw=(4K%isX=fj^(6fqfrmCX7~|)rOiSehA~<2Cc#V#bOFdF?RH9Z) zKUuM_QYArumaFUMX3S>sW-f~R*f0J))v3`*dA*h7>OF;A&yFk%*l#{SrxYAA-_jB^ zk&8byk=)KCqfkDCeE51^y1V{y$u8urHnDsrieIpfl>$ONEi%X#qxB7(`NS;K*h{N- zN~vMSc~w5?M?5=umsn5<&7j|y0ypK38`M4@_lA#Htk6GqWh}lc9vvC&dc&T=5`@$T z2Zklh8R?$yaVm2`xR?_qBA^22XJHhyU_b`)GdG<-%X!G|_EF(y|A4oInsdAwaAftX zOpma%Kkqa)MGqEJ2x4~1O<*=5-8=t2C>MXb{I#8-!SDruefnWA(8u@(hGkP$EM#Er z3_VzL-4DV^1rd9EbXQYG{&F3Ov7O8HY23)v|Lq@0RkVIn{yilPKB288%x7A8d%{sN`3BR1Y^}8n%=$dVgZ|=jYjD5N-yK<580t|`yFkgOwt;Zot*`wfLletmc9K7l=A_!eV z1x_y#N>rKPzaVT{v~2q`cXfljJ~WP12Y)aR&(=WZsFkq;$=%Hj85wze zV&dZB0-(L9e&fk9SQGd$5{=?zTH9ccdhOW?WM`@ajD(G-uU&nQYvKN4*5e{<9cO2D z-ri4t_<6JCYpd-)sN_;70ZyrsQr7!^9Pr?Lb8|#*c9O?%6bh`**a9~F830-eq4Ks3 zbpaR|%>q&Pr^~D|GJo-5+_kE)$w|lEQBn(wgQ%#t4G(({zSUYvN*jlV9+$fcG*$0& zZlMs$hSjq7btVVi7t$x<>3nn;h5LoQ2n%E|)V~0^BSz?GR~Nucaq@=)7y-)0b9;)5 zGdGOKP1F?rjhPg56VQkRy!IAej27hoUa)1sL{R}g%F5J;KL=0(r5pRxn!s*a-UNy5 z=T_(vb}EY|Ur&ew{^HG^8KR~D8z(EvVQ-v5LoGLRkvfzD$78`uvnZVRZ~H#|o?fIP zhmwDQbDSllrKKf+TRC?QaEJj)>PtjKQ+;llKRDEdrfwvL+wuKZZrRXK=&$H^H_UkY za=*3z-CoWPe}DgA97cfc(r?JZ%39^HGn~TbKE1f;!A(h$isNQ(71#EOK&|yi zUzpnFmG_Sjc@7Quzj%A&t|%8kZ(?D2i-#uxQ&m@22RK~1x^3^bewy}@;&@CrsY2$P zKz*-F;RovYVmMJFQP6~2kpFvk_xQLpBjapJRd=b`wW_Xe=GU)ZV`B;=Z|HdG5kD7N7)O$VN!Kf@}%YC*Cjg0|rB0VqtuyK7f zN~!&Qqwy8*5*ozx*+3)TV(2v~sJP)8fxJr{nPe}MV6AS&%i_!z1&4u7m$VRZp%-E0 zbl&}m_E_jg;fL6HWabVgLY9uk5UGD8IM~{EV`HPQukR0++i#1ub0|odr32olaq~NX z$E_dg9v_i%>+$00oA^=vGsHSRX_A(eKODe10f<&ox;)l_ehfMWqaO%^BttV^Jum0Mye zkn}7}|LE>IZVzX3j3`ydt7gCr{N5vjhA1^WE;uKcc1Ui*f!_ z7+^Q%_V@R1ZyQ&rHHRpl7Ri!=7Cl1mFOO$`(xwD9?^1cN}94fkmOtR98EV++OI zP7p{qpz0PD+=#tY6?I2Kb0Ps*N^?K^yI4RCz4J!l7Zb&8y!e6kg)qMYZeGZDMZ&sw z7liU}!fNgCbx?ON!qe0jm#svXyT=yNUV9sKxX2H4C#)=jc4A!rj26t=0nq5TxJvLb zCN3jFY-=`J6Q@o>jI;9(_W)ef`|Rjbe3k6!>d{$LR#e!kAO4#91i0wcBgOS`r|qkM zQaP<$pbxI+o520Ky1G(QR1_XChsX{cY8v|DFxrrUFzaf7&PuUJlI7eZ!d)WHK15%O zyT9!##f&Do8p*6=jlyO$v#Hb?J@t5bo-W-Bg{m=p`kM?H$1(90*45PoDD@D?G>)!^ zzJWnhY%E2jIHdJOQI=yLQp>fMRvvT=8I~qnmT2~7bT!^1bk9`1$TIBc6T?0RCy)J^ z)_z*gTOh}6%v>g(xU_@m(oa!MZzVWPRm%R(*pm(azA%bW5x?oldry^IX4t;3*U`Ek zA?7lx@)hV>jyfHc*T6gYpUe~EJW_*oY1Z$Rl_x-#0z|%<$;rhU3!J$%MShq<#i`TC zQrU_!qt5m9_6GjIrFW#X0Z*D3}@}*wkvn|88$$hTdi8QM|g3+$@ z8N`T7Km3fcvXe-V7>D(usj)F6Ep22ut1Lf1eb=^~HYFj!_0#i&kOMV+)vUh2d|Cbsi~wsCiIMuR?Z9pAvS_3B;-#SJUW2 zqFP5nv}L}0pWw~p``aQj8>)T^dI{d{b?-qjua3pgC>7%QBp}ri%QuaVmzT!Wc+B#C z$d$b0^SN=QJ`iEW+DX2N+zF+42niY^!W=L~Kq~mwxPj}JS6$w1Xj><8Hg!NW2Rpfl zEq?WAWH;)~*OHX@V8LSlY5u8PARtpmA03ICRrFs0GV=w9vViiDys(ZYjQYgzHD_ae zeSKr2&EyqJLPm!Er%yie)BsEM{Nf^Mqf{E@dmmDp9rut7GyY~19c-l6y_=XYv7^sG zhg3@5o~1JFM``loAyZipGV2!?5S3v54RN%02+lEH5zAED+Q7q?;&z9A;#f9rIb6B< zr=JH_;KWVUGX`w2*Cg7>#MnyxtImv?c& zBr;+f7aE=HqKhX`^332*fU~xT!Y(KyGjuRh79JXEmy)Ht57@w>q9*ZJ=fCL>so&mE}{w`Gw}(L z(S3--*zA%{KYR}v$S4AS#f)X^Iv^P6Qn02^;yqC(#~+@-9R`%yyb}86HWq{u1D{%|vhJOwz!uV&Vfa zRpPM>^nc1lD2k+{q*$4l0H%6ZSC_1;>^mrBWCVt+S3yNf3*X88O|ED(3T*72x4&sF@3k{hjLQmDNAHU*R$6wPxq6KH<}~P z?7^fO%T^N_SZzXQUSK`K1pj+z&4bqc)kl8IwV}^QyK#i}{^bclZl4 z>3MU^$v)B6a`9c2!g`w+l;OsJtsZM+HCreXl>yuBQIiW>YYnbMI$j9~b#GKL&#?LzqoBG6zt^E2#*3B+9 zgC@ncHxYN??FF(3#M0)uj#!M2rlH)M-xsN_rOrO$vR4UOFSRT{9?v5#MF{k*txFRV z=jWiq|(H> zCn`$4GrwNrX^#NMPGH%3PWbkaFQ`XOrzl;ZPs^-s*WejIVjP%43Iw>ce~R%UB4T1< zA|oTaimLy=nS<=r@WrvtPG8UWTue-(E8enc@lQD?Glsr?P%U9DT#U={CsyHDp2go) z#o=nt#I}W}Yep)6jd!^PxMJPD5K*WQd5a7)o_&R-w}$WMB3YF?h6YYsr|KG{=SbF` za_pb2t=7W0eU5{vauAJ!9MupI7I@|yQ?_$&IdLq1Sl{htnc0!~8NgHBGVx^$0qPV0tpS83K!nrXEeeqU%B$SNZ5cSU0D>XI4M46K z>S6CiLJ+xSJo|~*v&k-F^_zKd^eLiK8oRMVSX87o@-ql)$n{jrsL3+#QO!EVzPKBx zI6=E*id^UJpL5qv$4$_-4f?{U`jdujPV>z^+9G`Ks&AzUUug{Tt0sqg?Lk_M8TF{P zs1uf=+&2-#l&lxc9RF;y)Y6}HZ*xmaXh_KG)bz44@AJ*R9FI*P`_qSnPQEZx;Ms|a zNBI6Lc&a`cZ2bH^ft2fr3+vP25V^sJwof#k3@-7*>?k0>`HbGCumL%Pba63f*+lwg2DgX&?W`{Dgn zzwIS0QH2rz-nvQ9Q|b_m*mhWqGmVc)zd_4FS0E(f#R{L{D`#0oDA3V zSfAzJ#Sb6}+#j+!3)x@oPbn5umy{d<9+=c^?_AGU2O{5Sj9P7&F|(H-10F`r&E-zo zs=p`AFg4*tP`+Y-N?c99T6x#d^6lo)uP%ObXSt{)LZbly2F66$oR*l=dtWM9QPwYN zk?%H02PA;x5oUi9O}(cC=s5Ll439^f?GlPFH|0vAnz-O2Emm1@Z>SMR@uF zZ8&)PBTh*OsE@wm!>4E8wI$P(R{66d>Rg+}zZf9LU$(ig&{7c~HOKWYf8Wu`(e+Tn zj9(!Eph1-oG(5P-WJ|Nqy zyMm*g4b^jSNp2YkXF&X@DBgG&YP-_v8O%8V{r+w&LP#_})l?ne^RNge=smwPI8NP( zjzgtp@OW4Xp|@lK?*5nPmu(R*wd@+%-&}mjNzl@H_VAlK`X~5ULZxSt!-h^Yq+PDpRE zgXacKB$xQG^lU0Q*=8bt@IP`Lq4+GFCf7f4V-;IlexQ1q=WWDwWd2(iU}A6&Jt|Tu znZNUd9O_#buaJSNL#io2mNVP}BQ24)6+7Pz1Ly*lv=`mAKl+f|_ePGp+tcZ6t{8f^ zm&@Cna~`z01R`N4n~C8&tICOs+F6~$-CF_2#t_Xt2t3U_S zMxrpn$f*WRR3EZF*$YFy;C3e@XAYG=i+oy!^9!^rMiw}@4DJD7SWUL0-wmw_+)s0w z0L{w)D4+1d7!J%*sxU-PlBrAaHhjrxSY5l{aGiB&dV1z^{b5F%;B)e6qPJXnL7W3W zM?wDpA-(!E4Z-^)GqsaXs#_8!Km-!(lMS#Yx!$R-hyk@D{r%=Rz^MZ6?mwN~SUS46 zoXpo)m=QTF$-l%~OM8@!z~CTM^lnY*?ctr3Is=x9Ts|wKaNg0!xT8SVOV-so7D)Az z)mvsSM<}CY-BaOzR>)5Pl#2nuzD8otLwbpCh;0h-^|$ihtLF}L>B8~1L`jsPkUl6N zONSLJ_!DE9-34u*2bM+k(yRrJ=(W~O{KY$3n60~&MugK^tF zCQHZTab6$Nee+W47j(;SgKFzZm^hG{{@JAOF|AkcD)YW6b!=A|1KgDm=(9iDo=w}2 zM2nSQQldS{I63kTNS(3>(hvMzj2N5DHd)frvgk(aMRG%#)qHcv{$sOp&O}@vBoBf8 zSrs6baJXx%6Eia|fYt=cMQe+JnlM8XtuMM{)eY4tA@Y-pH_{7|O_@}!gk$*5^P0WK zevK4?x$dmmf%$N+P~MLb{W0(WdjT&aH+LH->Fw#RxARvlm|R-YR#kN|Bf7|K>Rw#9 zY-&KC7|0oKu<0EkVO25f)v`@GQuDlKZAPJvvaO06I)x*ihi}9M%4zoO**iw~@1@h3 zoY?7=hQ~i_x4lRq1xeqmw*cIR?N%%SX-7J5^po$bA25=`Gz-=fbXSGkKjOdxd!Y>x z&CkdH+>7=nppMaNcQhl%b*=Jv$rp&KKtS zLoe(;RlodG0Yt7{Au0}(G6H{T04TZ7&d#QrQ^-Q#b29Yxc3F}W1>6_5IGJt~=SUQ2 z_rqbcyI+4JNh2;$Q$z}&%h-^Cd<9?x#>4ubwg6*x&<}yk)u^9)7y;z{wU;Nlg)$?N z0g#zLvjkurzbzK?OHngAyfus##$Kc@D|*(L5Jm`BeL^$};4a%QpOs2Fymf$u{AZ<*W82RJ1>viaPsKM<0eHOf%_@4h{gv0SE~LD zs-=#dCF;H55);C-ap4WEpOsTJ&fk6Apy#=(x%BvGiujM#0JP6eMpoAEg$4Hl!lOYuDU~7BtjVYm4Mb5s9RD-62Zw(^Kvrg^Y#M)y@eoiUo|5BS4XmuKsU0sP zoy5idc|*EB9jpfc0~xj(oD{2{|Id7qfrto*4({&m4yH?ZoeyUVKNkUI$B@;rO1X0{ zgNo1)`S}^%K17P|)lZ~2(w9m~F7Jil0m1rH;)OB%3MhqTY`s|r#DkQS6hMSyghcDv z!XchfE_K7*0MC@N3@g?y98nXrqR482GKih^{2vYU3u&j5bHzjGZ*{+$M4HExX&*l6 zJ^4w4!$D&B;b#pB0-DWb{1DfzpECQ67Fh$A@EE4(e@^a&_}$x()3fLdW`2HtAix0> z4}ewz(Wy9OT?~7c%9TF6_?W4_xLQ)HL{9XE`uG>khC=jDyX42eTZ`~#XDchm$HpSz zI;|FJfxLdUoGF;l{H0=(?DZ$Xc;gJeT_<3{?|KVG_l4eCIkT7Ta&dV(8r5O zkP**_QyYPT*3()$Tzy^M^em76ulPO>u{G-Oj#5?A$&6<-v!?_NqAdxo=_&iX_X#V=bBI~b?{)MDU37jE7vsSEgtubiTVqw9* z-xt56O)6u@^Vg4m{oi1IKwnLJg&F{fq{~AhNx<*Nl)}k+D>YDi2h_@m)<@~5ZSoa2 zwEn(vcW4X6IR*sznuP+SJXbc7#Rs?#$a=oC#IWdQ&(vW#hpngzcL4xtwNhvv0&2H2 z{+&u3{O#?nv9U4W$PEt`^Q!f5QF#hjFgi;Nh|{?82;!X#>Dq_&(V?o zpH|L19?G?i-TLGD-I1Rdv<`7 z5?B2sO%g(CS{q0+*|J6y4%l@ghDVlRMLFQY+BX0EjJ2PipR=0{B6fsVBHyo)jJ_g7rPUT^q8!>cljL7K41?_czAkx5{c^-5}KQu zVCY&`|J4Ea<=(`-+W8NM*ja`>o6x>Hx*aibk(M<>3K=$MKpy;3!uQTDh# zIld(h#Y*^LPTP2|!oO<5@98N0OI2~DU4-j@LS*M!7E3U!Of`ycE6!F!&0b{UdtiG$ zwt}c|Hp&jSJ1H-2uCOb4Dmq%>rY>)}8vSib^dE-ETS>|0q3^Hw;b?^4H@XClaOJa< zbgHw3Fno)|sSM|9K57A;pAM<0m4!;rzR&=>+yZ}PC+?iW;dF-3aouXUt26yTTPnk~ z`m37?+Sgelj0Oyoy{TXU9FCu~+rSwwu`-tS+Mgz=pBQ_WBi9KcjI-53p{ z$$`8O3knrNBf{#eDTyAlwRccTb-G`&@~$F_lQ5=^?3Wb7s+rEp%DX7K_)z!M;>Xn? zr>487O74ENs*+Z-;zSprI&0U0rJ0@6&0&-0iR0jENz#AW<5~?hYqUT@IG$9kBi!Ybn31pB|gWx&$yw_j3su?o2&3S zB&>P32&0b?5eE$bN}REW_I^4yfYol=u4pA5mbSYPjIpyaWsuy?-1f^~ zNXePoe*Phz{6%ah@s2@6eVQ4RFbW?$XytNG>e{I<#b9H$U&dEgRrNdqNK?M^jbv-fFXbng@8!~{ zFn-~y5HAG+27}Q`6^G1LPac5VZiwr(Y+17SJP?IK^?mwuX37)p*Cx>|{rzFQG=}&N ziS*mlT~Q%VMF6P($GPGqeE%K+69sI$$>d%(du!@RZe6bvgoywE0Z;_h{#XDY?I)9S zZr*&_yS-@~fD_gOyB=$dN=Zu-c7Ukp+<6Et0T$!>^>s-$@=%kGjzLs%hW>BVlJ<&< z7*qK`Ix}=qZy$x?<>rRd(0&?|J#4-W&^opQNf$w40a1rMNLG-uKTbFY3*f!7F8jWS zp9lOAaHHfa4Akh^!%qZ)((Bi8hSIEO(x=8Y7#oi}zJa}w_(`6lpWhm9sjb!BZ-)aZ z6o#q%z=1H)L%yM*DdB%8D=WiPMSTL?4jWS^%`c!PAR~Q)gM)2sPH2lHXScUsNC3dg zalAnqx2{6AVbs#rRz_EdL+tGRlgjdg@NA2j#@e+2G2--4p$K3%>F+7CDMh1D4c9WX zGp~VeYZ=Th@)gdHeWLuR!{ZGtEu??|EBE$OqCza}>=KHK43%rW*b(Uktt$QIGzz#B zr028rR8?al>wT;2pc>6<2s*@Nli8q_u!``q0@~{O54s;>C$zM~@dvA){en zU_jm&{%g{{c0MI7Eox%)g_6m^Y#BrxR%RMfU~hmep#Ag)1B z9h&lN{%M8E%F61R8i-RC>?t>W=PA%g_o7mV038GeDJ&$bk#(d|04WpDEi+6GH95N7 z+7mf78JQ>Xp?jpinWAyWHzLA(`LIx^LQ8qtGxCs>3L6Z`7|60n`s-jVFz8^sT`eJW=DWs1KiEtWd)rr(j&MJXdF6L6yw#;2dZAPH;6(RrL2GEx%Z^gU2f9mT4Xqj2$*E?+Xq8hqlF9Eztk;dU+L+lzevkczZOdh1$ zyeROtHHH}N7HT)A^vJu@tITjonjh%z>)^;?Ab6y&5wb7b@{5aEG7)2KWb(7jjstt} zcu_7>t-9jM6)R@mqXoGI{MWCYDpp#B**cA`qaB+!52$~IS1-#o^Z7>rgeBhr0Kwm7 tWuZg;3VeuCRTuS4@Q;5G5T)ZZ8I=|L21nhnT{PuM?6h*UEWrB2{uiPvEVuvw diff --git a/MxNet/Classification/RN50v1.5/models.py b/MxNet/Classification/RN50v1.5/models.py new file mode 100644 index 00000000..43b5ae09 --- /dev/null +++ b/MxNet/Classification/RN50v1.5/models.py @@ -0,0 +1,522 @@ +# Copyright 2017-2018 The Apache Software Foundation +# +# Licensed to the Apache Software Foundation (ASF) under one +# or more contributor license agreements. See the NOTICE file +# distributed with this work for additional information +# regarding copyright ownership. The ASF licenses this file +# to you under the Apache License, Version 2.0 (the +# "License"); you may not use this file except in compliance +# with the License. You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, +# software distributed under the License is distributed on an +# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY +# KIND, either express or implied. See the License for the +# specific language governing permissions and limitations +# under the License. +# +# ----------------------------------------------------------------------- +# +# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + + +import copy + +import mxnet as mx +from mxnet.gluon.block import HybridBlock +from mxnet.gluon import nn + +def add_model_args(parser): + model = parser.add_argument_group('Model') + model.add_argument('--arch', default='resnetv15', + choices=['resnetv1', 'resnetv15', + 'resnextv1', 'resnextv15', + 'xception'], + help='model architecture') + model.add_argument('--num-layers', type=int, default=50, + help='number of layers in the neural network, \ + required by some networks such as resnet') + model.add_argument('--num-groups', type=int, default=32, + help='number of groups for grouped convolutions, \ + required by some networks such as resnext') + model.add_argument('--num-classes', type=int, default=1000, + help='the number of classes') + model.add_argument('--batchnorm-eps', type=float, default=1e-5, + help='the amount added to the batchnorm variance to prevent output explosion.') + model.add_argument('--batchnorm-mom', type=float, default=0.9, + help='the leaky-integrator factor controling the batchnorm mean and variance.') + model.add_argument('--fuse-bn-relu', type=int, default=0, + help='have batchnorm kernel perform activation relu') + model.add_argument('--fuse-bn-add-relu', type=int, default=0, + help='have batchnorm kernel perform add followed by activation relu') + return model + +class Builder: + def __init__(self, dtype, input_layout, conv_layout, bn_layout, + pooling_layout, bn_eps, bn_mom, fuse_bn_relu, fuse_bn_add_relu): + self.dtype = dtype + self.input_layout = input_layout + self.conv_layout = conv_layout + self.bn_layout = bn_layout + self.pooling_layout = pooling_layout + self.bn_eps = bn_eps + self.bn_mom = bn_mom + self.fuse_bn_relu = fuse_bn_relu + self.fuse_bn_add_relu = fuse_bn_add_relu + + self.act_type = 'relu' + self.bn_gamma_initializer = lambda last: 'zeros' if last else 'ones' + self.linear_initializer = lambda groups=1: mx.init.Xavier(rnd_type='gaussian', factor_type="in", + magnitude=2 * (groups ** 0.5)) + + self.last_layout = self.input_layout + + def copy(self): + return copy.copy(self) + + def batchnorm(self, last=False): + gamma_initializer = self.bn_gamma_initializer(last) + bn_axis = 3 if self.bn_layout == 'NHWC' else 1 + return self.sequence( + self.transpose(self.bn_layout), + nn.BatchNorm(axis=bn_axis, momentum=self.bn_mom, epsilon=self.bn_eps, + gamma_initializer=gamma_initializer, + running_variance_initializer=gamma_initializer) + ) + + def batchnorm_add_relu(self, last=False): + gamma_initializer = self.bn_gamma_initializer(last) + if self.fuse_bn_add_relu: + bn_axis = 3 if self.bn_layout == 'NHWC' else 1 + return self.sequence( + self.transpose(self.bn_layout), + BatchNormAddRelu(axis=bn_axis, momentum=self.bn_mom, + epsilon=self.bn_eps, act_type=self.act_type, + gamma_initializer=gamma_initializer, + running_variance_initializer=gamma_initializer) + ) + return NonFusedBatchNormAddRelu(self, last=last) + + def batchnorm_relu(self, last=False): + gamma_initializer = self.bn_gamma_initializer(last) + if self.fuse_bn_relu: + bn_axis = 3 if self.bn_layout == 'NHWC' else 1 + return self.sequence( + self.transpose(self.bn_layout), + nn.BatchNorm(axis=bn_axis, momentum=self.bn_mom, + epsilon=self.bn_eps, act_type=self.act_type, + gamma_initializer=gamma_initializer, + running_variance_initializer=gamma_initializer) + ) + + return self.sequence(self.batchnorm(last=last), self.activation()) + + def activation(self): + return nn.Activation(self.act_type) + + def global_avg_pool(self): + return self.sequence( + self.transpose(self.pooling_layout), + nn.GlobalAvgPool2D(layout=self.pooling_layout) + ) + + def max_pool(self, pool_size, strides=1, padding=True): + padding = pool_size // 2 if padding is True else int(padding) + return self.sequence( + self.transpose(self.pooling_layout), + nn.MaxPool2D(pool_size, strides=strides, padding=padding, + layout=self.pooling_layout) + ) + + def conv(self, channels, kernel_size, padding=True, strides=1, groups=1, in_channels=0): + padding = kernel_size // 2 if padding is True else int(padding) + initializer = self.linear_initializer(groups=groups) + return self.sequence( + self.transpose(self.conv_layout), + nn.Conv2D(channels, kernel_size=kernel_size, strides=strides, + padding=padding, use_bias=False, groups=groups, + in_channels=in_channels, layout=self.conv_layout, + weight_initializer=initializer) + ) + + def separable_conv(self, channels, kernel_size, in_channels, padding=True, strides=1): + return self.sequence( + self.conv(in_channels, kernel_size, padding=padding, + strides=strides, groups=in_channels, in_channels=in_channels), + self.conv(channels, 1, in_channels=in_channels) + ) + + def dense(self, units, in_units=0): + return nn.Dense(units, in_units=in_units, + weight_initializer=self.linear_initializer()) + + def transpose(self, to_layout): + if self.last_layout == to_layout: + return None + ret = Transpose(self.last_layout, to_layout) + self.last_layout = to_layout + return ret + + def sequence(self, *seq): + seq = list(filter(lambda x: x is not None, seq)) + if len(seq) == 1: + return seq[0] + ret = nn.HybridSequential() + ret.add(*seq) + return ret + + +class Transpose(HybridBlock): + def __init__(self, from_layout, to_layout): + super().__init__() + supported_layouts = ['NCHW', 'NHWC'] + if from_layout not in supported_layouts: + raise ValueError('Not prepared to handle layout: {}'.format(from_layout)) + if to_layout not in supported_layouts: + raise ValueError('Not prepared to handle layout: {}'.format(to_layout)) + self.from_layout = from_layout + self.to_layout = to_layout + + def hybrid_forward(self, F, x): + # Insert transpose if from_layout and to_layout don't match + if self.from_layout == 'NCHW' and self.to_layout == 'NHWC': + return F.transpose(x, axes=(0, 2, 3, 1)) + elif self.from_layout == 'NHWC' and self.to_layout == 'NCHW': + return F.transpose(x, axes=(0, 3, 1, 2)) + else: + return x + + def __repr__(self): + s = '{name}({content})' + if self.from_layout == self.to_layout: + content = 'passthrough ' + self.from_layout + else: + content = self.from_layout + ' -> ' + self.to_layout + return s.format(name=self.__class__.__name__, + content=content) + +class LayoutWrapper(HybridBlock): + def __init__(self, op, io_layout, op_layout, **kwargs): + super(LayoutWrapper, self).__init__(**kwargs) + with self.name_scope(): + self.layout1 = Transpose(io_layout, op_layout) + self.op = op + self.layout2 = Transpose(op_layout, io_layout) + + def hybrid_forward(self, F, *x): + return self.layout2(self.op(*(self.layout1(y) for y in x))) + +class BatchNormAddRelu(nn.BatchNorm): + def __init__(self, *args, **kwargs): + super().__init__(*args, **kwargs) + if self._kwargs.pop('act_type') != 'relu': + raise ValueError('BatchNormAddRelu can be used only with ReLU as activation') + + def hybrid_forward(self, F, x, y, gamma, beta, running_mean, running_var): + return F.BatchNormAddRelu(data=x, addend=y, gamma=gamma, beta=beta, + moving_mean=running_mean, moving_var=running_var, name='fwd', **self._kwargs) + +class NonFusedBatchNormAddRelu(HybridBlock): + def __init__(self, builder, **kwargs): + super().__init__() + self.bn = builder.batchnorm(**kwargs) + self.act = builder.activation() + + def hybrid_forward(self, F, x, y): + return self.act(self.bn(x) + y) + + +# Blocks +class ResNetBasicBlock(HybridBlock): + def __init__(self, builder, channels, stride, downsample=False, in_channels=0, + version='1', resnext_groups=None, **kwargs): + super().__init__() + assert not resnext_groups + + self.transpose = builder.transpose(builder.conv_layout) + builder_copy = builder.copy() + + body = [ + builder.conv(channels, 3, strides=stride, in_channels=in_channels), + builder.batchnorm_relu(), + builder.conv(channels, 3), + ] + + self.body = builder.sequence(*body) + self.bn_add_relu = builder.batchnorm_add_relu(last=True) + + builder = builder_copy + if downsample: + self.downsample = builder.sequence( + builder.conv(channels, 1, strides=stride, in_channels=in_channels), + builder.batchnorm() + ) + else: + self.downsample = None + + def hybrid_forward(self, F, x): + if self.transpose is not None: + x = self.transpose(x) + residual = x + + x = self.body(x) + + if self.downsample: + residual = self.downsample(residual) + + x = self.bn_add_relu(x, residual) + return x + + +class ResNetBottleNeck(HybridBlock): + def __init__(self, builder, channels, stride, downsample=False, in_channels=0, + version='1', resnext_groups=None): + super().__init__() + stride1 = stride if version == '1' else 1 + stride2 = 1 if version == '1' else stride + + mult = 2 if resnext_groups else 1 + groups = resnext_groups or 1 + + self.transpose = builder.transpose(builder.conv_layout) + builder_copy = builder.copy() + + body = [ + builder.conv(channels * mult // 4, 1, strides=stride1, in_channels=in_channels), + builder.batchnorm_relu(), + builder.conv(channels * mult // 4, 3, strides=stride2), + builder.batchnorm_relu(), + builder.conv(channels, 1) + ] + + self.body = builder.sequence(*body) + self.bn_add_relu = builder.batchnorm_add_relu(last=True) + + builder = builder_copy + if downsample: + self.downsample = builder.sequence( + builder.conv(channels, 1, strides=stride, in_channels=in_channels), + builder.batchnorm() + ) + else: + self.downsample = None + + def hybrid_forward(self, F, x): + if self.transpose is not None: + x = self.transpose(x) + residual = x + + x = self.body(x) + + if self.downsample: + residual = self.downsample(residual) + + x = self.bn_add_relu(x, residual) + return x + + +class XceptionBlock(HybridBlock): + def __init__(self, builder, definition, in_channels, relu_at_beginning=True): + super().__init__() + + self.transpose = builder.transpose(builder.conv_layout) + builder_copy = builder.copy() + + body = [] + if relu_at_beginning: + body.append(builder.activation()) + + last_channels = in_channels + for channels1, channels2 in zip(definition, definition[1:] + [0]): + if channels1 > 0: + body.append(builder.separable_conv(channels1, 3, in_channels=last_channels)) + if channels2 > 0: + body.append(builder.batchnorm_relu()) + else: + body.append(builder.batchnorm(last=True)) + + last_channels = channels1 + else: + body.append(builder.max_pool(3, 2)) + + self.body = builder.sequence(*body) + + builder = builder_copy + if any(map(lambda x: x <= 0, definition)): + self.shortcut = builder.sequence( + builder.conv(last_channels, 1, strides=2, in_channels=in_channels), + builder.batchnorm(), + ) + else: + self.shortcut = builder.sequence() + + def hybrid_forward(self, F, x): + return self.shortcut(x) + self.body(x) + +# Nets +class ResNet(HybridBlock): + def __init__(self, builder, block, layers, channels, classes=1000, + version='1', resnext_groups=None): + super().__init__() + assert len(layers) == len(channels) - 1 + + self.version = version + with self.name_scope(): + features = [ + builder.conv(channels[0], 7, strides=2), + builder.batchnorm_relu(), + builder.max_pool(3, 2), + ] + + for i, num_layer in enumerate(layers): + stride = 1 if i == 0 else 2 + features.append(self.make_layer(builder, block, num_layer, channels[i+1], + stride, in_channels=channels[i], + resnext_groups=resnext_groups)) + features.append(builder.global_avg_pool()) + + self.features = builder.sequence(*features) + self.output = builder.dense(classes, in_units=channels[-1]) + + def make_layer(self, builder, block, layers, channels, stride, + in_channels=0, resnext_groups=None): + layer = [] + layer.append(block(builder, channels, stride, channels != in_channels, + in_channels=in_channels, version=self.version, + resnext_groups=resnext_groups)) + for _ in range(layers-1): + layer.append(block(builder, channels, 1, False, in_channels=channels, + version=self.version, resnext_groups=resnext_groups)) + return builder.sequence(*layer) + + def hybrid_forward(self, F, x): + x = self.features(x) + x = self.output(x) + return x + + +class Xception(HybridBlock): + def __init__(self, builder, + definition=([32, 64], + [[128, 128, 0], [256, 256, 0], [728, 728, 0], + *([[728, 728, 728]] * 8), [728, 1024, 0]], + [1536, 2048]), + classes=1000): + super().__init__() + + definition1, definition2, definition3 = definition + + with self.name_scope(): + features = [] + last_channels = 0 + for i, channels in enumerate(definition1): + features += [ + builder.conv(channels, 3, strides=(2 if i == 0 else 1), in_channels=last_channels), + builder.batchnorm_relu(), + ] + last_channels = channels + + for i, block_definition in enumerate(definition2): + features.append(XceptionBlock(builder, block_definition, in_channels=last_channels, + relu_at_beginning=False if i == 0 else True)) + last_channels = list(filter(lambda x: x > 0, block_definition))[-1] + + for i, channels in enumerate(definition3): + features += [ + builder.separable_conv(channels, 3, in_channels=last_channels), + builder.batchnorm_relu(), + ] + last_channels = channels + + features.append(builder.global_avg_pool()) + + self.features = builder.sequence(*features) + self.output = builder.dense(classes, in_units=last_channels) + + def hybrid_forward(self, F, x): + x = self.features(x) + x = self.output(x) + + return x + + +resnet_spec = {18: (ResNetBasicBlock, [2, 2, 2, 2], [64, 64, 128, 256, 512]), + 34: (ResNetBasicBlock, [3, 4, 6, 3], [64, 64, 128, 256, 512]), + 50: (ResNetBottleNeck, [3, 4, 6, 3], [64, 256, 512, 1024, 2048]), + 101: (ResNetBottleNeck, [3, 4, 23, 3], [64, 256, 512, 1024, 2048]), + 152: (ResNetBottleNeck, [3, 8, 36, 3], [64, 256, 512, 1024, 2048])} + +def create_resnet(builder, version, num_layers=50, resnext=False, classes=1000): + assert num_layers in resnet_spec, \ + "Invalid number of layers: {}. Options are {}".format( + num_layers, str(resnet_spec.keys())) + block_class, layers, channels = resnet_spec[num_layers] + assert not resnext or num_layers >= 50, \ + "Cannot create resnext with less then 50 layers" + net = ResNet(builder, block_class, layers, channels, version=version, + resnext_groups=args.num_groups if resnext else None) + return net + +class fp16_model(mx.gluon.block.HybridBlock): + def __init__(self, net, **kwargs): + super(fp16_model, self).__init__(**kwargs) + with self.name_scope(): + self._net = net + + def hybrid_forward(self, F, x): + y = self._net(x) + y = F.cast(y, dtype='float32') + return y + +def get_model(arch, num_classes, num_layers, image_shape, dtype, amp, + input_layout, conv_layout, batchnorm_layout, pooling_layout, + batchnorm_eps, batchnorm_mom, fuse_bn_relu, fuse_bn_add_relu, **kwargs): + + builder = Builder( + dtype = dtype, + input_layout = input_layout, + conv_layout = conv_layout, + bn_layout = batchnorm_layout, + pooling_layout = pooling_layout, + bn_eps = batchnorm_eps, + bn_mom = batchnorm_mom, + fuse_bn_relu = fuse_bn_relu, + fuse_bn_add_relu = fuse_bn_add_relu, + ) + + if arch.startswith('resnet') or arch.startswith('resnext'): + version = '1' if arch in {'resnetv1', 'resnextv1'} else '1.5' + net = create_resnet( + builder = builder, + version = version, + resnext = arch.startswith('resnext'), + num_layers = num_layers, + classes = num_classes, + ) + elif arch == 'xception': + net = Xception(builder, classes=num_classes) + else: + raise ValueError('Wrong model architecture') + + net.hybridize(static_shape=True, static_alloc=True) + + if not amp: + net.cast(dtype) + if dtype == 'float16': + net = fp16_model(net) + + return net diff --git a/MxNet/Classification/RN50v1.5/report.py b/MxNet/Classification/RN50v1.5/report.py index d2a29441..9abbeaaa 100644 --- a/MxNet/Classification/RN50v1.5/report.py +++ b/MxNet/Classification/RN50v1.5/report.py @@ -21,15 +21,21 @@ # - "metrics" : per epoch metrics for train and validation # (some of below metrics may not exist in the report, # depending on application arguments) -# - "train.top1" : training top1 accuracy in epoch. -# - "train.top5" : training top5 accuracy in epoch. -# - "train.loss" : training loss in epoch. -# - "train.time" : average training time of iteration in seconds. -# - "train.total_ips" : training speed (data and compute time taken into account) for epoch in images/sec. -# - "val.top1", "val.top5", "val.loss", "val.time", "val.total_ips" : the same but for validation. +# - "train.top1" : training top1 accuracy in epoch. +# - "train.top5" : training top5 accuracy in epoch. +# - "train.loss" : training loss in epoch. +# - "train.total_ips" : training speed (data and compute time taken into account) for epoch in images/sec. +# - "train.latency_avg" : average latency of one iteration in seconds. +# - "train.latency_50" : median latency of one iteration in seconds. +# - "train.latency_90" : 90th percentile latency of one iteration in seconds. +# - "train.latency_95" : 95th percentile latency of one iteration in seconds. +# - "train.latency_99" : 99th percentile latency of one iteration in seconds. +# - "train.latency_100" : highest observed latency of one iteration in seconds. +# - "val.top1", "val.top5", "val.time", "val.total_ips", "val.latency_avg", "val.latency_50", +# "val.latency_90", "val.latency_95", "val.latency_99", "val.latency_100" : the same but for validation. import json -from collections import defaultdict, OrderedDict +from collections import OrderedDict class Report: def __init__(self, model_name, ngpus, cmd): @@ -37,15 +43,21 @@ class Report: self.ngpus = ngpus self.cmd = cmd self.total_duration = 0 - self.metrics = defaultdict(lambda: []) + self.metrics = OrderedDict() def add_value(self, metric, value): + if metric not in self.metrics: + self.metrics[metric] = [] self.metrics[metric].append(value) def set_total_duration(self, duration): self.total_duration = duration def save(self, filename): + with open(filename, 'w') as f: + f.write(self.get_report()) + + def get_report(self): report = OrderedDict([ ('model', self.model_name), ('ngpus', self.ngpus), @@ -53,5 +65,4 @@ class Report: ('cmd', self.cmd), ('metrics', self.metrics), ]) - with open(filename, 'w') as f: - json.dump(report, f, indent=4) + return json.dumps(report, indent=4) diff --git a/MxNet/Classification/RN50v1.5/resnet.py b/MxNet/Classification/RN50v1.5/resnet.py deleted file mode 100644 index 94920142..00000000 --- a/MxNet/Classification/RN50v1.5/resnet.py +++ /dev/null @@ -1,376 +0,0 @@ -# Copyright 2017-2018 The Apache Software Foundation -# -# Licensed to the Apache Software Foundation (ASF) under one -# or more contributor license agreements. See the NOTICE file -# distributed with this work for additional information -# regarding copyright ownership. The ASF licenses this file -# to you under the Apache License, Version 2.0 (the -# "License"); you may not use this file except in compliance -# with the License. You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, -# software distributed under the License is distributed on an -# "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY -# KIND, either express or implied. See the License for the -# specific language governing permissions and limitations -# under the License. -# -# ----------------------------------------------------------------------- -# -# Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. -# -# Licensed under the Apache License, Version 2.0 (the "License"); -# you may not use this file except in compliance with the License. -# You may obtain a copy of the License at -# -# http://www.apache.org/licenses/LICENSE-2.0 -# -# Unless required by applicable law or agreed to in writing, software -# distributed under the License is distributed on an "AS IS" BASIS, -# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. -# See the License for the specific language governing permissions and -# limitations under the License. - -''' -Adapted from https://github.com/tornadomeet/ResNet/blob/master/symbol_resnet.py -(Original author Wei Wu) by Antti-Pekka Hynninen - -"Flexible Layout" (fl) version created by Dick Carter. - -Implementing the original resnet ILSVRC 2015 winning network from: - -Kaiming He, Xiangyu Zhang, Shaoqing Ren, Jian Sun. "Deep Residual Learning for Image Recognition" -''' -import mxnet as mx -import numpy as np -import random - -# Transform a symbol from one layout to another, or do nothing if they have the same layout -def transform_layout(data, from_layout, to_layout): - supported_layouts = ['NCHW', 'NHWC'] - if from_layout not in supported_layouts: - raise ValueError('Not prepared to handle layout: {}'.format(from_layout)) - if to_layout not in supported_layouts: - raise ValueError('Not prepared to handle layout: {}'.format(to_layout)) - - # Insert transpose if from_layout and to_layout don't match - if from_layout == 'NCHW' and to_layout == 'NHWC': - return mx.sym.transpose(data, axes=(0, 2, 3, 1)) - elif from_layout == 'NHWC' and to_layout == 'NCHW': - return mx.sym.transpose(data, axes=(0, 3, 1, 2)) - else: - return data - -# A BatchNorm wrapper that responds to the input layout -def batchnorm(data, io_layout, batchnorm_layout, **kwargs): - # Transpose as needed to batchnorm_layout - transposed_as_needed = transform_layout(data, io_layout, batchnorm_layout) - bn_axis = 3 if batchnorm_layout == 'NHWC' else 1 - batchnormed = mx.sym.BatchNorm(data=transposed_as_needed, axis=bn_axis, **kwargs) - # Transpose back to i/o layout as needed - return transform_layout(batchnormed, batchnorm_layout, io_layout) - -# A BatchNormAddRelu wrapper that responds to the input layout -def batchnorm_add_relu(data, addend, io_layout, batchnorm_layout, **kwargs): - # Transpose as needed to batchnorm_layout - transposed_data_as_needed = transform_layout(data, io_layout, batchnorm_layout) - transposed_addend_as_needed = transform_layout(addend, io_layout, batchnorm_layout) - bn_axis = 3 if batchnorm_layout == 'NHWC' else 1 - batchnormed = mx.sym.BatchNormAddRelu(data=transposed_data_as_needed, - addend=transposed_addend_as_needed, - axis=bn_axis, **kwargs) - # Transpose back to i/o layout as needed - return transform_layout(batchnormed, batchnorm_layout, io_layout) - -# A Pooling wrapper that responds to the input layout -def pooling(data, io_layout, pooling_layout, **kwargs): - # Pooling kernel, as specified by pooling_layout, may be in conflict with i/o layout. - transposed_as_needed = transform_layout(data, io_layout, pooling_layout) - pooled = mx.sym.Pooling(data=transposed_as_needed, layout=pooling_layout, **kwargs) - # Transpose back to i/o layout as needed - return transform_layout(pooled, pooling_layout, io_layout) - -# Assumption is that data comes in and out in the 'conv_layout' format. -# If this format is different from the 'batchnorm_layout' format, then the batchnorm() routine -# will introduce transposes on both sides of the mx.sym.BatchNorm symbol -def residual_unit(data, num_filter, stride, dim_match, name, bottle_neck=True, - workspace=256, memonger=False, conv_layout='NCHW', batchnorm_layout='NCHW', - verbose=False, cudnn_bn_off=False, bn_eps=2e-5, bn_mom=0.9, conv_algo=-1, - fuse_bn_relu=False, fuse_bn_add_relu=False, cudnn_tensor_core_only=False): - """Return ResNet Unit symbol for building ResNet - Parameters - ---------- - data : str - Input data - num_filter : int - Number of output channels - bnf : int - Bottle neck channels factor with regard to num_filter - stride : tuple - Stride used in convolution - dim_match : Boolean - True means channel number between input and output is the same, otherwise means differ - name : str - Base name of the operators - workspace : int - Workspace used in convolution operator - """ - - act = 'relu' if fuse_bn_relu else None - if bottle_neck: - conv1 = mx.sym.Convolution(data=data, num_filter=int(num_filter*0.25), kernel=(1,1), stride=(1,1), pad=(0,0), - no_bias=True, workspace=workspace, name=name + '_conv1', layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=cudnn_tensor_core_only) - bn1 = batchnorm(data=conv1, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, eps=bn_eps, momentum=bn_mom, name=name + '_bn1', cudnn_off=cudnn_bn_off, act_type=act) - act1 = mx.sym.Activation(data=bn1, act_type='relu', name=name + '_relu1') if not fuse_bn_relu else bn1 - conv2 = mx.sym.Convolution(data=act1, num_filter=int(num_filter*0.25), kernel=(3,3), stride=stride, pad=(1,1), - no_bias=True, workspace=workspace, name=name + '_conv2', layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=cudnn_tensor_core_only) - bn2 = batchnorm(data=conv2, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, eps=bn_eps, momentum=bn_mom, name=name + '_bn2', cudnn_off=cudnn_bn_off, act_type=act) - act2 = mx.sym.Activation(data=bn2, act_type='relu', name=name + '_relu2') if not fuse_bn_relu else bn2 - conv3 = mx.sym.Convolution(data=act2, num_filter=num_filter, kernel=(1,1), stride=(1,1), pad=(0,0), no_bias=True, - workspace=workspace, name=name + '_conv3', layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=cudnn_tensor_core_only) - - if dim_match: - shortcut = data - else: - conv1sc = mx.sym.Convolution(data=data, num_filter=num_filter, kernel=(1,1), stride=stride, no_bias=True, - workspace=workspace, name=name+'_conv1sc', layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=cudnn_tensor_core_only) - shortcut = batchnorm(data=conv1sc, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, eps=bn_eps, momentum=bn_mom, name=name + '_sc', cudnn_off=cudnn_bn_off) - if memonger: - shortcut._set_attr(mirror_stage='True') - - if fuse_bn_add_relu: - return batchnorm_add_relu(data=conv3, addend=shortcut, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, eps=bn_eps, momentum=bn_mom, name=name + '_bn3', cudnn_off=cudnn_bn_off) - else: - bn3 = batchnorm(data=conv3, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, eps=bn_eps, momentum=bn_mom, name=name + '_bn3', cudnn_off=cudnn_bn_off) - return mx.sym.Activation(data=bn3 + shortcut, act_type='relu', name=name + '_relu3') - - else: - conv1 = mx.sym.Convolution(data=data, num_filter=num_filter, kernel=(3,3), stride=stride, pad=(1,1), - no_bias=True, workspace=workspace, name=name + '_conv1', layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=cudnn_tensor_core_only) - bn1 = batchnorm(data=conv1, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, momentum=bn_mom, eps=bn_eps, name=name + '_bn1', cudnn_off=cudnn_bn_off, act_type=act) - act1 = mx.sym.Activation(data=bn1, act_type='relu', name=name + '_relu1') if not fuse_bn_relu else bn1 - conv2 = mx.sym.Convolution(data=act1, num_filter=num_filter, kernel=(3,3), stride=(1,1), pad=(1,1), - no_bias=True, workspace=workspace, name=name + '_conv2', layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=cudnn_tensor_core_only) - - if dim_match: - shortcut = data - else: - conv1sc = mx.sym.Convolution(data=data, num_filter=num_filter, kernel=(1,1), stride=stride, no_bias=True, - workspace=workspace, name=name+'_conv1sc', layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=cudnn_tensor_core_only) - shortcut = batchnorm(data=conv1sc, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, momentum=bn_mom, eps=bn_eps, name=name + '_sc', cudnn_off=cudnn_bn_off) - if memonger: - shortcut._set_attr(mirror_stage='True') - - if fuse_bn_add_relu: - return batchnorm_add_relu(data=conv2, addend=shortcut, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, momentum=bn_mom, eps=bn_eps, name=name + '_bn2', cudnn_off=cudnn_bn_off) - else: - bn2 = batchnorm(data=conv2, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, momentum=bn_mom, eps=bn_eps, name=name + '_bn2', cudnn_off=cudnn_bn_off) - return mx.sym.Activation(data=bn2 + shortcut, act_type='relu', name=name + '_relu2') - -def resnet(units, num_stages, filter_list, num_classes, image_shape, bottle_neck=True, workspace=256, dtype='float32', memonger=False, - input_layout='NCHW', conv_layout='NCHW', batchnorm_layout='NCHW', pooling_layout='NCHW', verbose=False, - cudnn_bn_off=False, bn_eps=2e-5, bn_mom=0.9, conv_algo=-1, - fuse_bn_relu=False, fuse_bn_add_relu=False, force_tensor_core=False, use_dali=True): - """Return ResNet symbol of - Parameters - ---------- - units : list - Number of units in each stage - num_stages : int - Number of stage - filter_list : list - Channel size of each stage - num_classes : int - Ouput size of symbol - dataset : str - Dataset type, only cifar10 and imagenet supports - workspace : int - Workspace used in convolution operator - dtype : str - Precision (float32 or float16) - memonger : boolean - Activates "memory monger" to reduce the model's memory footprint - input_layout : str - interpretation (e.g. NCHW vs NHWC) of data provided by the i/o pipeline (may introduce transposes - if in conflict with 'layout' above) - conv_layout : str - interpretation (e.g. NCHW vs NHWC) of data for convolution operation. - batchnorm_layout : str - directs which kernel performs the batchnorm (may introduce transposes if in conflict with 'conv_layout' above) - pooling_layout : str - directs which kernel performs the pooling (may introduce transposes if in conflict with 'conv_layout' above) - """ - - act = 'relu' if fuse_bn_relu else None - num_unit = len(units) - assert(num_unit == num_stages) - data = mx.sym.Variable(name='data') - if not use_dali: - # double buffering of data - if dtype == 'float32': - data = mx.sym.identity(data=data, name='id') - else: - if dtype == 'float16': - data = mx.sym.Cast(data=data, dtype=np.float16) - (nchannel, height, width) = image_shape - - # Insert transpose as needed to get the input layout to match the desired processing layout - data = transform_layout(data, input_layout, conv_layout) - - if height <= 32: # such as cifar10 - body = mx.sym.Convolution(data=data, num_filter=filter_list[0], kernel=(3, 3), stride=(1,1), pad=(1, 1), - no_bias=True, name="conv0", workspace=workspace, layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=force_tensor_core) - # Is this BatchNorm supposed to be here? - body = batchnorm(data=body, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, eps=bn_eps, momentum=bn_mom, name='bn0', cudnn_off=cudnn_bn_off) - else: # often expected to be 224 such as imagenet - body = mx.sym.Convolution(data=data, num_filter=filter_list[0], kernel=(7, 7), stride=(2,2), pad=(3, 3), - no_bias=True, name="conv0", workspace=workspace, layout=conv_layout, - cudnn_algo_verbose=verbose, - cudnn_algo_fwd=conv_algo, cudnn_algo_bwd_data=conv_algo, cudnn_algo_bwd_filter=conv_algo, - cudnn_tensor_core_only=force_tensor_core) - body = batchnorm(data=body, io_layout=conv_layout, batchnorm_layout=batchnorm_layout, - fix_gamma=False, eps=bn_eps, momentum=bn_mom, name='bn0', cudnn_off=cudnn_bn_off, act_type=act) - if not fuse_bn_relu: - body = mx.sym.Activation(data=body, act_type='relu', name='relu0') - body = pooling(data=body, io_layout=conv_layout, pooling_layout=pooling_layout, - kernel=(3, 3), stride=(2, 2), pad=(1, 1), pool_type='max') - - for i in range(num_stages): - body = residual_unit(body, filter_list[i+1], (1 if i==0 else 2, 1 if i==0 else 2), False, - name='stage%d_unit%d' % (i + 1, 1), - bottle_neck=bottle_neck, workspace=workspace, - memonger=memonger, conv_layout=conv_layout, batchnorm_layout=batchnorm_layout, - verbose=verbose, cudnn_bn_off=cudnn_bn_off, bn_eps=bn_eps, bn_mom=bn_mom, - conv_algo=conv_algo, fuse_bn_relu=fuse_bn_relu, fuse_bn_add_relu=fuse_bn_add_relu, - cudnn_tensor_core_only=force_tensor_core) - for j in range(units[i]-1): - body = residual_unit(body, filter_list[i+1], (1,1), True, name='stage%d_unit%d' % (i + 1, j + 2), - bottle_neck=bottle_neck, workspace=workspace, - memonger=memonger, conv_layout=conv_layout, batchnorm_layout=batchnorm_layout, - verbose=verbose, cudnn_bn_off=cudnn_bn_off, bn_eps = bn_eps, bn_mom=bn_mom, - conv_algo=conv_algo, fuse_bn_relu=fuse_bn_relu, fuse_bn_add_relu=fuse_bn_add_relu, - cudnn_tensor_core_only=force_tensor_core) - # bn1 = mx.sym.BatchNorm(data=body, fix_gamma=False, eps=2e-5, momentum=bn_mom, name='bn1') - # relu1 = mx.sym.Activation(data=bn1, act_type='relu', name='relu1') - # Although kernel is not used here when global_pool=True, we should put one - pool1 = pooling(data=body, io_layout=conv_layout, pooling_layout=pooling_layout, - global_pool=True, kernel=(7, 7), pool_type='avg', name='pool1') - flat = mx.sym.Flatten(data=pool1) - fc1 = mx.sym.FullyConnected(data=flat, num_hidden=num_classes, name='fc1', cublas_algo_verbose=verbose) - if dtype == 'float16': - fc1 = mx.sym.Cast(data=fc1, dtype=np.float32) - return mx.sym.SoftmaxOutput(data=fc1, name='softmax') - -def get_symbol(num_classes, num_layers, image_shape, conv_workspace=256, dtype='float32', - input_layout='NCHW', conv_layout='NCHW', batchnorm_layout='NCHW', pooling_layout='NCHW', - verbose=False, seed=None, cudnn_bn_off=False, batchnorm_eps=2e-5, batchnorm_mom=0.9, - conv_algo=-1, fuse_bn_relu=False, fuse_bn_add_relu=False, force_tensor_core=False, use_dali=True, **kwargs): - """ - Adapted from https://github.com/tornadomeet/ResNet/blob/master/symbol_resnet.py - (Original author Wei Wu) by Antti-Pekka Hynninen - Implementing the original resnet ILSVRC 2015 winning network from: - Kaiming He, Xiangyu Zhang, Shaoqing Ren, Jian Sun. "Deep Residual Learning for Image Recognition" - """ - if seed is not None: - print('Setting seeds to %s' % (seed,)) - random.seed(seed) - np.random.seed(seed) - mx.random.seed(seed) - - image_shape = [int(l) for l in image_shape.split(',')] - (nchannel, height, width) = image_shape - if height <= 28: - num_stages = 3 - if (num_layers-2) % 9 == 0 and num_layers >= 164: - per_unit = [(num_layers-2)//9] - filter_list = [16, 64, 128, 256] - bottle_neck = True - elif (num_layers-2) % 6 == 0 and num_layers < 164: - per_unit = [(num_layers-2)//6] - filter_list = [16, 16, 32, 64] - bottle_neck = False - else: - raise ValueError("no experiments done on num_layers {}, you can do it yourself".format(num_layers)) - units = per_unit * num_stages - else: - if num_layers >= 50: - filter_list = [64, 256, 512, 1024, 2048] - bottle_neck = True - else: - filter_list = [64, 64, 128, 256, 512] - bottle_neck = False - num_stages = 4 - if num_layers == 18: - units = [2, 2, 2, 2] - elif num_layers == 34: - units = [3, 4, 6, 3] - elif num_layers == 50: - units = [3, 4, 6, 3] - elif num_layers == 101: - units = [3, 4, 23, 3] - elif num_layers == 152: - units = [3, 8, 36, 3] - elif num_layers == 200: - units = [3, 24, 36, 3] - elif num_layers == 269: - units = [3, 30, 48, 8] - else: - raise ValueError("no experiments done on num_layers {}, you can do it yourself".format(num_layers)) - - return resnet(units = units, - num_stages = num_stages, - filter_list = filter_list, - num_classes = num_classes, - image_shape = image_shape, - bottle_neck = bottle_neck, - workspace = conv_workspace, - dtype = dtype, - input_layout = input_layout, - conv_layout = conv_layout, - batchnorm_layout = batchnorm_layout, - pooling_layout = pooling_layout, - verbose = verbose, - cudnn_bn_off = cudnn_bn_off, - bn_eps = batchnorm_eps, - bn_mom = batchnorm_mom, - conv_algo = conv_algo, - fuse_bn_relu = fuse_bn_relu, - fuse_bn_add_relu = fuse_bn_add_relu, - force_tensor_core = force_tensor_core, - use_dali = use_dali) diff --git a/MxNet/Classification/RN50v1.5/runner b/MxNet/Classification/RN50v1.5/runner index 40be0e7b..c70a5309 100755 --- a/MxNet/Classification/RN50v1.5/runner +++ b/MxNet/Classification/RN50v1.5/runner @@ -14,77 +14,56 @@ # See the License for the specific language governing permissions and # limitations under the License. -import os, socket -from argparse import ArgumentParser -import warnings +import os +import argparse +from pathlib import Path - -optparser = ArgumentParser(description="train resnet50 with MXNet") -optparser.add_argument("-n", "--n-GPUs", type=int, default=8, help="number of GPUs to use; " +\ - "default = 8") -optparser.add_argument("-b", "--batch-size", type=int, default=208, help="batch size per GPU; " +\ - "default = 208") -optparser.add_argument("-e", "--num-epochs", type=int, default=90, help="number of epochs; " +\ - "default = 90") -optparser.add_argument("-l", "--lr", type=float, default=0.1, help="learning rate; default = 0.1; " +\ - "IMPORTANT: true learning rate will be calculated as `lr * batch_size/256`") -optparser.add_argument("--no-val", action="store_true", - help="if set no validation will be performed") -optparser.add_argument("--no-dali", action="store_true", default=False, - help="use default MXNet pipeline instead of DALI") -optparser.add_argument("--data-root", type=str, help="Directory with RecordIO data files", default="/data/imagenet/train-val-recordio-passthrough") -optparser.add_argument("--data-nthreads", type=int, help="number of threads for data loading; default = 40", default=40) -optparser.add_argument("--dtype", type=str, help="Precision, float16 or float32", default="float16") +optparser = argparse.ArgumentParser(description='Train classification models on ImageNet', + formatter_class=argparse.ArgumentDefaultsHelpFormatter) +optparser.add_argument('-n', '--ngpus', type=int, default=1, help='number of GPUs to use') +optparser.add_argument('-b', '--batch-size', type=int, default=192, help='batch size per GPU') +optparser.add_argument('-e', '--num-epochs', type=int, default=90, help='number of epochs') +optparser.add_argument('-l', '--lr', type=float, default=0.256, help='learning rate; ' + 'IMPORTANT: true learning rate will be calculated as `lr * batch_size / 256`') +optparser.add_argument('--data-root', type=Path, help='Directory with RecordIO data files', default=Path('/data/imagenet/train-val-recordio-passthrough')) +optparser.add_argument('--dtype', help='Precision', default='float16', choices=('float32', 'float16')) +optparser.add_argument('--kv-store', default='horovod', choices=('device', 'horovod'), help='key-value store type') +optparser.add_argument('--data-backend', default='dali-gpu', choices=('dali-gpu', 'dali-cpu', 'mxnet', 'synthetic'), help='data backend') opts, args = optparser.parse_known_args() -if opts.dtype == "float16": - n_ch = str(4 - int(opts.no_dali)) +if opts.dtype == 'float16': + n_ch = str(4 - int(opts.data_backend == 'mxnet')) else: n_ch = str(3) -opts.batch_size *= opts.n_GPUs +opts.batch_size *= opts.ngpus +opts.lr *= opts.batch_size / 256 -opts.lr *= opts.batch_size/256 - -command = "" -command += "python "+os.path.dirname(__file__)+"/train.py" -command += " --num-layers 50" -command += " --data-train " + opts.data_root + "/train.rec" -command += " --data-train-idx " + opts.data_root + "/train.idx" -if not opts.no_val: - command += " --data-val " + opts.data_root + "/val.rec" - command += " --data-val-idx " + opts.data_root + "/val.idx" -command += " --data-nthreads " + str(opts.data_nthreads) -command += " --optimizer sgd --dtype " + opts.dtype -command += " --lr-step-epochs 30,60,80 --max-random-area 1" -command += " --min-random-area 0.05 --max-random-scale 1" -command += " --min-random-scale 1 --min-random-aspect-ratio 0.75" -command += " --max-random-aspect-ratio 1.33 --max-random-shear-ratio 0" -command += " --max-random-rotate-angle 0 --random-resized-crop 1" -command += " --random-crop 0 --random-mirror 1" -command += " --image-shape "+n_ch+",224,224 --warmup-epochs 5" -command += " --disp-batches 20" -command += " --batchnorm-mom 0.9 --batchnorm-eps 1e-5" +command = [] +if 'horovod' in opts.kv_store: + command += ['horovodrun', '-np', str(opts.ngpus)] +command += ['python', str(Path(__file__).parent / "train.py")] +command += ['--data-train', str(opts.data_root / "train.rec")] +command += ['--data-train-idx', str(opts.data_root / "train.idx")] +command += ['--data-val', str(opts.data_root / "val.rec")] +command += ['--data-val-idx', str(opts.data_root / "val.idx")] +command += ['--dtype', opts.dtype] +command += ['--image-shape', n_ch + ',224,224'] if opts.dtype == 'float16': - command += " --fuse-bn-relu 1" - command += " --input-layout NHWC --conv-layout NHWC" - command += " --batchnorm-layout NHWC --pooling-layout NHWC" - command += " --conv-algo 1 --force-tensor-core 1" - command += " --fuse-bn-add-relu 1" + command += '--fuse-bn-relu 1 --fuse-bn-add-relu 1'.split() + command += '--input-layout NCHW --conv-layout NHWC ' \ + '--batchnorm-layout NHWC --pooling-layout NHWC'.split() -command += " --kv-store device" -if not opts.no_dali: - command += " --use-dali" - command += " --dali-prefetch-queue 2 --dali-nvjpeg-memory-padding 64" -command += " --lr "+str(opts.lr) -command += " --gpus " + str(list(range(opts.n_GPUs))).replace(' ', '').replace('[', '').replace(']', '') -command += " --batch-size " + str(opts.batch_size) -command += " --num-epochs " + str(opts.num_epochs) +command += ['--kv-store', opts.kv_store] +command += ['--data-backend', opts.data_backend] +command += ['--lr', str(opts.lr)] +command += ['--gpus', ','.join(list(map(str, range(opts.ngpus))))] +command += ['--batch-size', str(opts.batch_size)] +command += ['--num-epochs', str(opts.num_epochs)] +command += args -for arg in args: - command += " " + arg os.environ['MXNET_UPDATE_ON_KVSTORE'] = "0" os.environ['MXNET_EXEC_ENABLE_ADDTO'] = "1" @@ -92,5 +71,11 @@ os.environ['MXNET_USE_TENSORRT'] = "0" os.environ['MXNET_GPU_WORKER_NTHREADS'] = "2" os.environ['MXNET_GPU_COPY_NTHREADS'] = "1" os.environ['MXNET_OPTIMIZER_AGGREGATION_SIZE'] = "54" +os.environ['HOROVOD_CYCLE_TIME'] = "0.1" +os.environ['HOROVOD_FUSION_THRESHOLD'] = "67108864" +os.environ['HOROVOD_NUM_NCCL_STREAMS'] = "2" +os.environ['MXNET_HOROVOD_NUM_GROUPS'] = "16" +os.environ['MXNET_EXEC_BULK_EXEC_MAX_NODE_TRAIN_FWD'] = "999" +os.environ['MXNET_EXEC_BULK_EXEC_MAX_NODE_TRAIN_BWD'] = "25" -exit(os.system('/bin/bash -c "'+command+'"')) +os.execvp(command[0], command) diff --git a/MxNet/Classification/RN50v1.5/examples/INFER_BENCHMARK_FP32.sh b/MxNet/Classification/RN50v1.5/scripts/prepare_imagenet.sh old mode 100644 new mode 100755 similarity index 57% rename from MxNet/Classification/RN50v1.5/examples/INFER_BENCHMARK_FP32.sh rename to MxNet/Classification/RN50v1.5/scripts/prepare_imagenet.sh index 1fc38269..4eb4700e --- a/MxNet/Classification/RN50v1.5/examples/INFER_BENCHMARK_FP32.sh +++ b/MxNet/Classification/RN50v1.5/scripts/prepare_imagenet.sh @@ -1,3 +1,4 @@ +#!/bin/bash # Copyright (c) 2019, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); @@ -12,8 +13,14 @@ # See the License for the specific language governing permissions and # limitations under the License. +if [ $# -lt 2 ] ; then + echo "usage: $0 raw_dataset prepared_dataset" + exit 1 +fi -# This script launches ResNet50 inference benchmark in FP32 on 1 GPU with 1,2,4,32,64,96 batch size -# Usage ./INFER_BENCHMARK_FP32.sh - -python benchmark.py -n 1 -b 1,2,4,32,64,96 --only-inference -e 3 -w 1 -i 100 -o report.json $@ +cd "$2" && +python /opt/mxnet/tools/im2rec.py --list --recursive train "$1/train" && +python /opt/mxnet/tools/im2rec.py --list --recursive val "$1/val" && +python /opt/mxnet/tools/im2rec.py --pass-through --num-thread 40 train "$1/train" && +python /opt/mxnet/tools/im2rec.py --pass-through --num-thread 40 val "$1/val" && +echo "Dataset was prepared succesfully!" diff --git a/MxNet/Classification/RN50v1.5/train.py b/MxNet/Classification/RN50v1.5/train.py index b7f5e555..33fff8fd 100644 --- a/MxNet/Classification/RN50v1.5/train.py +++ b/MxNet/Classification/RN50v1.5/train.py @@ -34,58 +34,37 @@ # limitations under the License. import os +import sys import argparse import logging -logging.basicConfig(level=logging.DEBUG) -import data, dali, fit import mxnet as mx import numpy as np -def set_imagenet_aug(aug): - # standard data augmentation setting for imagenet training - aug.set_defaults(rgb_mean='123.68,116.779,103.939', rgb_std='58.393,57.12,57.375') - aug.set_defaults(random_crop=0, random_resized_crop=1, random_mirror=1) - aug.set_defaults(min_random_area=0.08) - aug.set_defaults(max_random_aspect_ratio=4./3., min_random_aspect_ratio=3./4.) - aug.set_defaults(brightness=0.4, contrast=0.4, saturation=0.4, pca_noise=0.1) +import data, dali +import fit +import models -if __name__ == '__main__': - # parse args - parser = argparse.ArgumentParser(description="train resnet on imagenet", +def parse_args(): + parser = argparse.ArgumentParser(description="Train classification models on ImageNet", formatter_class=argparse.ArgumentDefaultsHelpFormatter) + models.add_model_args(parser) fit.add_fit_args(parser) data.add_data_args(parser) dali.add_dali_args(parser) data.add_data_aug_args(parser) - - # Instead, to get standard resnet augmentation on a per-use basis, invoke as in: - # train_imagenet.py --set-resnet-aug ... - # Finally, to get the legacy MXNet v1.2 training settings on a per-use basis, invoke as in: - # train_imagenet.py --set-data-aug-level 3 - parser.set_defaults( - # network - num_layers = 50, + return parser.parse_args() - # data - resize = 256, - num_classes = 1000, - num_examples = 1281167, - image_shape = '3,224,224', - min_random_scale = 1, # if input image has min size k, suggest to use - # 256.0/x, e.g. 0.533 for 480 - # train - num_epochs = 90, - lr_step_epochs = '30,60,80', - dtype = 'float32' - ) - args = parser.parse_args() +def setup_logging(args): + head = '{asctime}:{levelname}: {message}' + logging.basicConfig(level=logging.DEBUG, format=head, style='{', + handlers=[logging.StreamHandler(sys.stderr), logging.FileHandler(args.log)]) + logging.info('Start with arguments {}'.format(args)) - if not args.use_dali: - data.set_data_aug_level(parser, 0) +if __name__ == '__main__': + args = parse_args() + setup_logging(args) - # load network - import resnet as net - sym = net.get_symbol(**vars(args)) + model = models.get_model(**vars(args)) + data_loader = data.get_data_loader(args) - # train - fit.fit(args, sym, dali.get_rec_iter) + fit.fit(args, model, data_loader) diff --git a/PyTorch/Detection/SSD/csrc/box_encoder_cuda.cu b/PyTorch/Detection/SSD/csrc/box_encoder_cuda.cu index b5a2f03f..b740a18d 100644 --- a/PyTorch/Detection/SSD/csrc/box_encoder_cuda.cu +++ b/PyTorch/Detection/SSD/csrc/box_encoder_cuda.cu @@ -1,6 +1,6 @@ /****************************************************************************** * -* Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. +* Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. diff --git a/PyTorch/Detection/SSD/csrc/interface.cpp b/PyTorch/Detection/SSD/csrc/interface.cpp index 0ca51e3f..a8dea4e4 100644 --- a/PyTorch/Detection/SSD/csrc/interface.cpp +++ b/PyTorch/Detection/SSD/csrc/interface.cpp @@ -1,6 +1,6 @@ /****************************************************************************** * -* Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. +* Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. diff --git a/PyTorch/Detection/SSD/csrc/random_horiz_flip.cu b/PyTorch/Detection/SSD/csrc/random_horiz_flip.cu index 6964bfee..de8a681e 100644 --- a/PyTorch/Detection/SSD/csrc/random_horiz_flip.cu +++ b/PyTorch/Detection/SSD/csrc/random_horiz_flip.cu @@ -1,6 +1,6 @@ /****************************************************************************** * -* Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. +* Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. * * Licensed under the Apache License, Version 2.0 (the "License"); * you may not use this file except in compliance with the License. diff --git a/PyTorch/Detection/SSD/dle/inference.py b/PyTorch/Detection/SSD/dle/inference.py index ad54c2c1..bb009331 100644 --- a/PyTorch/Detection/SSD/dle/inference.py +++ b/PyTorch/Detection/SSD/dle/inference.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + import numpy as np import skimage diff --git a/PyTorch/Detection/SSD/examples/SSD300_inference.py b/PyTorch/Detection/SSD/examples/SSD300_inference.py index e133178b..148454be 100644 --- a/PyTorch/Detection/SSD/examples/SSD300_inference.py +++ b/PyTorch/Detection/SSD/examples/SSD300_inference.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + import torch import numpy as np diff --git a/PyTorch/Detection/SSD/main.py b/PyTorch/Detection/SSD/main.py index 44d9de96..81b2009a 100644 --- a/PyTorch/Detection/SSD/main.py +++ b/PyTorch/Detection/SSD/main.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + import os import time from argparse import ArgumentParser diff --git a/PyTorch/Detection/SSD/setup.py b/PyTorch/Detection/SSD/setup.py index 7bc21aa1..c96bde14 100644 --- a/PyTorch/Detection/SSD/setup.py +++ b/PyTorch/Detection/SSD/setup.py @@ -1,6 +1,6 @@ #!/usr/bin/env python -# Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. diff --git a/PyTorch/Detection/SSD/src/coco.py b/PyTorch/Detection/SSD/src/coco.py old mode 100755 new mode 100644 index dd0e880b..60d7eede --- a/PyTorch/Detection/SSD/src/coco.py +++ b/PyTorch/Detection/SSD/src/coco.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + __author__ = 'tylin' __version__ = '2.0' # Interface for accessing the Microsoft COCO dataset. diff --git a/PyTorch/Detection/SSD/src/coco_pipeline.py b/PyTorch/Detection/SSD/src/coco_pipeline.py index 5b3b6389..3c5a6b4c 100644 --- a/PyTorch/Detection/SSD/src/coco_pipeline.py +++ b/PyTorch/Detection/SSD/src/coco_pipeline.py @@ -1,4 +1,4 @@ -# Copyright (c) 2018, NVIDIA CORPORATION. All rights reserved. +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. diff --git a/PyTorch/Detection/SSD/src/data.py b/PyTorch/Detection/SSD/src/data.py index 622af5d9..10b87dd1 100644 --- a/PyTorch/Detection/SSD/src/data.py +++ b/PyTorch/Detection/SSD/src/data.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + import os import torch @@ -18,7 +32,7 @@ def get_train_loader(args, local_seed): output_fp16=args.amp, output_nhwc=False, pad_output=False, seed=local_seed) train_pipe.build() - test_run = train_pipe.run() + test_run = train_pipe.schedule_run(), train_pipe.share_outputs(), train_pipe.release_outputs() train_loader = DALICOCOIterator(train_pipe, 118287 / args.N_gpu) return train_loader diff --git a/PyTorch/Detection/SSD/src/evaluate.py b/PyTorch/Detection/SSD/src/evaluate.py index f9d6560a..923faa43 100644 --- a/PyTorch/Detection/SSD/src/evaluate.py +++ b/PyTorch/Detection/SSD/src/evaluate.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + import torch import time import numpy as np diff --git a/PyTorch/Detection/SSD/src/logger.py b/PyTorch/Detection/SSD/src/logger.py index b9c19de2..f4c7dd87 100644 --- a/PyTorch/Detection/SSD/src/logger.py +++ b/PyTorch/Detection/SSD/src/logger.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + import math import numpy as np diff --git a/PyTorch/Detection/SSD/src/model.py b/PyTorch/Detection/SSD/src/model.py index f5738eb8..91fdb9d4 100644 --- a/PyTorch/Detection/SSD/src/model.py +++ b/PyTorch/Detection/SSD/src/model.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + import torch import torch.nn as nn from torchvision.models.resnet import resnet18, resnet34, resnet50, resnet101, resnet152 diff --git a/PyTorch/Detection/SSD/src/train.py b/PyTorch/Detection/SSD/src/train.py index 014404c5..85c92193 100644 --- a/PyTorch/Detection/SSD/src/train.py +++ b/PyTorch/Detection/SSD/src/train.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + from torch.autograd import Variable import torch import time diff --git a/PyTorch/Detection/SSD/src/utils.py b/PyTorch/Detection/SSD/src/utils.py index b36a1c96..6d7efbff 100644 --- a/PyTorch/Detection/SSD/src/utils.py +++ b/PyTorch/Detection/SSD/src/utils.py @@ -1,3 +1,17 @@ +# Copyright (c) 2018-2019, NVIDIA CORPORATION. All rights reserved. +# +# Licensed under the Apache License, Version 2.0 (the "License"); +# you may not use this file except in compliance with the License. +# You may obtain a copy of the License at +# +# http://www.apache.org/licenses/LICENSE-2.0 +# +# Unless required by applicable law or agreed to in writing, software +# distributed under the License is distributed on an "AS IS" BASIS, +# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +# See the License for the specific language governing permissions and +# limitations under the License. + import torch import torchvision.transforms as transforms import torch.utils.data as data