From f24753812a2b9ccfdd8645cb8d4d8f635065de03 Mon Sep 17 00:00:00 2001 From: Anis Elleuch Date: Thu, 12 Jan 2017 01:41:05 +0100 Subject: [PATCH] nats: Add support of NATS.io Streaming server (#3494) --- cmd/config-migrate.go | 127 +- cmd/config-migrate_test.go | 11 +- cmd/config-old.go | 68 +- cmd/{config-v11.go => config-v12.go} | 68 +- ...{config-v11_test.go => config-v12_test.go} | 0 cmd/globals.go | 2 +- cmd/notifiers.go | 4 +- cmd/notify-nats.go | 141 +- vendor/github.com/gogo/protobuf/LICENSE | 36 + .../gogo/protobuf/gogoproto/Makefile | 37 + .../github.com/gogo/protobuf/gogoproto/doc.go | 168 + .../gogo/protobuf/gogoproto/gogo.pb.go | 749 +++++ .../gogo/protobuf/gogoproto/gogo.pb.golden | 45 + .../gogo/protobuf/gogoproto/gogo.proto | 125 + .../gogo/protobuf/gogoproto/helper.go | 345 ++ .../github.com/gogo/protobuf/proto/Makefile | 43 + .../github.com/gogo/protobuf/proto/clone.go | 234 ++ .../github.com/gogo/protobuf/proto/decode.go | 978 ++++++ .../gogo/protobuf/proto/decode_gogo.go | 172 + .../gogo/protobuf/proto/duration.go | 100 + .../gogo/protobuf/proto/duration_gogo.go | 203 ++ .../github.com/gogo/protobuf/proto/encode.go | 1362 ++++++++ .../gogo/protobuf/proto/encode_gogo.go | 350 +++ .../github.com/gogo/protobuf/proto/equal.go | 300 ++ .../gogo/protobuf/proto/extensions.go | 693 ++++ .../gogo/protobuf/proto/extensions_gogo.go | 294 ++ vendor/github.com/gogo/protobuf/proto/lib.go | 898 ++++++ .../gogo/protobuf/proto/lib_gogo.go | 42 + .../gogo/protobuf/proto/message_set.go | 311 ++ .../gogo/protobuf/proto/pointer_reflect.go | 484 +++ .../protobuf/proto/pointer_reflect_gogo.go | 85 + .../gogo/protobuf/proto/pointer_unsafe.go | 270 ++ .../protobuf/proto/pointer_unsafe_gogo.go | 128 + .../gogo/protobuf/proto/properties.go | 968 ++++++ .../gogo/protobuf/proto/properties_gogo.go | 111 + .../gogo/protobuf/proto/skip_gogo.go | 119 + vendor/github.com/gogo/protobuf/proto/text.go | 928 ++++++ .../gogo/protobuf/proto/text_gogo.go | 57 + .../gogo/protobuf/proto/text_parser.go | 1013 ++++++ .../gogo/protobuf/proto/timestamp.go | 113 + .../gogo/protobuf/proto/timestamp_gogo.go | 229 ++ .../protoc-gen-gogo/descriptor/Makefile | 36 + .../protoc-gen-gogo/descriptor/descriptor.go | 92 + .../descriptor/descriptor.pb.go | 2088 ++++++++++++ .../descriptor/descriptor_gostring.gen.go | 715 +++++ .../protoc-gen-gogo/descriptor/helper.go | 357 +++ .../nats-io/go-nats-streaming/LICENSE | 20 + .../nats-io/go-nats-streaming/README.md | 350 +++ .../nats-io/go-nats-streaming/TODO.md | 15 + .../go-nats-streaming/pb/protocol.pb.go | 2794 +++++++++++++++++ .../go-nats-streaming/pb/protocol.proto | 115 + .../nats-io/go-nats-streaming/stan.go | 476 +++ .../nats-io/go-nats-streaming/sub.go | 472 +++ vendor/github.com/nats-io/go-nats/LICENSE | 20 + vendor/github.com/nats-io/go-nats/README.md | 322 ++ vendor/github.com/nats-io/go-nats/TODO.md | 26 + vendor/github.com/nats-io/go-nats/enc.go | 249 ++ .../go-nats/encoders/builtin/default_enc.go | 106 + .../go-nats/encoders/builtin/gob_enc.go | 34 + .../go-nats/encoders/builtin/json_enc.go | 45 + vendor/github.com/nats-io/go-nats/nats.go | 2630 ++++++++++++++++ vendor/github.com/nats-io/go-nats/netchan.go | 100 + vendor/github.com/nats-io/go-nats/parser.go | 470 +++ vendor/github.com/nats-io/go-nats/util/tls.go | 37 + .../nats-io/go-nats/util/tls_pre17.go | 35 + vendor/vendor.json | 48 + 66 files changed, 23979 insertions(+), 84 deletions(-) rename cmd/{config-v11.go => config-v12.go} (77%) rename cmd/{config-v11_test.go => config-v12_test.go} (100%) create mode 100644 vendor/github.com/gogo/protobuf/LICENSE create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/Makefile create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/doc.go create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/gogo.proto create mode 100644 vendor/github.com/gogo/protobuf/gogoproto/helper.go create mode 100644 vendor/github.com/gogo/protobuf/proto/Makefile create mode 100644 vendor/github.com/gogo/protobuf/proto/clone.go create mode 100644 vendor/github.com/gogo/protobuf/proto/decode.go create mode 100644 vendor/github.com/gogo/protobuf/proto/decode_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/duration.go create mode 100644 vendor/github.com/gogo/protobuf/proto/duration_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/encode.go create mode 100644 vendor/github.com/gogo/protobuf/proto/encode_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/equal.go create mode 100644 vendor/github.com/gogo/protobuf/proto/extensions.go create mode 100644 vendor/github.com/gogo/protobuf/proto/extensions_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/lib.go create mode 100644 vendor/github.com/gogo/protobuf/proto/lib_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/message_set.go create mode 100644 vendor/github.com/gogo/protobuf/proto/pointer_reflect.go create mode 100644 vendor/github.com/gogo/protobuf/proto/pointer_reflect_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/pointer_unsafe.go create mode 100644 vendor/github.com/gogo/protobuf/proto/pointer_unsafe_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/properties.go create mode 100644 vendor/github.com/gogo/protobuf/proto/properties_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/skip_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/text.go create mode 100644 vendor/github.com/gogo/protobuf/proto/text_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/proto/text_parser.go create mode 100644 vendor/github.com/gogo/protobuf/proto/timestamp.go create mode 100644 vendor/github.com/gogo/protobuf/proto/timestamp_gogo.go create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go create mode 100644 vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go create mode 100644 vendor/github.com/nats-io/go-nats-streaming/LICENSE create mode 100644 vendor/github.com/nats-io/go-nats-streaming/README.md create mode 100644 vendor/github.com/nats-io/go-nats-streaming/TODO.md create mode 100644 vendor/github.com/nats-io/go-nats-streaming/pb/protocol.pb.go create mode 100644 vendor/github.com/nats-io/go-nats-streaming/pb/protocol.proto create mode 100644 vendor/github.com/nats-io/go-nats-streaming/stan.go create mode 100644 vendor/github.com/nats-io/go-nats-streaming/sub.go create mode 100644 vendor/github.com/nats-io/go-nats/LICENSE create mode 100644 vendor/github.com/nats-io/go-nats/README.md create mode 100644 vendor/github.com/nats-io/go-nats/TODO.md create mode 100644 vendor/github.com/nats-io/go-nats/enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go create mode 100644 vendor/github.com/nats-io/go-nats/nats.go create mode 100644 vendor/github.com/nats-io/go-nats/netchan.go create mode 100644 vendor/github.com/nats-io/go-nats/parser.go create mode 100644 vendor/github.com/nats-io/go-nats/util/tls.go create mode 100644 vendor/github.com/nats-io/go-nats/util/tls_pre17.go diff --git a/cmd/config-migrate.go b/cmd/config-migrate.go index 04da1c882..8f6bccf4e 100644 --- a/cmd/config-migrate.go +++ b/cmd/config-migrate.go @@ -66,6 +66,11 @@ func migrateConfig() error { if err := migrateV10ToV11(); err != nil { return err } + // Migrate version '11' to '12'. + if err := migrateV11ToV12(); err != nil { + return err + } + return nil } @@ -423,7 +428,7 @@ func migrateV7ToV8() error { srvConfig.Logger.File = cv7.Logger.File srvConfig.Logger.Syslog = cv7.Logger.Syslog srvConfig.Notify.AMQP = make(map[string]amqpNotify) - srvConfig.Notify.NATS = make(map[string]natsNotify) + srvConfig.Notify.NATS = make(map[string]natsNotifyV1) srvConfig.Notify.ElasticSearch = make(map[string]elasticSearchNotify) srvConfig.Notify.Redis = make(map[string]redisNotify) srvConfig.Notify.PostgreSQL = make(map[string]postgreSQLNotify) @@ -433,7 +438,7 @@ func migrateV7ToV8() error { srvConfig.Notify.AMQP = cv7.Notify.AMQP } if len(cv7.Notify.NATS) == 0 { - srvConfig.Notify.NATS["1"] = natsNotify{} + srvConfig.Notify.NATS["1"] = natsNotifyV1{} } else { srvConfig.Notify.NATS = cv7.Notify.NATS } @@ -502,8 +507,8 @@ func migrateV8ToV9() error { srvConfig.Notify.AMQP = cv8.Notify.AMQP } if len(cv8.Notify.NATS) == 0 { - srvConfig.Notify.NATS = make(map[string]natsNotify) - srvConfig.Notify.NATS["1"] = natsNotify{} + srvConfig.Notify.NATS = make(map[string]natsNotifyV1) + srvConfig.Notify.NATS["1"] = natsNotifyV1{} } else { srvConfig.Notify.NATS = cv8.Notify.NATS } @@ -587,8 +592,8 @@ func migrateV9ToV10() error { srvConfig.Notify.AMQP = cv9.Notify.AMQP } if len(cv9.Notify.NATS) == 0 { - srvConfig.Notify.NATS = make(map[string]natsNotify) - srvConfig.Notify.NATS["1"] = natsNotify{} + srvConfig.Notify.NATS = make(map[string]natsNotifyV1) + srvConfig.Notify.NATS["1"] = natsNotifyV1{} } else { srvConfig.Notify.NATS = cv9.Notify.NATS } @@ -672,8 +677,8 @@ func migrateV10ToV11() error { srvConfig.Notify.AMQP = cv10.Notify.AMQP } if len(cv10.Notify.NATS) == 0 { - srvConfig.Notify.NATS = make(map[string]natsNotify) - srvConfig.Notify.NATS["1"] = natsNotify{} + srvConfig.Notify.NATS = make(map[string]natsNotifyV1) + srvConfig.Notify.NATS["1"] = natsNotifyV1{} } else { srvConfig.Notify.NATS = cv10.Notify.NATS } @@ -725,3 +730,109 @@ func migrateV10ToV11() error { ) return nil } + +// Version '11' to '12' migration. Add support for NATS streaming +// notifications. +func migrateV11ToV12() error { + cv11, err := loadConfigV11() + if err != nil { + if os.IsNotExist(err) { + return nil + } + return fmt.Errorf("Unable to load config version ‘11’. %v", err) + } + if cv11.Version != "11" { + return nil + } + + // Copy over fields from V11 into V12 config struct + srvConfig := &serverConfigV12{} + srvConfig.Version = "12" + srvConfig.Credential = cv11.Credential + srvConfig.Region = cv11.Region + if srvConfig.Region == "" { + // Region needs to be set for AWS Signature Version 4. + srvConfig.Region = "us-east-1" + } + srvConfig.Logger.Console = cv11.Logger.Console + srvConfig.Logger.File = cv11.Logger.File + + // check and set notifiers config + if len(cv11.Notify.AMQP) == 0 { + srvConfig.Notify.AMQP = make(map[string]amqpNotify) + srvConfig.Notify.AMQP["1"] = amqpNotify{} + } else { + srvConfig.Notify.AMQP = cv11.Notify.AMQP + } + if len(cv11.Notify.ElasticSearch) == 0 { + srvConfig.Notify.ElasticSearch = make(map[string]elasticSearchNotify) + srvConfig.Notify.ElasticSearch["1"] = elasticSearchNotify{} + } else { + srvConfig.Notify.ElasticSearch = cv11.Notify.ElasticSearch + } + if len(cv11.Notify.Redis) == 0 { + srvConfig.Notify.Redis = make(map[string]redisNotify) + srvConfig.Notify.Redis["1"] = redisNotify{} + } else { + srvConfig.Notify.Redis = cv11.Notify.Redis + } + if len(cv11.Notify.PostgreSQL) == 0 { + srvConfig.Notify.PostgreSQL = make(map[string]postgreSQLNotify) + srvConfig.Notify.PostgreSQL["1"] = postgreSQLNotify{} + } else { + srvConfig.Notify.PostgreSQL = cv11.Notify.PostgreSQL + } + if len(cv11.Notify.Kafka) == 0 { + srvConfig.Notify.Kafka = make(map[string]kafkaNotify) + srvConfig.Notify.Kafka["1"] = kafkaNotify{} + } else { + srvConfig.Notify.Kafka = cv11.Notify.Kafka + } + + // V12 will have an updated config of nats. So we create a new one or we + // update the old one if found. + if len(cv11.Notify.NATS) == 0 { + srvConfig.Notify.NATS = make(map[string]natsNotify) + srvConfig.Notify.NATS["1"] = natsNotify{} + } else { + srvConfig.Notify.NATS = make(map[string]natsNotify) + for k, v := range cv11.Notify.NATS { + n := natsNotify{} + n.Enable = v.Enable + n.Address = v.Address + n.Subject = v.Subject + n.Username = v.Username + n.Password = v.Password + n.Token = v.Token + n.Secure = v.Secure + n.PingInterval = v.PingInterval + srvConfig.Notify.NATS[k] = n + } + } + + qc, err := quick.New(srvConfig) + if err != nil { + return fmt.Errorf("Unable to initialize the quick config. %v", + err) + } + configFile, err := getConfigFile() + if err != nil { + return fmt.Errorf("Unable to get config file. %v", err) + } + + err = qc.Save(configFile) + if err != nil { + return fmt.Errorf( + "Failed to migrate config from ‘"+ + cv11.Version+"’ to ‘"+srvConfig.Version+ + "’ failed. %v", err, + ) + } + + console.Println( + "Migration from version ‘" + + cv11.Version + "’ to ‘" + srvConfig.Version + + "’ completed successfully.", + ) + return nil +} diff --git a/cmd/config-migrate_test.go b/cmd/config-migrate_test.go index f2f4d3229..d4897e049 100644 --- a/cmd/config-migrate_test.go +++ b/cmd/config-migrate_test.go @@ -100,10 +100,13 @@ func TestServerConfigMigrateInexistentConfig(t *testing.T) { if err := migrateV10ToV11(); err != nil { t.Fatal("migrate v10 to v11 should succeed when no config file is found") } + if err := migrateV11ToV12(); err != nil { + t.Fatal("migrate v10 to v11 should succeed when no config file is found") + } } -// Test if a config migration from v2 to v11 is successfully done -func TestServerConfigMigrateV2toV11(t *testing.T) { +// Test if a config migration from v2 to v12 is successfully done +func TestServerConfigMigrateV2toV12(t *testing.T) { rootPath, err := newTestConfig("us-east-1") if err != nil { t.Fatalf("Init Test config failed") @@ -206,4 +209,8 @@ func TestServerConfigMigrateFaultyConfig(t *testing.T) { if err := migrateV10ToV11(); err == nil { t.Fatal("migrateConfigV10ToV11() should fail with a corrupted json") } + if err := migrateV11ToV12(); err == nil { + t.Fatal("migrateConfigV11ToV12() should fail with a corrupted json") + } + } diff --git a/cmd/config-old.go b/cmd/config-old.go index ebf8edb3b..30b7fd460 100644 --- a/cmd/config-old.go +++ b/cmd/config-old.go @@ -301,7 +301,7 @@ type configV6 struct { Logger loggerV6 `json:"logger"` // Notification queue configuration. - Notify notifier `json:"notify"` + Notify notifierV1 `json:"notify"` } // loadConfigV6 load config version '6'. @@ -325,6 +325,16 @@ func loadConfigV6() (*configV6, error) { return c, nil } +// Notifier represents collection of supported notification queues. +type notifierV1 struct { + AMQP map[string]amqpNotify `json:"amqp"` + NATS map[string]natsNotifyV1 `json:"nats"` + ElasticSearch map[string]elasticSearchNotify `json:"elasticsearch"` + Redis map[string]redisNotify `json:"redis"` + PostgreSQL map[string]postgreSQLNotify `json:"postgresql"` + Kafka map[string]kafkaNotify `json:"kafka"` +} + // configV7 server configuration version '7'. type serverConfigV7 struct { Version string `json:"version"` @@ -337,7 +347,7 @@ type serverConfigV7 struct { Logger loggerV6 `json:"logger"` // Notification queue configuration. - Notify notifier `json:"notify"` + Notify notifierV1 `json:"notify"` // Read Write mutex. rwMutex *sync.RWMutex @@ -377,7 +387,7 @@ type serverConfigV8 struct { Logger loggerV6 `json:"logger"` // Notification queue configuration. - Notify notifier `json:"notify"` + Notify notifierV1 `json:"notify"` // Read Write mutex. rwMutex *sync.RWMutex @@ -417,7 +427,7 @@ type serverConfigV9 struct { Logger loggerV6 `json:"logger"` // Notification queue configuration. - Notify notifier `json:"notify"` + Notify notifierV1 `json:"notify"` // Read Write mutex. rwMutex *sync.RWMutex @@ -458,7 +468,7 @@ type serverConfigV10 struct { Logger logger `json:"logger"` // Notification queue configuration. - Notify notifier `json:"notify"` + Notify notifierV1 `json:"notify"` } func loadConfigV10() (*serverConfigV10, error) { @@ -480,3 +490,51 @@ func loadConfigV10() (*serverConfigV10, error) { } return srvCfg, nil } + +// natsNotifyV1 - structure was valid until config V 11 +type natsNotifyV1 struct { + Enable bool `json:"enable"` + Address string `json:"address"` + Subject string `json:"subject"` + Username string `json:"username"` + Password string `json:"password"` + Token string `json:"token"` + Secure bool `json:"secure"` + PingInterval int64 `json:"pingInterval"` +} + +// serverConfigV11 server configuration version '11' which is like +// version '10' except it adds support for Kafka notifications. +type serverConfigV11 struct { + Version string `json:"version"` + + // S3 API configuration. + Credential credential `json:"credential"` + Region string `json:"region"` + + // Additional error logging configuration. + Logger logger `json:"logger"` + + // Notification queue configuration. + Notify notifierV1 `json:"notify"` +} + +func loadConfigV11() (*serverConfigV11, error) { + configFile, err := getConfigFile() + if err != nil { + return nil, err + } + if _, err = os.Stat(configFile); err != nil { + return nil, err + } + srvCfg := &serverConfigV11{} + srvCfg.Version = "11" + qc, err := quick.New(srvCfg) + if err != nil { + return nil, err + } + if err := qc.Load(configFile); err != nil { + return nil, err + } + return srvCfg, nil +} diff --git a/cmd/config-v11.go b/cmd/config-v12.go similarity index 77% rename from cmd/config-v11.go rename to cmd/config-v12.go index ebef56f36..017529303 100644 --- a/cmd/config-v11.go +++ b/cmd/config-v12.go @@ -26,9 +26,9 @@ import ( // Read Write mutex for safe access to ServerConfig. var serverConfigMu sync.RWMutex -// serverConfigV11 server configuration version '11' which is like -// version '10' except it adds support for Kafka notifications. -type serverConfigV11 struct { +// serverConfigV12 server configuration version '12' which is like +// version '11' except it adds support for NATS streaming notifications. +type serverConfigV12 struct { Version string `json:"version"` // S3 API configuration. @@ -47,7 +47,7 @@ type serverConfigV11 struct { func initConfig() (bool, error) { if !isConfigFileExists() { // Initialize server config. - srvCfg := &serverConfigV11{} + srvCfg := &serverConfigV12{} srvCfg.Version = globalMinioConfigVersion srvCfg.Region = "us-east-1" srvCfg.Credential = newCredential() @@ -94,7 +94,7 @@ func initConfig() (bool, error) { if _, err = os.Stat(configFile); err != nil { return false, err } - srvCfg := &serverConfigV11{} + srvCfg := &serverConfigV12{} srvCfg.Version = globalMinioConfigVersion qc, err := quick.New(srvCfg) if err != nil { @@ -116,10 +116,10 @@ func initConfig() (bool, error) { } // serverConfig server config. -var serverConfig *serverConfigV11 +var serverConfig *serverConfigV12 // GetVersion get current config version. -func (s serverConfigV11) GetVersion() string { +func (s serverConfigV12) GetVersion() string { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -128,14 +128,14 @@ func (s serverConfigV11) GetVersion() string { /// Logger related. -func (s *serverConfigV11) SetAMQPNotifyByID(accountID string, amqpn amqpNotify) { +func (s *serverConfigV12) SetAMQPNotifyByID(accountID string, amqpn amqpNotify) { serverConfigMu.Lock() defer serverConfigMu.Unlock() s.Notify.AMQP[accountID] = amqpn } -func (s serverConfigV11) GetAMQP() map[string]amqpNotify { +func (s serverConfigV12) GetAMQP() map[string]amqpNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -143,7 +143,7 @@ func (s serverConfigV11) GetAMQP() map[string]amqpNotify { } // GetAMQPNotify get current AMQP logger. -func (s serverConfigV11) GetAMQPNotifyByID(accountID string) amqpNotify { +func (s serverConfigV12) GetAMQPNotifyByID(accountID string) amqpNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -151,35 +151,35 @@ func (s serverConfigV11) GetAMQPNotifyByID(accountID string) amqpNotify { } // -func (s *serverConfigV11) SetNATSNotifyByID(accountID string, natsn natsNotify) { +func (s *serverConfigV12) SetNATSNotifyByID(accountID string, natsn natsNotify) { serverConfigMu.Lock() defer serverConfigMu.Unlock() s.Notify.NATS[accountID] = natsn } -func (s serverConfigV11) GetNATS() map[string]natsNotify { +func (s serverConfigV12) GetNATS() map[string]natsNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() return s.Notify.NATS } // GetNATSNotify get current NATS logger. -func (s serverConfigV11) GetNATSNotifyByID(accountID string) natsNotify { +func (s serverConfigV12) GetNATSNotifyByID(accountID string) natsNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() return s.Notify.NATS[accountID] } -func (s *serverConfigV11) SetElasticSearchNotifyByID(accountID string, esNotify elasticSearchNotify) { +func (s *serverConfigV12) SetElasticSearchNotifyByID(accountID string, esNotify elasticSearchNotify) { serverConfigMu.Lock() defer serverConfigMu.Unlock() s.Notify.ElasticSearch[accountID] = esNotify } -func (s serverConfigV11) GetElasticSearch() map[string]elasticSearchNotify { +func (s serverConfigV12) GetElasticSearch() map[string]elasticSearchNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -187,21 +187,21 @@ func (s serverConfigV11) GetElasticSearch() map[string]elasticSearchNotify { } // GetElasticSearchNotify get current ElasicSearch logger. -func (s serverConfigV11) GetElasticSearchNotifyByID(accountID string) elasticSearchNotify { +func (s serverConfigV12) GetElasticSearchNotifyByID(accountID string) elasticSearchNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() return s.Notify.ElasticSearch[accountID] } -func (s *serverConfigV11) SetRedisNotifyByID(accountID string, rNotify redisNotify) { +func (s *serverConfigV12) SetRedisNotifyByID(accountID string, rNotify redisNotify) { serverConfigMu.Lock() defer serverConfigMu.Unlock() s.Notify.Redis[accountID] = rNotify } -func (s serverConfigV11) GetRedis() map[string]redisNotify { +func (s serverConfigV12) GetRedis() map[string]redisNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -209,28 +209,28 @@ func (s serverConfigV11) GetRedis() map[string]redisNotify { } // GetRedisNotify get current Redis logger. -func (s serverConfigV11) GetRedisNotifyByID(accountID string) redisNotify { +func (s serverConfigV12) GetRedisNotifyByID(accountID string) redisNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() return s.Notify.Redis[accountID] } -func (s *serverConfigV11) SetPostgreSQLNotifyByID(accountID string, pgn postgreSQLNotify) { +func (s *serverConfigV12) SetPostgreSQLNotifyByID(accountID string, pgn postgreSQLNotify) { serverConfigMu.Lock() defer serverConfigMu.Unlock() s.Notify.PostgreSQL[accountID] = pgn } -func (s serverConfigV11) GetPostgreSQL() map[string]postgreSQLNotify { +func (s serverConfigV12) GetPostgreSQL() map[string]postgreSQLNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() return s.Notify.PostgreSQL } -func (s serverConfigV11) GetPostgreSQLNotifyByID(accountID string) postgreSQLNotify { +func (s serverConfigV12) GetPostgreSQLNotifyByID(accountID string) postgreSQLNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -238,21 +238,21 @@ func (s serverConfigV11) GetPostgreSQLNotifyByID(accountID string) postgreSQLNot } // Kafka related functions -func (s *serverConfigV11) SetKafkaNotifyByID(accountID string, kn kafkaNotify) { +func (s *serverConfigV12) SetKafkaNotifyByID(accountID string, kn kafkaNotify) { serverConfigMu.Lock() defer serverConfigMu.Unlock() s.Notify.Kafka[accountID] = kn } -func (s serverConfigV11) GetKafka() map[string]kafkaNotify { +func (s serverConfigV12) GetKafka() map[string]kafkaNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() return s.Notify.Kafka } -func (s serverConfigV11) GetKafkaNotifyByID(accountID string) kafkaNotify { +func (s serverConfigV12) GetKafkaNotifyByID(accountID string) kafkaNotify { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -260,7 +260,7 @@ func (s serverConfigV11) GetKafkaNotifyByID(accountID string) kafkaNotify { } // SetFileLogger set new file logger. -func (s *serverConfigV11) SetFileLogger(flogger fileLogger) { +func (s *serverConfigV12) SetFileLogger(flogger fileLogger) { serverConfigMu.Lock() defer serverConfigMu.Unlock() @@ -268,7 +268,7 @@ func (s *serverConfigV11) SetFileLogger(flogger fileLogger) { } // GetFileLogger get current file logger. -func (s serverConfigV11) GetFileLogger() fileLogger { +func (s serverConfigV12) GetFileLogger() fileLogger { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -276,7 +276,7 @@ func (s serverConfigV11) GetFileLogger() fileLogger { } // SetConsoleLogger set new console logger. -func (s *serverConfigV11) SetConsoleLogger(clogger consoleLogger) { +func (s *serverConfigV12) SetConsoleLogger(clogger consoleLogger) { serverConfigMu.Lock() defer serverConfigMu.Unlock() @@ -284,7 +284,7 @@ func (s *serverConfigV11) SetConsoleLogger(clogger consoleLogger) { } // GetConsoleLogger get current console logger. -func (s serverConfigV11) GetConsoleLogger() consoleLogger { +func (s serverConfigV12) GetConsoleLogger() consoleLogger { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -292,7 +292,7 @@ func (s serverConfigV11) GetConsoleLogger() consoleLogger { } // SetRegion set new region. -func (s *serverConfigV11) SetRegion(region string) { +func (s *serverConfigV12) SetRegion(region string) { serverConfigMu.Lock() defer serverConfigMu.Unlock() @@ -300,7 +300,7 @@ func (s *serverConfigV11) SetRegion(region string) { } // GetRegion get current region. -func (s serverConfigV11) GetRegion() string { +func (s serverConfigV12) GetRegion() string { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -308,7 +308,7 @@ func (s serverConfigV11) GetRegion() string { } // SetCredentials set new credentials. -func (s *serverConfigV11) SetCredential(creds credential) { +func (s *serverConfigV12) SetCredential(creds credential) { serverConfigMu.Lock() defer serverConfigMu.Unlock() @@ -316,7 +316,7 @@ func (s *serverConfigV11) SetCredential(creds credential) { } // GetCredentials get current credentials. -func (s serverConfigV11) GetCredential() credential { +func (s serverConfigV12) GetCredential() credential { serverConfigMu.RLock() defer serverConfigMu.RUnlock() @@ -324,7 +324,7 @@ func (s serverConfigV11) GetCredential() credential { } // Save config. -func (s serverConfigV11) Save() error { +func (s serverConfigV12) Save() error { serverConfigMu.RLock() defer serverConfigMu.RUnlock() diff --git a/cmd/config-v11_test.go b/cmd/config-v12_test.go similarity index 100% rename from cmd/config-v11_test.go rename to cmd/config-v12_test.go diff --git a/cmd/globals.go b/cmd/globals.go index 307a02198..0f0eb7476 100644 --- a/cmd/globals.go +++ b/cmd/globals.go @@ -36,7 +36,7 @@ const ( // minio configuration related constants. const ( - globalMinioConfigVersion = "11" + globalMinioConfigVersion = "12" globalMinioConfigDir = ".minio" globalMinioCertsDir = "certs" globalMinioCertsCADir = "CAs" diff --git a/cmd/notifiers.go b/cmd/notifiers.go index f40190421..8e65b9d9a 100644 --- a/cmd/notifiers.go +++ b/cmd/notifiers.go @@ -93,12 +93,12 @@ func isNATSQueue(sqsArn arnSQS) bool { return false } // Connect to nats server to validate. - natsC, err := dialNATS(natsL) + natsC, err := dialNATS(natsL, true) if err != nil { errorIf(err, "Unable to connect to nats service. %#v", natsL) return false } - defer natsC.Close() + closeNATS(natsC) return true } diff --git a/cmd/notify-nats.go b/cmd/notify-nats.go index 8fdbe2944..bec7cdcdf 100644 --- a/cmd/notify-nats.go +++ b/cmd/notify-nats.go @@ -20,53 +20,117 @@ import ( "io/ioutil" "github.com/Sirupsen/logrus" + "github.com/nats-io/go-nats-streaming" "github.com/nats-io/nats" ) +// natsNotifyStreaming contains specific options related to connection +// to a NATS streaming server +type natsNotifyStreaming struct { + Enable bool `json:"enable"` + ClusterID string `json:"clusterID"` + ClientID string `json:"clientID"` + Async bool `json:"async"` + MaxPubAcksInflight int `json:"maxPubAcksInflight"` +} + // natsNotify - represents logrus compatible NATS hook. // All fields represent NATS configuration details. type natsNotify struct { - Enable bool `json:"enable"` - Address string `json:"address"` - Subject string `json:"subject"` - Username string `json:"username"` - Password string `json:"password"` - Token string `json:"token"` - Secure bool `json:"secure"` - PingInterval int64 `json:"pingInterval"` + Enable bool `json:"enable"` + Address string `json:"address"` + Subject string `json:"subject"` + Username string `json:"username"` + Password string `json:"password"` + Token string `json:"token"` + Secure bool `json:"secure"` + PingInterval int64 `json:"pingInterval"` + Streaming natsNotifyStreaming `json:"streaming"` } -type natsConn struct { - params natsNotify - *nats.Conn +// natsIOConn abstracts connection to any type of NATS server +type natsIOConn struct { + params natsNotify + natsConn *nats.Conn + stanConn stan.Conn } -// dialNATS - dials and returns an natsConn instance, +// dialNATS - dials and returns an natsIOConn instance, // for sending notifications. Returns error if nats logger // is not enabled. -func dialNATS(natsL natsNotify) (natsConn, error) { +func dialNATS(natsL natsNotify, testDial bool) (natsIOConn, error) { if !natsL.Enable { - return natsConn{}, errNotifyNotEnabled + return natsIOConn{}, errNotifyNotEnabled } - // Configure and connect to NATS server - natsC := nats.DefaultOptions - natsC.Url = "nats://" + natsL.Address - natsC.User = natsL.Username - natsC.Password = natsL.Password - natsC.Token = natsL.Token - natsC.Secure = natsL.Secure - conn, err := natsC.Connect() - if err != nil { - return natsConn{}, err + + // Construct natsIOConn which holds all NATS connection information + conn := natsIOConn{params: natsL} + + if natsL.Streaming.Enable { + // Construct scheme to differentiate between clear and TLS connections + scheme := "nats" + if natsL.Secure { + scheme = "tls" + } + // Construct address URL + addressURL := scheme + "://" + natsL.Username + ":" + natsL.Password + "@" + natsL.Address + // Fetch the user-supplied client ID and provide a random one if not provided + clientID := natsL.Streaming.ClientID + if clientID == "" { + clientID = mustGetUUID() + } + // Add test suffix to clientID to avoid clientID already registered error + if testDial { + clientID += "-test" + } + connOpts := []stan.Option{ + stan.NatsURL(addressURL), + } + // Setup MaxPubAcksInflight parameter + if natsL.Streaming.MaxPubAcksInflight > 0 { + connOpts = append(connOpts, + stan.MaxPubAcksInflight(natsL.Streaming.MaxPubAcksInflight)) + } + // Do the real connection to the NATS server + sc, err := stan.Connect(natsL.Streaming.ClusterID, clientID, connOpts...) + if err != nil { + return natsIOConn{}, err + } + // Save the created connection + conn.stanConn = sc + } else { + // Configure and connect to NATS server + natsC := nats.DefaultOptions + natsC.Url = "nats://" + natsL.Address + natsC.User = natsL.Username + natsC.Password = natsL.Password + natsC.Token = natsL.Token + natsC.Secure = natsL.Secure + // Do the real connection + nc, err := natsC.Connect() + if err != nil { + return natsIOConn{}, err + } + // Save the created connection + conn.natsConn = nc + } + return conn, nil +} + +// closeNATS - close the underlying NATS connection +func closeNATS(conn natsIOConn) { + if conn.params.Streaming.Enable { + conn.stanConn.Close() + } else { + conn.natsConn.Close() } - return natsConn{Conn: conn, params: natsL}, nil } func newNATSNotify(accountID string) (*logrus.Logger, error) { natsL := serverConfig.GetNATSNotifyByID(accountID) // Connect to nats server. - natsC, err := dialNATS(natsL) + natsC, err := dialNATS(natsL, false) if err != nil { return nil, err } @@ -87,21 +151,34 @@ func newNATSNotify(accountID string) (*logrus.Logger, error) { } // Fire is called when an event should be sent to the message broker -func (n natsConn) Fire(entry *logrus.Entry) error { - ch := n.Conn +func (n natsIOConn) Fire(entry *logrus.Entry) error { body, err := entry.Reader() if err != nil { return err } - err = ch.Publish(n.params.Subject, body.Bytes()) - if err != nil { - return err + if n.params.Streaming.Enable { + // Streaming flag is enabled, publish the log synchronously or asynchronously + // depending on the user supplied parameter + if n.params.Streaming.Async { + _, err = n.stanConn.PublishAsync(n.params.Subject, body.Bytes(), nil) + } else { + err = n.stanConn.Publish(n.params.Subject, body.Bytes()) + } + if err != nil { + return err + } + } else { + // Publish the log + err = n.natsConn.Publish(n.params.Subject, body.Bytes()) + if err != nil { + return err + } } return nil } // Levels is available logging levels. -func (n natsConn) Levels() []logrus.Level { +func (n natsIOConn) Levels() []logrus.Level { return []logrus.Level{ logrus.InfoLevel, } diff --git a/vendor/github.com/gogo/protobuf/LICENSE b/vendor/github.com/gogo/protobuf/LICENSE new file mode 100644 index 000000000..7be0cc7b6 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/LICENSE @@ -0,0 +1,36 @@ +Protocol Buffers for Go with Gadgets + +Copyright (c) 2013, The GoGo Authors. All rights reserved. +http://github.com/gogo/protobuf + +Go support for Protocol Buffers - Google's data interchange format + +Copyright 2010 The Go Authors. All rights reserved. +https://github.com/golang/protobuf + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright +notice, this list of conditions and the following disclaimer. + * Redistributions in binary form must reproduce the above +copyright notice, this list of conditions and the following disclaimer +in the documentation and/or other materials provided with the +distribution. + * Neither the name of Google Inc. nor the names of its +contributors may be used to endorse or promote products derived from +this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + diff --git a/vendor/github.com/gogo/protobuf/gogoproto/Makefile b/vendor/github.com/gogo/protobuf/gogoproto/Makefile new file mode 100644 index 000000000..02f9c62c2 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/Makefile @@ -0,0 +1,37 @@ +# Protocol Buffers for Go with Gadgets +# +# Copyright (c) 2013, The GoGo Authors. All rights reserved. +# http://github.com/gogo/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + protoc --gogo_out=Mgoogle/protobuf/descriptor.proto=github.com/gogo/protobuf/protoc-gen-gogo/descriptor:. --proto_path=../../../../:../protobuf/:. *.proto + +restore: + cp gogo.pb.golden gogo.pb.go + +preserve: + cp gogo.pb.go gogo.pb.golden diff --git a/vendor/github.com/gogo/protobuf/gogoproto/doc.go b/vendor/github.com/gogo/protobuf/gogoproto/doc.go new file mode 100644 index 000000000..5ecfae113 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/doc.go @@ -0,0 +1,168 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +/* +Package gogoproto provides extensions for protocol buffers to achieve: + + - fast marshalling and unmarshalling. + - peace of mind by optionally generating test and benchmark code. + - more canonical Go structures. + - less typing by optionally generating extra helper code. + - goprotobuf compatibility + +More Canonical Go Structures + +A lot of time working with a goprotobuf struct will lead you to a place where you create another struct that is easier to work with and then have a function to copy the values between the two structs. +You might also find that basic structs that started their life as part of an API need to be sent over the wire. With gob, you could just send it. With goprotobuf, you need to make a parallel struct. +Gogoprotobuf tries to fix these problems with the nullable, embed, customtype and customname field extensions. + + - nullable, if false, a field is generated without a pointer (see warning below). + - embed, if true, the field is generated as an embedded field. + - customtype, It works with the Marshal and Unmarshal methods, to allow you to have your own types in your struct, but marshal to bytes. For example, custom.Uuid or custom.Fixed128 + - customname (beta), Changes the generated fieldname. This is especially useful when generated methods conflict with fieldnames. + - casttype (beta), Changes the generated fieldtype. All generated code assumes that this type is castable to the protocol buffer field type. It does not work for structs or enums. + - castkey (beta), Changes the generated fieldtype for a map key. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + - castvalue (beta), Changes the generated fieldtype for a map value. All generated code assumes that this type is castable to the protocol buffer field type. Only supported on maps. + +Warning about nullable: According to the Protocol Buffer specification, you should be able to tell whether a field is set or unset. With the option nullable=false this feature is lost, since your non-nullable fields will always be set. It can be seen as a layer on top of Protocol Buffers, where before and after marshalling all non-nullable fields are set and they cannot be unset. + +Let us look at: + + github.com/gogo/protobuf/test/example/example.proto + +for a quicker overview. + +The following message: + + package test; + + import "github.com/gogo/protobuf/gogoproto/gogo.proto"; + + message A { + optional string Description = 1 [(gogoproto.nullable) = false]; + optional int64 Number = 2 [(gogoproto.nullable) = false]; + optional bytes Id = 3 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uuid", (gogoproto.nullable) = false]; + } + +Will generate a go struct which looks a lot like this: + + type A struct { + Description string + Number int64 + Id github_com_gogo_protobuf_test_custom.Uuid + } + +You will see there are no pointers, since all fields are non-nullable. +You will also see a custom type which marshals to a string. +Be warned it is your responsibility to test your custom types thoroughly. +You should think of every possible empty and nil case for your marshaling, unmarshaling and size methods. + +Next we will embed the message A in message B. + + message B { + optional A A = 1 [(gogoproto.nullable) = false, (gogoproto.embed) = true]; + repeated bytes G = 2 [(gogoproto.customtype) = "github.com/gogo/protobuf/test/custom.Uint128", (gogoproto.nullable) = false]; + } + +See below that A is embedded in B. + + type B struct { + A + G []github_com_gogo_protobuf_test_custom.Uint128 + } + +Also see the repeated custom type. + + type Uint128 [2]uint64 + +Next we will create a custom name for one of our fields. + + message C { + optional int64 size = 1 [(gogoproto.customname) = "MySize"]; + } + +See below that the field's name is MySize and not Size. + + type C struct { + MySize *int64 + } + +The is useful when having a protocol buffer message with a field name which conflicts with a generated method. +As an example, having a field name size and using the sizer plugin to generate a Size method will cause a go compiler error. +Using customname you can fix this error without changing the field name. +This is typically useful when working with a protocol buffer that was designed before these methods and/or the go language were avialable. + +Gogoprotobuf also has some more subtle changes, these could be changed back: + + - the generated package name for imports do not have the extra /filename.pb, + but are actually the imports specified in the .proto file. + +Gogoprotobuf also has lost some features which should be brought back with time: + + - Marshalling and unmarshalling with reflect and without the unsafe package, + this requires work in pointer_reflect.go + +Why does nullable break protocol buffer specifications: + +The protocol buffer specification states, somewhere, that you should be able to tell whether a +field is set or unset. With the option nullable=false this feature is lost, +since your non-nullable fields will always be set. It can be seen as a layer on top of +protocol buffers, where before and after marshalling all non-nullable fields are set +and they cannot be unset. + +Goprotobuf Compatibility: + +Gogoprotobuf is compatible with Goprotobuf, because it is compatible with protocol buffers. +Gogoprotobuf generates the same code as goprotobuf if no extensions are used. +The enumprefix, getters and stringer extensions can be used to remove some of the unnecessary code generated by goprotobuf: + + - gogoproto_import, if false, the generated code imports github.com/golang/protobuf/proto instead of github.com/gogo/protobuf/proto. + - goproto_enum_prefix, if false, generates the enum constant names without the messagetype prefix + - goproto_enum_stringer (experimental), if false, the enum is generated without the default string method, this is useful for rather using enum_stringer, or allowing you to write your own string method. + - goproto_getters, if false, the message is generated without get methods, this is useful when you would rather want to use face + - goproto_stringer, if false, the message is generated without the default string method, this is useful for rather using stringer, or allowing you to write your own string method. + - goproto_extensions_map (beta), if false, the extensions field is generated as type []byte instead of type map[int32]proto.Extension + - goproto_unrecognized (beta), if false, XXX_unrecognized field is not generated. This is useful in conjunction with gogoproto.nullable=false, to generate structures completely devoid of pointers and reduce GC pressure at the cost of losing information about unrecognized fields. + +Less Typing and Peace of Mind is explained in their specific plugin folders godoc: + + - github.com/gogo/protobuf/plugin/ + +If you do not use any of these extension the code that is generated +will be the same as if goprotobuf has generated it. + +The most complete way to see examples is to look at + + github.com/gogo/protobuf/test/thetest.proto + +Gogoprototest is a seperate project, +because we want to keep gogoprotobuf independant of goprotobuf, +but we still want to test it thoroughly. + +*/ +package gogoproto diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go new file mode 100644 index 000000000..d88ba8013 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.go @@ -0,0 +1,749 @@ +// Code generated by protoc-gen-gogo. +// source: gogo.proto +// DO NOT EDIT! + +/* +Package gogoproto is a generated protocol buffer package. + +It is generated from these files: + gogo.proto + +It has these top-level messages: +*/ +package gogoproto + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +var E_GoprotoEnumPrefix = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62001, + Name: "gogoproto.goproto_enum_prefix", + Tag: "varint,62001,opt,name=goproto_enum_prefix,json=goprotoEnumPrefix", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62021, + Name: "gogoproto.goproto_enum_stringer", + Tag: "varint,62021,opt,name=goproto_enum_stringer,json=goprotoEnumStringer", + Filename: "gogo.proto", +} + +var E_EnumStringer = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.EnumOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 62022, + Name: "gogoproto.enum_stringer", + Tag: "varint,62022,opt,name=enum_stringer,json=enumStringer", + Filename: "gogo.proto", +} + +var E_EnumCustomname = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.EnumOptions)(nil), + ExtensionType: (*string)(nil), + Field: 62023, + Name: "gogoproto.enum_customname", + Tag: "bytes,62023,opt,name=enum_customname,json=enumCustomname", + Filename: "gogo.proto", +} + +var E_EnumvalueCustomname = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.EnumValueOptions)(nil), + ExtensionType: (*string)(nil), + Field: 66001, + Name: "gogoproto.enumvalue_customname", + Tag: "bytes,66001,opt,name=enumvalue_customname,json=enumvalueCustomname", + Filename: "gogo.proto", +} + +var E_GoprotoGettersAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63001, + Name: "gogoproto.goproto_getters_all", + Tag: "varint,63001,opt,name=goproto_getters_all,json=goprotoGettersAll", + Filename: "gogo.proto", +} + +var E_GoprotoEnumPrefixAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63002, + Name: "gogoproto.goproto_enum_prefix_all", + Tag: "varint,63002,opt,name=goproto_enum_prefix_all,json=goprotoEnumPrefixAll", + Filename: "gogo.proto", +} + +var E_GoprotoStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63003, + Name: "gogoproto.goproto_stringer_all", + Tag: "varint,63003,opt,name=goproto_stringer_all,json=goprotoStringerAll", + Filename: "gogo.proto", +} + +var E_VerboseEqualAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63004, + Name: "gogoproto.verbose_equal_all", + Tag: "varint,63004,opt,name=verbose_equal_all,json=verboseEqualAll", + Filename: "gogo.proto", +} + +var E_FaceAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63005, + Name: "gogoproto.face_all", + Tag: "varint,63005,opt,name=face_all,json=faceAll", + Filename: "gogo.proto", +} + +var E_GostringAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63006, + Name: "gogoproto.gostring_all", + Tag: "varint,63006,opt,name=gostring_all,json=gostringAll", + Filename: "gogo.proto", +} + +var E_PopulateAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63007, + Name: "gogoproto.populate_all", + Tag: "varint,63007,opt,name=populate_all,json=populateAll", + Filename: "gogo.proto", +} + +var E_StringerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63008, + Name: "gogoproto.stringer_all", + Tag: "varint,63008,opt,name=stringer_all,json=stringerAll", + Filename: "gogo.proto", +} + +var E_OnlyoneAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63009, + Name: "gogoproto.onlyone_all", + Tag: "varint,63009,opt,name=onlyone_all,json=onlyoneAll", + Filename: "gogo.proto", +} + +var E_EqualAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63013, + Name: "gogoproto.equal_all", + Tag: "varint,63013,opt,name=equal_all,json=equalAll", + Filename: "gogo.proto", +} + +var E_DescriptionAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63014, + Name: "gogoproto.description_all", + Tag: "varint,63014,opt,name=description_all,json=descriptionAll", + Filename: "gogo.proto", +} + +var E_TestgenAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63015, + Name: "gogoproto.testgen_all", + Tag: "varint,63015,opt,name=testgen_all,json=testgenAll", + Filename: "gogo.proto", +} + +var E_BenchgenAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63016, + Name: "gogoproto.benchgen_all", + Tag: "varint,63016,opt,name=benchgen_all,json=benchgenAll", + Filename: "gogo.proto", +} + +var E_MarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63017, + Name: "gogoproto.marshaler_all", + Tag: "varint,63017,opt,name=marshaler_all,json=marshalerAll", + Filename: "gogo.proto", +} + +var E_UnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63018, + Name: "gogoproto.unmarshaler_all", + Tag: "varint,63018,opt,name=unmarshaler_all,json=unmarshalerAll", + Filename: "gogo.proto", +} + +var E_StableMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63019, + Name: "gogoproto.stable_marshaler_all", + Tag: "varint,63019,opt,name=stable_marshaler_all,json=stableMarshalerAll", + Filename: "gogo.proto", +} + +var E_SizerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63020, + Name: "gogoproto.sizer_all", + Tag: "varint,63020,opt,name=sizer_all,json=sizerAll", + Filename: "gogo.proto", +} + +var E_GoprotoEnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63021, + Name: "gogoproto.goproto_enum_stringer_all", + Tag: "varint,63021,opt,name=goproto_enum_stringer_all,json=goprotoEnumStringerAll", + Filename: "gogo.proto", +} + +var E_EnumStringerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63022, + Name: "gogoproto.enum_stringer_all", + Tag: "varint,63022,opt,name=enum_stringer_all,json=enumStringerAll", + Filename: "gogo.proto", +} + +var E_UnsafeMarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63023, + Name: "gogoproto.unsafe_marshaler_all", + Tag: "varint,63023,opt,name=unsafe_marshaler_all,json=unsafeMarshalerAll", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshalerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63024, + Name: "gogoproto.unsafe_unmarshaler_all", + Tag: "varint,63024,opt,name=unsafe_unmarshaler_all,json=unsafeUnmarshalerAll", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMapAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63025, + Name: "gogoproto.goproto_extensions_map_all", + Tag: "varint,63025,opt,name=goproto_extensions_map_all,json=goprotoExtensionsMapAll", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognizedAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63026, + Name: "gogoproto.goproto_unrecognized_all", + Tag: "varint,63026,opt,name=goproto_unrecognized_all,json=goprotoUnrecognizedAll", + Filename: "gogo.proto", +} + +var E_GogoprotoImport = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63027, + Name: "gogoproto.gogoproto_import", + Tag: "varint,63027,opt,name=gogoproto_import,json=gogoprotoImport", + Filename: "gogo.proto", +} + +var E_ProtosizerAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63028, + Name: "gogoproto.protosizer_all", + Tag: "varint,63028,opt,name=protosizer_all,json=protosizerAll", + Filename: "gogo.proto", +} + +var E_CompareAll = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FileOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 63029, + Name: "gogoproto.compare_all", + Tag: "varint,63029,opt,name=compare_all,json=compareAll", + Filename: "gogo.proto", +} + +var E_GoprotoGetters = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64001, + Name: "gogoproto.goproto_getters", + Tag: "varint,64001,opt,name=goproto_getters,json=goprotoGetters", + Filename: "gogo.proto", +} + +var E_GoprotoStringer = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64003, + Name: "gogoproto.goproto_stringer", + Tag: "varint,64003,opt,name=goproto_stringer,json=goprotoStringer", + Filename: "gogo.proto", +} + +var E_VerboseEqual = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64004, + Name: "gogoproto.verbose_equal", + Tag: "varint,64004,opt,name=verbose_equal,json=verboseEqual", + Filename: "gogo.proto", +} + +var E_Face = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64005, + Name: "gogoproto.face", + Tag: "varint,64005,opt,name=face", + Filename: "gogo.proto", +} + +var E_Gostring = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64006, + Name: "gogoproto.gostring", + Tag: "varint,64006,opt,name=gostring", + Filename: "gogo.proto", +} + +var E_Populate = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64007, + Name: "gogoproto.populate", + Tag: "varint,64007,opt,name=populate", + Filename: "gogo.proto", +} + +var E_Stringer = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 67008, + Name: "gogoproto.stringer", + Tag: "varint,67008,opt,name=stringer", + Filename: "gogo.proto", +} + +var E_Onlyone = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64009, + Name: "gogoproto.onlyone", + Tag: "varint,64009,opt,name=onlyone", + Filename: "gogo.proto", +} + +var E_Equal = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64013, + Name: "gogoproto.equal", + Tag: "varint,64013,opt,name=equal", + Filename: "gogo.proto", +} + +var E_Description = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64014, + Name: "gogoproto.description", + Tag: "varint,64014,opt,name=description", + Filename: "gogo.proto", +} + +var E_Testgen = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64015, + Name: "gogoproto.testgen", + Tag: "varint,64015,opt,name=testgen", + Filename: "gogo.proto", +} + +var E_Benchgen = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64016, + Name: "gogoproto.benchgen", + Tag: "varint,64016,opt,name=benchgen", + Filename: "gogo.proto", +} + +var E_Marshaler = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64017, + Name: "gogoproto.marshaler", + Tag: "varint,64017,opt,name=marshaler", + Filename: "gogo.proto", +} + +var E_Unmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64018, + Name: "gogoproto.unmarshaler", + Tag: "varint,64018,opt,name=unmarshaler", + Filename: "gogo.proto", +} + +var E_StableMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64019, + Name: "gogoproto.stable_marshaler", + Tag: "varint,64019,opt,name=stable_marshaler,json=stableMarshaler", + Filename: "gogo.proto", +} + +var E_Sizer = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64020, + Name: "gogoproto.sizer", + Tag: "varint,64020,opt,name=sizer", + Filename: "gogo.proto", +} + +var E_UnsafeMarshaler = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64023, + Name: "gogoproto.unsafe_marshaler", + Tag: "varint,64023,opt,name=unsafe_marshaler,json=unsafeMarshaler", + Filename: "gogo.proto", +} + +var E_UnsafeUnmarshaler = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64024, + Name: "gogoproto.unsafe_unmarshaler", + Tag: "varint,64024,opt,name=unsafe_unmarshaler,json=unsafeUnmarshaler", + Filename: "gogo.proto", +} + +var E_GoprotoExtensionsMap = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64025, + Name: "gogoproto.goproto_extensions_map", + Tag: "varint,64025,opt,name=goproto_extensions_map,json=goprotoExtensionsMap", + Filename: "gogo.proto", +} + +var E_GoprotoUnrecognized = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64026, + Name: "gogoproto.goproto_unrecognized", + Tag: "varint,64026,opt,name=goproto_unrecognized,json=goprotoUnrecognized", + Filename: "gogo.proto", +} + +var E_Protosizer = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64028, + Name: "gogoproto.protosizer", + Tag: "varint,64028,opt,name=protosizer", + Filename: "gogo.proto", +} + +var E_Compare = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.MessageOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 64029, + Name: "gogoproto.compare", + Tag: "varint,64029,opt,name=compare", + Filename: "gogo.proto", +} + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65001, + Name: "gogoproto.nullable", + Tag: "varint,65001,opt,name=nullable", + Filename: "gogo.proto", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65002, + Name: "gogoproto.embed", + Tag: "varint,65002,opt,name=embed", + Filename: "gogo.proto", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65003, + Name: "gogoproto.customtype", + Tag: "bytes,65003,opt,name=customtype", + Filename: "gogo.proto", +} + +var E_Customname = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65004, + Name: "gogoproto.customname", + Tag: "bytes,65004,opt,name=customname", + Filename: "gogo.proto", +} + +var E_Jsontag = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65005, + Name: "gogoproto.jsontag", + Tag: "bytes,65005,opt,name=jsontag", + Filename: "gogo.proto", +} + +var E_Moretags = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65006, + Name: "gogoproto.moretags", + Tag: "bytes,65006,opt,name=moretags", + Filename: "gogo.proto", +} + +var E_Casttype = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65007, + Name: "gogoproto.casttype", + Tag: "bytes,65007,opt,name=casttype", + Filename: "gogo.proto", +} + +var E_Castkey = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65008, + Name: "gogoproto.castkey", + Tag: "bytes,65008,opt,name=castkey", + Filename: "gogo.proto", +} + +var E_Castvalue = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 65009, + Name: "gogoproto.castvalue", + Tag: "bytes,65009,opt,name=castvalue", + Filename: "gogo.proto", +} + +var E_Stdtime = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65010, + Name: "gogoproto.stdtime", + Tag: "varint,65010,opt,name=stdtime", + Filename: "gogo.proto", +} + +var E_Stdduration = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 65011, + Name: "gogoproto.stdduration", + Tag: "varint,65011,opt,name=stdduration", + Filename: "gogo.proto", +} + +func init() { + proto.RegisterExtension(E_GoprotoEnumPrefix) + proto.RegisterExtension(E_GoprotoEnumStringer) + proto.RegisterExtension(E_EnumStringer) + proto.RegisterExtension(E_EnumCustomname) + proto.RegisterExtension(E_EnumvalueCustomname) + proto.RegisterExtension(E_GoprotoGettersAll) + proto.RegisterExtension(E_GoprotoEnumPrefixAll) + proto.RegisterExtension(E_GoprotoStringerAll) + proto.RegisterExtension(E_VerboseEqualAll) + proto.RegisterExtension(E_FaceAll) + proto.RegisterExtension(E_GostringAll) + proto.RegisterExtension(E_PopulateAll) + proto.RegisterExtension(E_StringerAll) + proto.RegisterExtension(E_OnlyoneAll) + proto.RegisterExtension(E_EqualAll) + proto.RegisterExtension(E_DescriptionAll) + proto.RegisterExtension(E_TestgenAll) + proto.RegisterExtension(E_BenchgenAll) + proto.RegisterExtension(E_MarshalerAll) + proto.RegisterExtension(E_UnmarshalerAll) + proto.RegisterExtension(E_StableMarshalerAll) + proto.RegisterExtension(E_SizerAll) + proto.RegisterExtension(E_GoprotoEnumStringerAll) + proto.RegisterExtension(E_EnumStringerAll) + proto.RegisterExtension(E_UnsafeMarshalerAll) + proto.RegisterExtension(E_UnsafeUnmarshalerAll) + proto.RegisterExtension(E_GoprotoExtensionsMapAll) + proto.RegisterExtension(E_GoprotoUnrecognizedAll) + proto.RegisterExtension(E_GogoprotoImport) + proto.RegisterExtension(E_ProtosizerAll) + proto.RegisterExtension(E_CompareAll) + proto.RegisterExtension(E_GoprotoGetters) + proto.RegisterExtension(E_GoprotoStringer) + proto.RegisterExtension(E_VerboseEqual) + proto.RegisterExtension(E_Face) + proto.RegisterExtension(E_Gostring) + proto.RegisterExtension(E_Populate) + proto.RegisterExtension(E_Stringer) + proto.RegisterExtension(E_Onlyone) + proto.RegisterExtension(E_Equal) + proto.RegisterExtension(E_Description) + proto.RegisterExtension(E_Testgen) + proto.RegisterExtension(E_Benchgen) + proto.RegisterExtension(E_Marshaler) + proto.RegisterExtension(E_Unmarshaler) + proto.RegisterExtension(E_StableMarshaler) + proto.RegisterExtension(E_Sizer) + proto.RegisterExtension(E_UnsafeMarshaler) + proto.RegisterExtension(E_UnsafeUnmarshaler) + proto.RegisterExtension(E_GoprotoExtensionsMap) + proto.RegisterExtension(E_GoprotoUnrecognized) + proto.RegisterExtension(E_Protosizer) + proto.RegisterExtension(E_Compare) + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) + proto.RegisterExtension(E_Customname) + proto.RegisterExtension(E_Jsontag) + proto.RegisterExtension(E_Moretags) + proto.RegisterExtension(E_Casttype) + proto.RegisterExtension(E_Castkey) + proto.RegisterExtension(E_Castvalue) + proto.RegisterExtension(E_Stdtime) + proto.RegisterExtension(E_Stdduration) +} + +func init() { proto.RegisterFile("gogo.proto", fileDescriptorGogo) } + +var fileDescriptorGogo = []byte{ + // 1129 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x09, 0x6e, 0x88, 0x02, 0xff, 0x94, 0x97, 0xc9, 0x6f, 0x1c, 0x45, + 0x14, 0x87, 0x85, 0x70, 0x64, 0xcf, 0xf3, 0x86, 0xc7, 0xc6, 0x84, 0x08, 0x44, 0x72, 0xe3, 0xe4, + 0x9c, 0x22, 0x94, 0xb2, 0x22, 0xcb, 0xb1, 0x9c, 0x51, 0x10, 0x86, 0x91, 0x89, 0x03, 0x88, 0xc3, + 0xa8, 0x67, 0xa6, 0xdc, 0x69, 0xe8, 0xee, 0x6a, 0xba, 0xaa, 0xa3, 0x38, 0x37, 0x14, 0x16, 0x21, + 0xc4, 0x8e, 0x04, 0x09, 0x09, 0xcb, 0x81, 0x7d, 0x0d, 0xcb, 0x9d, 0x0b, 0x70, 0xe6, 0x7f, 0xe0, + 0x02, 0x84, 0xdd, 0x37, 0x5f, 0x50, 0x75, 0xbf, 0xd7, 0x53, 0xdd, 0x1e, 0xa9, 0x6a, 0x6e, 0xe3, + 0x71, 0x7d, 0xdf, 0x54, 0xbf, 0x37, 0xf5, 0x7e, 0x53, 0x00, 0xbe, 0xf0, 0xc5, 0x52, 0x92, 0x0a, + 0x25, 0x9a, 0x0d, 0xfd, 0x3a, 0x7f, 0x79, 0xe8, 0xb0, 0x2f, 0x84, 0x1f, 0xf2, 0xa3, 0xf9, 0x5f, + 0xdd, 0x6c, 0xfb, 0x68, 0x9f, 0xcb, 0x5e, 0x1a, 0x24, 0x4a, 0xa4, 0xc5, 0x62, 0x76, 0x3f, 0xcc, + 0xe3, 0xe2, 0x0e, 0x8f, 0xb3, 0xa8, 0x93, 0xa4, 0x7c, 0x3b, 0xb8, 0xd0, 0xbc, 0x63, 0xa9, 0x20, + 0x97, 0x88, 0x5c, 0x5a, 0x8f, 0xb3, 0xe8, 0x81, 0x44, 0x05, 0x22, 0x96, 0x07, 0xaf, 0xff, 0x72, + 0xf3, 0xe1, 0x9b, 0xee, 0x9e, 0xd8, 0x9c, 0x43, 0x54, 0xff, 0xaf, 0x9d, 0x83, 0x6c, 0x13, 0x6e, + 0xad, 0xf8, 0xa4, 0x4a, 0x83, 0xd8, 0xe7, 0xa9, 0xc5, 0xf8, 0x03, 0x1a, 0xe7, 0x0d, 0xe3, 0x83, + 0x88, 0xb2, 0x35, 0x98, 0x1e, 0xc5, 0xf5, 0x23, 0xba, 0xa6, 0xb8, 0x29, 0x69, 0xc1, 0x6c, 0x2e, + 0xe9, 0x65, 0x52, 0x89, 0x28, 0xf6, 0x22, 0x6e, 0xd1, 0xfc, 0x94, 0x6b, 0x1a, 0x9b, 0x33, 0x1a, + 0x5b, 0x2b, 0x29, 0x76, 0x16, 0x16, 0xf4, 0x3b, 0xe7, 0xbd, 0x30, 0xe3, 0xa6, 0xed, 0xc8, 0x50, + 0xdb, 0x59, 0xbd, 0x8c, 0x94, 0x3f, 0x5f, 0x1a, 0xcb, 0x95, 0xf3, 0xa5, 0xc0, 0xf0, 0x1a, 0x9d, + 0xf0, 0xb9, 0x52, 0x3c, 0x95, 0x1d, 0x2f, 0x0c, 0x87, 0x6c, 0xf2, 0x54, 0x10, 0x96, 0xc6, 0xcb, + 0x37, 0xaa, 0x9d, 0x68, 0x15, 0xe4, 0x6a, 0x18, 0xb2, 0x2d, 0xb8, 0x6d, 0x48, 0x67, 0x1d, 0x9c, + 0x57, 0xd0, 0xb9, 0xb0, 0xaf, 0xbb, 0x5a, 0xdb, 0x06, 0x7a, 0xbf, 0xec, 0x87, 0x83, 0xf3, 0x2d, + 0x74, 0x36, 0x91, 0xa5, 0xb6, 0x68, 0xe3, 0xbd, 0x30, 0x77, 0x9e, 0xa7, 0x5d, 0x21, 0x79, 0x87, + 0x3f, 0x91, 0x79, 0xa1, 0x83, 0xee, 0x2a, 0xea, 0x66, 0x11, 0x5c, 0xd7, 0x9c, 0x76, 0x1d, 0x87, + 0x89, 0x6d, 0xaf, 0xc7, 0x1d, 0x14, 0xd7, 0x50, 0x31, 0xae, 0xd7, 0x6b, 0x74, 0x15, 0xa6, 0x7c, + 0x51, 0x3c, 0x92, 0x03, 0xfe, 0x36, 0xe2, 0x93, 0xc4, 0xa0, 0x22, 0x11, 0x49, 0x16, 0x7a, 0xca, + 0x65, 0x07, 0xef, 0x90, 0x82, 0x18, 0x54, 0x8c, 0x50, 0xd6, 0x77, 0x49, 0x21, 0x8d, 0x7a, 0xae, + 0xc0, 0xa4, 0x88, 0xc3, 0x1d, 0x11, 0xbb, 0x6c, 0xe2, 0x3d, 0x34, 0x00, 0x22, 0x5a, 0xb0, 0x0c, + 0x0d, 0xd7, 0x46, 0xbc, 0x8f, 0xf8, 0x04, 0xa7, 0x0e, 0xb4, 0x60, 0x96, 0x86, 0x4c, 0x20, 0x62, + 0x07, 0xc5, 0x07, 0xa8, 0x98, 0x31, 0x30, 0x7c, 0x0c, 0xc5, 0xa5, 0xf2, 0xb9, 0x8b, 0xe4, 0x43, + 0x7a, 0x0c, 0x44, 0xb0, 0x94, 0x5d, 0x1e, 0xf7, 0xce, 0xb9, 0x19, 0x3e, 0xa2, 0x52, 0x12, 0xa3, + 0x15, 0x6b, 0x30, 0x1d, 0x79, 0xa9, 0x3c, 0xe7, 0x85, 0x4e, 0xed, 0xf8, 0x18, 0x1d, 0x53, 0x25, + 0x84, 0x15, 0xc9, 0xe2, 0x51, 0x34, 0x9f, 0x50, 0x45, 0x0c, 0x0c, 0x8f, 0x9e, 0x54, 0x5e, 0x37, + 0xe4, 0x9d, 0x51, 0x6c, 0x9f, 0xd2, 0xd1, 0x2b, 0xd8, 0x0d, 0xd3, 0xb8, 0x0c, 0x0d, 0x19, 0x5c, + 0x74, 0xd2, 0x7c, 0x46, 0x9d, 0xce, 0x01, 0x0d, 0x3f, 0x02, 0xb7, 0x0f, 0x1d, 0xf5, 0x0e, 0xb2, + 0xcf, 0x51, 0xb6, 0x38, 0x64, 0xdc, 0xe3, 0x48, 0x18, 0x55, 0xf9, 0x05, 0x8d, 0x04, 0x5e, 0x73, + 0xb5, 0x61, 0x21, 0x8b, 0xa5, 0xb7, 0x3d, 0x5a, 0xd5, 0xbe, 0xa4, 0xaa, 0x15, 0x6c, 0xa5, 0x6a, + 0x67, 0x60, 0x11, 0x8d, 0xa3, 0xf5, 0xf5, 0x2b, 0x1a, 0xac, 0x05, 0xbd, 0x55, 0xed, 0xee, 0xa3, + 0x70, 0xa8, 0x2c, 0xe7, 0x05, 0xc5, 0x63, 0xa9, 0x99, 0x4e, 0xe4, 0x25, 0x0e, 0xe6, 0xeb, 0x68, + 0xa6, 0x89, 0xbf, 0x5e, 0x0a, 0x36, 0xbc, 0x44, 0xcb, 0x1f, 0x86, 0x83, 0x24, 0xcf, 0xe2, 0x94, + 0xf7, 0x84, 0x1f, 0x07, 0x17, 0x79, 0xdf, 0x41, 0xfd, 0x75, 0xad, 0x55, 0x5b, 0x06, 0xae, 0xcd, + 0xa7, 0xe1, 0x96, 0xf2, 0xf7, 0x46, 0x27, 0x88, 0x12, 0x91, 0x2a, 0x8b, 0xf1, 0x1b, 0xea, 0x54, + 0xc9, 0x9d, 0xce, 0x31, 0xb6, 0x0e, 0x33, 0xf9, 0x9f, 0xae, 0x5f, 0xc9, 0x6f, 0x51, 0x34, 0x3d, + 0xa0, 0x70, 0x70, 0xf4, 0x44, 0x94, 0x78, 0xa9, 0xcb, 0xfc, 0xfb, 0x8e, 0x06, 0x07, 0x22, 0xc5, + 0xb7, 0x6f, 0xb6, 0x96, 0xc4, 0xcd, 0xbb, 0xf6, 0x49, 0x36, 0xb8, 0x94, 0x9e, 0x5f, 0x7a, 0x9e, + 0xdc, 0xc5, 0x33, 0x5b, 0x0d, 0x62, 0x76, 0x9f, 0x2e, 0x4f, 0x35, 0x2e, 0xed, 0xb2, 0x4b, 0xbb, + 0x65, 0x85, 0x2a, 0x69, 0xc9, 0x4e, 0xc1, 0x74, 0x25, 0x2a, 0xed, 0xaa, 0xa7, 0x50, 0x35, 0x65, + 0x26, 0x25, 0x3b, 0x06, 0x63, 0x3a, 0xf6, 0xec, 0xf8, 0xd3, 0x88, 0xe7, 0xcb, 0xd9, 0x09, 0x98, + 0xa0, 0xb8, 0xb3, 0xa3, 0xcf, 0x20, 0x5a, 0x22, 0x1a, 0xa7, 0xa8, 0xb3, 0xe3, 0xcf, 0x12, 0x4e, + 0x88, 0xc6, 0xdd, 0x4b, 0xf8, 0xfd, 0xf3, 0x63, 0x38, 0xae, 0xa8, 0x76, 0xcb, 0x30, 0x8e, 0x19, + 0x67, 0xa7, 0x9f, 0xc3, 0x0f, 0x27, 0x82, 0xdd, 0x03, 0x07, 0x1c, 0x0b, 0xfe, 0x02, 0xa2, 0xc5, + 0x7a, 0xb6, 0x06, 0x93, 0x46, 0xae, 0xd9, 0xf1, 0x17, 0x11, 0x37, 0x29, 0xbd, 0x75, 0xcc, 0x35, + 0xbb, 0xe0, 0x25, 0xda, 0x3a, 0x12, 0xba, 0x6c, 0x14, 0x69, 0x76, 0xfa, 0x65, 0xaa, 0x3a, 0x21, + 0x6c, 0x05, 0x1a, 0xe5, 0x98, 0xb2, 0xf3, 0xaf, 0x20, 0x3f, 0x60, 0x74, 0x05, 0x8c, 0x31, 0x69, + 0x57, 0xbc, 0x4a, 0x15, 0x30, 0x28, 0x7d, 0x8c, 0xea, 0xd1, 0x67, 0x37, 0xbd, 0x46, 0xc7, 0xa8, + 0x96, 0x7c, 0xba, 0x9b, 0xf9, 0xb4, 0xb0, 0x2b, 0x5e, 0xa7, 0x6e, 0xe6, 0xeb, 0xf5, 0x36, 0xea, + 0x59, 0x62, 0x77, 0xbc, 0x41, 0xdb, 0xa8, 0x45, 0x09, 0x6b, 0x43, 0x73, 0x7f, 0x8e, 0xd8, 0x7d, + 0x6f, 0xa2, 0x6f, 0x6e, 0x5f, 0x8c, 0xb0, 0x87, 0x60, 0x71, 0x78, 0x86, 0xd8, 0xad, 0x97, 0x77, + 0x6b, 0xbf, 0xfa, 0xcd, 0x08, 0x61, 0x67, 0x06, 0xbf, 0xfa, 0xcd, 0xfc, 0xb0, 0x6b, 0xaf, 0xec, + 0x56, 0x2f, 0x76, 0x66, 0x7c, 0xb0, 0x55, 0x80, 0xc1, 0xe8, 0xb6, 0xbb, 0xae, 0xa2, 0xcb, 0x80, + 0xf4, 0xd1, 0xc0, 0xc9, 0x6d, 0xe7, 0xaf, 0xd1, 0xd1, 0x40, 0x82, 0x2d, 0xc3, 0x44, 0x9c, 0x85, + 0xa1, 0xfe, 0x72, 0x34, 0xef, 0x1c, 0x12, 0x13, 0x3c, 0xec, 0x13, 0xfb, 0xeb, 0x1e, 0x1e, 0x0c, + 0x02, 0xd8, 0x31, 0x38, 0xc0, 0xa3, 0x2e, 0xef, 0xdb, 0xc8, 0xdf, 0xf6, 0x68, 0x20, 0xe8, 0xd5, + 0x6c, 0x05, 0xa0, 0xb8, 0x34, 0xaa, 0x9d, 0xc4, 0xfa, 0xa9, 0xbf, 0xef, 0x15, 0x77, 0x50, 0x03, + 0x19, 0x08, 0xf2, 0x5b, 0xa7, 0x45, 0x70, 0xa3, 0x2a, 0xc8, 0x2f, 0x9a, 0xc7, 0x61, 0xfc, 0x31, + 0x29, 0x62, 0xe5, 0xf9, 0x36, 0xfa, 0x0f, 0xa4, 0x69, 0xbd, 0x2e, 0x58, 0x24, 0x52, 0xae, 0x3c, + 0x5f, 0xda, 0xd8, 0x3f, 0x91, 0x2d, 0x01, 0x0d, 0xf7, 0x3c, 0xa9, 0x5c, 0x9e, 0xfb, 0x2f, 0x82, + 0x09, 0xd0, 0x9b, 0xd6, 0xaf, 0x1f, 0xe7, 0x3b, 0x36, 0xf6, 0x6f, 0xda, 0x34, 0xae, 0x67, 0x27, + 0xa0, 0xa1, 0x5f, 0xe6, 0xf7, 0x6d, 0x1b, 0xfc, 0x0f, 0xc2, 0x03, 0x42, 0x7f, 0xb2, 0x54, 0x7d, + 0x15, 0xd8, 0x8b, 0xfd, 0x2f, 0x76, 0x9a, 0xd6, 0xb3, 0x55, 0x98, 0x94, 0xaa, 0xdf, 0xcf, 0x52, + 0x2f, 0x1f, 0xfe, 0x16, 0xfc, 0xbf, 0xbd, 0xf2, 0x32, 0x57, 0x32, 0x27, 0x8f, 0xc0, 0x7c, 0x4f, + 0x44, 0x75, 0xf0, 0x24, 0xb4, 0x44, 0x4b, 0xb4, 0xf3, 0x63, 0xf0, 0x7f, 0x00, 0x00, 0x00, 0xff, + 0xff, 0x3f, 0x9b, 0x2b, 0x54, 0xfc, 0x11, 0x00, 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden new file mode 100644 index 000000000..f6502e4b9 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.pb.golden @@ -0,0 +1,45 @@ +// Code generated by protoc-gen-go. +// source: gogo.proto +// DO NOT EDIT! + +package gogoproto + +import proto "github.com/gogo/protobuf/proto" +import json "encoding/json" +import math "math" +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" + +// Reference proto, json, and math imports to suppress error if they are not otherwise used. +var _ = proto.Marshal +var _ = &json.SyntaxError{} +var _ = math.Inf + +var E_Nullable = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51235, + Name: "gogoproto.nullable", + Tag: "varint,51235,opt,name=nullable", +} + +var E_Embed = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*bool)(nil), + Field: 51236, + Name: "gogoproto.embed", + Tag: "varint,51236,opt,name=embed", +} + +var E_Customtype = &proto.ExtensionDesc{ + ExtendedType: (*google_protobuf.FieldOptions)(nil), + ExtensionType: (*string)(nil), + Field: 51237, + Name: "gogoproto.customtype", + Tag: "bytes,51237,opt,name=customtype", +} + +func init() { + proto.RegisterExtension(E_Nullable) + proto.RegisterExtension(E_Embed) + proto.RegisterExtension(E_Customtype) +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto new file mode 100644 index 000000000..0da211a8e --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/gogo.proto @@ -0,0 +1,125 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +syntax = "proto2"; +package gogoproto; + +import "google/protobuf/descriptor.proto"; + +option java_package = "com.google.protobuf"; +option java_outer_classname = "GoGoProtos"; + +extend google.protobuf.EnumOptions { + optional bool goproto_enum_prefix = 62001; + optional bool goproto_enum_stringer = 62021; + optional bool enum_stringer = 62022; + optional string enum_customname = 62023; +} + +extend google.protobuf.EnumValueOptions { + optional string enumvalue_customname = 66001; +} + +extend google.protobuf.FileOptions { + optional bool goproto_getters_all = 63001; + optional bool goproto_enum_prefix_all = 63002; + optional bool goproto_stringer_all = 63003; + optional bool verbose_equal_all = 63004; + optional bool face_all = 63005; + optional bool gostring_all = 63006; + optional bool populate_all = 63007; + optional bool stringer_all = 63008; + optional bool onlyone_all = 63009; + + optional bool equal_all = 63013; + optional bool description_all = 63014; + optional bool testgen_all = 63015; + optional bool benchgen_all = 63016; + optional bool marshaler_all = 63017; + optional bool unmarshaler_all = 63018; + optional bool stable_marshaler_all = 63019; + + optional bool sizer_all = 63020; + + optional bool goproto_enum_stringer_all = 63021; + optional bool enum_stringer_all = 63022; + + optional bool unsafe_marshaler_all = 63023; + optional bool unsafe_unmarshaler_all = 63024; + + optional bool goproto_extensions_map_all = 63025; + optional bool goproto_unrecognized_all = 63026; + optional bool gogoproto_import = 63027; + optional bool protosizer_all = 63028; + optional bool compare_all = 63029; +} + +extend google.protobuf.MessageOptions { + optional bool goproto_getters = 64001; + optional bool goproto_stringer = 64003; + optional bool verbose_equal = 64004; + optional bool face = 64005; + optional bool gostring = 64006; + optional bool populate = 64007; + optional bool stringer = 67008; + optional bool onlyone = 64009; + + optional bool equal = 64013; + optional bool description = 64014; + optional bool testgen = 64015; + optional bool benchgen = 64016; + optional bool marshaler = 64017; + optional bool unmarshaler = 64018; + optional bool stable_marshaler = 64019; + + optional bool sizer = 64020; + + optional bool unsafe_marshaler = 64023; + optional bool unsafe_unmarshaler = 64024; + + optional bool goproto_extensions_map = 64025; + optional bool goproto_unrecognized = 64026; + + optional bool protosizer = 64028; + optional bool compare = 64029; +} + +extend google.protobuf.FieldOptions { + optional bool nullable = 65001; + optional bool embed = 65002; + optional string customtype = 65003; + optional string customname = 65004; + optional string jsontag = 65005; + optional string moretags = 65006; + optional string casttype = 65007; + optional string castkey = 65008; + optional string castvalue = 65009; + + optional bool stdtime = 65010; + optional bool stdduration = 65011; +} diff --git a/vendor/github.com/gogo/protobuf/gogoproto/helper.go b/vendor/github.com/gogo/protobuf/gogoproto/helper.go new file mode 100644 index 000000000..bb5fff48b --- /dev/null +++ b/vendor/github.com/gogo/protobuf/gogoproto/helper.go @@ -0,0 +1,345 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package gogoproto + +import google_protobuf "github.com/gogo/protobuf/protoc-gen-gogo/descriptor" +import proto "github.com/gogo/protobuf/proto" + +func IsEmbed(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Embed, false) +} + +func IsNullable(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Nullable, true) +} + +func IsStdTime(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdtime, false) +} + +func IsStdDuration(field *google_protobuf.FieldDescriptorProto) bool { + return proto.GetBoolExtension(field.Options, E_Stdduration, false) +} + +func NeedsNilCheck(proto3 bool, field *google_protobuf.FieldDescriptorProto) bool { + nullable := IsNullable(field) + if field.IsMessage() || IsCustomType(field) { + return nullable + } + if proto3 { + return false + } + return nullable || *field.Type == google_protobuf.FieldDescriptorProto_TYPE_BYTES +} + +func IsCustomType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCustomType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastType(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastType(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastKey(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastKey(field) + if len(typ) > 0 { + return true + } + return false +} + +func IsCastValue(field *google_protobuf.FieldDescriptorProto) bool { + typ := GetCastValue(field) + if len(typ) > 0 { + return true + } + return false +} + +func GetCustomType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customtype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastType(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Casttype) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastKey(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castkey) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetCastValue(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Castvalue) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func IsCustomName(field *google_protobuf.FieldDescriptorProto) bool { + name := GetCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumCustomName(field *google_protobuf.EnumDescriptorProto) bool { + name := GetEnumCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func IsEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) bool { + name := GetEnumValueCustomName(field) + if len(name) > 0 { + return true + } + return false +} + +func GetCustomName(field *google_protobuf.FieldDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Customname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumCustomName(field *google_protobuf.EnumDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetEnumValueCustomName(field *google_protobuf.EnumValueDescriptorProto) string { + if field == nil { + return "" + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_EnumvalueCustomname) + if err == nil && v.(*string) != nil { + return *(v.(*string)) + } + } + return "" +} + +func GetJsonTag(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Jsontag) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +func GetMoreTags(field *google_protobuf.FieldDescriptorProto) *string { + if field == nil { + return nil + } + if field.Options != nil { + v, err := proto.GetExtension(field.Options, E_Moretags) + if err == nil && v.(*string) != nil { + return (v.(*string)) + } + } + return nil +} + +type EnableFunc func(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool + +func EnabledGoEnumPrefix(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumPrefix, proto.GetBoolExtension(file.Options, E_GoprotoEnumPrefixAll, true)) +} + +func EnabledGoStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoStringer, proto.GetBoolExtension(file.Options, E_GoprotoStringerAll, true)) +} + +func HasGoGetters(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoGetters, proto.GetBoolExtension(file.Options, E_GoprotoGettersAll, true)) +} + +func IsUnion(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Onlyone, proto.GetBoolExtension(file.Options, E_OnlyoneAll, false)) +} + +func HasGoString(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Gostring, proto.GetBoolExtension(file.Options, E_GostringAll, false)) +} + +func HasEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Equal, proto.GetBoolExtension(file.Options, E_EqualAll, false)) +} + +func HasVerboseEqual(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_VerboseEqual, proto.GetBoolExtension(file.Options, E_VerboseEqualAll, false)) +} + +func IsStringer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Stringer, proto.GetBoolExtension(file.Options, E_StringerAll, false)) +} + +func IsFace(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Face, proto.GetBoolExtension(file.Options, E_FaceAll, false)) +} + +func HasDescription(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Description, proto.GetBoolExtension(file.Options, E_DescriptionAll, false)) +} + +func HasPopulate(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Populate, proto.GetBoolExtension(file.Options, E_PopulateAll, false)) +} + +func HasTestGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Testgen, proto.GetBoolExtension(file.Options, E_TestgenAll, false)) +} + +func HasBenchGen(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Benchgen, proto.GetBoolExtension(file.Options, E_BenchgenAll, false)) +} + +func IsMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Marshaler, proto.GetBoolExtension(file.Options, E_MarshalerAll, false)) +} + +func IsUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Unmarshaler, proto.GetBoolExtension(file.Options, E_UnmarshalerAll, false)) +} + +func IsStableMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_StableMarshaler, proto.GetBoolExtension(file.Options, E_StableMarshalerAll, false)) +} + +func IsSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Sizer, proto.GetBoolExtension(file.Options, E_SizerAll, false)) +} + +func IsProtoSizer(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Protosizer, proto.GetBoolExtension(file.Options, E_ProtosizerAll, false)) +} + +func IsGoEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_GoprotoEnumStringer, proto.GetBoolExtension(file.Options, E_GoprotoEnumStringerAll, true)) +} + +func IsEnumStringer(file *google_protobuf.FileDescriptorProto, enum *google_protobuf.EnumDescriptorProto) bool { + return proto.GetBoolExtension(enum.Options, E_EnumStringer, proto.GetBoolExtension(file.Options, E_EnumStringerAll, false)) +} + +func IsUnsafeMarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeMarshaler, proto.GetBoolExtension(file.Options, E_UnsafeMarshalerAll, false)) +} + +func IsUnsafeUnmarshaler(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_UnsafeUnmarshaler, proto.GetBoolExtension(file.Options, E_UnsafeUnmarshalerAll, false)) +} + +func HasExtensionsMap(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_GoprotoExtensionsMap, proto.GetBoolExtension(file.Options, E_GoprotoExtensionsMapAll, true)) +} + +func HasUnrecognized(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + if IsProto3(file) { + return false + } + return proto.GetBoolExtension(message.Options, E_GoprotoUnrecognized, proto.GetBoolExtension(file.Options, E_GoprotoUnrecognizedAll, true)) +} + +func IsProto3(file *google_protobuf.FileDescriptorProto) bool { + return file.GetSyntax() == "proto3" +} + +func ImportsGoGoProto(file *google_protobuf.FileDescriptorProto) bool { + return proto.GetBoolExtension(file.Options, E_GogoprotoImport, true) +} + +func HasCompare(file *google_protobuf.FileDescriptorProto, message *google_protobuf.DescriptorProto) bool { + return proto.GetBoolExtension(message.Options, E_Compare, proto.GetBoolExtension(file.Options, E_CompareAll, false)) +} diff --git a/vendor/github.com/gogo/protobuf/proto/Makefile b/vendor/github.com/gogo/protobuf/proto/Makefile new file mode 100644 index 000000000..41c717573 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/Makefile @@ -0,0 +1,43 @@ +# Go support for Protocol Buffers - Google's data interchange format +# +# Copyright 2010 The Go Authors. All rights reserved. +# https://github.com/golang/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# * Neither the name of Google Inc. nor the names of its +# contributors may be used to endorse or promote products derived from +# this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +install: + go install + +test: install generate-test-pbs + go test + + +generate-test-pbs: + make install + make -C testdata + protoc-min-version --version="3.0.0" --proto_path=.:../../../../:../protobuf --gogo_out=Mtestdata/test.proto=github.com/gogo/protobuf/proto/testdata,Mgoogle/protobuf/any.proto=github.com/gogo/protobuf/types:. proto3_proto/proto3.proto + make diff --git a/vendor/github.com/gogo/protobuf/proto/clone.go b/vendor/github.com/gogo/protobuf/proto/clone.go new file mode 100644 index 000000000..5d4cba4b5 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/clone.go @@ -0,0 +1,234 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2011 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Protocol buffer deep copy and merge. +// TODO: RawMessage. + +package proto + +import ( + "log" + "reflect" + "strings" +) + +// Clone returns a deep copy of a protocol buffer. +func Clone(pb Message) Message { + in := reflect.ValueOf(pb) + if in.IsNil() { + return pb + } + + out := reflect.New(in.Type().Elem()) + // out is empty so a merge is a deep copy. + mergeStruct(out.Elem(), in.Elem()) + return out.Interface().(Message) +} + +// Merge merges src into dst. +// Required and optional fields that are set in src will be set to that value in dst. +// Elements of repeated fields will be appended. +// Merge panics if src and dst are not the same type, or if dst is nil. +func Merge(dst, src Message) { + in := reflect.ValueOf(src) + out := reflect.ValueOf(dst) + if out.IsNil() { + panic("proto: nil destination") + } + if in.Type() != out.Type() { + // Explicit test prior to mergeStruct so that mistyped nils will fail + panic("proto: type mismatch") + } + if in.IsNil() { + // Merging nil into non-nil is a quiet no-op + return + } + mergeStruct(out.Elem(), in.Elem()) +} + +func mergeStruct(out, in reflect.Value) { + sprop := GetProperties(in.Type()) + for i := 0; i < in.NumField(); i++ { + f := in.Type().Field(i) + if strings.HasPrefix(f.Name, "XXX_") { + continue + } + mergeAny(out.Field(i), in.Field(i), false, sprop.Prop[i]) + } + + if emIn, ok := in.Addr().Interface().(extensionsBytes); ok { + emOut := out.Addr().Interface().(extensionsBytes) + bIn := emIn.GetExtensions() + bOut := emOut.GetExtensions() + *bOut = append(*bOut, *bIn...) + } else if emIn, ok := extendable(in.Addr().Interface()); ok { + emOut, _ := extendable(out.Addr().Interface()) + mIn, muIn := emIn.extensionsRead() + if mIn != nil { + mOut := emOut.extensionsWrite() + muIn.Lock() + mergeExtension(mOut, mIn) + muIn.Unlock() + } + } + + uf := in.FieldByName("XXX_unrecognized") + if !uf.IsValid() { + return + } + uin := uf.Bytes() + if len(uin) > 0 { + out.FieldByName("XXX_unrecognized").SetBytes(append([]byte(nil), uin...)) + } +} + +// mergeAny performs a merge between two values of the same type. +// viaPtr indicates whether the values were indirected through a pointer (implying proto2). +// prop is set if this is a struct field (it may be nil). +func mergeAny(out, in reflect.Value, viaPtr bool, prop *Properties) { + if in.Type() == protoMessageType { + if !in.IsNil() { + if out.IsNil() { + out.Set(reflect.ValueOf(Clone(in.Interface().(Message)))) + } else { + Merge(out.Interface().(Message), in.Interface().(Message)) + } + } + return + } + switch in.Kind() { + case reflect.Bool, reflect.Float32, reflect.Float64, reflect.Int32, reflect.Int64, + reflect.String, reflect.Uint32, reflect.Uint64: + if !viaPtr && isProto3Zero(in) { + return + } + out.Set(in) + case reflect.Interface: + // Probably a oneof field; copy non-nil values. + if in.IsNil() { + return + } + // Allocate destination if it is not set, or set to a different type. + // Otherwise we will merge as normal. + if out.IsNil() || out.Elem().Type() != in.Elem().Type() { + out.Set(reflect.New(in.Elem().Elem().Type())) // interface -> *T -> T -> new(T) + } + mergeAny(out.Elem(), in.Elem(), false, nil) + case reflect.Map: + if in.Len() == 0 { + return + } + if out.IsNil() { + out.Set(reflect.MakeMap(in.Type())) + } + // For maps with value types of *T or []byte we need to deep copy each value. + elemKind := in.Type().Elem().Kind() + for _, key := range in.MapKeys() { + var val reflect.Value + switch elemKind { + case reflect.Ptr: + val = reflect.New(in.Type().Elem().Elem()) + mergeAny(val, in.MapIndex(key), false, nil) + case reflect.Slice: + val = in.MapIndex(key) + val = reflect.ValueOf(append([]byte{}, val.Bytes()...)) + default: + val = in.MapIndex(key) + } + out.SetMapIndex(key, val) + } + case reflect.Ptr: + if in.IsNil() { + return + } + if out.IsNil() { + out.Set(reflect.New(in.Elem().Type())) + } + mergeAny(out.Elem(), in.Elem(), true, nil) + case reflect.Slice: + if in.IsNil() { + return + } + if in.Type().Elem().Kind() == reflect.Uint8 { + // []byte is a scalar bytes field, not a repeated field. + + // Edge case: if this is in a proto3 message, a zero length + // bytes field is considered the zero value, and should not + // be merged. + if prop != nil && prop.proto3 && in.Len() == 0 { + return + } + + // Make a deep copy. + // Append to []byte{} instead of []byte(nil) so that we never end up + // with a nil result. + out.SetBytes(append([]byte{}, in.Bytes()...)) + return + } + n := in.Len() + if out.IsNil() { + out.Set(reflect.MakeSlice(in.Type(), 0, n)) + } + switch in.Type().Elem().Kind() { + case reflect.Bool, reflect.Float32, reflect.Float64, reflect.Int32, reflect.Int64, + reflect.String, reflect.Uint32, reflect.Uint64: + out.Set(reflect.AppendSlice(out, in)) + default: + for i := 0; i < n; i++ { + x := reflect.Indirect(reflect.New(in.Type().Elem())) + mergeAny(x, in.Index(i), false, nil) + out.Set(reflect.Append(out, x)) + } + } + case reflect.Struct: + mergeStruct(out, in) + default: + // unknown type, so not a protocol buffer + log.Printf("proto: don't know how to copy %v", in) + } +} + +func mergeExtension(out, in map[int32]Extension) { + for extNum, eIn := range in { + eOut := Extension{desc: eIn.desc} + if eIn.value != nil { + v := reflect.New(reflect.TypeOf(eIn.value)).Elem() + mergeAny(v, reflect.ValueOf(eIn.value), false, nil) + eOut.value = v.Interface() + } + if eIn.enc != nil { + eOut.enc = make([]byte, len(eIn.enc)) + copy(eOut.enc, eIn.enc) + } + + out[extNum] = eOut + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/decode.go b/vendor/github.com/gogo/protobuf/proto/decode.go new file mode 100644 index 000000000..737f2731d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/decode.go @@ -0,0 +1,978 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Routines for decoding protocol buffer data to construct in-memory representations. + */ + +import ( + "errors" + "fmt" + "io" + "os" + "reflect" +) + +// errOverflow is returned when an integer is too large to be represented. +var errOverflow = errors.New("proto: integer overflow") + +// ErrInternalBadWireType is returned by generated code when an incorrect +// wire type is encountered. It does not get returned to user code. +var ErrInternalBadWireType = errors.New("proto: internal error: bad wiretype for oneof") + +// The fundamental decoders that interpret bytes on the wire. +// Those that take integer types all return uint64 and are +// therefore of type valueDecoder. + +// DecodeVarint reads a varint-encoded integer from the slice. +// It returns the integer and the number of bytes consumed, or +// zero if there is not enough. +// This is the format for the +// int32, int64, uint32, uint64, bool, and enum +// protocol buffer types. +func DecodeVarint(buf []byte) (x uint64, n int) { + for shift := uint(0); shift < 64; shift += 7 { + if n >= len(buf) { + return 0, 0 + } + b := uint64(buf[n]) + n++ + x |= (b & 0x7F) << shift + if (b & 0x80) == 0 { + return x, n + } + } + + // The number is too large to represent in a 64-bit value. + return 0, 0 +} + +func (p *Buffer) decodeVarintSlow() (x uint64, err error) { + i := p.index + l := len(p.buf) + + for shift := uint(0); shift < 64; shift += 7 { + if i >= l { + err = io.ErrUnexpectedEOF + return + } + b := p.buf[i] + i++ + x |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + p.index = i + return + } + } + + // The number is too large to represent in a 64-bit value. + err = errOverflow + return +} + +// DecodeVarint reads a varint-encoded integer from the Buffer. +// This is the format for the +// int32, int64, uint32, uint64, bool, and enum +// protocol buffer types. +func (p *Buffer) DecodeVarint() (x uint64, err error) { + i := p.index + buf := p.buf + + if i >= len(buf) { + return 0, io.ErrUnexpectedEOF + } else if buf[i] < 0x80 { + p.index++ + return uint64(buf[i]), nil + } else if len(buf)-i < 10 { + return p.decodeVarintSlow() + } + + var b uint64 + // we already checked the first byte + x = uint64(buf[i]) - 0x80 + i++ + + b = uint64(buf[i]) + i++ + x += b << 7 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 7 + + b = uint64(buf[i]) + i++ + x += b << 14 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 14 + + b = uint64(buf[i]) + i++ + x += b << 21 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 21 + + b = uint64(buf[i]) + i++ + x += b << 28 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 28 + + b = uint64(buf[i]) + i++ + x += b << 35 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 35 + + b = uint64(buf[i]) + i++ + x += b << 42 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 42 + + b = uint64(buf[i]) + i++ + x += b << 49 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 49 + + b = uint64(buf[i]) + i++ + x += b << 56 + if b&0x80 == 0 { + goto done + } + x -= 0x80 << 56 + + b = uint64(buf[i]) + i++ + x += b << 63 + if b&0x80 == 0 { + goto done + } + // x -= 0x80 << 63 // Always zero. + + return 0, errOverflow + +done: + p.index = i + return x, nil +} + +// DecodeFixed64 reads a 64-bit integer from the Buffer. +// This is the format for the +// fixed64, sfixed64, and double protocol buffer types. +func (p *Buffer) DecodeFixed64() (x uint64, err error) { + // x, err already 0 + i := p.index + 8 + if i < 0 || i > len(p.buf) { + err = io.ErrUnexpectedEOF + return + } + p.index = i + + x = uint64(p.buf[i-8]) + x |= uint64(p.buf[i-7]) << 8 + x |= uint64(p.buf[i-6]) << 16 + x |= uint64(p.buf[i-5]) << 24 + x |= uint64(p.buf[i-4]) << 32 + x |= uint64(p.buf[i-3]) << 40 + x |= uint64(p.buf[i-2]) << 48 + x |= uint64(p.buf[i-1]) << 56 + return +} + +// DecodeFixed32 reads a 32-bit integer from the Buffer. +// This is the format for the +// fixed32, sfixed32, and float protocol buffer types. +func (p *Buffer) DecodeFixed32() (x uint64, err error) { + // x, err already 0 + i := p.index + 4 + if i < 0 || i > len(p.buf) { + err = io.ErrUnexpectedEOF + return + } + p.index = i + + x = uint64(p.buf[i-4]) + x |= uint64(p.buf[i-3]) << 8 + x |= uint64(p.buf[i-2]) << 16 + x |= uint64(p.buf[i-1]) << 24 + return +} + +// DecodeZigzag64 reads a zigzag-encoded 64-bit integer +// from the Buffer. +// This is the format used for the sint64 protocol buffer type. +func (p *Buffer) DecodeZigzag64() (x uint64, err error) { + x, err = p.DecodeVarint() + if err != nil { + return + } + x = (x >> 1) ^ uint64((int64(x&1)<<63)>>63) + return +} + +// DecodeZigzag32 reads a zigzag-encoded 32-bit integer +// from the Buffer. +// This is the format used for the sint32 protocol buffer type. +func (p *Buffer) DecodeZigzag32() (x uint64, err error) { + x, err = p.DecodeVarint() + if err != nil { + return + } + x = uint64((uint32(x) >> 1) ^ uint32((int32(x&1)<<31)>>31)) + return +} + +// These are not ValueDecoders: they produce an array of bytes or a string. +// bytes, embedded messages + +// DecodeRawBytes reads a count-delimited byte buffer from the Buffer. +// This is the format used for the bytes protocol buffer +// type and for embedded messages. +func (p *Buffer) DecodeRawBytes(alloc bool) (buf []byte, err error) { + n, err := p.DecodeVarint() + if err != nil { + return nil, err + } + + nb := int(n) + if nb < 0 { + return nil, fmt.Errorf("proto: bad byte length %d", nb) + } + end := p.index + nb + if end < p.index || end > len(p.buf) { + return nil, io.ErrUnexpectedEOF + } + + if !alloc { + // todo: check if can get more uses of alloc=false + buf = p.buf[p.index:end] + p.index += nb + return + } + + buf = make([]byte, nb) + copy(buf, p.buf[p.index:]) + p.index += nb + return +} + +// DecodeStringBytes reads an encoded string from the Buffer. +// This is the format used for the proto2 string type. +func (p *Buffer) DecodeStringBytes() (s string, err error) { + buf, err := p.DecodeRawBytes(false) + if err != nil { + return + } + return string(buf), nil +} + +// Skip the next item in the buffer. Its wire type is decoded and presented as an argument. +// If the protocol buffer has extensions, and the field matches, add it as an extension. +// Otherwise, if the XXX_unrecognized field exists, append the skipped data there. +func (o *Buffer) skipAndSave(t reflect.Type, tag, wire int, base structPointer, unrecField field) error { + oi := o.index + + err := o.skip(t, tag, wire) + if err != nil { + return err + } + + if !unrecField.IsValid() { + return nil + } + + ptr := structPointer_Bytes(base, unrecField) + + // Add the skipped field to struct field + obuf := o.buf + + o.buf = *ptr + o.EncodeVarint(uint64(tag<<3 | wire)) + *ptr = append(o.buf, obuf[oi:o.index]...) + + o.buf = obuf + + return nil +} + +// Skip the next item in the buffer. Its wire type is decoded and presented as an argument. +func (o *Buffer) skip(t reflect.Type, tag, wire int) error { + + var u uint64 + var err error + + switch wire { + case WireVarint: + _, err = o.DecodeVarint() + case WireFixed64: + _, err = o.DecodeFixed64() + case WireBytes: + _, err = o.DecodeRawBytes(false) + case WireFixed32: + _, err = o.DecodeFixed32() + case WireStartGroup: + for { + u, err = o.DecodeVarint() + if err != nil { + break + } + fwire := int(u & 0x7) + if fwire == WireEndGroup { + break + } + ftag := int(u >> 3) + err = o.skip(t, ftag, fwire) + if err != nil { + break + } + } + default: + err = fmt.Errorf("proto: can't skip unknown wire type %d for %s", wire, t) + } + return err +} + +// Unmarshaler is the interface representing objects that can +// unmarshal themselves. The method should reset the receiver before +// decoding starts. The argument points to data that may be +// overwritten, so implementations should not keep references to the +// buffer. +type Unmarshaler interface { + Unmarshal([]byte) error +} + +// Unmarshal parses the protocol buffer representation in buf and places the +// decoded result in pb. If the struct underlying pb does not match +// the data in buf, the results can be unpredictable. +// +// Unmarshal resets pb before starting to unmarshal, so any +// existing data in pb is always removed. Use UnmarshalMerge +// to preserve and append to existing data. +func Unmarshal(buf []byte, pb Message) error { + pb.Reset() + return UnmarshalMerge(buf, pb) +} + +// UnmarshalMerge parses the protocol buffer representation in buf and +// writes the decoded result to pb. If the struct underlying pb does not match +// the data in buf, the results can be unpredictable. +// +// UnmarshalMerge merges into existing data in pb. +// Most code should use Unmarshal instead. +func UnmarshalMerge(buf []byte, pb Message) error { + // If the object can unmarshal itself, let it. + if u, ok := pb.(Unmarshaler); ok { + return u.Unmarshal(buf) + } + return NewBuffer(buf).Unmarshal(pb) +} + +// DecodeMessage reads a count-delimited message from the Buffer. +func (p *Buffer) DecodeMessage(pb Message) error { + enc, err := p.DecodeRawBytes(false) + if err != nil { + return err + } + return NewBuffer(enc).Unmarshal(pb) +} + +// DecodeGroup reads a tag-delimited group from the Buffer. +func (p *Buffer) DecodeGroup(pb Message) error { + typ, base, err := getbase(pb) + if err != nil { + return err + } + return p.unmarshalType(typ.Elem(), GetProperties(typ.Elem()), true, base) +} + +// Unmarshal parses the protocol buffer representation in the +// Buffer and places the decoded result in pb. If the struct +// underlying pb does not match the data in the buffer, the results can be +// unpredictable. +// +// Unlike proto.Unmarshal, this does not reset pb before starting to unmarshal. +func (p *Buffer) Unmarshal(pb Message) error { + // If the object can unmarshal itself, let it. + if u, ok := pb.(Unmarshaler); ok { + err := u.Unmarshal(p.buf[p.index:]) + p.index = len(p.buf) + return err + } + + typ, base, err := getbase(pb) + if err != nil { + return err + } + + err = p.unmarshalType(typ.Elem(), GetProperties(typ.Elem()), false, base) + + if collectStats { + stats.Decode++ + } + + return err +} + +// unmarshalType does the work of unmarshaling a structure. +func (o *Buffer) unmarshalType(st reflect.Type, prop *StructProperties, is_group bool, base structPointer) error { + var state errorState + required, reqFields := prop.reqCount, uint64(0) + + var err error + for err == nil && o.index < len(o.buf) { + oi := o.index + var u uint64 + u, err = o.DecodeVarint() + if err != nil { + break + } + wire := int(u & 0x7) + if wire == WireEndGroup { + if is_group { + if required > 0 { + // Not enough information to determine the exact field. + // (See below.) + return &RequiredNotSetError{"{Unknown}"} + } + return nil // input is satisfied + } + return fmt.Errorf("proto: %s: wiretype end group for non-group", st) + } + tag := int(u >> 3) + if tag <= 0 { + return fmt.Errorf("proto: %s: illegal tag %d (wire type %d)", st, tag, wire) + } + fieldnum, ok := prop.decoderTags.get(tag) + if !ok { + // Maybe it's an extension? + if prop.extendable { + if e, eok := structPointer_Interface(base, st).(extensionsBytes); eok { + if isExtensionField(e, int32(tag)) { + if err = o.skip(st, tag, wire); err == nil { + ext := e.GetExtensions() + *ext = append(*ext, o.buf[oi:o.index]...) + } + continue + } + } else if e, _ := extendable(structPointer_Interface(base, st)); isExtensionField(e, int32(tag)) { + if err = o.skip(st, tag, wire); err == nil { + extmap := e.extensionsWrite() + ext := extmap[int32(tag)] // may be missing + ext.enc = append(ext.enc, o.buf[oi:o.index]...) + extmap[int32(tag)] = ext + } + continue + } + } + // Maybe it's a oneof? + if prop.oneofUnmarshaler != nil { + m := structPointer_Interface(base, st).(Message) + // First return value indicates whether tag is a oneof field. + ok, err = prop.oneofUnmarshaler(m, tag, wire, o) + if err == ErrInternalBadWireType { + // Map the error to something more descriptive. + // Do the formatting here to save generated code space. + err = fmt.Errorf("bad wiretype for oneof field in %T", m) + } + if ok { + continue + } + } + err = o.skipAndSave(st, tag, wire, base, prop.unrecField) + continue + } + p := prop.Prop[fieldnum] + + if p.dec == nil { + fmt.Fprintf(os.Stderr, "proto: no protobuf decoder for %s.%s\n", st, st.Field(fieldnum).Name) + continue + } + dec := p.dec + if wire != WireStartGroup && wire != p.WireType { + if wire == WireBytes && p.packedDec != nil { + // a packable field + dec = p.packedDec + } else { + err = fmt.Errorf("proto: bad wiretype for field %s.%s: got wiretype %d, want %d", st, st.Field(fieldnum).Name, wire, p.WireType) + continue + } + } + decErr := dec(o, p, base) + if decErr != nil && !state.shouldContinue(decErr, p) { + err = decErr + } + if err == nil && p.Required { + // Successfully decoded a required field. + if tag <= 64 { + // use bitmap for fields 1-64 to catch field reuse. + var mask uint64 = 1 << uint64(tag-1) + if reqFields&mask == 0 { + // new required field + reqFields |= mask + required-- + } + } else { + // This is imprecise. It can be fooled by a required field + // with a tag > 64 that is encoded twice; that's very rare. + // A fully correct implementation would require allocating + // a data structure, which we would like to avoid. + required-- + } + } + } + if err == nil { + if is_group { + return io.ErrUnexpectedEOF + } + if state.err != nil { + return state.err + } + if required > 0 { + // Not enough information to determine the exact field. If we use extra + // CPU, we could determine the field only if the missing required field + // has a tag <= 64 and we check reqFields. + return &RequiredNotSetError{"{Unknown}"} + } + } + return err +} + +// Individual type decoders +// For each, +// u is the decoded value, +// v is a pointer to the field (pointer) in the struct + +// Sizes of the pools to allocate inside the Buffer. +// The goal is modest amortization and allocation +// on at least 16-byte boundaries. +const ( + boolPoolSize = 16 + uint32PoolSize = 8 + uint64PoolSize = 4 +) + +// Decode a bool. +func (o *Buffer) dec_bool(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + if len(o.bools) == 0 { + o.bools = make([]bool, boolPoolSize) + } + o.bools[0] = u != 0 + *structPointer_Bool(base, p.field) = &o.bools[0] + o.bools = o.bools[1:] + return nil +} + +func (o *Buffer) dec_proto3_bool(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + *structPointer_BoolVal(base, p.field) = u != 0 + return nil +} + +// Decode an int32. +func (o *Buffer) dec_int32(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + word32_Set(structPointer_Word32(base, p.field), o, uint32(u)) + return nil +} + +func (o *Buffer) dec_proto3_int32(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + word32Val_Set(structPointer_Word32Val(base, p.field), uint32(u)) + return nil +} + +// Decode an int64. +func (o *Buffer) dec_int64(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + word64_Set(structPointer_Word64(base, p.field), o, u) + return nil +} + +func (o *Buffer) dec_proto3_int64(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + word64Val_Set(structPointer_Word64Val(base, p.field), o, u) + return nil +} + +// Decode a string. +func (o *Buffer) dec_string(p *Properties, base structPointer) error { + s, err := o.DecodeStringBytes() + if err != nil { + return err + } + *structPointer_String(base, p.field) = &s + return nil +} + +func (o *Buffer) dec_proto3_string(p *Properties, base structPointer) error { + s, err := o.DecodeStringBytes() + if err != nil { + return err + } + *structPointer_StringVal(base, p.field) = s + return nil +} + +// Decode a slice of bytes ([]byte). +func (o *Buffer) dec_slice_byte(p *Properties, base structPointer) error { + b, err := o.DecodeRawBytes(true) + if err != nil { + return err + } + *structPointer_Bytes(base, p.field) = b + return nil +} + +// Decode a slice of bools ([]bool). +func (o *Buffer) dec_slice_bool(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + v := structPointer_BoolSlice(base, p.field) + *v = append(*v, u != 0) + return nil +} + +// Decode a slice of bools ([]bool) in packed format. +func (o *Buffer) dec_slice_packed_bool(p *Properties, base structPointer) error { + v := structPointer_BoolSlice(base, p.field) + + nn, err := o.DecodeVarint() + if err != nil { + return err + } + nb := int(nn) // number of bytes of encoded bools + fin := o.index + nb + if fin < o.index { + return errOverflow + } + + y := *v + for o.index < fin { + u, err := p.valDec(o) + if err != nil { + return err + } + y = append(y, u != 0) + } + + *v = y + return nil +} + +// Decode a slice of int32s ([]int32). +func (o *Buffer) dec_slice_int32(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + structPointer_Word32Slice(base, p.field).Append(uint32(u)) + return nil +} + +// Decode a slice of int32s ([]int32) in packed format. +func (o *Buffer) dec_slice_packed_int32(p *Properties, base structPointer) error { + v := structPointer_Word32Slice(base, p.field) + + nn, err := o.DecodeVarint() + if err != nil { + return err + } + nb := int(nn) // number of bytes of encoded int32s + + fin := o.index + nb + if fin < o.index { + return errOverflow + } + for o.index < fin { + u, err := p.valDec(o) + if err != nil { + return err + } + v.Append(uint32(u)) + } + return nil +} + +// Decode a slice of int64s ([]int64). +func (o *Buffer) dec_slice_int64(p *Properties, base structPointer) error { + u, err := p.valDec(o) + if err != nil { + return err + } + + structPointer_Word64Slice(base, p.field).Append(u) + return nil +} + +// Decode a slice of int64s ([]int64) in packed format. +func (o *Buffer) dec_slice_packed_int64(p *Properties, base structPointer) error { + v := structPointer_Word64Slice(base, p.field) + + nn, err := o.DecodeVarint() + if err != nil { + return err + } + nb := int(nn) // number of bytes of encoded int64s + + fin := o.index + nb + if fin < o.index { + return errOverflow + } + for o.index < fin { + u, err := p.valDec(o) + if err != nil { + return err + } + v.Append(u) + } + return nil +} + +// Decode a slice of strings ([]string). +func (o *Buffer) dec_slice_string(p *Properties, base structPointer) error { + s, err := o.DecodeStringBytes() + if err != nil { + return err + } + v := structPointer_StringSlice(base, p.field) + *v = append(*v, s) + return nil +} + +// Decode a slice of slice of bytes ([][]byte). +func (o *Buffer) dec_slice_slice_byte(p *Properties, base structPointer) error { + b, err := o.DecodeRawBytes(true) + if err != nil { + return err + } + v := structPointer_BytesSlice(base, p.field) + *v = append(*v, b) + return nil +} + +// Decode a map field. +func (o *Buffer) dec_new_map(p *Properties, base structPointer) error { + raw, err := o.DecodeRawBytes(false) + if err != nil { + return err + } + oi := o.index // index at the end of this map entry + o.index -= len(raw) // move buffer back to start of map entry + + mptr := structPointer_NewAt(base, p.field, p.mtype) // *map[K]V + if mptr.Elem().IsNil() { + mptr.Elem().Set(reflect.MakeMap(mptr.Type().Elem())) + } + v := mptr.Elem() // map[K]V + + // Prepare addressable doubly-indirect placeholders for the key and value types. + // See enc_new_map for why. + keyptr := reflect.New(reflect.PtrTo(p.mtype.Key())).Elem() // addressable *K + keybase := toStructPointer(keyptr.Addr()) // **K + + var valbase structPointer + var valptr reflect.Value + switch p.mtype.Elem().Kind() { + case reflect.Slice: + // []byte + var dummy []byte + valptr = reflect.ValueOf(&dummy) // *[]byte + valbase = toStructPointer(valptr) // *[]byte + case reflect.Ptr: + // message; valptr is **Msg; need to allocate the intermediate pointer + valptr = reflect.New(reflect.PtrTo(p.mtype.Elem())).Elem() // addressable *V + valptr.Set(reflect.New(valptr.Type().Elem())) + valbase = toStructPointer(valptr) + default: + // everything else + valptr = reflect.New(reflect.PtrTo(p.mtype.Elem())).Elem() // addressable *V + valbase = toStructPointer(valptr.Addr()) // **V + } + + // Decode. + // This parses a restricted wire format, namely the encoding of a message + // with two fields. See enc_new_map for the format. + for o.index < oi { + // tagcode for key and value properties are always a single byte + // because they have tags 1 and 2. + tagcode := o.buf[o.index] + o.index++ + switch tagcode { + case p.mkeyprop.tagcode[0]: + if err := p.mkeyprop.dec(o, p.mkeyprop, keybase); err != nil { + return err + } + case p.mvalprop.tagcode[0]: + if err := p.mvalprop.dec(o, p.mvalprop, valbase); err != nil { + return err + } + default: + // TODO: Should we silently skip this instead? + return fmt.Errorf("proto: bad map data tag %d", raw[0]) + } + } + keyelem, valelem := keyptr.Elem(), valptr.Elem() + if !keyelem.IsValid() { + keyelem = reflect.Zero(p.mtype.Key()) + } + if !valelem.IsValid() { + valelem = reflect.Zero(p.mtype.Elem()) + } + + v.SetMapIndex(keyelem, valelem) + return nil +} + +// Decode a group. +func (o *Buffer) dec_struct_group(p *Properties, base structPointer) error { + bas := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(bas) { + // allocate new nested message + bas = toStructPointer(reflect.New(p.stype)) + structPointer_SetStructPointer(base, p.field, bas) + } + return o.unmarshalType(p.stype, p.sprop, true, bas) +} + +// Decode an embedded message. +func (o *Buffer) dec_struct_message(p *Properties, base structPointer) (err error) { + raw, e := o.DecodeRawBytes(false) + if e != nil { + return e + } + + bas := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(bas) { + // allocate new nested message + bas = toStructPointer(reflect.New(p.stype)) + structPointer_SetStructPointer(base, p.field, bas) + } + + // If the object can unmarshal itself, let it. + if p.isUnmarshaler { + iv := structPointer_Interface(bas, p.stype) + return iv.(Unmarshaler).Unmarshal(raw) + } + + obuf := o.buf + oi := o.index + o.buf = raw + o.index = 0 + + err = o.unmarshalType(p.stype, p.sprop, false, bas) + o.buf = obuf + o.index = oi + + return err +} + +// Decode a slice of embedded messages. +func (o *Buffer) dec_slice_struct_message(p *Properties, base structPointer) error { + return o.dec_slice_struct(p, false, base) +} + +// Decode a slice of embedded groups. +func (o *Buffer) dec_slice_struct_group(p *Properties, base structPointer) error { + return o.dec_slice_struct(p, true, base) +} + +// Decode a slice of structs ([]*struct). +func (o *Buffer) dec_slice_struct(p *Properties, is_group bool, base structPointer) error { + v := reflect.New(p.stype) + bas := toStructPointer(v) + structPointer_StructPointerSlice(base, p.field).Append(bas) + + if is_group { + err := o.unmarshalType(p.stype, p.sprop, is_group, bas) + return err + } + + raw, err := o.DecodeRawBytes(false) + if err != nil { + return err + } + + // If the object can unmarshal itself, let it. + if p.isUnmarshaler { + iv := v.Interface() + return iv.(Unmarshaler).Unmarshal(raw) + } + + obuf := o.buf + oi := o.index + o.buf = raw + o.index = 0 + + err = o.unmarshalType(p.stype, p.sprop, is_group, bas) + + o.buf = obuf + o.index = oi + + return err +} diff --git a/vendor/github.com/gogo/protobuf/proto/decode_gogo.go b/vendor/github.com/gogo/protobuf/proto/decode_gogo.go new file mode 100644 index 000000000..6fb74de4c --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/decode_gogo.go @@ -0,0 +1,172 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "reflect" +) + +// Decode a reference to a struct pointer. +func (o *Buffer) dec_ref_struct_message(p *Properties, base structPointer) (err error) { + raw, e := o.DecodeRawBytes(false) + if e != nil { + return e + } + + // If the object can unmarshal itself, let it. + if p.isUnmarshaler { + panic("not supported, since this is a pointer receiver") + } + + obuf := o.buf + oi := o.index + o.buf = raw + o.index = 0 + + bas := structPointer_FieldPointer(base, p.field) + + err = o.unmarshalType(p.stype, p.sprop, false, bas) + o.buf = obuf + o.index = oi + + return err +} + +// Decode a slice of references to struct pointers ([]struct). +func (o *Buffer) dec_slice_ref_struct(p *Properties, is_group bool, base structPointer) error { + newBas := appendStructPointer(base, p.field, p.sstype) + + if is_group { + panic("not supported, maybe in future, if requested.") + } + + raw, err := o.DecodeRawBytes(false) + if err != nil { + return err + } + + // If the object can unmarshal itself, let it. + if p.isUnmarshaler { + panic("not supported, since this is not a pointer receiver.") + } + + obuf := o.buf + oi := o.index + o.buf = raw + o.index = 0 + + err = o.unmarshalType(p.stype, p.sprop, is_group, newBas) + + o.buf = obuf + o.index = oi + + return err +} + +// Decode a slice of references to struct pointers. +func (o *Buffer) dec_slice_ref_struct_message(p *Properties, base structPointer) error { + return o.dec_slice_ref_struct(p, false, base) +} + +func setPtrCustomType(base structPointer, f field, v interface{}) { + if v == nil { + return + } + structPointer_SetStructPointer(base, f, toStructPointer(reflect.ValueOf(v))) +} + +func setCustomType(base structPointer, f field, value interface{}) { + if value == nil { + return + } + v := reflect.ValueOf(value).Elem() + t := reflect.TypeOf(value).Elem() + kind := t.Kind() + switch kind { + case reflect.Slice: + slice := reflect.MakeSlice(t, v.Len(), v.Cap()) + reflect.Copy(slice, v) + oldHeader := structPointer_GetSliceHeader(base, f) + oldHeader.Data = slice.Pointer() + oldHeader.Len = v.Len() + oldHeader.Cap = v.Cap() + default: + size := reflect.TypeOf(value).Elem().Size() + structPointer_Copy(toStructPointer(reflect.ValueOf(value)), structPointer_Add(base, f), int(size)) + } +} + +func (o *Buffer) dec_custom_bytes(p *Properties, base structPointer) error { + b, err := o.DecodeRawBytes(true) + if err != nil { + return err + } + i := reflect.New(p.ctype.Elem()).Interface() + custom := (i).(Unmarshaler) + if err := custom.Unmarshal(b); err != nil { + return err + } + setPtrCustomType(base, p.field, custom) + return nil +} + +func (o *Buffer) dec_custom_ref_bytes(p *Properties, base structPointer) error { + b, err := o.DecodeRawBytes(true) + if err != nil { + return err + } + i := reflect.New(p.ctype).Interface() + custom := (i).(Unmarshaler) + if err := custom.Unmarshal(b); err != nil { + return err + } + if custom != nil { + setCustomType(base, p.field, custom) + } + return nil +} + +// Decode a slice of bytes ([]byte) into a slice of custom types. +func (o *Buffer) dec_custom_slice_bytes(p *Properties, base structPointer) error { + b, err := o.DecodeRawBytes(true) + if err != nil { + return err + } + i := reflect.New(p.ctype.Elem()).Interface() + custom := (i).(Unmarshaler) + if err := custom.Unmarshal(b); err != nil { + return err + } + newBas := appendStructPointer(base, p.field, p.ctype) + + var zero field + setCustomType(newBas, zero, custom) + + return nil +} diff --git a/vendor/github.com/gogo/protobuf/proto/duration.go b/vendor/github.com/gogo/protobuf/proto/duration.go new file mode 100644 index 000000000..93464c91c --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/duration.go @@ -0,0 +1,100 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +// This file implements conversions between google.protobuf.Duration +// and time.Duration. + +import ( + "errors" + "fmt" + "time" +) + +const ( + // Range of a Duration in seconds, as specified in + // google/protobuf/duration.proto. This is about 10,000 years in seconds. + maxSeconds = int64(10000 * 365.25 * 24 * 60 * 60) + minSeconds = -maxSeconds +) + +// validateDuration determines whether the Duration is valid according to the +// definition in google/protobuf/duration.proto. A valid Duration +// may still be too large to fit into a time.Duration (the range of Duration +// is about 10,000 years, and the range of time.Duration is about 290). +func validateDuration(d *duration) error { + if d == nil { + return errors.New("duration: nil Duration") + } + if d.Seconds < minSeconds || d.Seconds > maxSeconds { + return fmt.Errorf("duration: %#v: seconds out of range", d) + } + if d.Nanos <= -1e9 || d.Nanos >= 1e9 { + return fmt.Errorf("duration: %#v: nanos out of range", d) + } + // Seconds and Nanos must have the same sign, unless d.Nanos is zero. + if (d.Seconds < 0 && d.Nanos > 0) || (d.Seconds > 0 && d.Nanos < 0) { + return fmt.Errorf("duration: %#v: seconds and nanos have different signs", d) + } + return nil +} + +// DurationFromProto converts a Duration to a time.Duration. DurationFromProto +// returns an error if the Duration is invalid or is too large to be +// represented in a time.Duration. +func durationFromProto(p *duration) (time.Duration, error) { + if err := validateDuration(p); err != nil { + return 0, err + } + d := time.Duration(p.Seconds) * time.Second + if int64(d/time.Second) != p.Seconds { + return 0, fmt.Errorf("duration: %#v is out of range for time.Duration", p) + } + if p.Nanos != 0 { + d += time.Duration(p.Nanos) + if (d < 0) != (p.Nanos < 0) { + return 0, fmt.Errorf("duration: %#v is out of range for time.Duration", p) + } + } + return d, nil +} + +// DurationProto converts a time.Duration to a Duration. +func durationProto(d time.Duration) *duration { + nanos := d.Nanoseconds() + secs := nanos / 1e9 + nanos -= secs * 1e9 + return &duration{ + Seconds: secs, + Nanos: int32(nanos), + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/duration_gogo.go b/vendor/github.com/gogo/protobuf/proto/duration_gogo.go new file mode 100644 index 000000000..18e2a5f77 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/duration_gogo.go @@ -0,0 +1,203 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2016, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "reflect" + "time" +) + +var durationType = reflect.TypeOf((*time.Duration)(nil)).Elem() + +type duration struct { + Seconds int64 `protobuf:"varint,1,opt,name=seconds,proto3" json:"seconds,omitempty"` + Nanos int32 `protobuf:"varint,2,opt,name=nanos,proto3" json:"nanos,omitempty"` +} + +func (m *duration) Reset() { *m = duration{} } +func (*duration) ProtoMessage() {} +func (*duration) String() string { return "duration" } + +func init() { + RegisterType((*duration)(nil), "gogo.protobuf.proto.duration") +} + +func (o *Buffer) decDuration() (time.Duration, error) { + b, err := o.DecodeRawBytes(true) + if err != nil { + return 0, err + } + dproto := &duration{} + if err := Unmarshal(b, dproto); err != nil { + return 0, err + } + return durationFromProto(dproto) +} + +func (o *Buffer) dec_duration(p *Properties, base structPointer) error { + d, err := o.decDuration() + if err != nil { + return err + } + word64_Set(structPointer_Word64(base, p.field), o, uint64(d)) + return nil +} + +func (o *Buffer) dec_ref_duration(p *Properties, base structPointer) error { + d, err := o.decDuration() + if err != nil { + return err + } + word64Val_Set(structPointer_Word64Val(base, p.field), o, uint64(d)) + return nil +} + +func (o *Buffer) dec_slice_duration(p *Properties, base structPointer) error { + d, err := o.decDuration() + if err != nil { + return err + } + newBas := appendStructPointer(base, p.field, reflect.SliceOf(reflect.PtrTo(durationType))) + var zero field + setPtrCustomType(newBas, zero, &d) + return nil +} + +func (o *Buffer) dec_slice_ref_duration(p *Properties, base structPointer) error { + d, err := o.decDuration() + if err != nil { + return err + } + structPointer_Word64Slice(base, p.field).Append(uint64(d)) + return nil +} + +func size_duration(p *Properties, base structPointer) (n int) { + structp := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(structp) { + return 0 + } + dur := structPointer_Interface(structp, durationType).(*time.Duration) + d := durationProto(*dur) + size := Size(d) + return size + sizeVarint(uint64(size)) + len(p.tagcode) +} + +func (o *Buffer) enc_duration(p *Properties, base structPointer) error { + structp := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(structp) { + return ErrNil + } + dur := structPointer_Interface(structp, durationType).(*time.Duration) + d := durationProto(*dur) + data, err := Marshal(d) + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + return nil +} + +func size_ref_duration(p *Properties, base structPointer) (n int) { + dur := structPointer_InterfaceAt(base, p.field, durationType).(*time.Duration) + d := durationProto(*dur) + size := Size(d) + return size + sizeVarint(uint64(size)) + len(p.tagcode) +} + +func (o *Buffer) enc_ref_duration(p *Properties, base structPointer) error { + dur := structPointer_InterfaceAt(base, p.field, durationType).(*time.Duration) + d := durationProto(*dur) + data, err := Marshal(d) + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + return nil +} + +func size_slice_duration(p *Properties, base structPointer) (n int) { + pdurs := structPointer_InterfaceAt(base, p.field, reflect.SliceOf(reflect.PtrTo(durationType))).(*[]*time.Duration) + durs := *pdurs + for i := 0; i < len(durs); i++ { + if durs[i] == nil { + return 0 + } + dproto := durationProto(*durs[i]) + size := Size(dproto) + n += len(p.tagcode) + size + sizeVarint(uint64(size)) + } + return n +} + +func (o *Buffer) enc_slice_duration(p *Properties, base structPointer) error { + pdurs := structPointer_InterfaceAt(base, p.field, reflect.SliceOf(reflect.PtrTo(durationType))).(*[]*time.Duration) + durs := *pdurs + for i := 0; i < len(durs); i++ { + if durs[i] == nil { + return errRepeatedHasNil + } + dproto := durationProto(*durs[i]) + data, err := Marshal(dproto) + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + } + return nil +} + +func size_slice_ref_duration(p *Properties, base structPointer) (n int) { + pdurs := structPointer_InterfaceAt(base, p.field, reflect.SliceOf(durationType)).(*[]time.Duration) + durs := *pdurs + for i := 0; i < len(durs); i++ { + dproto := durationProto(durs[i]) + size := Size(dproto) + n += len(p.tagcode) + size + sizeVarint(uint64(size)) + } + return n +} + +func (o *Buffer) enc_slice_ref_duration(p *Properties, base structPointer) error { + pdurs := structPointer_InterfaceAt(base, p.field, reflect.SliceOf(durationType)).(*[]time.Duration) + durs := *pdurs + for i := 0; i < len(durs); i++ { + dproto := durationProto(durs[i]) + data, err := Marshal(dproto) + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + } + return nil +} diff --git a/vendor/github.com/gogo/protobuf/proto/encode.go b/vendor/github.com/gogo/protobuf/proto/encode.go new file mode 100644 index 000000000..2b30f8462 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/encode.go @@ -0,0 +1,1362 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Routines for encoding data into the wire format for protocol buffers. + */ + +import ( + "errors" + "fmt" + "reflect" + "sort" +) + +// RequiredNotSetError is the error returned if Marshal is called with +// a protocol buffer struct whose required fields have not +// all been initialized. It is also the error returned if Unmarshal is +// called with an encoded protocol buffer that does not include all the +// required fields. +// +// When printed, RequiredNotSetError reports the first unset required field in a +// message. If the field cannot be precisely determined, it is reported as +// "{Unknown}". +type RequiredNotSetError struct { + field string +} + +func (e *RequiredNotSetError) Error() string { + return fmt.Sprintf("proto: required field %q not set", e.field) +} + +var ( + // errRepeatedHasNil is the error returned if Marshal is called with + // a struct with a repeated field containing a nil element. + errRepeatedHasNil = errors.New("proto: repeated field has nil element") + + // errOneofHasNil is the error returned if Marshal is called with + // a struct with a oneof field containing a nil element. + errOneofHasNil = errors.New("proto: oneof field has nil value") + + // ErrNil is the error returned if Marshal is called with nil. + ErrNil = errors.New("proto: Marshal called with nil") + + // ErrTooLarge is the error returned if Marshal is called with a + // message that encodes to >2GB. + ErrTooLarge = errors.New("proto: message encodes to over 2 GB") +) + +// The fundamental encoders that put bytes on the wire. +// Those that take integer types all accept uint64 and are +// therefore of type valueEncoder. + +const maxVarintBytes = 10 // maximum length of a varint + +// maxMarshalSize is the largest allowed size of an encoded protobuf, +// since C++ and Java use signed int32s for the size. +const maxMarshalSize = 1<<31 - 1 + +// EncodeVarint returns the varint encoding of x. +// This is the format for the +// int32, int64, uint32, uint64, bool, and enum +// protocol buffer types. +// Not used by the package itself, but helpful to clients +// wishing to use the same encoding. +func EncodeVarint(x uint64) []byte { + var buf [maxVarintBytes]byte + var n int + for n = 0; x > 127; n++ { + buf[n] = 0x80 | uint8(x&0x7F) + x >>= 7 + } + buf[n] = uint8(x) + n++ + return buf[0:n] +} + +// EncodeVarint writes a varint-encoded integer to the Buffer. +// This is the format for the +// int32, int64, uint32, uint64, bool, and enum +// protocol buffer types. +func (p *Buffer) EncodeVarint(x uint64) error { + for x >= 1<<7 { + p.buf = append(p.buf, uint8(x&0x7f|0x80)) + x >>= 7 + } + p.buf = append(p.buf, uint8(x)) + return nil +} + +// SizeVarint returns the varint encoding size of an integer. +func SizeVarint(x uint64) int { + return sizeVarint(x) +} + +func sizeVarint(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} + +// EncodeFixed64 writes a 64-bit integer to the Buffer. +// This is the format for the +// fixed64, sfixed64, and double protocol buffer types. +func (p *Buffer) EncodeFixed64(x uint64) error { + p.buf = append(p.buf, + uint8(x), + uint8(x>>8), + uint8(x>>16), + uint8(x>>24), + uint8(x>>32), + uint8(x>>40), + uint8(x>>48), + uint8(x>>56)) + return nil +} + +func sizeFixed64(x uint64) int { + return 8 +} + +// EncodeFixed32 writes a 32-bit integer to the Buffer. +// This is the format for the +// fixed32, sfixed32, and float protocol buffer types. +func (p *Buffer) EncodeFixed32(x uint64) error { + p.buf = append(p.buf, + uint8(x), + uint8(x>>8), + uint8(x>>16), + uint8(x>>24)) + return nil +} + +func sizeFixed32(x uint64) int { + return 4 +} + +// EncodeZigzag64 writes a zigzag-encoded 64-bit integer +// to the Buffer. +// This is the format used for the sint64 protocol buffer type. +func (p *Buffer) EncodeZigzag64(x uint64) error { + // use signed number to get arithmetic right shift. + return p.EncodeVarint(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} + +func sizeZigzag64(x uint64) int { + return sizeVarint(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} + +// EncodeZigzag32 writes a zigzag-encoded 32-bit integer +// to the Buffer. +// This is the format used for the sint32 protocol buffer type. +func (p *Buffer) EncodeZigzag32(x uint64) error { + // use signed number to get arithmetic right shift. + return p.EncodeVarint(uint64((uint32(x) << 1) ^ uint32((int32(x) >> 31)))) +} + +func sizeZigzag32(x uint64) int { + return sizeVarint(uint64((uint32(x) << 1) ^ uint32((int32(x) >> 31)))) +} + +// EncodeRawBytes writes a count-delimited byte buffer to the Buffer. +// This is the format used for the bytes protocol buffer +// type and for embedded messages. +func (p *Buffer) EncodeRawBytes(b []byte) error { + p.EncodeVarint(uint64(len(b))) + p.buf = append(p.buf, b...) + return nil +} + +func sizeRawBytes(b []byte) int { + return sizeVarint(uint64(len(b))) + + len(b) +} + +// EncodeStringBytes writes an encoded string to the Buffer. +// This is the format used for the proto2 string type. +func (p *Buffer) EncodeStringBytes(s string) error { + p.EncodeVarint(uint64(len(s))) + p.buf = append(p.buf, s...) + return nil +} + +func sizeStringBytes(s string) int { + return sizeVarint(uint64(len(s))) + + len(s) +} + +// Marshaler is the interface representing objects that can marshal themselves. +type Marshaler interface { + Marshal() ([]byte, error) +} + +// Marshal takes the protocol buffer +// and encodes it into the wire format, returning the data. +func Marshal(pb Message) ([]byte, error) { + // Can the object marshal itself? + if m, ok := pb.(Marshaler); ok { + return m.Marshal() + } + p := NewBuffer(nil) + err := p.Marshal(pb) + if p.buf == nil && err == nil { + // Return a non-nil slice on success. + return []byte{}, nil + } + return p.buf, err +} + +// EncodeMessage writes the protocol buffer to the Buffer, +// prefixed by a varint-encoded length. +func (p *Buffer) EncodeMessage(pb Message) error { + t, base, err := getbase(pb) + if structPointer_IsNil(base) { + return ErrNil + } + if err == nil { + var state errorState + err = p.enc_len_struct(GetProperties(t.Elem()), base, &state) + } + return err +} + +// Marshal takes the protocol buffer +// and encodes it into the wire format, writing the result to the +// Buffer. +func (p *Buffer) Marshal(pb Message) error { + // Can the object marshal itself? + if m, ok := pb.(Marshaler); ok { + data, err := m.Marshal() + p.buf = append(p.buf, data...) + return err + } + + t, base, err := getbase(pb) + if structPointer_IsNil(base) { + return ErrNil + } + if err == nil { + err = p.enc_struct(GetProperties(t.Elem()), base) + } + + if collectStats { + (stats).Encode++ // Parens are to work around a goimports bug. + } + + if len(p.buf) > maxMarshalSize { + return ErrTooLarge + } + return err +} + +// Size returns the encoded size of a protocol buffer. +func Size(pb Message) (n int) { + // Can the object marshal itself? If so, Size is slow. + // TODO: add Size to Marshaler, or add a Sizer interface. + if m, ok := pb.(Marshaler); ok { + b, _ := m.Marshal() + return len(b) + } + + t, base, err := getbase(pb) + if structPointer_IsNil(base) { + return 0 + } + if err == nil { + n = size_struct(GetProperties(t.Elem()), base) + } + + if collectStats { + (stats).Size++ // Parens are to work around a goimports bug. + } + + return +} + +// Individual type encoders. + +// Encode a bool. +func (o *Buffer) enc_bool(p *Properties, base structPointer) error { + v := *structPointer_Bool(base, p.field) + if v == nil { + return ErrNil + } + x := 0 + if *v { + x = 1 + } + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, uint64(x)) + return nil +} + +func (o *Buffer) enc_proto3_bool(p *Properties, base structPointer) error { + v := *structPointer_BoolVal(base, p.field) + if !v { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, 1) + return nil +} + +func size_bool(p *Properties, base structPointer) int { + v := *structPointer_Bool(base, p.field) + if v == nil { + return 0 + } + return len(p.tagcode) + 1 // each bool takes exactly one byte +} + +func size_proto3_bool(p *Properties, base structPointer) int { + v := *structPointer_BoolVal(base, p.field) + if !v && !p.oneof { + return 0 + } + return len(p.tagcode) + 1 // each bool takes exactly one byte +} + +// Encode an int32. +func (o *Buffer) enc_int32(p *Properties, base structPointer) error { + v := structPointer_Word32(base, p.field) + if word32_IsNil(v) { + return ErrNil + } + x := int32(word32_Get(v)) // permit sign extension to use full 64-bit range + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, uint64(x)) + return nil +} + +func (o *Buffer) enc_proto3_int32(p *Properties, base structPointer) error { + v := structPointer_Word32Val(base, p.field) + x := int32(word32Val_Get(v)) // permit sign extension to use full 64-bit range + if x == 0 { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, uint64(x)) + return nil +} + +func size_int32(p *Properties, base structPointer) (n int) { + v := structPointer_Word32(base, p.field) + if word32_IsNil(v) { + return 0 + } + x := int32(word32_Get(v)) // permit sign extension to use full 64-bit range + n += len(p.tagcode) + n += p.valSize(uint64(x)) + return +} + +func size_proto3_int32(p *Properties, base structPointer) (n int) { + v := structPointer_Word32Val(base, p.field) + x := int32(word32Val_Get(v)) // permit sign extension to use full 64-bit range + if x == 0 && !p.oneof { + return 0 + } + n += len(p.tagcode) + n += p.valSize(uint64(x)) + return +} + +// Encode a uint32. +// Exactly the same as int32, except for no sign extension. +func (o *Buffer) enc_uint32(p *Properties, base structPointer) error { + v := structPointer_Word32(base, p.field) + if word32_IsNil(v) { + return ErrNil + } + x := word32_Get(v) + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, uint64(x)) + return nil +} + +func (o *Buffer) enc_proto3_uint32(p *Properties, base structPointer) error { + v := structPointer_Word32Val(base, p.field) + x := word32Val_Get(v) + if x == 0 { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, uint64(x)) + return nil +} + +func size_uint32(p *Properties, base structPointer) (n int) { + v := structPointer_Word32(base, p.field) + if word32_IsNil(v) { + return 0 + } + x := word32_Get(v) + n += len(p.tagcode) + n += p.valSize(uint64(x)) + return +} + +func size_proto3_uint32(p *Properties, base structPointer) (n int) { + v := structPointer_Word32Val(base, p.field) + x := word32Val_Get(v) + if x == 0 && !p.oneof { + return 0 + } + n += len(p.tagcode) + n += p.valSize(uint64(x)) + return +} + +// Encode an int64. +func (o *Buffer) enc_int64(p *Properties, base structPointer) error { + v := structPointer_Word64(base, p.field) + if word64_IsNil(v) { + return ErrNil + } + x := word64_Get(v) + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, x) + return nil +} + +func (o *Buffer) enc_proto3_int64(p *Properties, base structPointer) error { + v := structPointer_Word64Val(base, p.field) + x := word64Val_Get(v) + if x == 0 { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, x) + return nil +} + +func size_int64(p *Properties, base structPointer) (n int) { + v := structPointer_Word64(base, p.field) + if word64_IsNil(v) { + return 0 + } + x := word64_Get(v) + n += len(p.tagcode) + n += p.valSize(x) + return +} + +func size_proto3_int64(p *Properties, base structPointer) (n int) { + v := structPointer_Word64Val(base, p.field) + x := word64Val_Get(v) + if x == 0 && !p.oneof { + return 0 + } + n += len(p.tagcode) + n += p.valSize(x) + return +} + +// Encode a string. +func (o *Buffer) enc_string(p *Properties, base structPointer) error { + v := *structPointer_String(base, p.field) + if v == nil { + return ErrNil + } + x := *v + o.buf = append(o.buf, p.tagcode...) + o.EncodeStringBytes(x) + return nil +} + +func (o *Buffer) enc_proto3_string(p *Properties, base structPointer) error { + v := *structPointer_StringVal(base, p.field) + if v == "" { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeStringBytes(v) + return nil +} + +func size_string(p *Properties, base structPointer) (n int) { + v := *structPointer_String(base, p.field) + if v == nil { + return 0 + } + x := *v + n += len(p.tagcode) + n += sizeStringBytes(x) + return +} + +func size_proto3_string(p *Properties, base structPointer) (n int) { + v := *structPointer_StringVal(base, p.field) + if v == "" && !p.oneof { + return 0 + } + n += len(p.tagcode) + n += sizeStringBytes(v) + return +} + +// All protocol buffer fields are nillable, but be careful. +func isNil(v reflect.Value) bool { + switch v.Kind() { + case reflect.Interface, reflect.Map, reflect.Ptr, reflect.Slice: + return v.IsNil() + } + return false +} + +// Encode a message struct. +func (o *Buffer) enc_struct_message(p *Properties, base structPointer) error { + var state errorState + structp := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(structp) { + return ErrNil + } + + // Can the object marshal itself? + if p.isMarshaler { + m := structPointer_Interface(structp, p.stype).(Marshaler) + data, err := m.Marshal() + if err != nil && !state.shouldContinue(err, nil) { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + return state.err + } + + o.buf = append(o.buf, p.tagcode...) + return o.enc_len_struct(p.sprop, structp, &state) +} + +func size_struct_message(p *Properties, base structPointer) int { + structp := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(structp) { + return 0 + } + + // Can the object marshal itself? + if p.isMarshaler { + m := structPointer_Interface(structp, p.stype).(Marshaler) + data, _ := m.Marshal() + n0 := len(p.tagcode) + n1 := sizeRawBytes(data) + return n0 + n1 + } + + n0 := len(p.tagcode) + n1 := size_struct(p.sprop, structp) + n2 := sizeVarint(uint64(n1)) // size of encoded length + return n0 + n1 + n2 +} + +// Encode a group struct. +func (o *Buffer) enc_struct_group(p *Properties, base structPointer) error { + var state errorState + b := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(b) { + return ErrNil + } + + o.EncodeVarint(uint64((p.Tag << 3) | WireStartGroup)) + err := o.enc_struct(p.sprop, b) + if err != nil && !state.shouldContinue(err, nil) { + return err + } + o.EncodeVarint(uint64((p.Tag << 3) | WireEndGroup)) + return state.err +} + +func size_struct_group(p *Properties, base structPointer) (n int) { + b := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(b) { + return 0 + } + + n += sizeVarint(uint64((p.Tag << 3) | WireStartGroup)) + n += size_struct(p.sprop, b) + n += sizeVarint(uint64((p.Tag << 3) | WireEndGroup)) + return +} + +// Encode a slice of bools ([]bool). +func (o *Buffer) enc_slice_bool(p *Properties, base structPointer) error { + s := *structPointer_BoolSlice(base, p.field) + l := len(s) + if l == 0 { + return ErrNil + } + for _, x := range s { + o.buf = append(o.buf, p.tagcode...) + v := uint64(0) + if x { + v = 1 + } + p.valEnc(o, v) + } + return nil +} + +func size_slice_bool(p *Properties, base structPointer) int { + s := *structPointer_BoolSlice(base, p.field) + l := len(s) + if l == 0 { + return 0 + } + return l * (len(p.tagcode) + 1) // each bool takes exactly one byte +} + +// Encode a slice of bools ([]bool) in packed format. +func (o *Buffer) enc_slice_packed_bool(p *Properties, base structPointer) error { + s := *structPointer_BoolSlice(base, p.field) + l := len(s) + if l == 0 { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeVarint(uint64(l)) // each bool takes exactly one byte + for _, x := range s { + v := uint64(0) + if x { + v = 1 + } + p.valEnc(o, v) + } + return nil +} + +func size_slice_packed_bool(p *Properties, base structPointer) (n int) { + s := *structPointer_BoolSlice(base, p.field) + l := len(s) + if l == 0 { + return 0 + } + n += len(p.tagcode) + n += sizeVarint(uint64(l)) + n += l // each bool takes exactly one byte + return +} + +// Encode a slice of bytes ([]byte). +func (o *Buffer) enc_slice_byte(p *Properties, base structPointer) error { + s := *structPointer_Bytes(base, p.field) + if s == nil { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(s) + return nil +} + +func (o *Buffer) enc_proto3_slice_byte(p *Properties, base structPointer) error { + s := *structPointer_Bytes(base, p.field) + if len(s) == 0 { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(s) + return nil +} + +func size_slice_byte(p *Properties, base structPointer) (n int) { + s := *structPointer_Bytes(base, p.field) + if s == nil && !p.oneof { + return 0 + } + n += len(p.tagcode) + n += sizeRawBytes(s) + return +} + +func size_proto3_slice_byte(p *Properties, base structPointer) (n int) { + s := *structPointer_Bytes(base, p.field) + if len(s) == 0 && !p.oneof { + return 0 + } + n += len(p.tagcode) + n += sizeRawBytes(s) + return +} + +// Encode a slice of int32s ([]int32). +func (o *Buffer) enc_slice_int32(p *Properties, base structPointer) error { + s := structPointer_Word32Slice(base, p.field) + l := s.Len() + if l == 0 { + return ErrNil + } + for i := 0; i < l; i++ { + o.buf = append(o.buf, p.tagcode...) + x := int32(s.Index(i)) // permit sign extension to use full 64-bit range + p.valEnc(o, uint64(x)) + } + return nil +} + +func size_slice_int32(p *Properties, base structPointer) (n int) { + s := structPointer_Word32Slice(base, p.field) + l := s.Len() + if l == 0 { + return 0 + } + for i := 0; i < l; i++ { + n += len(p.tagcode) + x := int32(s.Index(i)) // permit sign extension to use full 64-bit range + n += p.valSize(uint64(x)) + } + return +} + +// Encode a slice of int32s ([]int32) in packed format. +func (o *Buffer) enc_slice_packed_int32(p *Properties, base structPointer) error { + s := structPointer_Word32Slice(base, p.field) + l := s.Len() + if l == 0 { + return ErrNil + } + // TODO: Reuse a Buffer. + buf := NewBuffer(nil) + for i := 0; i < l; i++ { + x := int32(s.Index(i)) // permit sign extension to use full 64-bit range + p.valEnc(buf, uint64(x)) + } + + o.buf = append(o.buf, p.tagcode...) + o.EncodeVarint(uint64(len(buf.buf))) + o.buf = append(o.buf, buf.buf...) + return nil +} + +func size_slice_packed_int32(p *Properties, base structPointer) (n int) { + s := structPointer_Word32Slice(base, p.field) + l := s.Len() + if l == 0 { + return 0 + } + var bufSize int + for i := 0; i < l; i++ { + x := int32(s.Index(i)) // permit sign extension to use full 64-bit range + bufSize += p.valSize(uint64(x)) + } + + n += len(p.tagcode) + n += sizeVarint(uint64(bufSize)) + n += bufSize + return +} + +// Encode a slice of uint32s ([]uint32). +// Exactly the same as int32, except for no sign extension. +func (o *Buffer) enc_slice_uint32(p *Properties, base structPointer) error { + s := structPointer_Word32Slice(base, p.field) + l := s.Len() + if l == 0 { + return ErrNil + } + for i := 0; i < l; i++ { + o.buf = append(o.buf, p.tagcode...) + x := s.Index(i) + p.valEnc(o, uint64(x)) + } + return nil +} + +func size_slice_uint32(p *Properties, base structPointer) (n int) { + s := structPointer_Word32Slice(base, p.field) + l := s.Len() + if l == 0 { + return 0 + } + for i := 0; i < l; i++ { + n += len(p.tagcode) + x := s.Index(i) + n += p.valSize(uint64(x)) + } + return +} + +// Encode a slice of uint32s ([]uint32) in packed format. +// Exactly the same as int32, except for no sign extension. +func (o *Buffer) enc_slice_packed_uint32(p *Properties, base structPointer) error { + s := structPointer_Word32Slice(base, p.field) + l := s.Len() + if l == 0 { + return ErrNil + } + // TODO: Reuse a Buffer. + buf := NewBuffer(nil) + for i := 0; i < l; i++ { + p.valEnc(buf, uint64(s.Index(i))) + } + + o.buf = append(o.buf, p.tagcode...) + o.EncodeVarint(uint64(len(buf.buf))) + o.buf = append(o.buf, buf.buf...) + return nil +} + +func size_slice_packed_uint32(p *Properties, base structPointer) (n int) { + s := structPointer_Word32Slice(base, p.field) + l := s.Len() + if l == 0 { + return 0 + } + var bufSize int + for i := 0; i < l; i++ { + bufSize += p.valSize(uint64(s.Index(i))) + } + + n += len(p.tagcode) + n += sizeVarint(uint64(bufSize)) + n += bufSize + return +} + +// Encode a slice of int64s ([]int64). +func (o *Buffer) enc_slice_int64(p *Properties, base structPointer) error { + s := structPointer_Word64Slice(base, p.field) + l := s.Len() + if l == 0 { + return ErrNil + } + for i := 0; i < l; i++ { + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, s.Index(i)) + } + return nil +} + +func size_slice_int64(p *Properties, base structPointer) (n int) { + s := structPointer_Word64Slice(base, p.field) + l := s.Len() + if l == 0 { + return 0 + } + for i := 0; i < l; i++ { + n += len(p.tagcode) + n += p.valSize(s.Index(i)) + } + return +} + +// Encode a slice of int64s ([]int64) in packed format. +func (o *Buffer) enc_slice_packed_int64(p *Properties, base structPointer) error { + s := structPointer_Word64Slice(base, p.field) + l := s.Len() + if l == 0 { + return ErrNil + } + // TODO: Reuse a Buffer. + buf := NewBuffer(nil) + for i := 0; i < l; i++ { + p.valEnc(buf, s.Index(i)) + } + + o.buf = append(o.buf, p.tagcode...) + o.EncodeVarint(uint64(len(buf.buf))) + o.buf = append(o.buf, buf.buf...) + return nil +} + +func size_slice_packed_int64(p *Properties, base structPointer) (n int) { + s := structPointer_Word64Slice(base, p.field) + l := s.Len() + if l == 0 { + return 0 + } + var bufSize int + for i := 0; i < l; i++ { + bufSize += p.valSize(s.Index(i)) + } + + n += len(p.tagcode) + n += sizeVarint(uint64(bufSize)) + n += bufSize + return +} + +// Encode a slice of slice of bytes ([][]byte). +func (o *Buffer) enc_slice_slice_byte(p *Properties, base structPointer) error { + ss := *structPointer_BytesSlice(base, p.field) + l := len(ss) + if l == 0 { + return ErrNil + } + for i := 0; i < l; i++ { + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(ss[i]) + } + return nil +} + +func size_slice_slice_byte(p *Properties, base structPointer) (n int) { + ss := *structPointer_BytesSlice(base, p.field) + l := len(ss) + if l == 0 { + return 0 + } + n += l * len(p.tagcode) + for i := 0; i < l; i++ { + n += sizeRawBytes(ss[i]) + } + return +} + +// Encode a slice of strings ([]string). +func (o *Buffer) enc_slice_string(p *Properties, base structPointer) error { + ss := *structPointer_StringSlice(base, p.field) + l := len(ss) + for i := 0; i < l; i++ { + o.buf = append(o.buf, p.tagcode...) + o.EncodeStringBytes(ss[i]) + } + return nil +} + +func size_slice_string(p *Properties, base structPointer) (n int) { + ss := *structPointer_StringSlice(base, p.field) + l := len(ss) + n += l * len(p.tagcode) + for i := 0; i < l; i++ { + n += sizeStringBytes(ss[i]) + } + return +} + +// Encode a slice of message structs ([]*struct). +func (o *Buffer) enc_slice_struct_message(p *Properties, base structPointer) error { + var state errorState + s := structPointer_StructPointerSlice(base, p.field) + l := s.Len() + + for i := 0; i < l; i++ { + structp := s.Index(i) + if structPointer_IsNil(structp) { + return errRepeatedHasNil + } + + // Can the object marshal itself? + if p.isMarshaler { + m := structPointer_Interface(structp, p.stype).(Marshaler) + data, err := m.Marshal() + if err != nil && !state.shouldContinue(err, nil) { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + continue + } + + o.buf = append(o.buf, p.tagcode...) + err := o.enc_len_struct(p.sprop, structp, &state) + if err != nil && !state.shouldContinue(err, nil) { + if err == ErrNil { + return errRepeatedHasNil + } + return err + } + } + return state.err +} + +func size_slice_struct_message(p *Properties, base structPointer) (n int) { + s := structPointer_StructPointerSlice(base, p.field) + l := s.Len() + n += l * len(p.tagcode) + for i := 0; i < l; i++ { + structp := s.Index(i) + if structPointer_IsNil(structp) { + return // return the size up to this point + } + + // Can the object marshal itself? + if p.isMarshaler { + m := structPointer_Interface(structp, p.stype).(Marshaler) + data, _ := m.Marshal() + n += sizeRawBytes(data) + continue + } + + n0 := size_struct(p.sprop, structp) + n1 := sizeVarint(uint64(n0)) // size of encoded length + n += n0 + n1 + } + return +} + +// Encode a slice of group structs ([]*struct). +func (o *Buffer) enc_slice_struct_group(p *Properties, base structPointer) error { + var state errorState + s := structPointer_StructPointerSlice(base, p.field) + l := s.Len() + + for i := 0; i < l; i++ { + b := s.Index(i) + if structPointer_IsNil(b) { + return errRepeatedHasNil + } + + o.EncodeVarint(uint64((p.Tag << 3) | WireStartGroup)) + + err := o.enc_struct(p.sprop, b) + + if err != nil && !state.shouldContinue(err, nil) { + if err == ErrNil { + return errRepeatedHasNil + } + return err + } + + o.EncodeVarint(uint64((p.Tag << 3) | WireEndGroup)) + } + return state.err +} + +func size_slice_struct_group(p *Properties, base structPointer) (n int) { + s := structPointer_StructPointerSlice(base, p.field) + l := s.Len() + + n += l * sizeVarint(uint64((p.Tag<<3)|WireStartGroup)) + n += l * sizeVarint(uint64((p.Tag<<3)|WireEndGroup)) + for i := 0; i < l; i++ { + b := s.Index(i) + if structPointer_IsNil(b) { + return // return size up to this point + } + + n += size_struct(p.sprop, b) + } + return +} + +// Encode an extension map. +func (o *Buffer) enc_map(p *Properties, base structPointer) error { + exts := structPointer_ExtMap(base, p.field) + if err := encodeExtensionsMap(*exts); err != nil { + return err + } + + return o.enc_map_body(*exts) +} + +func (o *Buffer) enc_exts(p *Properties, base structPointer) error { + exts := structPointer_Extensions(base, p.field) + + v, mu := exts.extensionsRead() + if v == nil { + return nil + } + + mu.Lock() + defer mu.Unlock() + if err := encodeExtensionsMap(v); err != nil { + return err + } + + return o.enc_map_body(v) +} + +func (o *Buffer) enc_map_body(v map[int32]Extension) error { + // Fast-path for common cases: zero or one extensions. + if len(v) <= 1 { + for _, e := range v { + o.buf = append(o.buf, e.enc...) + } + return nil + } + + // Sort keys to provide a deterministic encoding. + keys := make([]int, 0, len(v)) + for k := range v { + keys = append(keys, int(k)) + } + sort.Ints(keys) + + for _, k := range keys { + o.buf = append(o.buf, v[int32(k)].enc...) + } + return nil +} + +func size_map(p *Properties, base structPointer) int { + v := structPointer_ExtMap(base, p.field) + return extensionsMapSize(*v) +} + +func size_exts(p *Properties, base structPointer) int { + v := structPointer_Extensions(base, p.field) + return extensionsSize(v) +} + +// Encode a map field. +func (o *Buffer) enc_new_map(p *Properties, base structPointer) error { + var state errorState // XXX: or do we need to plumb this through? + + /* + A map defined as + map map_field = N; + is encoded in the same way as + message MapFieldEntry { + key_type key = 1; + value_type value = 2; + } + repeated MapFieldEntry map_field = N; + */ + + v := structPointer_NewAt(base, p.field, p.mtype).Elem() // map[K]V + if v.Len() == 0 { + return nil + } + + keycopy, valcopy, keybase, valbase := mapEncodeScratch(p.mtype) + + enc := func() error { + if err := p.mkeyprop.enc(o, p.mkeyprop, keybase); err != nil { + return err + } + if err := p.mvalprop.enc(o, p.mvalprop, valbase); err != nil && err != ErrNil { + return err + } + return nil + } + + // Don't sort map keys. It is not required by the spec, and C++ doesn't do it. + for _, key := range v.MapKeys() { + val := v.MapIndex(key) + + keycopy.Set(key) + valcopy.Set(val) + + o.buf = append(o.buf, p.tagcode...) + if err := o.enc_len_thing(enc, &state); err != nil { + return err + } + } + return nil +} + +func size_new_map(p *Properties, base structPointer) int { + v := structPointer_NewAt(base, p.field, p.mtype).Elem() // map[K]V + + keycopy, valcopy, keybase, valbase := mapEncodeScratch(p.mtype) + + n := 0 + for _, key := range v.MapKeys() { + val := v.MapIndex(key) + keycopy.Set(key) + valcopy.Set(val) + + // Tag codes for key and val are the responsibility of the sub-sizer. + keysize := p.mkeyprop.size(p.mkeyprop, keybase) + valsize := p.mvalprop.size(p.mvalprop, valbase) + entry := keysize + valsize + // Add on tag code and length of map entry itself. + n += len(p.tagcode) + sizeVarint(uint64(entry)) + entry + } + return n +} + +// mapEncodeScratch returns a new reflect.Value matching the map's value type, +// and a structPointer suitable for passing to an encoder or sizer. +func mapEncodeScratch(mapType reflect.Type) (keycopy, valcopy reflect.Value, keybase, valbase structPointer) { + // Prepare addressable doubly-indirect placeholders for the key and value types. + // This is needed because the element-type encoders expect **T, but the map iteration produces T. + + keycopy = reflect.New(mapType.Key()).Elem() // addressable K + keyptr := reflect.New(reflect.PtrTo(keycopy.Type())).Elem() // addressable *K + keyptr.Set(keycopy.Addr()) // + keybase = toStructPointer(keyptr.Addr()) // **K + + // Value types are more varied and require special handling. + switch mapType.Elem().Kind() { + case reflect.Slice: + // []byte + var dummy []byte + valcopy = reflect.ValueOf(&dummy).Elem() // addressable []byte + valbase = toStructPointer(valcopy.Addr()) + case reflect.Ptr: + // message; the generated field type is map[K]*Msg (so V is *Msg), + // so we only need one level of indirection. + valcopy = reflect.New(mapType.Elem()).Elem() // addressable V + valbase = toStructPointer(valcopy.Addr()) + default: + // everything else + valcopy = reflect.New(mapType.Elem()).Elem() // addressable V + valptr := reflect.New(reflect.PtrTo(valcopy.Type())).Elem() // addressable *V + valptr.Set(valcopy.Addr()) // + valbase = toStructPointer(valptr.Addr()) // **V + } + return +} + +// Encode a struct. +func (o *Buffer) enc_struct(prop *StructProperties, base structPointer) error { + var state errorState + // Encode fields in tag order so that decoders may use optimizations + // that depend on the ordering. + // https://developers.google.com/protocol-buffers/docs/encoding#order + for _, i := range prop.order { + p := prop.Prop[i] + if p.enc != nil { + err := p.enc(o, p, base) + if err != nil { + if err == ErrNil { + if p.Required && state.err == nil { + state.err = &RequiredNotSetError{p.Name} + } + } else if err == errRepeatedHasNil { + // Give more context to nil values in repeated fields. + return errors.New("repeated field " + p.OrigName + " has nil element") + } else if !state.shouldContinue(err, p) { + return err + } + } + if len(o.buf) > maxMarshalSize { + return ErrTooLarge + } + } + } + + // Do oneof fields. + if prop.oneofMarshaler != nil { + m := structPointer_Interface(base, prop.stype).(Message) + if err := prop.oneofMarshaler(m, o); err == ErrNil { + return errOneofHasNil + } else if err != nil { + return err + } + } + + // Add unrecognized fields at the end. + if prop.unrecField.IsValid() { + v := *structPointer_Bytes(base, prop.unrecField) + if len(o.buf)+len(v) > maxMarshalSize { + return ErrTooLarge + } + if len(v) > 0 { + o.buf = append(o.buf, v...) + } + } + + return state.err +} + +func size_struct(prop *StructProperties, base structPointer) (n int) { + for _, i := range prop.order { + p := prop.Prop[i] + if p.size != nil { + n += p.size(p, base) + } + } + + // Add unrecognized fields at the end. + if prop.unrecField.IsValid() { + v := *structPointer_Bytes(base, prop.unrecField) + n += len(v) + } + + // Factor in any oneof fields. + if prop.oneofSizer != nil { + m := structPointer_Interface(base, prop.stype).(Message) + n += prop.oneofSizer(m) + } + + return +} + +var zeroes [20]byte // longer than any conceivable sizeVarint + +// Encode a struct, preceded by its encoded length (as a varint). +func (o *Buffer) enc_len_struct(prop *StructProperties, base structPointer, state *errorState) error { + return o.enc_len_thing(func() error { return o.enc_struct(prop, base) }, state) +} + +// Encode something, preceded by its encoded length (as a varint). +func (o *Buffer) enc_len_thing(enc func() error, state *errorState) error { + iLen := len(o.buf) + o.buf = append(o.buf, 0, 0, 0, 0) // reserve four bytes for length + iMsg := len(o.buf) + err := enc() + if err != nil && !state.shouldContinue(err, nil) { + return err + } + lMsg := len(o.buf) - iMsg + lLen := sizeVarint(uint64(lMsg)) + switch x := lLen - (iMsg - iLen); { + case x > 0: // actual length is x bytes larger than the space we reserved + // Move msg x bytes right. + o.buf = append(o.buf, zeroes[:x]...) + copy(o.buf[iMsg+x:], o.buf[iMsg:iMsg+lMsg]) + case x < 0: // actual length is x bytes smaller than the space we reserved + // Move msg x bytes left. + copy(o.buf[iMsg+x:], o.buf[iMsg:iMsg+lMsg]) + o.buf = o.buf[:len(o.buf)+x] // x is negative + } + // Encode the length in the reserved space. + o.buf = o.buf[:iLen] + o.EncodeVarint(uint64(lMsg)) + o.buf = o.buf[:len(o.buf)+lMsg] + return state.err +} + +// errorState maintains the first error that occurs and updates that error +// with additional context. +type errorState struct { + err error +} + +// shouldContinue reports whether encoding should continue upon encountering the +// given error. If the error is RequiredNotSetError, shouldContinue returns true +// and, if this is the first appearance of that error, remembers it for future +// reporting. +// +// If prop is not nil, it may update any error with additional context about the +// field with the error. +func (s *errorState) shouldContinue(err error, prop *Properties) bool { + // Ignore unset required fields. + reqNotSet, ok := err.(*RequiredNotSetError) + if !ok { + return false + } + if s.err == nil { + if prop != nil { + err = &RequiredNotSetError{prop.Name + "." + reqNotSet.field} + } + s.err = err + } + return true +} diff --git a/vendor/github.com/gogo/protobuf/proto/encode_gogo.go b/vendor/github.com/gogo/protobuf/proto/encode_gogo.go new file mode 100644 index 000000000..32111b7f4 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/encode_gogo.go @@ -0,0 +1,350 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// http://github.com/golang/protobuf/ +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "reflect" +) + +func NewRequiredNotSetError(field string) *RequiredNotSetError { + return &RequiredNotSetError{field} +} + +type Sizer interface { + Size() int +} + +func (o *Buffer) enc_ext_slice_byte(p *Properties, base structPointer) error { + s := *structPointer_Bytes(base, p.field) + if s == nil { + return ErrNil + } + o.buf = append(o.buf, s...) + return nil +} + +func size_ext_slice_byte(p *Properties, base structPointer) (n int) { + s := *structPointer_Bytes(base, p.field) + if s == nil { + return 0 + } + n += len(s) + return +} + +// Encode a reference to bool pointer. +func (o *Buffer) enc_ref_bool(p *Properties, base structPointer) error { + v := *structPointer_BoolVal(base, p.field) + x := 0 + if v { + x = 1 + } + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, uint64(x)) + return nil +} + +func size_ref_bool(p *Properties, base structPointer) int { + return len(p.tagcode) + 1 // each bool takes exactly one byte +} + +// Encode a reference to int32 pointer. +func (o *Buffer) enc_ref_int32(p *Properties, base structPointer) error { + v := structPointer_Word32Val(base, p.field) + x := int32(word32Val_Get(v)) + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, uint64(x)) + return nil +} + +func size_ref_int32(p *Properties, base structPointer) (n int) { + v := structPointer_Word32Val(base, p.field) + x := int32(word32Val_Get(v)) + n += len(p.tagcode) + n += p.valSize(uint64(x)) + return +} + +func (o *Buffer) enc_ref_uint32(p *Properties, base structPointer) error { + v := structPointer_Word32Val(base, p.field) + x := word32Val_Get(v) + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, uint64(x)) + return nil +} + +func size_ref_uint32(p *Properties, base structPointer) (n int) { + v := structPointer_Word32Val(base, p.field) + x := word32Val_Get(v) + n += len(p.tagcode) + n += p.valSize(uint64(x)) + return +} + +// Encode a reference to an int64 pointer. +func (o *Buffer) enc_ref_int64(p *Properties, base structPointer) error { + v := structPointer_Word64Val(base, p.field) + x := word64Val_Get(v) + o.buf = append(o.buf, p.tagcode...) + p.valEnc(o, x) + return nil +} + +func size_ref_int64(p *Properties, base structPointer) (n int) { + v := structPointer_Word64Val(base, p.field) + x := word64Val_Get(v) + n += len(p.tagcode) + n += p.valSize(x) + return +} + +// Encode a reference to a string pointer. +func (o *Buffer) enc_ref_string(p *Properties, base structPointer) error { + v := *structPointer_StringVal(base, p.field) + o.buf = append(o.buf, p.tagcode...) + o.EncodeStringBytes(v) + return nil +} + +func size_ref_string(p *Properties, base structPointer) (n int) { + v := *structPointer_StringVal(base, p.field) + n += len(p.tagcode) + n += sizeStringBytes(v) + return +} + +// Encode a reference to a message struct. +func (o *Buffer) enc_ref_struct_message(p *Properties, base structPointer) error { + var state errorState + structp := structPointer_GetRefStructPointer(base, p.field) + if structPointer_IsNil(structp) { + return ErrNil + } + + // Can the object marshal itself? + if p.isMarshaler { + m := structPointer_Interface(structp, p.stype).(Marshaler) + data, err := m.Marshal() + if err != nil && !state.shouldContinue(err, nil) { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + return nil + } + + o.buf = append(o.buf, p.tagcode...) + return o.enc_len_struct(p.sprop, structp, &state) +} + +//TODO this is only copied, please fix this +func size_ref_struct_message(p *Properties, base structPointer) int { + structp := structPointer_GetRefStructPointer(base, p.field) + if structPointer_IsNil(structp) { + return 0 + } + + // Can the object marshal itself? + if p.isMarshaler { + m := structPointer_Interface(structp, p.stype).(Marshaler) + data, _ := m.Marshal() + n0 := len(p.tagcode) + n1 := sizeRawBytes(data) + return n0 + n1 + } + + n0 := len(p.tagcode) + n1 := size_struct(p.sprop, structp) + n2 := sizeVarint(uint64(n1)) // size of encoded length + return n0 + n1 + n2 +} + +// Encode a slice of references to message struct pointers ([]struct). +func (o *Buffer) enc_slice_ref_struct_message(p *Properties, base structPointer) error { + var state errorState + ss := structPointer_StructRefSlice(base, p.field, p.stype.Size()) + l := ss.Len() + for i := 0; i < l; i++ { + structp := ss.Index(i) + if structPointer_IsNil(structp) { + return errRepeatedHasNil + } + + // Can the object marshal itself? + if p.isMarshaler { + m := structPointer_Interface(structp, p.stype).(Marshaler) + data, err := m.Marshal() + if err != nil && !state.shouldContinue(err, nil) { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + continue + } + + o.buf = append(o.buf, p.tagcode...) + err := o.enc_len_struct(p.sprop, structp, &state) + if err != nil && !state.shouldContinue(err, nil) { + if err == ErrNil { + return errRepeatedHasNil + } + return err + } + + } + return state.err +} + +//TODO this is only copied, please fix this +func size_slice_ref_struct_message(p *Properties, base structPointer) (n int) { + ss := structPointer_StructRefSlice(base, p.field, p.stype.Size()) + l := ss.Len() + n += l * len(p.tagcode) + for i := 0; i < l; i++ { + structp := ss.Index(i) + if structPointer_IsNil(structp) { + return // return the size up to this point + } + + // Can the object marshal itself? + if p.isMarshaler { + m := structPointer_Interface(structp, p.stype).(Marshaler) + data, _ := m.Marshal() + n += len(p.tagcode) + n += sizeRawBytes(data) + continue + } + + n0 := size_struct(p.sprop, structp) + n1 := sizeVarint(uint64(n0)) // size of encoded length + n += n0 + n1 + } + return +} + +func (o *Buffer) enc_custom_bytes(p *Properties, base structPointer) error { + i := structPointer_InterfaceRef(base, p.field, p.ctype) + if i == nil { + return ErrNil + } + custom := i.(Marshaler) + data, err := custom.Marshal() + if err != nil { + return err + } + if data == nil { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + return nil +} + +func size_custom_bytes(p *Properties, base structPointer) (n int) { + n += len(p.tagcode) + i := structPointer_InterfaceRef(base, p.field, p.ctype) + if i == nil { + return 0 + } + custom := i.(Marshaler) + data, _ := custom.Marshal() + n += sizeRawBytes(data) + return +} + +func (o *Buffer) enc_custom_ref_bytes(p *Properties, base structPointer) error { + custom := structPointer_InterfaceAt(base, p.field, p.ctype).(Marshaler) + data, err := custom.Marshal() + if err != nil { + return err + } + if data == nil { + return ErrNil + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + return nil +} + +func size_custom_ref_bytes(p *Properties, base structPointer) (n int) { + n += len(p.tagcode) + i := structPointer_InterfaceAt(base, p.field, p.ctype) + if i == nil { + return 0 + } + custom := i.(Marshaler) + data, _ := custom.Marshal() + n += sizeRawBytes(data) + return +} + +func (o *Buffer) enc_custom_slice_bytes(p *Properties, base structPointer) error { + inter := structPointer_InterfaceRef(base, p.field, p.ctype) + if inter == nil { + return ErrNil + } + slice := reflect.ValueOf(inter) + l := slice.Len() + for i := 0; i < l; i++ { + v := slice.Index(i) + custom := v.Interface().(Marshaler) + data, err := custom.Marshal() + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + } + return nil +} + +func size_custom_slice_bytes(p *Properties, base structPointer) (n int) { + inter := structPointer_InterfaceRef(base, p.field, p.ctype) + if inter == nil { + return 0 + } + slice := reflect.ValueOf(inter) + l := slice.Len() + n += l * len(p.tagcode) + for i := 0; i < l; i++ { + v := slice.Index(i) + custom := v.Interface().(Marshaler) + data, _ := custom.Marshal() + n += sizeRawBytes(data) + } + return +} diff --git a/vendor/github.com/gogo/protobuf/proto/equal.go b/vendor/github.com/gogo/protobuf/proto/equal.go new file mode 100644 index 000000000..2ed1cf596 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/equal.go @@ -0,0 +1,300 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2011 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Protocol buffer comparison. + +package proto + +import ( + "bytes" + "log" + "reflect" + "strings" +) + +/* +Equal returns true iff protocol buffers a and b are equal. +The arguments must both be pointers to protocol buffer structs. + +Equality is defined in this way: + - Two messages are equal iff they are the same type, + corresponding fields are equal, unknown field sets + are equal, and extensions sets are equal. + - Two set scalar fields are equal iff their values are equal. + If the fields are of a floating-point type, remember that + NaN != x for all x, including NaN. If the message is defined + in a proto3 .proto file, fields are not "set"; specifically, + zero length proto3 "bytes" fields are equal (nil == {}). + - Two repeated fields are equal iff their lengths are the same, + and their corresponding elements are equal. Note a "bytes" field, + although represented by []byte, is not a repeated field and the + rule for the scalar fields described above applies. + - Two unset fields are equal. + - Two unknown field sets are equal if their current + encoded state is equal. + - Two extension sets are equal iff they have corresponding + elements that are pairwise equal. + - Two map fields are equal iff their lengths are the same, + and they contain the same set of elements. Zero-length map + fields are equal. + - Every other combination of things are not equal. + +The return value is undefined if a and b are not protocol buffers. +*/ +func Equal(a, b Message) bool { + if a == nil || b == nil { + return a == b + } + v1, v2 := reflect.ValueOf(a), reflect.ValueOf(b) + if v1.Type() != v2.Type() { + return false + } + if v1.Kind() == reflect.Ptr { + if v1.IsNil() { + return v2.IsNil() + } + if v2.IsNil() { + return false + } + v1, v2 = v1.Elem(), v2.Elem() + } + if v1.Kind() != reflect.Struct { + return false + } + return equalStruct(v1, v2) +} + +// v1 and v2 are known to have the same type. +func equalStruct(v1, v2 reflect.Value) bool { + sprop := GetProperties(v1.Type()) + for i := 0; i < v1.NumField(); i++ { + f := v1.Type().Field(i) + if strings.HasPrefix(f.Name, "XXX_") { + continue + } + f1, f2 := v1.Field(i), v2.Field(i) + if f.Type.Kind() == reflect.Ptr { + if n1, n2 := f1.IsNil(), f2.IsNil(); n1 && n2 { + // both unset + continue + } else if n1 != n2 { + // set/unset mismatch + return false + } + b1, ok := f1.Interface().(raw) + if ok { + b2 := f2.Interface().(raw) + // RawMessage + if !bytes.Equal(b1.Bytes(), b2.Bytes()) { + return false + } + continue + } + f1, f2 = f1.Elem(), f2.Elem() + } + if !equalAny(f1, f2, sprop.Prop[i]) { + return false + } + } + + if em1 := v1.FieldByName("XXX_InternalExtensions"); em1.IsValid() { + em2 := v2.FieldByName("XXX_InternalExtensions") + if !equalExtensions(v1.Type(), em1.Interface().(XXX_InternalExtensions), em2.Interface().(XXX_InternalExtensions)) { + return false + } + } + + if em1 := v1.FieldByName("XXX_extensions"); em1.IsValid() { + em2 := v2.FieldByName("XXX_extensions") + if !equalExtMap(v1.Type(), em1.Interface().(map[int32]Extension), em2.Interface().(map[int32]Extension)) { + return false + } + } + + uf := v1.FieldByName("XXX_unrecognized") + if !uf.IsValid() { + return true + } + + u1 := uf.Bytes() + u2 := v2.FieldByName("XXX_unrecognized").Bytes() + if !bytes.Equal(u1, u2) { + return false + } + + return true +} + +// v1 and v2 are known to have the same type. +// prop may be nil. +func equalAny(v1, v2 reflect.Value, prop *Properties) bool { + if v1.Type() == protoMessageType { + m1, _ := v1.Interface().(Message) + m2, _ := v2.Interface().(Message) + return Equal(m1, m2) + } + switch v1.Kind() { + case reflect.Bool: + return v1.Bool() == v2.Bool() + case reflect.Float32, reflect.Float64: + return v1.Float() == v2.Float() + case reflect.Int32, reflect.Int64: + return v1.Int() == v2.Int() + case reflect.Interface: + // Probably a oneof field; compare the inner values. + n1, n2 := v1.IsNil(), v2.IsNil() + if n1 || n2 { + return n1 == n2 + } + e1, e2 := v1.Elem(), v2.Elem() + if e1.Type() != e2.Type() { + return false + } + return equalAny(e1, e2, nil) + case reflect.Map: + if v1.Len() != v2.Len() { + return false + } + for _, key := range v1.MapKeys() { + val2 := v2.MapIndex(key) + if !val2.IsValid() { + // This key was not found in the second map. + return false + } + if !equalAny(v1.MapIndex(key), val2, nil) { + return false + } + } + return true + case reflect.Ptr: + // Maps may have nil values in them, so check for nil. + if v1.IsNil() && v2.IsNil() { + return true + } + if v1.IsNil() != v2.IsNil() { + return false + } + return equalAny(v1.Elem(), v2.Elem(), prop) + case reflect.Slice: + if v1.Type().Elem().Kind() == reflect.Uint8 { + // short circuit: []byte + + // Edge case: if this is in a proto3 message, a zero length + // bytes field is considered the zero value. + if prop != nil && prop.proto3 && v1.Len() == 0 && v2.Len() == 0 { + return true + } + if v1.IsNil() != v2.IsNil() { + return false + } + return bytes.Equal(v1.Interface().([]byte), v2.Interface().([]byte)) + } + + if v1.Len() != v2.Len() { + return false + } + for i := 0; i < v1.Len(); i++ { + if !equalAny(v1.Index(i), v2.Index(i), prop) { + return false + } + } + return true + case reflect.String: + return v1.Interface().(string) == v2.Interface().(string) + case reflect.Struct: + return equalStruct(v1, v2) + case reflect.Uint32, reflect.Uint64: + return v1.Uint() == v2.Uint() + } + + // unknown type, so not a protocol buffer + log.Printf("proto: don't know how to compare %v", v1) + return false +} + +// base is the struct type that the extensions are based on. +// x1 and x2 are InternalExtensions. +func equalExtensions(base reflect.Type, x1, x2 XXX_InternalExtensions) bool { + em1, _ := x1.extensionsRead() + em2, _ := x2.extensionsRead() + return equalExtMap(base, em1, em2) +} + +func equalExtMap(base reflect.Type, em1, em2 map[int32]Extension) bool { + if len(em1) != len(em2) { + return false + } + + for extNum, e1 := range em1 { + e2, ok := em2[extNum] + if !ok { + return false + } + + m1, m2 := e1.value, e2.value + + if m1 != nil && m2 != nil { + // Both are unencoded. + if !equalAny(reflect.ValueOf(m1), reflect.ValueOf(m2), nil) { + return false + } + continue + } + + // At least one is encoded. To do a semantically correct comparison + // we need to unmarshal them first. + var desc *ExtensionDesc + if m := extensionMaps[base]; m != nil { + desc = m[extNum] + } + if desc == nil { + log.Printf("proto: don't know how to compare extension %d of %v", extNum, base) + continue + } + var err error + if m1 == nil { + m1, err = decodeExtension(e1.enc, desc) + } + if m2 == nil && err == nil { + m2, err = decodeExtension(e2.enc, desc) + } + if err != nil { + // The encoded form is invalid. + log.Printf("proto: badly encoded extension %d of %v: %v", extNum, base, err) + return false + } + if !equalAny(reflect.ValueOf(m1), reflect.ValueOf(m2), nil) { + return false + } + } + + return true +} diff --git a/vendor/github.com/gogo/protobuf/proto/extensions.go b/vendor/github.com/gogo/protobuf/proto/extensions.go new file mode 100644 index 000000000..0dfcb538e --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/extensions.go @@ -0,0 +1,693 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Types and routines for supporting protocol buffer extensions. + */ + +import ( + "errors" + "fmt" + "reflect" + "strconv" + "sync" +) + +// ErrMissingExtension is the error returned by GetExtension if the named extension is not in the message. +var ErrMissingExtension = errors.New("proto: missing extension") + +// ExtensionRange represents a range of message extensions for a protocol buffer. +// Used in code generated by the protocol compiler. +type ExtensionRange struct { + Start, End int32 // both inclusive +} + +// extendableProto is an interface implemented by any protocol buffer generated by the current +// proto compiler that may be extended. +type extendableProto interface { + Message + ExtensionRangeArray() []ExtensionRange + extensionsWrite() map[int32]Extension + extensionsRead() (map[int32]Extension, sync.Locker) +} + +// extendableProtoV1 is an interface implemented by a protocol buffer generated by the previous +// version of the proto compiler that may be extended. +type extendableProtoV1 interface { + Message + ExtensionRangeArray() []ExtensionRange + ExtensionMap() map[int32]Extension +} + +type extensionsBytes interface { + Message + ExtensionRangeArray() []ExtensionRange + GetExtensions() *[]byte +} + +// extensionAdapter is a wrapper around extendableProtoV1 that implements extendableProto. +type extensionAdapter struct { + extendableProtoV1 +} + +func (e extensionAdapter) extensionsWrite() map[int32]Extension { + return e.ExtensionMap() +} + +func (e extensionAdapter) extensionsRead() (map[int32]Extension, sync.Locker) { + return e.ExtensionMap(), notLocker{} +} + +// notLocker is a sync.Locker whose Lock and Unlock methods are nops. +type notLocker struct{} + +func (n notLocker) Lock() {} +func (n notLocker) Unlock() {} + +// extendable returns the extendableProto interface for the given generated proto message. +// If the proto message has the old extension format, it returns a wrapper that implements +// the extendableProto interface. +func extendable(p interface{}) (extendableProto, bool) { + if ep, ok := p.(extendableProto); ok { + return ep, ok + } + if ep, ok := p.(extendableProtoV1); ok { + return extensionAdapter{ep}, ok + } + return nil, false +} + +// XXX_InternalExtensions is an internal representation of proto extensions. +// +// Each generated message struct type embeds an anonymous XXX_InternalExtensions field, +// thus gaining the unexported 'extensions' method, which can be called only from the proto package. +// +// The methods of XXX_InternalExtensions are not concurrency safe in general, +// but calls to logically read-only methods such as has and get may be executed concurrently. +type XXX_InternalExtensions struct { + // The struct must be indirect so that if a user inadvertently copies a + // generated message and its embedded XXX_InternalExtensions, they + // avoid the mayhem of a copied mutex. + // + // The mutex serializes all logically read-only operations to p.extensionMap. + // It is up to the client to ensure that write operations to p.extensionMap are + // mutually exclusive with other accesses. + p *struct { + mu sync.Mutex + extensionMap map[int32]Extension + } +} + +// extensionsWrite returns the extension map, creating it on first use. +func (e *XXX_InternalExtensions) extensionsWrite() map[int32]Extension { + if e.p == nil { + e.p = new(struct { + mu sync.Mutex + extensionMap map[int32]Extension + }) + e.p.extensionMap = make(map[int32]Extension) + } + return e.p.extensionMap +} + +// extensionsRead returns the extensions map for read-only use. It may be nil. +// The caller must hold the returned mutex's lock when accessing Elements within the map. +func (e *XXX_InternalExtensions) extensionsRead() (map[int32]Extension, sync.Locker) { + if e.p == nil { + return nil, nil + } + return e.p.extensionMap, &e.p.mu +} + +type extensionRange interface { + Message + ExtensionRangeArray() []ExtensionRange +} + +var extendableProtoType = reflect.TypeOf((*extendableProto)(nil)).Elem() +var extendableProtoV1Type = reflect.TypeOf((*extendableProtoV1)(nil)).Elem() +var extendableBytesType = reflect.TypeOf((*extensionsBytes)(nil)).Elem() +var extensionRangeType = reflect.TypeOf((*extensionRange)(nil)).Elem() + +// ExtensionDesc represents an extension specification. +// Used in generated code from the protocol compiler. +type ExtensionDesc struct { + ExtendedType Message // nil pointer to the type that is being extended + ExtensionType interface{} // nil pointer to the extension type + Field int32 // field number + Name string // fully-qualified name of extension, for text formatting + Tag string // protobuf tag style + Filename string // name of the file in which the extension is defined +} + +func (ed *ExtensionDesc) repeated() bool { + t := reflect.TypeOf(ed.ExtensionType) + return t.Kind() == reflect.Slice && t.Elem().Kind() != reflect.Uint8 +} + +// Extension represents an extension in a message. +type Extension struct { + // When an extension is stored in a message using SetExtension + // only desc and value are set. When the message is marshaled + // enc will be set to the encoded form of the message. + // + // When a message is unmarshaled and contains extensions, each + // extension will have only enc set. When such an extension is + // accessed using GetExtension (or GetExtensions) desc and value + // will be set. + desc *ExtensionDesc + value interface{} + enc []byte +} + +// SetRawExtension is for testing only. +func SetRawExtension(base Message, id int32, b []byte) { + if ebase, ok := base.(extensionsBytes); ok { + clearExtension(base, id) + ext := ebase.GetExtensions() + *ext = append(*ext, b...) + return + } + epb, ok := extendable(base) + if !ok { + return + } + extmap := epb.extensionsWrite() + extmap[id] = Extension{enc: b} +} + +// isExtensionField returns true iff the given field number is in an extension range. +func isExtensionField(pb extensionRange, field int32) bool { + for _, er := range pb.ExtensionRangeArray() { + if er.Start <= field && field <= er.End { + return true + } + } + return false +} + +// checkExtensionTypes checks that the given extension is valid for pb. +func checkExtensionTypes(pb extendableProto, extension *ExtensionDesc) error { + var pbi interface{} = pb + // Check the extended type. + if ea, ok := pbi.(extensionAdapter); ok { + pbi = ea.extendableProtoV1 + } + if a, b := reflect.TypeOf(pbi), reflect.TypeOf(extension.ExtendedType); a != b { + return errors.New("proto: bad extended type; " + b.String() + " does not extend " + a.String()) + } + // Check the range. + if !isExtensionField(pb, extension.Field) { + return errors.New("proto: bad extension number; not in declared ranges") + } + return nil +} + +// extPropKey is sufficient to uniquely identify an extension. +type extPropKey struct { + base reflect.Type + field int32 +} + +var extProp = struct { + sync.RWMutex + m map[extPropKey]*Properties +}{ + m: make(map[extPropKey]*Properties), +} + +func extensionProperties(ed *ExtensionDesc) *Properties { + key := extPropKey{base: reflect.TypeOf(ed.ExtendedType), field: ed.Field} + + extProp.RLock() + if prop, ok := extProp.m[key]; ok { + extProp.RUnlock() + return prop + } + extProp.RUnlock() + + extProp.Lock() + defer extProp.Unlock() + // Check again. + if prop, ok := extProp.m[key]; ok { + return prop + } + + prop := new(Properties) + prop.Init(reflect.TypeOf(ed.ExtensionType), "unknown_name", ed.Tag, nil) + extProp.m[key] = prop + return prop +} + +// encode encodes any unmarshaled (unencoded) extensions in e. +func encodeExtensions(e *XXX_InternalExtensions) error { + m, mu := e.extensionsRead() + if m == nil { + return nil // fast path + } + mu.Lock() + defer mu.Unlock() + return encodeExtensionsMap(m) +} + +// encode encodes any unmarshaled (unencoded) extensions in e. +func encodeExtensionsMap(m map[int32]Extension) error { + for k, e := range m { + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + et := reflect.TypeOf(e.desc.ExtensionType) + props := extensionProperties(e.desc) + + p := NewBuffer(nil) + // If e.value has type T, the encoder expects a *struct{ X T }. + // Pass a *T with a zero field and hope it all works out. + x := reflect.New(et) + x.Elem().Set(reflect.ValueOf(e.value)) + if err := props.enc(p, props, toStructPointer(x)); err != nil { + return err + } + e.enc = p.buf + m[k] = e + } + return nil +} + +func extensionsSize(e *XXX_InternalExtensions) (n int) { + m, mu := e.extensionsRead() + if m == nil { + return 0 + } + mu.Lock() + defer mu.Unlock() + return extensionsMapSize(m) +} + +func extensionsMapSize(m map[int32]Extension) (n int) { + for _, e := range m { + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + n += len(e.enc) + continue + } + + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + et := reflect.TypeOf(e.desc.ExtensionType) + props := extensionProperties(e.desc) + + // If e.value has type T, the encoder expects a *struct{ X T }. + // Pass a *T with a zero field and hope it all works out. + x := reflect.New(et) + x.Elem().Set(reflect.ValueOf(e.value)) + n += props.size(props, toStructPointer(x)) + } + return +} + +// HasExtension returns whether the given extension is present in pb. +func HasExtension(pb Message, extension *ExtensionDesc) bool { + if epb, doki := pb.(extensionsBytes); doki { + ext := epb.GetExtensions() + buf := *ext + o := 0 + for o < len(buf) { + tag, n := DecodeVarint(buf[o:]) + fieldNum := int32(tag >> 3) + if int32(fieldNum) == extension.Field { + return true + } + wireType := int(tag & 0x7) + o += n + l, err := size(buf[o:], wireType) + if err != nil { + return false + } + o += l + } + return false + } + // TODO: Check types, field numbers, etc.? + epb, ok := extendable(pb) + if !ok { + return false + } + extmap, mu := epb.extensionsRead() + if extmap == nil { + return false + } + mu.Lock() + _, ok = extmap[extension.Field] + mu.Unlock() + return ok +} + +func deleteExtension(pb extensionsBytes, theFieldNum int32, offset int) int { + ext := pb.GetExtensions() + for offset < len(*ext) { + tag, n1 := DecodeVarint((*ext)[offset:]) + fieldNum := int32(tag >> 3) + wireType := int(tag & 0x7) + n2, err := size((*ext)[offset+n1:], wireType) + if err != nil { + panic(err) + } + newOffset := offset + n1 + n2 + if fieldNum == theFieldNum { + *ext = append((*ext)[:offset], (*ext)[newOffset:]...) + return offset + } + offset = newOffset + } + return -1 +} + +// ClearExtension removes the given extension from pb. +func ClearExtension(pb Message, extension *ExtensionDesc) { + clearExtension(pb, extension.Field) +} + +func clearExtension(pb Message, fieldNum int32) { + if epb, doki := pb.(extensionsBytes); doki { + offset := 0 + for offset != -1 { + offset = deleteExtension(epb, fieldNum, offset) + } + return + } + epb, ok := extendable(pb) + if !ok { + return + } + // TODO: Check types, field numbers, etc.? + extmap := epb.extensionsWrite() + delete(extmap, fieldNum) +} + +// GetExtension parses and returns the given extension of pb. +// If the extension is not present and has no default value it returns ErrMissingExtension. +func GetExtension(pb Message, extension *ExtensionDesc) (interface{}, error) { + if epb, doki := pb.(extensionsBytes); doki { + ext := epb.GetExtensions() + o := 0 + for o < len(*ext) { + tag, n := DecodeVarint((*ext)[o:]) + fieldNum := int32(tag >> 3) + wireType := int(tag & 0x7) + l, err := size((*ext)[o+n:], wireType) + if err != nil { + return nil, err + } + if int32(fieldNum) == extension.Field { + v, err := decodeExtension((*ext)[o:o+n+l], extension) + if err != nil { + return nil, err + } + return v, nil + } + o += n + l + } + return defaultExtensionValue(extension) + } + epb, ok := extendable(pb) + if !ok { + return nil, errors.New("proto: not an extendable proto") + } + if err := checkExtensionTypes(epb, extension); err != nil { + return nil, err + } + + emap, mu := epb.extensionsRead() + if emap == nil { + return defaultExtensionValue(extension) + } + mu.Lock() + defer mu.Unlock() + e, ok := emap[extension.Field] + if !ok { + // defaultExtensionValue returns the default value or + // ErrMissingExtension if there is no default. + return defaultExtensionValue(extension) + } + + if e.value != nil { + // Already decoded. Check the descriptor, though. + if e.desc != extension { + // This shouldn't happen. If it does, it means that + // GetExtension was called twice with two different + // descriptors with the same field number. + return nil, errors.New("proto: descriptor conflict") + } + return e.value, nil + } + + v, err := decodeExtension(e.enc, extension) + if err != nil { + return nil, err + } + + // Remember the decoded version and drop the encoded version. + // That way it is safe to mutate what we return. + e.value = v + e.desc = extension + e.enc = nil + emap[extension.Field] = e + return e.value, nil +} + +// defaultExtensionValue returns the default value for extension. +// If no default for an extension is defined ErrMissingExtension is returned. +func defaultExtensionValue(extension *ExtensionDesc) (interface{}, error) { + t := reflect.TypeOf(extension.ExtensionType) + props := extensionProperties(extension) + + sf, _, err := fieldDefault(t, props) + if err != nil { + return nil, err + } + + if sf == nil || sf.value == nil { + // There is no default value. + return nil, ErrMissingExtension + } + + if t.Kind() != reflect.Ptr { + // We do not need to return a Ptr, we can directly return sf.value. + return sf.value, nil + } + + // We need to return an interface{} that is a pointer to sf.value. + value := reflect.New(t).Elem() + value.Set(reflect.New(value.Type().Elem())) + if sf.kind == reflect.Int32 { + // We may have an int32 or an enum, but the underlying data is int32. + // Since we can't set an int32 into a non int32 reflect.value directly + // set it as a int32. + value.Elem().SetInt(int64(sf.value.(int32))) + } else { + value.Elem().Set(reflect.ValueOf(sf.value)) + } + return value.Interface(), nil +} + +// decodeExtension decodes an extension encoded in b. +func decodeExtension(b []byte, extension *ExtensionDesc) (interface{}, error) { + o := NewBuffer(b) + + t := reflect.TypeOf(extension.ExtensionType) + + props := extensionProperties(extension) + + // t is a pointer to a struct, pointer to basic type or a slice. + // Allocate a "field" to store the pointer/slice itself; the + // pointer/slice will be stored here. We pass + // the address of this field to props.dec. + // This passes a zero field and a *t and lets props.dec + // interpret it as a *struct{ x t }. + value := reflect.New(t).Elem() + + for { + // Discard wire type and field number varint. It isn't needed. + if _, err := o.DecodeVarint(); err != nil { + return nil, err + } + + if err := props.dec(o, props, toStructPointer(value.Addr())); err != nil { + return nil, err + } + + if o.index >= len(o.buf) { + break + } + } + return value.Interface(), nil +} + +// GetExtensions returns a slice of the extensions present in pb that are also listed in es. +// The returned slice has the same length as es; missing extensions will appear as nil elements. +func GetExtensions(pb Message, es []*ExtensionDesc) (extensions []interface{}, err error) { + extensions = make([]interface{}, len(es)) + for i, e := range es { + extensions[i], err = GetExtension(pb, e) + if err == ErrMissingExtension { + err = nil + } + if err != nil { + return + } + } + return +} + +// ExtensionDescs returns a new slice containing pb's extension descriptors, in undefined order. +// For non-registered extensions, ExtensionDescs returns an incomplete descriptor containing +// just the Field field, which defines the extension's field number. +func ExtensionDescs(pb Message) ([]*ExtensionDesc, error) { + epb, ok := extendable(pb) + if !ok { + return nil, fmt.Errorf("proto: %T is not an extendable proto.Message", pb) + } + registeredExtensions := RegisteredExtensions(pb) + + emap, mu := epb.extensionsRead() + if emap == nil { + return nil, nil + } + mu.Lock() + defer mu.Unlock() + extensions := make([]*ExtensionDesc, 0, len(emap)) + for extid, e := range emap { + desc := e.desc + if desc == nil { + desc = registeredExtensions[extid] + if desc == nil { + desc = &ExtensionDesc{Field: extid} + } + } + + extensions = append(extensions, desc) + } + return extensions, nil +} + +// SetExtension sets the specified extension of pb to the specified value. +func SetExtension(pb Message, extension *ExtensionDesc, value interface{}) error { + if epb, doki := pb.(extensionsBytes); doki { + ClearExtension(pb, extension) + ext := epb.GetExtensions() + et := reflect.TypeOf(extension.ExtensionType) + props := extensionProperties(extension) + p := NewBuffer(nil) + x := reflect.New(et) + x.Elem().Set(reflect.ValueOf(value)) + if err := props.enc(p, props, toStructPointer(x)); err != nil { + return err + } + *ext = append(*ext, p.buf...) + return nil + } + epb, ok := extendable(pb) + if !ok { + return errors.New("proto: not an extendable proto") + } + if err := checkExtensionTypes(epb, extension); err != nil { + return err + } + typ := reflect.TypeOf(extension.ExtensionType) + if typ != reflect.TypeOf(value) { + return errors.New("proto: bad extension value type") + } + // nil extension values need to be caught early, because the + // encoder can't distinguish an ErrNil due to a nil extension + // from an ErrNil due to a missing field. Extensions are + // always optional, so the encoder would just swallow the error + // and drop all the extensions from the encoded message. + if reflect.ValueOf(value).IsNil() { + return fmt.Errorf("proto: SetExtension called with nil value of type %T", value) + } + + extmap := epb.extensionsWrite() + extmap[extension.Field] = Extension{desc: extension, value: value} + return nil +} + +// ClearAllExtensions clears all extensions from pb. +func ClearAllExtensions(pb Message) { + if epb, doki := pb.(extensionsBytes); doki { + ext := epb.GetExtensions() + *ext = []byte{} + return + } + epb, ok := extendable(pb) + if !ok { + return + } + m := epb.extensionsWrite() + for k := range m { + delete(m, k) + } +} + +// A global registry of extensions. +// The generated code will register the generated descriptors by calling RegisterExtension. + +var extensionMaps = make(map[reflect.Type]map[int32]*ExtensionDesc) + +// RegisterExtension is called from the generated code. +func RegisterExtension(desc *ExtensionDesc) { + st := reflect.TypeOf(desc.ExtendedType).Elem() + m := extensionMaps[st] + if m == nil { + m = make(map[int32]*ExtensionDesc) + extensionMaps[st] = m + } + if _, ok := m[desc.Field]; ok { + panic("proto: duplicate extension registered: " + st.String() + " " + strconv.Itoa(int(desc.Field))) + } + m[desc.Field] = desc +} + +// RegisteredExtensions returns a map of the registered extensions of a +// protocol buffer struct, indexed by the extension number. +// The argument pb should be a nil pointer to the struct type. +func RegisteredExtensions(pb Message) map[int32]*ExtensionDesc { + return extensionMaps[reflect.TypeOf(pb).Elem()] +} diff --git a/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go b/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go new file mode 100644 index 000000000..ea6478f00 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/extensions_gogo.go @@ -0,0 +1,294 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "bytes" + "errors" + "fmt" + "reflect" + "sort" + "strings" + "sync" +) + +func GetBoolExtension(pb Message, extension *ExtensionDesc, ifnotset bool) bool { + if reflect.ValueOf(pb).IsNil() { + return ifnotset + } + value, err := GetExtension(pb, extension) + if err != nil { + return ifnotset + } + if value == nil { + return ifnotset + } + if value.(*bool) == nil { + return ifnotset + } + return *(value.(*bool)) +} + +func (this *Extension) Equal(that *Extension) bool { + return bytes.Equal(this.enc, that.enc) +} + +func (this *Extension) Compare(that *Extension) int { + return bytes.Compare(this.enc, that.enc) +} + +func SizeOfInternalExtension(m extendableProto) (n int) { + return SizeOfExtensionMap(m.extensionsWrite()) +} + +func SizeOfExtensionMap(m map[int32]Extension) (n int) { + return extensionsMapSize(m) +} + +type sortableMapElem struct { + field int32 + ext Extension +} + +func newSortableExtensionsFromMap(m map[int32]Extension) sortableExtensions { + s := make(sortableExtensions, 0, len(m)) + for k, v := range m { + s = append(s, &sortableMapElem{field: k, ext: v}) + } + return s +} + +type sortableExtensions []*sortableMapElem + +func (this sortableExtensions) Len() int { return len(this) } + +func (this sortableExtensions) Swap(i, j int) { this[i], this[j] = this[j], this[i] } + +func (this sortableExtensions) Less(i, j int) bool { return this[i].field < this[j].field } + +func (this sortableExtensions) String() string { + sort.Sort(this) + ss := make([]string, len(this)) + for i := range this { + ss[i] = fmt.Sprintf("%d: %v", this[i].field, this[i].ext) + } + return "map[" + strings.Join(ss, ",") + "]" +} + +func StringFromInternalExtension(m extendableProto) string { + return StringFromExtensionsMap(m.extensionsWrite()) +} + +func StringFromExtensionsMap(m map[int32]Extension) string { + return newSortableExtensionsFromMap(m).String() +} + +func StringFromExtensionsBytes(ext []byte) string { + m, err := BytesToExtensionsMap(ext) + if err != nil { + panic(err) + } + return StringFromExtensionsMap(m) +} + +func EncodeInternalExtension(m extendableProto, data []byte) (n int, err error) { + return EncodeExtensionMap(m.extensionsWrite(), data) +} + +func EncodeExtensionMap(m map[int32]Extension, data []byte) (n int, err error) { + if err := encodeExtensionsMap(m); err != nil { + return 0, err + } + keys := make([]int, 0, len(m)) + for k := range m { + keys = append(keys, int(k)) + } + sort.Ints(keys) + for _, k := range keys { + n += copy(data[n:], m[int32(k)].enc) + } + return n, nil +} + +func GetRawExtension(m map[int32]Extension, id int32) ([]byte, error) { + if m[id].value == nil || m[id].desc == nil { + return m[id].enc, nil + } + if err := encodeExtensionsMap(m); err != nil { + return nil, err + } + return m[id].enc, nil +} + +func size(buf []byte, wire int) (int, error) { + switch wire { + case WireVarint: + _, n := DecodeVarint(buf) + return n, nil + case WireFixed64: + return 8, nil + case WireBytes: + v, n := DecodeVarint(buf) + return int(v) + n, nil + case WireFixed32: + return 4, nil + case WireStartGroup: + offset := 0 + for { + u, n := DecodeVarint(buf[offset:]) + fwire := int(u & 0x7) + offset += n + if fwire == WireEndGroup { + return offset, nil + } + s, err := size(buf[offset:], wire) + if err != nil { + return 0, err + } + offset += s + } + } + return 0, fmt.Errorf("proto: can't get size for unknown wire type %d", wire) +} + +func BytesToExtensionsMap(buf []byte) (map[int32]Extension, error) { + m := make(map[int32]Extension) + i := 0 + for i < len(buf) { + tag, n := DecodeVarint(buf[i:]) + if n <= 0 { + return nil, fmt.Errorf("unable to decode varint") + } + fieldNum := int32(tag >> 3) + wireType := int(tag & 0x7) + l, err := size(buf[i+n:], wireType) + if err != nil { + return nil, err + } + end := i + int(l) + n + m[int32(fieldNum)] = Extension{enc: buf[i:end]} + i = end + } + return m, nil +} + +func NewExtension(e []byte) Extension { + ee := Extension{enc: make([]byte, len(e))} + copy(ee.enc, e) + return ee +} + +func AppendExtension(e Message, tag int32, buf []byte) { + if ee, eok := e.(extensionsBytes); eok { + ext := ee.GetExtensions() + *ext = append(*ext, buf...) + return + } + if ee, eok := e.(extendableProto); eok { + m := ee.extensionsWrite() + ext := m[int32(tag)] // may be missing + ext.enc = append(ext.enc, buf...) + m[int32(tag)] = ext + } +} + +func encodeExtension(e *Extension) error { + if e.value == nil || e.desc == nil { + // Extension is only in its encoded form. + return nil + } + // We don't skip extensions that have an encoded form set, + // because the extension value may have been mutated after + // the last time this function was called. + + et := reflect.TypeOf(e.desc.ExtensionType) + props := extensionProperties(e.desc) + + p := NewBuffer(nil) + // If e.value has type T, the encoder expects a *struct{ X T }. + // Pass a *T with a zero field and hope it all works out. + x := reflect.New(et) + x.Elem().Set(reflect.ValueOf(e.value)) + if err := props.enc(p, props, toStructPointer(x)); err != nil { + return err + } + e.enc = p.buf + return nil +} + +func (this Extension) GoString() string { + if this.enc == nil { + if err := encodeExtension(&this); err != nil { + panic(err) + } + } + return fmt.Sprintf("proto.NewExtension(%#v)", this.enc) +} + +func SetUnsafeExtension(pb Message, fieldNum int32, value interface{}) error { + typ := reflect.TypeOf(pb).Elem() + ext, ok := extensionMaps[typ] + if !ok { + return fmt.Errorf("proto: bad extended type; %s is not extendable", typ.String()) + } + desc, ok := ext[fieldNum] + if !ok { + return errors.New("proto: bad extension number; not in declared ranges") + } + return SetExtension(pb, desc, value) +} + +func GetUnsafeExtension(pb Message, fieldNum int32) (interface{}, error) { + typ := reflect.TypeOf(pb).Elem() + ext, ok := extensionMaps[typ] + if !ok { + return nil, fmt.Errorf("proto: bad extended type; %s is not extendable", typ.String()) + } + desc, ok := ext[fieldNum] + if !ok { + return nil, fmt.Errorf("unregistered field number %d", fieldNum) + } + return GetExtension(pb, desc) +} + +func NewUnsafeXXX_InternalExtensions(m map[int32]Extension) XXX_InternalExtensions { + x := &XXX_InternalExtensions{ + p: new(struct { + mu sync.Mutex + extensionMap map[int32]Extension + }), + } + x.p.extensionMap = m + return *x +} + +func GetUnsafeExtensionsMap(extendable Message) map[int32]Extension { + pb := extendable.(extendableProto) + return pb.extensionsWrite() +} diff --git a/vendor/github.com/gogo/protobuf/proto/lib.go b/vendor/github.com/gogo/protobuf/proto/lib.go new file mode 100644 index 000000000..7580bb45c --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/lib.go @@ -0,0 +1,898 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +/* +Package proto converts data structures to and from the wire format of +protocol buffers. It works in concert with the Go source code generated +for .proto files by the protocol compiler. + +A summary of the properties of the protocol buffer interface +for a protocol buffer variable v: + + - Names are turned from camel_case to CamelCase for export. + - There are no methods on v to set fields; just treat + them as structure fields. + - There are getters that return a field's value if set, + and return the field's default value if unset. + The getters work even if the receiver is a nil message. + - The zero value for a struct is its correct initialization state. + All desired fields must be set before marshaling. + - A Reset() method will restore a protobuf struct to its zero state. + - Non-repeated fields are pointers to the values; nil means unset. + That is, optional or required field int32 f becomes F *int32. + - Repeated fields are slices. + - Helper functions are available to aid the setting of fields. + msg.Foo = proto.String("hello") // set field + - Constants are defined to hold the default values of all fields that + have them. They have the form Default_StructName_FieldName. + Because the getter methods handle defaulted values, + direct use of these constants should be rare. + - Enums are given type names and maps from names to values. + Enum values are prefixed by the enclosing message's name, or by the + enum's type name if it is a top-level enum. Enum types have a String + method, and a Enum method to assist in message construction. + - Nested messages, groups and enums have type names prefixed with the name of + the surrounding message type. + - Extensions are given descriptor names that start with E_, + followed by an underscore-delimited list of the nested messages + that contain it (if any) followed by the CamelCased name of the + extension field itself. HasExtension, ClearExtension, GetExtension + and SetExtension are functions for manipulating extensions. + - Oneof field sets are given a single field in their message, + with distinguished wrapper types for each possible field value. + - Marshal and Unmarshal are functions to encode and decode the wire format. + +When the .proto file specifies `syntax="proto3"`, there are some differences: + + - Non-repeated fields of non-message type are values instead of pointers. + - Getters are only generated for message and oneof fields. + - Enum types do not get an Enum method. + +The simplest way to describe this is to see an example. +Given file test.proto, containing + + package example; + + enum FOO { X = 17; } + + message Test { + required string label = 1; + optional int32 type = 2 [default=77]; + repeated int64 reps = 3; + optional group OptionalGroup = 4 { + required string RequiredField = 5; + } + oneof union { + int32 number = 6; + string name = 7; + } + } + +The resulting file, test.pb.go, is: + + package example + + import proto "github.com/gogo/protobuf/proto" + import math "math" + + type FOO int32 + const ( + FOO_X FOO = 17 + ) + var FOO_name = map[int32]string{ + 17: "X", + } + var FOO_value = map[string]int32{ + "X": 17, + } + + func (x FOO) Enum() *FOO { + p := new(FOO) + *p = x + return p + } + func (x FOO) String() string { + return proto.EnumName(FOO_name, int32(x)) + } + func (x *FOO) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FOO_value, data) + if err != nil { + return err + } + *x = FOO(value) + return nil + } + + type Test struct { + Label *string `protobuf:"bytes,1,req,name=label" json:"label,omitempty"` + Type *int32 `protobuf:"varint,2,opt,name=type,def=77" json:"type,omitempty"` + Reps []int64 `protobuf:"varint,3,rep,name=reps" json:"reps,omitempty"` + Optionalgroup *Test_OptionalGroup `protobuf:"group,4,opt,name=OptionalGroup" json:"optionalgroup,omitempty"` + // Types that are valid to be assigned to Union: + // *Test_Number + // *Test_Name + Union isTest_Union `protobuf_oneof:"union"` + XXX_unrecognized []byte `json:"-"` + } + func (m *Test) Reset() { *m = Test{} } + func (m *Test) String() string { return proto.CompactTextString(m) } + func (*Test) ProtoMessage() {} + + type isTest_Union interface { + isTest_Union() + } + + type Test_Number struct { + Number int32 `protobuf:"varint,6,opt,name=number"` + } + type Test_Name struct { + Name string `protobuf:"bytes,7,opt,name=name"` + } + + func (*Test_Number) isTest_Union() {} + func (*Test_Name) isTest_Union() {} + + func (m *Test) GetUnion() isTest_Union { + if m != nil { + return m.Union + } + return nil + } + const Default_Test_Type int32 = 77 + + func (m *Test) GetLabel() string { + if m != nil && m.Label != nil { + return *m.Label + } + return "" + } + + func (m *Test) GetType() int32 { + if m != nil && m.Type != nil { + return *m.Type + } + return Default_Test_Type + } + + func (m *Test) GetOptionalgroup() *Test_OptionalGroup { + if m != nil { + return m.Optionalgroup + } + return nil + } + + type Test_OptionalGroup struct { + RequiredField *string `protobuf:"bytes,5,req" json:"RequiredField,omitempty"` + } + func (m *Test_OptionalGroup) Reset() { *m = Test_OptionalGroup{} } + func (m *Test_OptionalGroup) String() string { return proto.CompactTextString(m) } + + func (m *Test_OptionalGroup) GetRequiredField() string { + if m != nil && m.RequiredField != nil { + return *m.RequiredField + } + return "" + } + + func (m *Test) GetNumber() int32 { + if x, ok := m.GetUnion().(*Test_Number); ok { + return x.Number + } + return 0 + } + + func (m *Test) GetName() string { + if x, ok := m.GetUnion().(*Test_Name); ok { + return x.Name + } + return "" + } + + func init() { + proto.RegisterEnum("example.FOO", FOO_name, FOO_value) + } + +To create and play with a Test object: + + package main + + import ( + "log" + + "github.com/gogo/protobuf/proto" + pb "./example.pb" + ) + + func main() { + test := &pb.Test{ + Label: proto.String("hello"), + Type: proto.Int32(17), + Reps: []int64{1, 2, 3}, + Optionalgroup: &pb.Test_OptionalGroup{ + RequiredField: proto.String("good bye"), + }, + Union: &pb.Test_Name{"fred"}, + } + data, err := proto.Marshal(test) + if err != nil { + log.Fatal("marshaling error: ", err) + } + newTest := &pb.Test{} + err = proto.Unmarshal(data, newTest) + if err != nil { + log.Fatal("unmarshaling error: ", err) + } + // Now test and newTest contain the same data. + if test.GetLabel() != newTest.GetLabel() { + log.Fatalf("data mismatch %q != %q", test.GetLabel(), newTest.GetLabel()) + } + // Use a type switch to determine which oneof was set. + switch u := test.Union.(type) { + case *pb.Test_Number: // u.Number contains the number. + case *pb.Test_Name: // u.Name contains the string. + } + // etc. + } +*/ +package proto + +import ( + "encoding/json" + "fmt" + "log" + "reflect" + "sort" + "strconv" + "sync" +) + +// Message is implemented by generated protocol buffer messages. +type Message interface { + Reset() + String() string + ProtoMessage() +} + +// Stats records allocation details about the protocol buffer encoders +// and decoders. Useful for tuning the library itself. +type Stats struct { + Emalloc uint64 // mallocs in encode + Dmalloc uint64 // mallocs in decode + Encode uint64 // number of encodes + Decode uint64 // number of decodes + Chit uint64 // number of cache hits + Cmiss uint64 // number of cache misses + Size uint64 // number of sizes +} + +// Set to true to enable stats collection. +const collectStats = false + +var stats Stats + +// GetStats returns a copy of the global Stats structure. +func GetStats() Stats { return stats } + +// A Buffer is a buffer manager for marshaling and unmarshaling +// protocol buffers. It may be reused between invocations to +// reduce memory usage. It is not necessary to use a Buffer; +// the global functions Marshal and Unmarshal create a +// temporary Buffer and are fine for most applications. +type Buffer struct { + buf []byte // encode/decode byte stream + index int // read point + + // pools of basic types to amortize allocation. + bools []bool + uint32s []uint32 + uint64s []uint64 + + // extra pools, only used with pointer_reflect.go + int32s []int32 + int64s []int64 + float32s []float32 + float64s []float64 +} + +// NewBuffer allocates a new Buffer and initializes its internal data to +// the contents of the argument slice. +func NewBuffer(e []byte) *Buffer { + return &Buffer{buf: e} +} + +// Reset resets the Buffer, ready for marshaling a new protocol buffer. +func (p *Buffer) Reset() { + p.buf = p.buf[0:0] // for reading/writing + p.index = 0 // for reading +} + +// SetBuf replaces the internal buffer with the slice, +// ready for unmarshaling the contents of the slice. +func (p *Buffer) SetBuf(s []byte) { + p.buf = s + p.index = 0 +} + +// Bytes returns the contents of the Buffer. +func (p *Buffer) Bytes() []byte { return p.buf } + +/* + * Helper routines for simplifying the creation of optional fields of basic type. + */ + +// Bool is a helper routine that allocates a new bool value +// to store v and returns a pointer to it. +func Bool(v bool) *bool { + return &v +} + +// Int32 is a helper routine that allocates a new int32 value +// to store v and returns a pointer to it. +func Int32(v int32) *int32 { + return &v +} + +// Int is a helper routine that allocates a new int32 value +// to store v and returns a pointer to it, but unlike Int32 +// its argument value is an int. +func Int(v int) *int32 { + p := new(int32) + *p = int32(v) + return p +} + +// Int64 is a helper routine that allocates a new int64 value +// to store v and returns a pointer to it. +func Int64(v int64) *int64 { + return &v +} + +// Float32 is a helper routine that allocates a new float32 value +// to store v and returns a pointer to it. +func Float32(v float32) *float32 { + return &v +} + +// Float64 is a helper routine that allocates a new float64 value +// to store v and returns a pointer to it. +func Float64(v float64) *float64 { + return &v +} + +// Uint32 is a helper routine that allocates a new uint32 value +// to store v and returns a pointer to it. +func Uint32(v uint32) *uint32 { + return &v +} + +// Uint64 is a helper routine that allocates a new uint64 value +// to store v and returns a pointer to it. +func Uint64(v uint64) *uint64 { + return &v +} + +// String is a helper routine that allocates a new string value +// to store v and returns a pointer to it. +func String(v string) *string { + return &v +} + +// EnumName is a helper function to simplify printing protocol buffer enums +// by name. Given an enum map and a value, it returns a useful string. +func EnumName(m map[int32]string, v int32) string { + s, ok := m[v] + if ok { + return s + } + return strconv.Itoa(int(v)) +} + +// UnmarshalJSONEnum is a helper function to simplify recovering enum int values +// from their JSON-encoded representation. Given a map from the enum's symbolic +// names to its int values, and a byte buffer containing the JSON-encoded +// value, it returns an int32 that can be cast to the enum type by the caller. +// +// The function can deal with both JSON representations, numeric and symbolic. +func UnmarshalJSONEnum(m map[string]int32, data []byte, enumName string) (int32, error) { + if data[0] == '"' { + // New style: enums are strings. + var repr string + if err := json.Unmarshal(data, &repr); err != nil { + return -1, err + } + val, ok := m[repr] + if !ok { + return 0, fmt.Errorf("unrecognized enum %s value %q", enumName, repr) + } + return val, nil + } + // Old style: enums are ints. + var val int32 + if err := json.Unmarshal(data, &val); err != nil { + return 0, fmt.Errorf("cannot unmarshal %#q into enum %s", data, enumName) + } + return val, nil +} + +// DebugPrint dumps the encoded data in b in a debugging format with a header +// including the string s. Used in testing but made available for general debugging. +func (p *Buffer) DebugPrint(s string, b []byte) { + var u uint64 + + obuf := p.buf + sindex := p.index + p.buf = b + p.index = 0 + depth := 0 + + fmt.Printf("\n--- %s ---\n", s) + +out: + for { + for i := 0; i < depth; i++ { + fmt.Print(" ") + } + + index := p.index + if index == len(p.buf) { + break + } + + op, err := p.DecodeVarint() + if err != nil { + fmt.Printf("%3d: fetching op err %v\n", index, err) + break out + } + tag := op >> 3 + wire := op & 7 + + switch wire { + default: + fmt.Printf("%3d: t=%3d unknown wire=%d\n", + index, tag, wire) + break out + + case WireBytes: + var r []byte + + r, err = p.DecodeRawBytes(false) + if err != nil { + break out + } + fmt.Printf("%3d: t=%3d bytes [%d]", index, tag, len(r)) + if len(r) <= 6 { + for i := 0; i < len(r); i++ { + fmt.Printf(" %.2x", r[i]) + } + } else { + for i := 0; i < 3; i++ { + fmt.Printf(" %.2x", r[i]) + } + fmt.Printf(" ..") + for i := len(r) - 3; i < len(r); i++ { + fmt.Printf(" %.2x", r[i]) + } + } + fmt.Printf("\n") + + case WireFixed32: + u, err = p.DecodeFixed32() + if err != nil { + fmt.Printf("%3d: t=%3d fix32 err %v\n", index, tag, err) + break out + } + fmt.Printf("%3d: t=%3d fix32 %d\n", index, tag, u) + + case WireFixed64: + u, err = p.DecodeFixed64() + if err != nil { + fmt.Printf("%3d: t=%3d fix64 err %v\n", index, tag, err) + break out + } + fmt.Printf("%3d: t=%3d fix64 %d\n", index, tag, u) + + case WireVarint: + u, err = p.DecodeVarint() + if err != nil { + fmt.Printf("%3d: t=%3d varint err %v\n", index, tag, err) + break out + } + fmt.Printf("%3d: t=%3d varint %d\n", index, tag, u) + + case WireStartGroup: + fmt.Printf("%3d: t=%3d start\n", index, tag) + depth++ + + case WireEndGroup: + depth-- + fmt.Printf("%3d: t=%3d end\n", index, tag) + } + } + + if depth != 0 { + fmt.Printf("%3d: start-end not balanced %d\n", p.index, depth) + } + fmt.Printf("\n") + + p.buf = obuf + p.index = sindex +} + +// SetDefaults sets unset protocol buffer fields to their default values. +// It only modifies fields that are both unset and have defined defaults. +// It recursively sets default values in any non-nil sub-messages. +func SetDefaults(pb Message) { + setDefaults(reflect.ValueOf(pb), true, false) +} + +// v is a pointer to a struct. +func setDefaults(v reflect.Value, recur, zeros bool) { + v = v.Elem() + + defaultMu.RLock() + dm, ok := defaults[v.Type()] + defaultMu.RUnlock() + if !ok { + dm = buildDefaultMessage(v.Type()) + defaultMu.Lock() + defaults[v.Type()] = dm + defaultMu.Unlock() + } + + for _, sf := range dm.scalars { + f := v.Field(sf.index) + if !f.IsNil() { + // field already set + continue + } + dv := sf.value + if dv == nil && !zeros { + // no explicit default, and don't want to set zeros + continue + } + fptr := f.Addr().Interface() // **T + // TODO: Consider batching the allocations we do here. + switch sf.kind { + case reflect.Bool: + b := new(bool) + if dv != nil { + *b = dv.(bool) + } + *(fptr.(**bool)) = b + case reflect.Float32: + f := new(float32) + if dv != nil { + *f = dv.(float32) + } + *(fptr.(**float32)) = f + case reflect.Float64: + f := new(float64) + if dv != nil { + *f = dv.(float64) + } + *(fptr.(**float64)) = f + case reflect.Int32: + // might be an enum + if ft := f.Type(); ft != int32PtrType { + // enum + f.Set(reflect.New(ft.Elem())) + if dv != nil { + f.Elem().SetInt(int64(dv.(int32))) + } + } else { + // int32 field + i := new(int32) + if dv != nil { + *i = dv.(int32) + } + *(fptr.(**int32)) = i + } + case reflect.Int64: + i := new(int64) + if dv != nil { + *i = dv.(int64) + } + *(fptr.(**int64)) = i + case reflect.String: + s := new(string) + if dv != nil { + *s = dv.(string) + } + *(fptr.(**string)) = s + case reflect.Uint8: + // exceptional case: []byte + var b []byte + if dv != nil { + db := dv.([]byte) + b = make([]byte, len(db)) + copy(b, db) + } else { + b = []byte{} + } + *(fptr.(*[]byte)) = b + case reflect.Uint32: + u := new(uint32) + if dv != nil { + *u = dv.(uint32) + } + *(fptr.(**uint32)) = u + case reflect.Uint64: + u := new(uint64) + if dv != nil { + *u = dv.(uint64) + } + *(fptr.(**uint64)) = u + default: + log.Printf("proto: can't set default for field %v (sf.kind=%v)", f, sf.kind) + } + } + + for _, ni := range dm.nested { + f := v.Field(ni) + // f is *T or []*T or map[T]*T + switch f.Kind() { + case reflect.Ptr: + if f.IsNil() { + continue + } + setDefaults(f, recur, zeros) + + case reflect.Slice: + for i := 0; i < f.Len(); i++ { + e := f.Index(i) + if e.IsNil() { + continue + } + setDefaults(e, recur, zeros) + } + + case reflect.Map: + for _, k := range f.MapKeys() { + e := f.MapIndex(k) + if e.IsNil() { + continue + } + setDefaults(e, recur, zeros) + } + } + } +} + +var ( + // defaults maps a protocol buffer struct type to a slice of the fields, + // with its scalar fields set to their proto-declared non-zero default values. + defaultMu sync.RWMutex + defaults = make(map[reflect.Type]defaultMessage) + + int32PtrType = reflect.TypeOf((*int32)(nil)) +) + +// defaultMessage represents information about the default values of a message. +type defaultMessage struct { + scalars []scalarField + nested []int // struct field index of nested messages +} + +type scalarField struct { + index int // struct field index + kind reflect.Kind // element type (the T in *T or []T) + value interface{} // the proto-declared default value, or nil +} + +// t is a struct type. +func buildDefaultMessage(t reflect.Type) (dm defaultMessage) { + sprop := GetProperties(t) + for _, prop := range sprop.Prop { + fi, ok := sprop.decoderTags.get(prop.Tag) + if !ok { + // XXX_unrecognized + continue + } + ft := t.Field(fi).Type + + sf, nested, err := fieldDefault(ft, prop) + switch { + case err != nil: + log.Print(err) + case nested: + dm.nested = append(dm.nested, fi) + case sf != nil: + sf.index = fi + dm.scalars = append(dm.scalars, *sf) + } + } + + return dm +} + +// fieldDefault returns the scalarField for field type ft. +// sf will be nil if the field can not have a default. +// nestedMessage will be true if this is a nested message. +// Note that sf.index is not set on return. +func fieldDefault(ft reflect.Type, prop *Properties) (sf *scalarField, nestedMessage bool, err error) { + var canHaveDefault bool + switch ft.Kind() { + case reflect.Ptr: + if ft.Elem().Kind() == reflect.Struct { + nestedMessage = true + } else { + canHaveDefault = true // proto2 scalar field + } + + case reflect.Slice: + switch ft.Elem().Kind() { + case reflect.Ptr: + nestedMessage = true // repeated message + case reflect.Uint8: + canHaveDefault = true // bytes field + } + + case reflect.Map: + if ft.Elem().Kind() == reflect.Ptr { + nestedMessage = true // map with message values + } + } + + if !canHaveDefault { + if nestedMessage { + return nil, true, nil + } + return nil, false, nil + } + + // We now know that ft is a pointer or slice. + sf = &scalarField{kind: ft.Elem().Kind()} + + // scalar fields without defaults + if !prop.HasDefault { + return sf, false, nil + } + + // a scalar field: either *T or []byte + switch ft.Elem().Kind() { + case reflect.Bool: + x, err := strconv.ParseBool(prop.Default) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default bool %q: %v", prop.Default, err) + } + sf.value = x + case reflect.Float32: + x, err := strconv.ParseFloat(prop.Default, 32) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default float32 %q: %v", prop.Default, err) + } + sf.value = float32(x) + case reflect.Float64: + x, err := strconv.ParseFloat(prop.Default, 64) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default float64 %q: %v", prop.Default, err) + } + sf.value = x + case reflect.Int32: + x, err := strconv.ParseInt(prop.Default, 10, 32) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default int32 %q: %v", prop.Default, err) + } + sf.value = int32(x) + case reflect.Int64: + x, err := strconv.ParseInt(prop.Default, 10, 64) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default int64 %q: %v", prop.Default, err) + } + sf.value = x + case reflect.String: + sf.value = prop.Default + case reflect.Uint8: + // []byte (not *uint8) + sf.value = []byte(prop.Default) + case reflect.Uint32: + x, err := strconv.ParseUint(prop.Default, 10, 32) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default uint32 %q: %v", prop.Default, err) + } + sf.value = uint32(x) + case reflect.Uint64: + x, err := strconv.ParseUint(prop.Default, 10, 64) + if err != nil { + return nil, false, fmt.Errorf("proto: bad default uint64 %q: %v", prop.Default, err) + } + sf.value = x + default: + return nil, false, fmt.Errorf("proto: unhandled def kind %v", ft.Elem().Kind()) + } + + return sf, false, nil +} + +// Map fields may have key types of non-float scalars, strings and enums. +// The easiest way to sort them in some deterministic order is to use fmt. +// If this turns out to be inefficient we can always consider other options, +// such as doing a Schwartzian transform. + +func mapKeys(vs []reflect.Value) sort.Interface { + s := mapKeySorter{ + vs: vs, + // default Less function: textual comparison + less: func(a, b reflect.Value) bool { + return fmt.Sprint(a.Interface()) < fmt.Sprint(b.Interface()) + }, + } + + // Type specialization per https://developers.google.com/protocol-buffers/docs/proto#maps; + // numeric keys are sorted numerically. + if len(vs) == 0 { + return s + } + switch vs[0].Kind() { + case reflect.Int32, reflect.Int64: + s.less = func(a, b reflect.Value) bool { return a.Int() < b.Int() } + case reflect.Uint32, reflect.Uint64: + s.less = func(a, b reflect.Value) bool { return a.Uint() < b.Uint() } + } + + return s +} + +type mapKeySorter struct { + vs []reflect.Value + less func(a, b reflect.Value) bool +} + +func (s mapKeySorter) Len() int { return len(s.vs) } +func (s mapKeySorter) Swap(i, j int) { s.vs[i], s.vs[j] = s.vs[j], s.vs[i] } +func (s mapKeySorter) Less(i, j int) bool { + return s.less(s.vs[i], s.vs[j]) +} + +// isProto3Zero reports whether v is a zero proto3 value. +func isProto3Zero(v reflect.Value) bool { + switch v.Kind() { + case reflect.Bool: + return !v.Bool() + case reflect.Int32, reflect.Int64: + return v.Int() == 0 + case reflect.Uint32, reflect.Uint64: + return v.Uint() == 0 + case reflect.Float32, reflect.Float64: + return v.Float() == 0 + case reflect.String: + return v.String() == "" + } + return false +} + +// ProtoPackageIsVersion2 is referenced from generated protocol buffer files +// to assert that that code is compatible with this version of the proto package. +const GoGoProtoPackageIsVersion2 = true + +// ProtoPackageIsVersion1 is referenced from generated protocol buffer files +// to assert that that code is compatible with this version of the proto package. +const GoGoProtoPackageIsVersion1 = true diff --git a/vendor/github.com/gogo/protobuf/proto/lib_gogo.go b/vendor/github.com/gogo/protobuf/proto/lib_gogo.go new file mode 100644 index 000000000..4b4f7c909 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/lib_gogo.go @@ -0,0 +1,42 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "encoding/json" + "strconv" +) + +func MarshalJSONEnum(m map[int32]string, value int32) ([]byte, error) { + s, ok := m[value] + if !ok { + s = strconv.Itoa(int(value)) + } + return json.Marshal(s) +} diff --git a/vendor/github.com/gogo/protobuf/proto/message_set.go b/vendor/github.com/gogo/protobuf/proto/message_set.go new file mode 100644 index 000000000..fd982decd --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/message_set.go @@ -0,0 +1,311 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Support for message sets. + */ + +import ( + "bytes" + "encoding/json" + "errors" + "fmt" + "reflect" + "sort" +) + +// errNoMessageTypeID occurs when a protocol buffer does not have a message type ID. +// A message type ID is required for storing a protocol buffer in a message set. +var errNoMessageTypeID = errors.New("proto does not have a message type ID") + +// The first two types (_MessageSet_Item and messageSet) +// model what the protocol compiler produces for the following protocol message: +// message MessageSet { +// repeated group Item = 1 { +// required int32 type_id = 2; +// required string message = 3; +// }; +// } +// That is the MessageSet wire format. We can't use a proto to generate these +// because that would introduce a circular dependency between it and this package. + +type _MessageSet_Item struct { + TypeId *int32 `protobuf:"varint,2,req,name=type_id"` + Message []byte `protobuf:"bytes,3,req,name=message"` +} + +type messageSet struct { + Item []*_MessageSet_Item `protobuf:"group,1,rep"` + XXX_unrecognized []byte + // TODO: caching? +} + +// Make sure messageSet is a Message. +var _ Message = (*messageSet)(nil) + +// messageTypeIder is an interface satisfied by a protocol buffer type +// that may be stored in a MessageSet. +type messageTypeIder interface { + MessageTypeId() int32 +} + +func (ms *messageSet) find(pb Message) *_MessageSet_Item { + mti, ok := pb.(messageTypeIder) + if !ok { + return nil + } + id := mti.MessageTypeId() + for _, item := range ms.Item { + if *item.TypeId == id { + return item + } + } + return nil +} + +func (ms *messageSet) Has(pb Message) bool { + if ms.find(pb) != nil { + return true + } + return false +} + +func (ms *messageSet) Unmarshal(pb Message) error { + if item := ms.find(pb); item != nil { + return Unmarshal(item.Message, pb) + } + if _, ok := pb.(messageTypeIder); !ok { + return errNoMessageTypeID + } + return nil // TODO: return error instead? +} + +func (ms *messageSet) Marshal(pb Message) error { + msg, err := Marshal(pb) + if err != nil { + return err + } + if item := ms.find(pb); item != nil { + // reuse existing item + item.Message = msg + return nil + } + + mti, ok := pb.(messageTypeIder) + if !ok { + return errNoMessageTypeID + } + + mtid := mti.MessageTypeId() + ms.Item = append(ms.Item, &_MessageSet_Item{ + TypeId: &mtid, + Message: msg, + }) + return nil +} + +func (ms *messageSet) Reset() { *ms = messageSet{} } +func (ms *messageSet) String() string { return CompactTextString(ms) } +func (*messageSet) ProtoMessage() {} + +// Support for the message_set_wire_format message option. + +func skipVarint(buf []byte) []byte { + i := 0 + for ; buf[i]&0x80 != 0; i++ { + } + return buf[i+1:] +} + +// MarshalMessageSet encodes the extension map represented by m in the message set wire format. +// It is called by generated Marshal methods on protocol buffer messages with the message_set_wire_format option. +func MarshalMessageSet(exts interface{}) ([]byte, error) { + var m map[int32]Extension + switch exts := exts.(type) { + case *XXX_InternalExtensions: + if err := encodeExtensions(exts); err != nil { + return nil, err + } + m, _ = exts.extensionsRead() + case map[int32]Extension: + if err := encodeExtensionsMap(exts); err != nil { + return nil, err + } + m = exts + default: + return nil, errors.New("proto: not an extension map") + } + + // Sort extension IDs to provide a deterministic encoding. + // See also enc_map in encode.go. + ids := make([]int, 0, len(m)) + for id := range m { + ids = append(ids, int(id)) + } + sort.Ints(ids) + + ms := &messageSet{Item: make([]*_MessageSet_Item, 0, len(m))} + for _, id := range ids { + e := m[int32(id)] + // Remove the wire type and field number varint, as well as the length varint. + msg := skipVarint(skipVarint(e.enc)) + + ms.Item = append(ms.Item, &_MessageSet_Item{ + TypeId: Int32(int32(id)), + Message: msg, + }) + } + return Marshal(ms) +} + +// UnmarshalMessageSet decodes the extension map encoded in buf in the message set wire format. +// It is called by generated Unmarshal methods on protocol buffer messages with the message_set_wire_format option. +func UnmarshalMessageSet(buf []byte, exts interface{}) error { + var m map[int32]Extension + switch exts := exts.(type) { + case *XXX_InternalExtensions: + m = exts.extensionsWrite() + case map[int32]Extension: + m = exts + default: + return errors.New("proto: not an extension map") + } + + ms := new(messageSet) + if err := Unmarshal(buf, ms); err != nil { + return err + } + for _, item := range ms.Item { + id := *item.TypeId + msg := item.Message + + // Restore wire type and field number varint, plus length varint. + // Be careful to preserve duplicate items. + b := EncodeVarint(uint64(id)<<3 | WireBytes) + if ext, ok := m[id]; ok { + // Existing data; rip off the tag and length varint + // so we join the new data correctly. + // We can assume that ext.enc is set because we are unmarshaling. + o := ext.enc[len(b):] // skip wire type and field number + _, n := DecodeVarint(o) // calculate length of length varint + o = o[n:] // skip length varint + msg = append(o, msg...) // join old data and new data + } + b = append(b, EncodeVarint(uint64(len(msg)))...) + b = append(b, msg...) + + m[id] = Extension{enc: b} + } + return nil +} + +// MarshalMessageSetJSON encodes the extension map represented by m in JSON format. +// It is called by generated MarshalJSON methods on protocol buffer messages with the message_set_wire_format option. +func MarshalMessageSetJSON(exts interface{}) ([]byte, error) { + var m map[int32]Extension + switch exts := exts.(type) { + case *XXX_InternalExtensions: + m, _ = exts.extensionsRead() + case map[int32]Extension: + m = exts + default: + return nil, errors.New("proto: not an extension map") + } + var b bytes.Buffer + b.WriteByte('{') + + // Process the map in key order for deterministic output. + ids := make([]int32, 0, len(m)) + for id := range m { + ids = append(ids, id) + } + sort.Sort(int32Slice(ids)) // int32Slice defined in text.go + + for i, id := range ids { + ext := m[id] + if i > 0 { + b.WriteByte(',') + } + + msd, ok := messageSetMap[id] + if !ok { + // Unknown type; we can't render it, so skip it. + continue + } + fmt.Fprintf(&b, `"[%s]":`, msd.name) + + x := ext.value + if x == nil { + x = reflect.New(msd.t.Elem()).Interface() + if err := Unmarshal(ext.enc, x.(Message)); err != nil { + return nil, err + } + } + d, err := json.Marshal(x) + if err != nil { + return nil, err + } + b.Write(d) + } + b.WriteByte('}') + return b.Bytes(), nil +} + +// UnmarshalMessageSetJSON decodes the extension map encoded in buf in JSON format. +// It is called by generated UnmarshalJSON methods on protocol buffer messages with the message_set_wire_format option. +func UnmarshalMessageSetJSON(buf []byte, exts interface{}) error { + // Common-case fast path. + if len(buf) == 0 || bytes.Equal(buf, []byte("{}")) { + return nil + } + + // This is fairly tricky, and it's not clear that it is needed. + return errors.New("TODO: UnmarshalMessageSetJSON not yet implemented") +} + +// A global registry of types that can be used in a MessageSet. + +var messageSetMap = make(map[int32]messageSetDesc) + +type messageSetDesc struct { + t reflect.Type // pointer to struct + name string +} + +// RegisterMessageSetType is called from the generated code. +func RegisterMessageSetType(m Message, fieldNum int32, name string) { + messageSetMap[fieldNum] = messageSetDesc{ + t: reflect.TypeOf(m), + name: name, + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/pointer_reflect.go b/vendor/github.com/gogo/protobuf/proto/pointer_reflect.go new file mode 100644 index 000000000..fb512e2e1 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/pointer_reflect.go @@ -0,0 +1,484 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2012 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// +build appengine js + +// This file contains an implementation of proto field accesses using package reflect. +// It is slower than the code in pointer_unsafe.go but it avoids package unsafe and can +// be used on App Engine. + +package proto + +import ( + "math" + "reflect" +) + +// A structPointer is a pointer to a struct. +type structPointer struct { + v reflect.Value +} + +// toStructPointer returns a structPointer equivalent to the given reflect value. +// The reflect value must itself be a pointer to a struct. +func toStructPointer(v reflect.Value) structPointer { + return structPointer{v} +} + +// IsNil reports whether p is nil. +func structPointer_IsNil(p structPointer) bool { + return p.v.IsNil() +} + +// Interface returns the struct pointer as an interface value. +func structPointer_Interface(p structPointer, _ reflect.Type) interface{} { + return p.v.Interface() +} + +// A field identifies a field in a struct, accessible from a structPointer. +// In this implementation, a field is identified by the sequence of field indices +// passed to reflect's FieldByIndex. +type field []int + +// toField returns a field equivalent to the given reflect field. +func toField(f *reflect.StructField) field { + return f.Index +} + +// invalidField is an invalid field identifier. +var invalidField = field(nil) + +// IsValid reports whether the field identifier is valid. +func (f field) IsValid() bool { return f != nil } + +// field returns the given field in the struct as a reflect value. +func structPointer_field(p structPointer, f field) reflect.Value { + // Special case: an extension map entry with a value of type T + // passes a *T to the struct-handling code with a zero field, + // expecting that it will be treated as equivalent to *struct{ X T }, + // which has the same memory layout. We have to handle that case + // specially, because reflect will panic if we call FieldByIndex on a + // non-struct. + if f == nil { + return p.v.Elem() + } + + return p.v.Elem().FieldByIndex(f) +} + +// ifield returns the given field in the struct as an interface value. +func structPointer_ifield(p structPointer, f field) interface{} { + return structPointer_field(p, f).Addr().Interface() +} + +// Bytes returns the address of a []byte field in the struct. +func structPointer_Bytes(p structPointer, f field) *[]byte { + return structPointer_ifield(p, f).(*[]byte) +} + +// BytesSlice returns the address of a [][]byte field in the struct. +func structPointer_BytesSlice(p structPointer, f field) *[][]byte { + return structPointer_ifield(p, f).(*[][]byte) +} + +// Bool returns the address of a *bool field in the struct. +func structPointer_Bool(p structPointer, f field) **bool { + return structPointer_ifield(p, f).(**bool) +} + +// BoolVal returns the address of a bool field in the struct. +func structPointer_BoolVal(p structPointer, f field) *bool { + return structPointer_ifield(p, f).(*bool) +} + +// BoolSlice returns the address of a []bool field in the struct. +func structPointer_BoolSlice(p structPointer, f field) *[]bool { + return structPointer_ifield(p, f).(*[]bool) +} + +// String returns the address of a *string field in the struct. +func structPointer_String(p structPointer, f field) **string { + return structPointer_ifield(p, f).(**string) +} + +// StringVal returns the address of a string field in the struct. +func structPointer_StringVal(p structPointer, f field) *string { + return structPointer_ifield(p, f).(*string) +} + +// StringSlice returns the address of a []string field in the struct. +func structPointer_StringSlice(p structPointer, f field) *[]string { + return structPointer_ifield(p, f).(*[]string) +} + +// Extensions returns the address of an extension map field in the struct. +func structPointer_Extensions(p structPointer, f field) *XXX_InternalExtensions { + return structPointer_ifield(p, f).(*XXX_InternalExtensions) +} + +// ExtMap returns the address of an extension map field in the struct. +func structPointer_ExtMap(p structPointer, f field) *map[int32]Extension { + return structPointer_ifield(p, f).(*map[int32]Extension) +} + +// NewAt returns the reflect.Value for a pointer to a field in the struct. +func structPointer_NewAt(p structPointer, f field, typ reflect.Type) reflect.Value { + return structPointer_field(p, f).Addr() +} + +// SetStructPointer writes a *struct field in the struct. +func structPointer_SetStructPointer(p structPointer, f field, q structPointer) { + structPointer_field(p, f).Set(q.v) +} + +// GetStructPointer reads a *struct field in the struct. +func structPointer_GetStructPointer(p structPointer, f field) structPointer { + return structPointer{structPointer_field(p, f)} +} + +// StructPointerSlice the address of a []*struct field in the struct. +func structPointer_StructPointerSlice(p structPointer, f field) structPointerSlice { + return structPointerSlice{structPointer_field(p, f)} +} + +// A structPointerSlice represents the address of a slice of pointers to structs +// (themselves messages or groups). That is, v.Type() is *[]*struct{...}. +type structPointerSlice struct { + v reflect.Value +} + +func (p structPointerSlice) Len() int { return p.v.Len() } +func (p structPointerSlice) Index(i int) structPointer { return structPointer{p.v.Index(i)} } +func (p structPointerSlice) Append(q structPointer) { + p.v.Set(reflect.Append(p.v, q.v)) +} + +var ( + int32Type = reflect.TypeOf(int32(0)) + uint32Type = reflect.TypeOf(uint32(0)) + float32Type = reflect.TypeOf(float32(0)) + int64Type = reflect.TypeOf(int64(0)) + uint64Type = reflect.TypeOf(uint64(0)) + float64Type = reflect.TypeOf(float64(0)) +) + +// A word32 represents a field of type *int32, *uint32, *float32, or *enum. +// That is, v.Type() is *int32, *uint32, *float32, or *enum and v is assignable. +type word32 struct { + v reflect.Value +} + +// IsNil reports whether p is nil. +func word32_IsNil(p word32) bool { + return p.v.IsNil() +} + +// Set sets p to point at a newly allocated word with bits set to x. +func word32_Set(p word32, o *Buffer, x uint32) { + t := p.v.Type().Elem() + switch t { + case int32Type: + if len(o.int32s) == 0 { + o.int32s = make([]int32, uint32PoolSize) + } + o.int32s[0] = int32(x) + p.v.Set(reflect.ValueOf(&o.int32s[0])) + o.int32s = o.int32s[1:] + return + case uint32Type: + if len(o.uint32s) == 0 { + o.uint32s = make([]uint32, uint32PoolSize) + } + o.uint32s[0] = x + p.v.Set(reflect.ValueOf(&o.uint32s[0])) + o.uint32s = o.uint32s[1:] + return + case float32Type: + if len(o.float32s) == 0 { + o.float32s = make([]float32, uint32PoolSize) + } + o.float32s[0] = math.Float32frombits(x) + p.v.Set(reflect.ValueOf(&o.float32s[0])) + o.float32s = o.float32s[1:] + return + } + + // must be enum + p.v.Set(reflect.New(t)) + p.v.Elem().SetInt(int64(int32(x))) +} + +// Get gets the bits pointed at by p, as a uint32. +func word32_Get(p word32) uint32 { + elem := p.v.Elem() + switch elem.Kind() { + case reflect.Int32: + return uint32(elem.Int()) + case reflect.Uint32: + return uint32(elem.Uint()) + case reflect.Float32: + return math.Float32bits(float32(elem.Float())) + } + panic("unreachable") +} + +// Word32 returns a reference to a *int32, *uint32, *float32, or *enum field in the struct. +func structPointer_Word32(p structPointer, f field) word32 { + return word32{structPointer_field(p, f)} +} + +// A word32Val represents a field of type int32, uint32, float32, or enum. +// That is, v.Type() is int32, uint32, float32, or enum and v is assignable. +type word32Val struct { + v reflect.Value +} + +// Set sets *p to x. +func word32Val_Set(p word32Val, x uint32) { + switch p.v.Type() { + case int32Type: + p.v.SetInt(int64(x)) + return + case uint32Type: + p.v.SetUint(uint64(x)) + return + case float32Type: + p.v.SetFloat(float64(math.Float32frombits(x))) + return + } + + // must be enum + p.v.SetInt(int64(int32(x))) +} + +// Get gets the bits pointed at by p, as a uint32. +func word32Val_Get(p word32Val) uint32 { + elem := p.v + switch elem.Kind() { + case reflect.Int32: + return uint32(elem.Int()) + case reflect.Uint32: + return uint32(elem.Uint()) + case reflect.Float32: + return math.Float32bits(float32(elem.Float())) + } + panic("unreachable") +} + +// Word32Val returns a reference to a int32, uint32, float32, or enum field in the struct. +func structPointer_Word32Val(p structPointer, f field) word32Val { + return word32Val{structPointer_field(p, f)} +} + +// A word32Slice is a slice of 32-bit values. +// That is, v.Type() is []int32, []uint32, []float32, or []enum. +type word32Slice struct { + v reflect.Value +} + +func (p word32Slice) Append(x uint32) { + n, m := p.v.Len(), p.v.Cap() + if n < m { + p.v.SetLen(n + 1) + } else { + t := p.v.Type().Elem() + p.v.Set(reflect.Append(p.v, reflect.Zero(t))) + } + elem := p.v.Index(n) + switch elem.Kind() { + case reflect.Int32: + elem.SetInt(int64(int32(x))) + case reflect.Uint32: + elem.SetUint(uint64(x)) + case reflect.Float32: + elem.SetFloat(float64(math.Float32frombits(x))) + } +} + +func (p word32Slice) Len() int { + return p.v.Len() +} + +func (p word32Slice) Index(i int) uint32 { + elem := p.v.Index(i) + switch elem.Kind() { + case reflect.Int32: + return uint32(elem.Int()) + case reflect.Uint32: + return uint32(elem.Uint()) + case reflect.Float32: + return math.Float32bits(float32(elem.Float())) + } + panic("unreachable") +} + +// Word32Slice returns a reference to a []int32, []uint32, []float32, or []enum field in the struct. +func structPointer_Word32Slice(p structPointer, f field) word32Slice { + return word32Slice{structPointer_field(p, f)} +} + +// word64 is like word32 but for 64-bit values. +type word64 struct { + v reflect.Value +} + +func word64_Set(p word64, o *Buffer, x uint64) { + t := p.v.Type().Elem() + switch t { + case int64Type: + if len(o.int64s) == 0 { + o.int64s = make([]int64, uint64PoolSize) + } + o.int64s[0] = int64(x) + p.v.Set(reflect.ValueOf(&o.int64s[0])) + o.int64s = o.int64s[1:] + return + case uint64Type: + if len(o.uint64s) == 0 { + o.uint64s = make([]uint64, uint64PoolSize) + } + o.uint64s[0] = x + p.v.Set(reflect.ValueOf(&o.uint64s[0])) + o.uint64s = o.uint64s[1:] + return + case float64Type: + if len(o.float64s) == 0 { + o.float64s = make([]float64, uint64PoolSize) + } + o.float64s[0] = math.Float64frombits(x) + p.v.Set(reflect.ValueOf(&o.float64s[0])) + o.float64s = o.float64s[1:] + return + } + panic("unreachable") +} + +func word64_IsNil(p word64) bool { + return p.v.IsNil() +} + +func word64_Get(p word64) uint64 { + elem := p.v.Elem() + switch elem.Kind() { + case reflect.Int64: + return uint64(elem.Int()) + case reflect.Uint64: + return elem.Uint() + case reflect.Float64: + return math.Float64bits(elem.Float()) + } + panic("unreachable") +} + +func structPointer_Word64(p structPointer, f field) word64 { + return word64{structPointer_field(p, f)} +} + +// word64Val is like word32Val but for 64-bit values. +type word64Val struct { + v reflect.Value +} + +func word64Val_Set(p word64Val, o *Buffer, x uint64) { + switch p.v.Type() { + case int64Type: + p.v.SetInt(int64(x)) + return + case uint64Type: + p.v.SetUint(x) + return + case float64Type: + p.v.SetFloat(math.Float64frombits(x)) + return + } + panic("unreachable") +} + +func word64Val_Get(p word64Val) uint64 { + elem := p.v + switch elem.Kind() { + case reflect.Int64: + return uint64(elem.Int()) + case reflect.Uint64: + return elem.Uint() + case reflect.Float64: + return math.Float64bits(elem.Float()) + } + panic("unreachable") +} + +func structPointer_Word64Val(p structPointer, f field) word64Val { + return word64Val{structPointer_field(p, f)} +} + +type word64Slice struct { + v reflect.Value +} + +func (p word64Slice) Append(x uint64) { + n, m := p.v.Len(), p.v.Cap() + if n < m { + p.v.SetLen(n + 1) + } else { + t := p.v.Type().Elem() + p.v.Set(reflect.Append(p.v, reflect.Zero(t))) + } + elem := p.v.Index(n) + switch elem.Kind() { + case reflect.Int64: + elem.SetInt(int64(int64(x))) + case reflect.Uint64: + elem.SetUint(uint64(x)) + case reflect.Float64: + elem.SetFloat(float64(math.Float64frombits(x))) + } +} + +func (p word64Slice) Len() int { + return p.v.Len() +} + +func (p word64Slice) Index(i int) uint64 { + elem := p.v.Index(i) + switch elem.Kind() { + case reflect.Int64: + return uint64(elem.Int()) + case reflect.Uint64: + return uint64(elem.Uint()) + case reflect.Float64: + return math.Float64bits(float64(elem.Float())) + } + panic("unreachable") +} + +func structPointer_Word64Slice(p structPointer, f field) word64Slice { + return word64Slice{structPointer_field(p, f)} +} diff --git a/vendor/github.com/gogo/protobuf/proto/pointer_reflect_gogo.go b/vendor/github.com/gogo/protobuf/proto/pointer_reflect_gogo.go new file mode 100644 index 000000000..1763a5f22 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/pointer_reflect_gogo.go @@ -0,0 +1,85 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2016, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// +build appengine js + +package proto + +import ( + "reflect" +) + +func structPointer_FieldPointer(p structPointer, f field) structPointer { + panic("not implemented") +} + +func appendStructPointer(base structPointer, f field, typ reflect.Type) structPointer { + panic("not implemented") +} + +func structPointer_InterfaceAt(p structPointer, f field, t reflect.Type) interface{} { + panic("not implemented") +} + +func structPointer_InterfaceRef(p structPointer, f field, t reflect.Type) interface{} { + panic("not implemented") +} + +func structPointer_GetRefStructPointer(p structPointer, f field) structPointer { + panic("not implemented") +} + +func structPointer_Add(p structPointer, size field) structPointer { + panic("not implemented") +} + +func structPointer_Len(p structPointer, f field) int { + panic("not implemented") +} + +func structPointer_GetSliceHeader(p structPointer, f field) *reflect.SliceHeader { + panic("not implemented") +} + +func structPointer_Copy(oldptr structPointer, newptr structPointer, size int) { + panic("not implemented") +} + +func structPointer_StructRefSlice(p structPointer, f field, size uintptr) *structRefSlice { + panic("not implemented") +} + +type structRefSlice struct{} + +func (v *structRefSlice) Len() int { + panic("not implemented") +} + +func (v *structRefSlice) Index(i int) structPointer { + panic("not implemented") +} diff --git a/vendor/github.com/gogo/protobuf/proto/pointer_unsafe.go b/vendor/github.com/gogo/protobuf/proto/pointer_unsafe.go new file mode 100644 index 000000000..6b5567d47 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/pointer_unsafe.go @@ -0,0 +1,270 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2012 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// +build !appengine,!js + +// This file contains the implementation of the proto field accesses using package unsafe. + +package proto + +import ( + "reflect" + "unsafe" +) + +// NOTE: These type_Foo functions would more idiomatically be methods, +// but Go does not allow methods on pointer types, and we must preserve +// some pointer type for the garbage collector. We use these +// funcs with clunky names as our poor approximation to methods. +// +// An alternative would be +// type structPointer struct { p unsafe.Pointer } +// but that does not registerize as well. + +// A structPointer is a pointer to a struct. +type structPointer unsafe.Pointer + +// toStructPointer returns a structPointer equivalent to the given reflect value. +func toStructPointer(v reflect.Value) structPointer { + return structPointer(unsafe.Pointer(v.Pointer())) +} + +// IsNil reports whether p is nil. +func structPointer_IsNil(p structPointer) bool { + return p == nil +} + +// Interface returns the struct pointer, assumed to have element type t, +// as an interface value. +func structPointer_Interface(p structPointer, t reflect.Type) interface{} { + return reflect.NewAt(t, unsafe.Pointer(p)).Interface() +} + +// A field identifies a field in a struct, accessible from a structPointer. +// In this implementation, a field is identified by its byte offset from the start of the struct. +type field uintptr + +// toField returns a field equivalent to the given reflect field. +func toField(f *reflect.StructField) field { + return field(f.Offset) +} + +// invalidField is an invalid field identifier. +const invalidField = ^field(0) + +// IsValid reports whether the field identifier is valid. +func (f field) IsValid() bool { + return f != ^field(0) +} + +// Bytes returns the address of a []byte field in the struct. +func structPointer_Bytes(p structPointer, f field) *[]byte { + return (*[]byte)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// BytesSlice returns the address of a [][]byte field in the struct. +func structPointer_BytesSlice(p structPointer, f field) *[][]byte { + return (*[][]byte)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// Bool returns the address of a *bool field in the struct. +func structPointer_Bool(p structPointer, f field) **bool { + return (**bool)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// BoolVal returns the address of a bool field in the struct. +func structPointer_BoolVal(p structPointer, f field) *bool { + return (*bool)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// BoolSlice returns the address of a []bool field in the struct. +func structPointer_BoolSlice(p structPointer, f field) *[]bool { + return (*[]bool)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// String returns the address of a *string field in the struct. +func structPointer_String(p structPointer, f field) **string { + return (**string)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// StringVal returns the address of a string field in the struct. +func structPointer_StringVal(p structPointer, f field) *string { + return (*string)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// StringSlice returns the address of a []string field in the struct. +func structPointer_StringSlice(p structPointer, f field) *[]string { + return (*[]string)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// ExtMap returns the address of an extension map field in the struct. +func structPointer_Extensions(p structPointer, f field) *XXX_InternalExtensions { + return (*XXX_InternalExtensions)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +func structPointer_ExtMap(p structPointer, f field) *map[int32]Extension { + return (*map[int32]Extension)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// NewAt returns the reflect.Value for a pointer to a field in the struct. +func structPointer_NewAt(p structPointer, f field, typ reflect.Type) reflect.Value { + return reflect.NewAt(typ, unsafe.Pointer(uintptr(p)+uintptr(f))) +} + +// SetStructPointer writes a *struct field in the struct. +func structPointer_SetStructPointer(p structPointer, f field, q structPointer) { + *(*structPointer)(unsafe.Pointer(uintptr(p) + uintptr(f))) = q +} + +// GetStructPointer reads a *struct field in the struct. +func structPointer_GetStructPointer(p structPointer, f field) structPointer { + return *(*structPointer)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// StructPointerSlice the address of a []*struct field in the struct. +func structPointer_StructPointerSlice(p structPointer, f field) *structPointerSlice { + return (*structPointerSlice)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// A structPointerSlice represents a slice of pointers to structs (themselves submessages or groups). +type structPointerSlice []structPointer + +func (v *structPointerSlice) Len() int { return len(*v) } +func (v *structPointerSlice) Index(i int) structPointer { return (*v)[i] } +func (v *structPointerSlice) Append(p structPointer) { *v = append(*v, p) } + +// A word32 is the address of a "pointer to 32-bit value" field. +type word32 **uint32 + +// IsNil reports whether *v is nil. +func word32_IsNil(p word32) bool { + return *p == nil +} + +// Set sets *v to point at a newly allocated word set to x. +func word32_Set(p word32, o *Buffer, x uint32) { + if len(o.uint32s) == 0 { + o.uint32s = make([]uint32, uint32PoolSize) + } + o.uint32s[0] = x + *p = &o.uint32s[0] + o.uint32s = o.uint32s[1:] +} + +// Get gets the value pointed at by *v. +func word32_Get(p word32) uint32 { + return **p +} + +// Word32 returns the address of a *int32, *uint32, *float32, or *enum field in the struct. +func structPointer_Word32(p structPointer, f field) word32 { + return word32((**uint32)(unsafe.Pointer(uintptr(p) + uintptr(f)))) +} + +// A word32Val is the address of a 32-bit value field. +type word32Val *uint32 + +// Set sets *p to x. +func word32Val_Set(p word32Val, x uint32) { + *p = x +} + +// Get gets the value pointed at by p. +func word32Val_Get(p word32Val) uint32 { + return *p +} + +// Word32Val returns the address of a *int32, *uint32, *float32, or *enum field in the struct. +func structPointer_Word32Val(p structPointer, f field) word32Val { + return word32Val((*uint32)(unsafe.Pointer(uintptr(p) + uintptr(f)))) +} + +// A word32Slice is a slice of 32-bit values. +type word32Slice []uint32 + +func (v *word32Slice) Append(x uint32) { *v = append(*v, x) } +func (v *word32Slice) Len() int { return len(*v) } +func (v *word32Slice) Index(i int) uint32 { return (*v)[i] } + +// Word32Slice returns the address of a []int32, []uint32, []float32, or []enum field in the struct. +func structPointer_Word32Slice(p structPointer, f field) *word32Slice { + return (*word32Slice)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +// word64 is like word32 but for 64-bit values. +type word64 **uint64 + +func word64_Set(p word64, o *Buffer, x uint64) { + if len(o.uint64s) == 0 { + o.uint64s = make([]uint64, uint64PoolSize) + } + o.uint64s[0] = x + *p = &o.uint64s[0] + o.uint64s = o.uint64s[1:] +} + +func word64_IsNil(p word64) bool { + return *p == nil +} + +func word64_Get(p word64) uint64 { + return **p +} + +func structPointer_Word64(p structPointer, f field) word64 { + return word64((**uint64)(unsafe.Pointer(uintptr(p) + uintptr(f)))) +} + +// word64Val is like word32Val but for 64-bit values. +type word64Val *uint64 + +func word64Val_Set(p word64Val, o *Buffer, x uint64) { + *p = x +} + +func word64Val_Get(p word64Val) uint64 { + return *p +} + +func structPointer_Word64Val(p structPointer, f field) word64Val { + return word64Val((*uint64)(unsafe.Pointer(uintptr(p) + uintptr(f)))) +} + +// word64Slice is like word32Slice but for 64-bit values. +type word64Slice []uint64 + +func (v *word64Slice) Append(x uint64) { *v = append(*v, x) } +func (v *word64Slice) Len() int { return len(*v) } +func (v *word64Slice) Index(i int) uint64 { return (*v)[i] } + +func structPointer_Word64Slice(p structPointer, f field) *word64Slice { + return (*word64Slice)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} diff --git a/vendor/github.com/gogo/protobuf/proto/pointer_unsafe_gogo.go b/vendor/github.com/gogo/protobuf/proto/pointer_unsafe_gogo.go new file mode 100644 index 000000000..f156a29f0 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/pointer_unsafe_gogo.go @@ -0,0 +1,128 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// +build !appengine,!js + +// This file contains the implementation of the proto field accesses using package unsafe. + +package proto + +import ( + "reflect" + "unsafe" +) + +func structPointer_InterfaceAt(p structPointer, f field, t reflect.Type) interface{} { + point := unsafe.Pointer(uintptr(p) + uintptr(f)) + r := reflect.NewAt(t, point) + return r.Interface() +} + +func structPointer_InterfaceRef(p structPointer, f field, t reflect.Type) interface{} { + point := unsafe.Pointer(uintptr(p) + uintptr(f)) + r := reflect.NewAt(t, point) + if r.Elem().IsNil() { + return nil + } + return r.Elem().Interface() +} + +func copyUintPtr(oldptr, newptr uintptr, size int) { + oldbytes := make([]byte, 0) + oldslice := (*reflect.SliceHeader)(unsafe.Pointer(&oldbytes)) + oldslice.Data = oldptr + oldslice.Len = size + oldslice.Cap = size + newbytes := make([]byte, 0) + newslice := (*reflect.SliceHeader)(unsafe.Pointer(&newbytes)) + newslice.Data = newptr + newslice.Len = size + newslice.Cap = size + copy(newbytes, oldbytes) +} + +func structPointer_Copy(oldptr structPointer, newptr structPointer, size int) { + copyUintPtr(uintptr(oldptr), uintptr(newptr), size) +} + +func appendStructPointer(base structPointer, f field, typ reflect.Type) structPointer { + size := typ.Elem().Size() + + oldHeader := structPointer_GetSliceHeader(base, f) + oldSlice := reflect.NewAt(typ, unsafe.Pointer(oldHeader)).Elem() + newLen := oldHeader.Len + 1 + newSlice := reflect.MakeSlice(typ, newLen, newLen) + reflect.Copy(newSlice, oldSlice) + bas := toStructPointer(newSlice) + oldHeader.Data = uintptr(bas) + oldHeader.Len = newLen + oldHeader.Cap = newLen + + return structPointer(unsafe.Pointer(uintptr(unsafe.Pointer(bas)) + uintptr(uintptr(newLen-1)*size))) +} + +func structPointer_FieldPointer(p structPointer, f field) structPointer { + return structPointer(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +func structPointer_GetRefStructPointer(p structPointer, f field) structPointer { + return structPointer((*structPointer)(unsafe.Pointer(uintptr(p) + uintptr(f)))) +} + +func structPointer_GetSliceHeader(p structPointer, f field) *reflect.SliceHeader { + return (*reflect.SliceHeader)(unsafe.Pointer(uintptr(p) + uintptr(f))) +} + +func structPointer_Add(p structPointer, size field) structPointer { + return structPointer(unsafe.Pointer(uintptr(p) + uintptr(size))) +} + +func structPointer_Len(p structPointer, f field) int { + return len(*(*[]interface{})(unsafe.Pointer(structPointer_GetRefStructPointer(p, f)))) +} + +func structPointer_StructRefSlice(p structPointer, f field, size uintptr) *structRefSlice { + return &structRefSlice{p: p, f: f, size: size} +} + +// A structRefSlice represents a slice of structs (themselves submessages or groups). +type structRefSlice struct { + p structPointer + f field + size uintptr +} + +func (v *structRefSlice) Len() int { + return structPointer_Len(v.p, v.f) +} + +func (v *structRefSlice) Index(i int) structPointer { + ss := structPointer_GetStructPointer(v.p, v.f) + ss1 := structPointer_GetRefStructPointer(ss, 0) + return structPointer_Add(ss1, field(uintptr(i)*v.size)) +} diff --git a/vendor/github.com/gogo/protobuf/proto/properties.go b/vendor/github.com/gogo/protobuf/proto/properties.go new file mode 100644 index 000000000..44b332052 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/properties.go @@ -0,0 +1,968 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +/* + * Routines for encoding data into the wire format for protocol buffers. + */ + +import ( + "fmt" + "log" + "os" + "reflect" + "sort" + "strconv" + "strings" + "sync" +) + +const debug bool = false + +// Constants that identify the encoding of a value on the wire. +const ( + WireVarint = 0 + WireFixed64 = 1 + WireBytes = 2 + WireStartGroup = 3 + WireEndGroup = 4 + WireFixed32 = 5 +) + +const startSize = 10 // initial slice/string sizes + +// Encoders are defined in encode.go +// An encoder outputs the full representation of a field, including its +// tag and encoder type. +type encoder func(p *Buffer, prop *Properties, base structPointer) error + +// A valueEncoder encodes a single integer in a particular encoding. +type valueEncoder func(o *Buffer, x uint64) error + +// Sizers are defined in encode.go +// A sizer returns the encoded size of a field, including its tag and encoder +// type. +type sizer func(prop *Properties, base structPointer) int + +// A valueSizer returns the encoded size of a single integer in a particular +// encoding. +type valueSizer func(x uint64) int + +// Decoders are defined in decode.go +// A decoder creates a value from its wire representation. +// Unrecognized subelements are saved in unrec. +type decoder func(p *Buffer, prop *Properties, base structPointer) error + +// A valueDecoder decodes a single integer in a particular encoding. +type valueDecoder func(o *Buffer) (x uint64, err error) + +// A oneofMarshaler does the marshaling for all oneof fields in a message. +type oneofMarshaler func(Message, *Buffer) error + +// A oneofUnmarshaler does the unmarshaling for a oneof field in a message. +type oneofUnmarshaler func(Message, int, int, *Buffer) (bool, error) + +// A oneofSizer does the sizing for all oneof fields in a message. +type oneofSizer func(Message) int + +// tagMap is an optimization over map[int]int for typical protocol buffer +// use-cases. Encoded protocol buffers are often in tag order with small tag +// numbers. +type tagMap struct { + fastTags []int + slowTags map[int]int +} + +// tagMapFastLimit is the upper bound on the tag number that will be stored in +// the tagMap slice rather than its map. +const tagMapFastLimit = 1024 + +func (p *tagMap) get(t int) (int, bool) { + if t > 0 && t < tagMapFastLimit { + if t >= len(p.fastTags) { + return 0, false + } + fi := p.fastTags[t] + return fi, fi >= 0 + } + fi, ok := p.slowTags[t] + return fi, ok +} + +func (p *tagMap) put(t int, fi int) { + if t > 0 && t < tagMapFastLimit { + for len(p.fastTags) < t+1 { + p.fastTags = append(p.fastTags, -1) + } + p.fastTags[t] = fi + return + } + if p.slowTags == nil { + p.slowTags = make(map[int]int) + } + p.slowTags[t] = fi +} + +// StructProperties represents properties for all the fields of a struct. +// decoderTags and decoderOrigNames should only be used by the decoder. +type StructProperties struct { + Prop []*Properties // properties for each field + reqCount int // required count + decoderTags tagMap // map from proto tag to struct field number + decoderOrigNames map[string]int // map from original name to struct field number + order []int // list of struct field numbers in tag order + unrecField field // field id of the XXX_unrecognized []byte field + extendable bool // is this an extendable proto + + oneofMarshaler oneofMarshaler + oneofUnmarshaler oneofUnmarshaler + oneofSizer oneofSizer + stype reflect.Type + + // OneofTypes contains information about the oneof fields in this message. + // It is keyed by the original name of a field. + OneofTypes map[string]*OneofProperties +} + +// OneofProperties represents information about a specific field in a oneof. +type OneofProperties struct { + Type reflect.Type // pointer to generated struct type for this oneof field + Field int // struct field number of the containing oneof in the message + Prop *Properties +} + +// Implement the sorting interface so we can sort the fields in tag order, as recommended by the spec. +// See encode.go, (*Buffer).enc_struct. + +func (sp *StructProperties) Len() int { return len(sp.order) } +func (sp *StructProperties) Less(i, j int) bool { + return sp.Prop[sp.order[i]].Tag < sp.Prop[sp.order[j]].Tag +} +func (sp *StructProperties) Swap(i, j int) { sp.order[i], sp.order[j] = sp.order[j], sp.order[i] } + +// Properties represents the protocol-specific behavior of a single struct field. +type Properties struct { + Name string // name of the field, for error messages + OrigName string // original name before protocol compiler (always set) + JSONName string // name to use for JSON; determined by protoc + Wire string + WireType int + Tag int + Required bool + Optional bool + Repeated bool + Packed bool // relevant for repeated primitives only + Enum string // set for enum types only + proto3 bool // whether this is known to be a proto3 field; set for []byte only + oneof bool // whether this is a oneof field + + Default string // default value + HasDefault bool // whether an explicit default was provided + CustomType string + StdTime bool + StdDuration bool + + enc encoder + valEnc valueEncoder // set for bool and numeric types only + field field + tagcode []byte // encoding of EncodeVarint((Tag<<3)|WireType) + tagbuf [8]byte + stype reflect.Type // set for struct types only + sstype reflect.Type // set for slices of structs types only + ctype reflect.Type // set for custom types only + sprop *StructProperties // set for struct types only + isMarshaler bool + isUnmarshaler bool + + mtype reflect.Type // set for map types only + mkeyprop *Properties // set for map types only + mvalprop *Properties // set for map types only + + size sizer + valSize valueSizer // set for bool and numeric types only + + dec decoder + valDec valueDecoder // set for bool and numeric types only + + // If this is a packable field, this will be the decoder for the packed version of the field. + packedDec decoder +} + +// String formats the properties in the protobuf struct field tag style. +func (p *Properties) String() string { + s := p.Wire + s = "," + s += strconv.Itoa(p.Tag) + if p.Required { + s += ",req" + } + if p.Optional { + s += ",opt" + } + if p.Repeated { + s += ",rep" + } + if p.Packed { + s += ",packed" + } + s += ",name=" + p.OrigName + if p.JSONName != p.OrigName { + s += ",json=" + p.JSONName + } + if p.proto3 { + s += ",proto3" + } + if p.oneof { + s += ",oneof" + } + if len(p.Enum) > 0 { + s += ",enum=" + p.Enum + } + if p.HasDefault { + s += ",def=" + p.Default + } + return s +} + +// Parse populates p by parsing a string in the protobuf struct field tag style. +func (p *Properties) Parse(s string) { + // "bytes,49,opt,name=foo,def=hello!" + fields := strings.Split(s, ",") // breaks def=, but handled below. + if len(fields) < 2 { + fmt.Fprintf(os.Stderr, "proto: tag has too few fields: %q\n", s) + return + } + + p.Wire = fields[0] + switch p.Wire { + case "varint": + p.WireType = WireVarint + p.valEnc = (*Buffer).EncodeVarint + p.valDec = (*Buffer).DecodeVarint + p.valSize = sizeVarint + case "fixed32": + p.WireType = WireFixed32 + p.valEnc = (*Buffer).EncodeFixed32 + p.valDec = (*Buffer).DecodeFixed32 + p.valSize = sizeFixed32 + case "fixed64": + p.WireType = WireFixed64 + p.valEnc = (*Buffer).EncodeFixed64 + p.valDec = (*Buffer).DecodeFixed64 + p.valSize = sizeFixed64 + case "zigzag32": + p.WireType = WireVarint + p.valEnc = (*Buffer).EncodeZigzag32 + p.valDec = (*Buffer).DecodeZigzag32 + p.valSize = sizeZigzag32 + case "zigzag64": + p.WireType = WireVarint + p.valEnc = (*Buffer).EncodeZigzag64 + p.valDec = (*Buffer).DecodeZigzag64 + p.valSize = sizeZigzag64 + case "bytes", "group": + p.WireType = WireBytes + // no numeric converter for non-numeric types + default: + fmt.Fprintf(os.Stderr, "proto: tag has unknown wire type: %q\n", s) + return + } + + var err error + p.Tag, err = strconv.Atoi(fields[1]) + if err != nil { + return + } + + for i := 2; i < len(fields); i++ { + f := fields[i] + switch { + case f == "req": + p.Required = true + case f == "opt": + p.Optional = true + case f == "rep": + p.Repeated = true + case f == "packed": + p.Packed = true + case strings.HasPrefix(f, "name="): + p.OrigName = f[5:] + case strings.HasPrefix(f, "json="): + p.JSONName = f[5:] + case strings.HasPrefix(f, "enum="): + p.Enum = f[5:] + case f == "proto3": + p.proto3 = true + case f == "oneof": + p.oneof = true + case strings.HasPrefix(f, "def="): + p.HasDefault = true + p.Default = f[4:] // rest of string + if i+1 < len(fields) { + // Commas aren't escaped, and def is always last. + p.Default += "," + strings.Join(fields[i+1:], ",") + break + } + case strings.HasPrefix(f, "embedded="): + p.OrigName = strings.Split(f, "=")[1] + case strings.HasPrefix(f, "customtype="): + p.CustomType = strings.Split(f, "=")[1] + case f == "stdtime": + p.StdTime = true + case f == "stdduration": + p.StdDuration = true + } + } +} + +func logNoSliceEnc(t1, t2 reflect.Type) { + fmt.Fprintf(os.Stderr, "proto: no slice oenc for %T = []%T\n", t1, t2) +} + +var protoMessageType = reflect.TypeOf((*Message)(nil)).Elem() + +// Initialize the fields for encoding and decoding. +func (p *Properties) setEncAndDec(typ reflect.Type, f *reflect.StructField, lockGetProp bool) { + p.enc = nil + p.dec = nil + p.size = nil + isMap := typ.Kind() == reflect.Map + if len(p.CustomType) > 0 && !isMap { + p.setCustomEncAndDec(typ) + p.setTag(lockGetProp) + return + } + if p.StdTime && !isMap { + p.setTimeEncAndDec(typ) + p.setTag(lockGetProp) + return + } + if p.StdDuration && !isMap { + p.setDurationEncAndDec(typ) + p.setTag(lockGetProp) + return + } + switch t1 := typ; t1.Kind() { + default: + fmt.Fprintf(os.Stderr, "proto: no coders for %v\n", t1) + + // proto3 scalar types + + case reflect.Bool: + if p.proto3 { + p.enc = (*Buffer).enc_proto3_bool + p.dec = (*Buffer).dec_proto3_bool + p.size = size_proto3_bool + } else { + p.enc = (*Buffer).enc_ref_bool + p.dec = (*Buffer).dec_proto3_bool + p.size = size_ref_bool + } + case reflect.Int32: + if p.proto3 { + p.enc = (*Buffer).enc_proto3_int32 + p.dec = (*Buffer).dec_proto3_int32 + p.size = size_proto3_int32 + } else { + p.enc = (*Buffer).enc_ref_int32 + p.dec = (*Buffer).dec_proto3_int32 + p.size = size_ref_int32 + } + case reflect.Uint32: + if p.proto3 { + p.enc = (*Buffer).enc_proto3_uint32 + p.dec = (*Buffer).dec_proto3_int32 // can reuse + p.size = size_proto3_uint32 + } else { + p.enc = (*Buffer).enc_ref_uint32 + p.dec = (*Buffer).dec_proto3_int32 // can reuse + p.size = size_ref_uint32 + } + case reflect.Int64, reflect.Uint64: + if p.proto3 { + p.enc = (*Buffer).enc_proto3_int64 + p.dec = (*Buffer).dec_proto3_int64 + p.size = size_proto3_int64 + } else { + p.enc = (*Buffer).enc_ref_int64 + p.dec = (*Buffer).dec_proto3_int64 + p.size = size_ref_int64 + } + case reflect.Float32: + if p.proto3 { + p.enc = (*Buffer).enc_proto3_uint32 // can just treat them as bits + p.dec = (*Buffer).dec_proto3_int32 + p.size = size_proto3_uint32 + } else { + p.enc = (*Buffer).enc_ref_uint32 // can just treat them as bits + p.dec = (*Buffer).dec_proto3_int32 + p.size = size_ref_uint32 + } + case reflect.Float64: + if p.proto3 { + p.enc = (*Buffer).enc_proto3_int64 // can just treat them as bits + p.dec = (*Buffer).dec_proto3_int64 + p.size = size_proto3_int64 + } else { + p.enc = (*Buffer).enc_ref_int64 // can just treat them as bits + p.dec = (*Buffer).dec_proto3_int64 + p.size = size_ref_int64 + } + case reflect.String: + if p.proto3 { + p.enc = (*Buffer).enc_proto3_string + p.dec = (*Buffer).dec_proto3_string + p.size = size_proto3_string + } else { + p.enc = (*Buffer).enc_ref_string + p.dec = (*Buffer).dec_proto3_string + p.size = size_ref_string + } + case reflect.Struct: + p.stype = typ + p.isMarshaler = isMarshaler(typ) + p.isUnmarshaler = isUnmarshaler(typ) + if p.Wire == "bytes" { + p.enc = (*Buffer).enc_ref_struct_message + p.dec = (*Buffer).dec_ref_struct_message + p.size = size_ref_struct_message + } else { + fmt.Fprintf(os.Stderr, "proto: no coders for struct %T\n", typ) + } + + case reflect.Ptr: + switch t2 := t1.Elem(); t2.Kind() { + default: + fmt.Fprintf(os.Stderr, "proto: no encoder function for %v -> %v\n", t1, t2) + break + case reflect.Bool: + p.enc = (*Buffer).enc_bool + p.dec = (*Buffer).dec_bool + p.size = size_bool + case reflect.Int32: + p.enc = (*Buffer).enc_int32 + p.dec = (*Buffer).dec_int32 + p.size = size_int32 + case reflect.Uint32: + p.enc = (*Buffer).enc_uint32 + p.dec = (*Buffer).dec_int32 // can reuse + p.size = size_uint32 + case reflect.Int64, reflect.Uint64: + p.enc = (*Buffer).enc_int64 + p.dec = (*Buffer).dec_int64 + p.size = size_int64 + case reflect.Float32: + p.enc = (*Buffer).enc_uint32 // can just treat them as bits + p.dec = (*Buffer).dec_int32 + p.size = size_uint32 + case reflect.Float64: + p.enc = (*Buffer).enc_int64 // can just treat them as bits + p.dec = (*Buffer).dec_int64 + p.size = size_int64 + case reflect.String: + p.enc = (*Buffer).enc_string + p.dec = (*Buffer).dec_string + p.size = size_string + case reflect.Struct: + p.stype = t1.Elem() + p.isMarshaler = isMarshaler(t1) + p.isUnmarshaler = isUnmarshaler(t1) + if p.Wire == "bytes" { + p.enc = (*Buffer).enc_struct_message + p.dec = (*Buffer).dec_struct_message + p.size = size_struct_message + } else { + p.enc = (*Buffer).enc_struct_group + p.dec = (*Buffer).dec_struct_group + p.size = size_struct_group + } + } + + case reflect.Slice: + switch t2 := t1.Elem(); t2.Kind() { + default: + logNoSliceEnc(t1, t2) + break + case reflect.Bool: + if p.Packed { + p.enc = (*Buffer).enc_slice_packed_bool + p.size = size_slice_packed_bool + } else { + p.enc = (*Buffer).enc_slice_bool + p.size = size_slice_bool + } + p.dec = (*Buffer).dec_slice_bool + p.packedDec = (*Buffer).dec_slice_packed_bool + case reflect.Int32: + if p.Packed { + p.enc = (*Buffer).enc_slice_packed_int32 + p.size = size_slice_packed_int32 + } else { + p.enc = (*Buffer).enc_slice_int32 + p.size = size_slice_int32 + } + p.dec = (*Buffer).dec_slice_int32 + p.packedDec = (*Buffer).dec_slice_packed_int32 + case reflect.Uint32: + if p.Packed { + p.enc = (*Buffer).enc_slice_packed_uint32 + p.size = size_slice_packed_uint32 + } else { + p.enc = (*Buffer).enc_slice_uint32 + p.size = size_slice_uint32 + } + p.dec = (*Buffer).dec_slice_int32 + p.packedDec = (*Buffer).dec_slice_packed_int32 + case reflect.Int64, reflect.Uint64: + if p.Packed { + p.enc = (*Buffer).enc_slice_packed_int64 + p.size = size_slice_packed_int64 + } else { + p.enc = (*Buffer).enc_slice_int64 + p.size = size_slice_int64 + } + p.dec = (*Buffer).dec_slice_int64 + p.packedDec = (*Buffer).dec_slice_packed_int64 + case reflect.Uint8: + p.dec = (*Buffer).dec_slice_byte + if p.proto3 { + p.enc = (*Buffer).enc_proto3_slice_byte + p.size = size_proto3_slice_byte + } else { + p.enc = (*Buffer).enc_slice_byte + p.size = size_slice_byte + } + case reflect.Float32, reflect.Float64: + switch t2.Bits() { + case 32: + // can just treat them as bits + if p.Packed { + p.enc = (*Buffer).enc_slice_packed_uint32 + p.size = size_slice_packed_uint32 + } else { + p.enc = (*Buffer).enc_slice_uint32 + p.size = size_slice_uint32 + } + p.dec = (*Buffer).dec_slice_int32 + p.packedDec = (*Buffer).dec_slice_packed_int32 + case 64: + // can just treat them as bits + if p.Packed { + p.enc = (*Buffer).enc_slice_packed_int64 + p.size = size_slice_packed_int64 + } else { + p.enc = (*Buffer).enc_slice_int64 + p.size = size_slice_int64 + } + p.dec = (*Buffer).dec_slice_int64 + p.packedDec = (*Buffer).dec_slice_packed_int64 + default: + logNoSliceEnc(t1, t2) + break + } + case reflect.String: + p.enc = (*Buffer).enc_slice_string + p.dec = (*Buffer).dec_slice_string + p.size = size_slice_string + case reflect.Ptr: + switch t3 := t2.Elem(); t3.Kind() { + default: + fmt.Fprintf(os.Stderr, "proto: no ptr oenc for %T -> %T -> %T\n", t1, t2, t3) + break + case reflect.Struct: + p.stype = t2.Elem() + p.isMarshaler = isMarshaler(t2) + p.isUnmarshaler = isUnmarshaler(t2) + if p.Wire == "bytes" { + p.enc = (*Buffer).enc_slice_struct_message + p.dec = (*Buffer).dec_slice_struct_message + p.size = size_slice_struct_message + } else { + p.enc = (*Buffer).enc_slice_struct_group + p.dec = (*Buffer).dec_slice_struct_group + p.size = size_slice_struct_group + } + } + case reflect.Slice: + switch t2.Elem().Kind() { + default: + fmt.Fprintf(os.Stderr, "proto: no slice elem oenc for %T -> %T -> %T\n", t1, t2, t2.Elem()) + break + case reflect.Uint8: + p.enc = (*Buffer).enc_slice_slice_byte + p.dec = (*Buffer).dec_slice_slice_byte + p.size = size_slice_slice_byte + } + case reflect.Struct: + p.setSliceOfNonPointerStructs(t1) + } + + case reflect.Map: + p.enc = (*Buffer).enc_new_map + p.dec = (*Buffer).dec_new_map + p.size = size_new_map + + p.mtype = t1 + p.mkeyprop = &Properties{} + p.mkeyprop.init(reflect.PtrTo(p.mtype.Key()), "Key", f.Tag.Get("protobuf_key"), nil, lockGetProp) + p.mvalprop = &Properties{} + vtype := p.mtype.Elem() + if vtype.Kind() != reflect.Ptr && vtype.Kind() != reflect.Slice { + // The value type is not a message (*T) or bytes ([]byte), + // so we need encoders for the pointer to this type. + vtype = reflect.PtrTo(vtype) + } + + p.mvalprop.CustomType = p.CustomType + p.mvalprop.StdDuration = p.StdDuration + p.mvalprop.StdTime = p.StdTime + p.mvalprop.init(vtype, "Value", f.Tag.Get("protobuf_val"), nil, lockGetProp) + } + p.setTag(lockGetProp) +} + +func (p *Properties) setTag(lockGetProp bool) { + // precalculate tag code + wire := p.WireType + if p.Packed { + wire = WireBytes + } + x := uint32(p.Tag)<<3 | uint32(wire) + i := 0 + for i = 0; x > 127; i++ { + p.tagbuf[i] = 0x80 | uint8(x&0x7F) + x >>= 7 + } + p.tagbuf[i] = uint8(x) + p.tagcode = p.tagbuf[0 : i+1] + + if p.stype != nil { + if lockGetProp { + p.sprop = GetProperties(p.stype) + } else { + p.sprop = getPropertiesLocked(p.stype) + } + } +} + +var ( + marshalerType = reflect.TypeOf((*Marshaler)(nil)).Elem() + unmarshalerType = reflect.TypeOf((*Unmarshaler)(nil)).Elem() +) + +// isMarshaler reports whether type t implements Marshaler. +func isMarshaler(t reflect.Type) bool { + return t.Implements(marshalerType) +} + +// isUnmarshaler reports whether type t implements Unmarshaler. +func isUnmarshaler(t reflect.Type) bool { + return t.Implements(unmarshalerType) +} + +// Init populates the properties from a protocol buffer struct tag. +func (p *Properties) Init(typ reflect.Type, name, tag string, f *reflect.StructField) { + p.init(typ, name, tag, f, true) +} + +func (p *Properties) init(typ reflect.Type, name, tag string, f *reflect.StructField, lockGetProp bool) { + // "bytes,49,opt,def=hello!" + p.Name = name + p.OrigName = name + if f != nil { + p.field = toField(f) + } + if tag == "" { + return + } + p.Parse(tag) + p.setEncAndDec(typ, f, lockGetProp) +} + +var ( + propertiesMu sync.RWMutex + propertiesMap = make(map[reflect.Type]*StructProperties) +) + +// GetProperties returns the list of properties for the type represented by t. +// t must represent a generated struct type of a protocol message. +func GetProperties(t reflect.Type) *StructProperties { + if t.Kind() != reflect.Struct { + panic("proto: type must have kind struct") + } + + // Most calls to GetProperties in a long-running program will be + // retrieving details for types we have seen before. + propertiesMu.RLock() + sprop, ok := propertiesMap[t] + propertiesMu.RUnlock() + if ok { + if collectStats { + stats.Chit++ + } + return sprop + } + + propertiesMu.Lock() + sprop = getPropertiesLocked(t) + propertiesMu.Unlock() + return sprop +} + +// getPropertiesLocked requires that propertiesMu is held. +func getPropertiesLocked(t reflect.Type) *StructProperties { + if prop, ok := propertiesMap[t]; ok { + if collectStats { + stats.Chit++ + } + return prop + } + if collectStats { + stats.Cmiss++ + } + + prop := new(StructProperties) + // in case of recursive protos, fill this in now. + propertiesMap[t] = prop + + // build properties + prop.extendable = reflect.PtrTo(t).Implements(extendableProtoType) || + reflect.PtrTo(t).Implements(extendableProtoV1Type) || + reflect.PtrTo(t).Implements(extendableBytesType) + prop.unrecField = invalidField + prop.Prop = make([]*Properties, t.NumField()) + prop.order = make([]int, t.NumField()) + + isOneofMessage := false + for i := 0; i < t.NumField(); i++ { + f := t.Field(i) + p := new(Properties) + name := f.Name + p.init(f.Type, name, f.Tag.Get("protobuf"), &f, false) + + if f.Name == "XXX_InternalExtensions" { // special case + p.enc = (*Buffer).enc_exts + p.dec = nil // not needed + p.size = size_exts + } else if f.Name == "XXX_extensions" { // special case + if len(f.Tag.Get("protobuf")) > 0 { + p.enc = (*Buffer).enc_ext_slice_byte + p.dec = nil // not needed + p.size = size_ext_slice_byte + } else { + p.enc = (*Buffer).enc_map + p.dec = nil // not needed + p.size = size_map + } + } else if f.Name == "XXX_unrecognized" { // special case + prop.unrecField = toField(&f) + } + oneof := f.Tag.Get("protobuf_oneof") // special case + if oneof != "" { + isOneofMessage = true + // Oneof fields don't use the traditional protobuf tag. + p.OrigName = oneof + } + prop.Prop[i] = p + prop.order[i] = i + if debug { + print(i, " ", f.Name, " ", t.String(), " ") + if p.Tag > 0 { + print(p.String()) + } + print("\n") + } + if p.enc == nil && !strings.HasPrefix(f.Name, "XXX_") && oneof == "" { + fmt.Fprintln(os.Stderr, "proto: no encoder for", f.Name, f.Type.String(), "[GetProperties]") + } + } + + // Re-order prop.order. + sort.Sort(prop) + + type oneofMessage interface { + XXX_OneofFuncs() (func(Message, *Buffer) error, func(Message, int, int, *Buffer) (bool, error), func(Message) int, []interface{}) + } + if om, ok := reflect.Zero(reflect.PtrTo(t)).Interface().(oneofMessage); isOneofMessage && ok { + var oots []interface{} + prop.oneofMarshaler, prop.oneofUnmarshaler, prop.oneofSizer, oots = om.XXX_OneofFuncs() + prop.stype = t + + // Interpret oneof metadata. + prop.OneofTypes = make(map[string]*OneofProperties) + for _, oot := range oots { + oop := &OneofProperties{ + Type: reflect.ValueOf(oot).Type(), // *T + Prop: new(Properties), + } + sft := oop.Type.Elem().Field(0) + oop.Prop.Name = sft.Name + oop.Prop.Parse(sft.Tag.Get("protobuf")) + // There will be exactly one interface field that + // this new value is assignable to. + for i := 0; i < t.NumField(); i++ { + f := t.Field(i) + if f.Type.Kind() != reflect.Interface { + continue + } + if !oop.Type.AssignableTo(f.Type) { + continue + } + oop.Field = i + break + } + prop.OneofTypes[oop.Prop.OrigName] = oop + } + } + + // build required counts + // build tags + reqCount := 0 + prop.decoderOrigNames = make(map[string]int) + for i, p := range prop.Prop { + if strings.HasPrefix(p.Name, "XXX_") { + // Internal fields should not appear in tags/origNames maps. + // They are handled specially when encoding and decoding. + continue + } + if p.Required { + reqCount++ + } + prop.decoderTags.put(p.Tag, i) + prop.decoderOrigNames[p.OrigName] = i + } + prop.reqCount = reqCount + + return prop +} + +// Return the Properties object for the x[0]'th field of the structure. +func propByIndex(t reflect.Type, x []int) *Properties { + if len(x) != 1 { + fmt.Fprintf(os.Stderr, "proto: field index dimension %d (not 1) for type %s\n", len(x), t) + return nil + } + prop := GetProperties(t) + return prop.Prop[x[0]] +} + +// Get the address and type of a pointer to a struct from an interface. +func getbase(pb Message) (t reflect.Type, b structPointer, err error) { + if pb == nil { + err = ErrNil + return + } + // get the reflect type of the pointer to the struct. + t = reflect.TypeOf(pb) + // get the address of the struct. + value := reflect.ValueOf(pb) + b = toStructPointer(value) + return +} + +// A global registry of enum types. +// The generated code will register the generated maps by calling RegisterEnum. + +var enumValueMaps = make(map[string]map[string]int32) +var enumStringMaps = make(map[string]map[int32]string) + +// RegisterEnum is called from the generated code to install the enum descriptor +// maps into the global table to aid parsing text format protocol buffers. +func RegisterEnum(typeName string, unusedNameMap map[int32]string, valueMap map[string]int32) { + if _, ok := enumValueMaps[typeName]; ok { + panic("proto: duplicate enum registered: " + typeName) + } + enumValueMaps[typeName] = valueMap + if _, ok := enumStringMaps[typeName]; ok { + panic("proto: duplicate enum registered: " + typeName) + } + enumStringMaps[typeName] = unusedNameMap +} + +// EnumValueMap returns the mapping from names to integers of the +// enum type enumType, or a nil if not found. +func EnumValueMap(enumType string) map[string]int32 { + return enumValueMaps[enumType] +} + +// A registry of all linked message types. +// The string is a fully-qualified proto name ("pkg.Message"). +var ( + protoTypes = make(map[string]reflect.Type) + revProtoTypes = make(map[reflect.Type]string) +) + +// RegisterType is called from generated code and maps from the fully qualified +// proto name to the type (pointer to struct) of the protocol buffer. +func RegisterType(x Message, name string) { + if _, ok := protoTypes[name]; ok { + // TODO: Some day, make this a panic. + log.Printf("proto: duplicate proto type registered: %s", name) + return + } + t := reflect.TypeOf(x) + protoTypes[name] = t + revProtoTypes[t] = name +} + +// MessageName returns the fully-qualified proto name for the given message type. +func MessageName(x Message) string { + type xname interface { + XXX_MessageName() string + } + if m, ok := x.(xname); ok { + return m.XXX_MessageName() + } + return revProtoTypes[reflect.TypeOf(x)] +} + +// MessageType returns the message type (pointer to struct) for a named message. +func MessageType(name string) reflect.Type { return protoTypes[name] } + +// A registry of all linked proto files. +var ( + protoFiles = make(map[string][]byte) // file name => fileDescriptor +) + +// RegisterFile is called from generated code and maps from the +// full file name of a .proto file to its compressed FileDescriptorProto. +func RegisterFile(filename string, fileDescriptor []byte) { + protoFiles[filename] = fileDescriptor +} + +// FileDescriptor returns the compressed FileDescriptorProto for a .proto file. +func FileDescriptor(filename string) []byte { return protoFiles[filename] } diff --git a/vendor/github.com/gogo/protobuf/proto/properties_gogo.go b/vendor/github.com/gogo/protobuf/proto/properties_gogo.go new file mode 100644 index 000000000..b6b7176c5 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/properties_gogo.go @@ -0,0 +1,111 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "fmt" + "os" + "reflect" +) + +func (p *Properties) setCustomEncAndDec(typ reflect.Type) { + p.ctype = typ + if p.Repeated { + p.enc = (*Buffer).enc_custom_slice_bytes + p.dec = (*Buffer).dec_custom_slice_bytes + p.size = size_custom_slice_bytes + } else if typ.Kind() == reflect.Ptr { + p.enc = (*Buffer).enc_custom_bytes + p.dec = (*Buffer).dec_custom_bytes + p.size = size_custom_bytes + } else { + p.enc = (*Buffer).enc_custom_ref_bytes + p.dec = (*Buffer).dec_custom_ref_bytes + p.size = size_custom_ref_bytes + } +} + +func (p *Properties) setDurationEncAndDec(typ reflect.Type) { + if p.Repeated { + if typ.Elem().Kind() == reflect.Ptr { + p.enc = (*Buffer).enc_slice_duration + p.dec = (*Buffer).dec_slice_duration + p.size = size_slice_duration + } else { + p.enc = (*Buffer).enc_slice_ref_duration + p.dec = (*Buffer).dec_slice_ref_duration + p.size = size_slice_ref_duration + } + } else if typ.Kind() == reflect.Ptr { + p.enc = (*Buffer).enc_duration + p.dec = (*Buffer).dec_duration + p.size = size_duration + } else { + p.enc = (*Buffer).enc_ref_duration + p.dec = (*Buffer).dec_ref_duration + p.size = size_ref_duration + } +} + +func (p *Properties) setTimeEncAndDec(typ reflect.Type) { + if p.Repeated { + if typ.Elem().Kind() == reflect.Ptr { + p.enc = (*Buffer).enc_slice_time + p.dec = (*Buffer).dec_slice_time + p.size = size_slice_time + } else { + p.enc = (*Buffer).enc_slice_ref_time + p.dec = (*Buffer).dec_slice_ref_time + p.size = size_slice_ref_time + } + } else if typ.Kind() == reflect.Ptr { + p.enc = (*Buffer).enc_time + p.dec = (*Buffer).dec_time + p.size = size_time + } else { + p.enc = (*Buffer).enc_ref_time + p.dec = (*Buffer).dec_ref_time + p.size = size_ref_time + } + +} + +func (p *Properties) setSliceOfNonPointerStructs(typ reflect.Type) { + t2 := typ.Elem() + p.sstype = typ + p.stype = t2 + p.isMarshaler = isMarshaler(t2) + p.isUnmarshaler = isUnmarshaler(t2) + p.enc = (*Buffer).enc_slice_ref_struct_message + p.dec = (*Buffer).dec_slice_ref_struct_message + p.size = size_slice_ref_struct_message + if p.Wire != "bytes" { + fmt.Fprintf(os.Stderr, "proto: no ptr oenc for %T -> %T \n", typ, t2) + } +} diff --git a/vendor/github.com/gogo/protobuf/proto/skip_gogo.go b/vendor/github.com/gogo/protobuf/proto/skip_gogo.go new file mode 100644 index 000000000..5a5fd93f7 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/skip_gogo.go @@ -0,0 +1,119 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "fmt" + "io" +) + +func Skip(data []byte) (n int, err error) { + l := len(data) + index := 0 + for index < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if index >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[index] + index++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for { + if index >= l { + return 0, io.ErrUnexpectedEOF + } + index++ + if data[index-1] < 0x80 { + break + } + } + return index, nil + case 1: + index += 8 + return index, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if index >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[index] + index++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + index += length + return index, nil + case 3: + for { + var innerWire uint64 + var start int = index + for shift := uint(0); ; shift += 7 { + if index >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[index] + index++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := Skip(data[start:]) + if err != nil { + return 0, err + } + index = start + next + } + return index, nil + case 4: + return index, nil + case 5: + index += 4 + return index, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} diff --git a/vendor/github.com/gogo/protobuf/proto/text.go b/vendor/github.com/gogo/protobuf/proto/text.go new file mode 100644 index 000000000..d63732fcb --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/text.go @@ -0,0 +1,928 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +// Functions for writing the text protocol buffer format. + +import ( + "bufio" + "bytes" + "encoding" + "errors" + "fmt" + "io" + "log" + "math" + "reflect" + "sort" + "strings" + "sync" + "time" +) + +var ( + newline = []byte("\n") + spaces = []byte(" ") + gtNewline = []byte(">\n") + endBraceNewline = []byte("}\n") + backslashN = []byte{'\\', 'n'} + backslashR = []byte{'\\', 'r'} + backslashT = []byte{'\\', 't'} + backslashDQ = []byte{'\\', '"'} + backslashBS = []byte{'\\', '\\'} + posInf = []byte("inf") + negInf = []byte("-inf") + nan = []byte("nan") +) + +type writer interface { + io.Writer + WriteByte(byte) error +} + +// textWriter is an io.Writer that tracks its indentation level. +type textWriter struct { + ind int + complete bool // if the current position is a complete line + compact bool // whether to write out as a one-liner + w writer +} + +func (w *textWriter) WriteString(s string) (n int, err error) { + if !strings.Contains(s, "\n") { + if !w.compact && w.complete { + w.writeIndent() + } + w.complete = false + return io.WriteString(w.w, s) + } + // WriteString is typically called without newlines, so this + // codepath and its copy are rare. We copy to avoid + // duplicating all of Write's logic here. + return w.Write([]byte(s)) +} + +func (w *textWriter) Write(p []byte) (n int, err error) { + newlines := bytes.Count(p, newline) + if newlines == 0 { + if !w.compact && w.complete { + w.writeIndent() + } + n, err = w.w.Write(p) + w.complete = false + return n, err + } + + frags := bytes.SplitN(p, newline, newlines+1) + if w.compact { + for i, frag := range frags { + if i > 0 { + if err := w.w.WriteByte(' '); err != nil { + return n, err + } + n++ + } + nn, err := w.w.Write(frag) + n += nn + if err != nil { + return n, err + } + } + return n, nil + } + + for i, frag := range frags { + if w.complete { + w.writeIndent() + } + nn, err := w.w.Write(frag) + n += nn + if err != nil { + return n, err + } + if i+1 < len(frags) { + if err := w.w.WriteByte('\n'); err != nil { + return n, err + } + n++ + } + } + w.complete = len(frags[len(frags)-1]) == 0 + return n, nil +} + +func (w *textWriter) WriteByte(c byte) error { + if w.compact && c == '\n' { + c = ' ' + } + if !w.compact && w.complete { + w.writeIndent() + } + err := w.w.WriteByte(c) + w.complete = c == '\n' + return err +} + +func (w *textWriter) indent() { w.ind++ } + +func (w *textWriter) unindent() { + if w.ind == 0 { + log.Print("proto: textWriter unindented too far") + return + } + w.ind-- +} + +func writeName(w *textWriter, props *Properties) error { + if _, err := w.WriteString(props.OrigName); err != nil { + return err + } + if props.Wire != "group" { + return w.WriteByte(':') + } + return nil +} + +// raw is the interface satisfied by RawMessage. +type raw interface { + Bytes() []byte +} + +func requiresQuotes(u string) bool { + // When type URL contains any characters except [0-9A-Za-z./\-]*, it must be quoted. + for _, ch := range u { + switch { + case ch == '.' || ch == '/' || ch == '_': + continue + case '0' <= ch && ch <= '9': + continue + case 'A' <= ch && ch <= 'Z': + continue + case 'a' <= ch && ch <= 'z': + continue + default: + return true + } + } + return false +} + +// isAny reports whether sv is a google.protobuf.Any message +func isAny(sv reflect.Value) bool { + type wkt interface { + XXX_WellKnownType() string + } + t, ok := sv.Addr().Interface().(wkt) + return ok && t.XXX_WellKnownType() == "Any" +} + +// writeProto3Any writes an expanded google.protobuf.Any message. +// +// It returns (false, nil) if sv value can't be unmarshaled (e.g. because +// required messages are not linked in). +// +// It returns (true, error) when sv was written in expanded format or an error +// was encountered. +func (tm *TextMarshaler) writeProto3Any(w *textWriter, sv reflect.Value) (bool, error) { + turl := sv.FieldByName("TypeUrl") + val := sv.FieldByName("Value") + if !turl.IsValid() || !val.IsValid() { + return true, errors.New("proto: invalid google.protobuf.Any message") + } + + b, ok := val.Interface().([]byte) + if !ok { + return true, errors.New("proto: invalid google.protobuf.Any message") + } + + parts := strings.Split(turl.String(), "/") + mt := MessageType(parts[len(parts)-1]) + if mt == nil { + return false, nil + } + m := reflect.New(mt.Elem()) + if err := Unmarshal(b, m.Interface().(Message)); err != nil { + return false, nil + } + w.Write([]byte("[")) + u := turl.String() + if requiresQuotes(u) { + writeString(w, u) + } else { + w.Write([]byte(u)) + } + if w.compact { + w.Write([]byte("]:<")) + } else { + w.Write([]byte("]: <\n")) + w.ind++ + } + if err := tm.writeStruct(w, m.Elem()); err != nil { + return true, err + } + if w.compact { + w.Write([]byte("> ")) + } else { + w.ind-- + w.Write([]byte(">\n")) + } + return true, nil +} + +func (tm *TextMarshaler) writeStruct(w *textWriter, sv reflect.Value) error { + if tm.ExpandAny && isAny(sv) { + if canExpand, err := tm.writeProto3Any(w, sv); canExpand { + return err + } + } + st := sv.Type() + sprops := GetProperties(st) + for i := 0; i < sv.NumField(); i++ { + fv := sv.Field(i) + props := sprops.Prop[i] + name := st.Field(i).Name + + if strings.HasPrefix(name, "XXX_") { + // There are two XXX_ fields: + // XXX_unrecognized []byte + // XXX_extensions map[int32]proto.Extension + // The first is handled here; + // the second is handled at the bottom of this function. + if name == "XXX_unrecognized" && !fv.IsNil() { + if err := writeUnknownStruct(w, fv.Interface().([]byte)); err != nil { + return err + } + } + continue + } + if fv.Kind() == reflect.Ptr && fv.IsNil() { + // Field not filled in. This could be an optional field or + // a required field that wasn't filled in. Either way, there + // isn't anything we can show for it. + continue + } + if fv.Kind() == reflect.Slice && fv.IsNil() { + // Repeated field that is empty, or a bytes field that is unused. + continue + } + + if props.Repeated && fv.Kind() == reflect.Slice { + // Repeated field. + for j := 0; j < fv.Len(); j++ { + if err := writeName(w, props); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + v := fv.Index(j) + if v.Kind() == reflect.Ptr && v.IsNil() { + // A nil message in a repeated field is not valid, + // but we can handle that more gracefully than panicking. + if _, err := w.Write([]byte("\n")); err != nil { + return err + } + continue + } + if len(props.Enum) > 0 { + if err := tm.writeEnum(w, v, props); err != nil { + return err + } + } else if err := tm.writeAny(w, v, props); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + } + continue + } + if fv.Kind() == reflect.Map { + // Map fields are rendered as a repeated struct with key/value fields. + keys := fv.MapKeys() + sort.Sort(mapKeys(keys)) + for _, key := range keys { + val := fv.MapIndex(key) + if err := writeName(w, props); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + // open struct + if err := w.WriteByte('<'); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte('\n'); err != nil { + return err + } + } + w.indent() + // key + if _, err := w.WriteString("key:"); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + if err := tm.writeAny(w, key, props.mkeyprop); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + // nil values aren't legal, but we can avoid panicking because of them. + if val.Kind() != reflect.Ptr || !val.IsNil() { + // value + if _, err := w.WriteString("value:"); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + if err := tm.writeAny(w, val, props.mvalprop); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + } + // close struct + w.unindent() + if err := w.WriteByte('>'); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + } + continue + } + if props.proto3 && fv.Kind() == reflect.Slice && fv.Len() == 0 { + // empty bytes field + continue + } + if props.proto3 && fv.Kind() != reflect.Ptr && fv.Kind() != reflect.Slice { + // proto3 non-repeated scalar field; skip if zero value + if isProto3Zero(fv) { + continue + } + } + + if fv.Kind() == reflect.Interface { + // Check if it is a oneof. + if st.Field(i).Tag.Get("protobuf_oneof") != "" { + // fv is nil, or holds a pointer to generated struct. + // That generated struct has exactly one field, + // which has a protobuf struct tag. + if fv.IsNil() { + continue + } + inner := fv.Elem().Elem() // interface -> *T -> T + tag := inner.Type().Field(0).Tag.Get("protobuf") + props = new(Properties) // Overwrite the outer props var, but not its pointee. + props.Parse(tag) + // Write the value in the oneof, not the oneof itself. + fv = inner.Field(0) + + // Special case to cope with malformed messages gracefully: + // If the value in the oneof is a nil pointer, don't panic + // in writeAny. + if fv.Kind() == reflect.Ptr && fv.IsNil() { + // Use errors.New so writeAny won't render quotes. + msg := errors.New("/* nil */") + fv = reflect.ValueOf(&msg).Elem() + } + } + } + + if err := writeName(w, props); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + if b, ok := fv.Interface().(raw); ok { + if err := writeRaw(w, b.Bytes()); err != nil { + return err + } + continue + } + + if len(props.Enum) > 0 { + if err := tm.writeEnum(w, fv, props); err != nil { + return err + } + } else if err := tm.writeAny(w, fv, props); err != nil { + return err + } + + if err := w.WriteByte('\n'); err != nil { + return err + } + } + + // Extensions (the XXX_extensions field). + pv := sv + if pv.CanAddr() { + pv = sv.Addr() + } else { + pv = reflect.New(sv.Type()) + pv.Elem().Set(sv) + } + if pv.Type().Implements(extensionRangeType) { + if err := tm.writeExtensions(w, pv); err != nil { + return err + } + } + + return nil +} + +// writeRaw writes an uninterpreted raw message. +func writeRaw(w *textWriter, b []byte) error { + if err := w.WriteByte('<'); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte('\n'); err != nil { + return err + } + } + w.indent() + if err := writeUnknownStruct(w, b); err != nil { + return err + } + w.unindent() + if err := w.WriteByte('>'); err != nil { + return err + } + return nil +} + +// writeAny writes an arbitrary field. +func (tm *TextMarshaler) writeAny(w *textWriter, v reflect.Value, props *Properties) error { + v = reflect.Indirect(v) + + if props != nil { + if len(props.CustomType) > 0 { + custom, ok := v.Interface().(Marshaler) + if ok { + data, err := custom.Marshal() + if err != nil { + return err + } + if err := writeString(w, string(data)); err != nil { + return err + } + return nil + } + } else if props.StdTime { + t, ok := v.Interface().(time.Time) + if !ok { + return fmt.Errorf("stdtime is not time.Time, but %T", v.Interface()) + } + tproto, err := timestampProto(t) + if err != nil { + return err + } + props.StdTime = false + err = tm.writeAny(w, reflect.ValueOf(tproto), props) + props.StdTime = true + return err + } else if props.StdDuration { + d, ok := v.Interface().(time.Duration) + if !ok { + return fmt.Errorf("stdtime is not time.Duration, but %T", v.Interface()) + } + dproto := durationProto(d) + props.StdDuration = false + err := tm.writeAny(w, reflect.ValueOf(dproto), props) + props.StdDuration = true + return err + } + } + + // Floats have special cases. + if v.Kind() == reflect.Float32 || v.Kind() == reflect.Float64 { + x := v.Float() + var b []byte + switch { + case math.IsInf(x, 1): + b = posInf + case math.IsInf(x, -1): + b = negInf + case math.IsNaN(x): + b = nan + } + if b != nil { + _, err := w.Write(b) + return err + } + // Other values are handled below. + } + + // We don't attempt to serialise every possible value type; only those + // that can occur in protocol buffers. + switch v.Kind() { + case reflect.Slice: + // Should only be a []byte; repeated fields are handled in writeStruct. + if err := writeString(w, string(v.Bytes())); err != nil { + return err + } + case reflect.String: + if err := writeString(w, v.String()); err != nil { + return err + } + case reflect.Struct: + // Required/optional group/message. + var bra, ket byte = '<', '>' + if props != nil && props.Wire == "group" { + bra, ket = '{', '}' + } + if err := w.WriteByte(bra); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte('\n'); err != nil { + return err + } + } + w.indent() + if etm, ok := v.Interface().(encoding.TextMarshaler); ok { + text, err := etm.MarshalText() + if err != nil { + return err + } + if _, err = w.Write(text); err != nil { + return err + } + } else if err := tm.writeStruct(w, v); err != nil { + return err + } + w.unindent() + if err := w.WriteByte(ket); err != nil { + return err + } + default: + _, err := fmt.Fprint(w, v.Interface()) + return err + } + return nil +} + +// equivalent to C's isprint. +func isprint(c byte) bool { + return c >= 0x20 && c < 0x7f +} + +// writeString writes a string in the protocol buffer text format. +// It is similar to strconv.Quote except we don't use Go escape sequences, +// we treat the string as a byte sequence, and we use octal escapes. +// These differences are to maintain interoperability with the other +// languages' implementations of the text format. +func writeString(w *textWriter, s string) error { + // use WriteByte here to get any needed indent + if err := w.WriteByte('"'); err != nil { + return err + } + // Loop over the bytes, not the runes. + for i := 0; i < len(s); i++ { + var err error + // Divergence from C++: we don't escape apostrophes. + // There's no need to escape them, and the C++ parser + // copes with a naked apostrophe. + switch c := s[i]; c { + case '\n': + _, err = w.w.Write(backslashN) + case '\r': + _, err = w.w.Write(backslashR) + case '\t': + _, err = w.w.Write(backslashT) + case '"': + _, err = w.w.Write(backslashDQ) + case '\\': + _, err = w.w.Write(backslashBS) + default: + if isprint(c) { + err = w.w.WriteByte(c) + } else { + _, err = fmt.Fprintf(w.w, "\\%03o", c) + } + } + if err != nil { + return err + } + } + return w.WriteByte('"') +} + +func writeUnknownStruct(w *textWriter, data []byte) (err error) { + if !w.compact { + if _, err := fmt.Fprintf(w, "/* %d unknown bytes */\n", len(data)); err != nil { + return err + } + } + b := NewBuffer(data) + for b.index < len(b.buf) { + x, err := b.DecodeVarint() + if err != nil { + _, ferr := fmt.Fprintf(w, "/* %v */\n", err) + return ferr + } + wire, tag := x&7, x>>3 + if wire == WireEndGroup { + w.unindent() + if _, werr := w.Write(endBraceNewline); werr != nil { + return werr + } + continue + } + if _, ferr := fmt.Fprint(w, tag); ferr != nil { + return ferr + } + if wire != WireStartGroup { + if err = w.WriteByte(':'); err != nil { + return err + } + } + if !w.compact || wire == WireStartGroup { + if err = w.WriteByte(' '); err != nil { + return err + } + } + switch wire { + case WireBytes: + buf, e := b.DecodeRawBytes(false) + if e == nil { + _, err = fmt.Fprintf(w, "%q", buf) + } else { + _, err = fmt.Fprintf(w, "/* %v */", e) + } + case WireFixed32: + x, err = b.DecodeFixed32() + err = writeUnknownInt(w, x, err) + case WireFixed64: + x, err = b.DecodeFixed64() + err = writeUnknownInt(w, x, err) + case WireStartGroup: + err = w.WriteByte('{') + w.indent() + case WireVarint: + x, err = b.DecodeVarint() + err = writeUnknownInt(w, x, err) + default: + _, err = fmt.Fprintf(w, "/* unknown wire type %d */", wire) + } + if err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + } + return nil +} + +func writeUnknownInt(w *textWriter, x uint64, err error) error { + if err == nil { + _, err = fmt.Fprint(w, x) + } else { + _, err = fmt.Fprintf(w, "/* %v */", err) + } + return err +} + +type int32Slice []int32 + +func (s int32Slice) Len() int { return len(s) } +func (s int32Slice) Less(i, j int) bool { return s[i] < s[j] } +func (s int32Slice) Swap(i, j int) { s[i], s[j] = s[j], s[i] } + +// writeExtensions writes all the extensions in pv. +// pv is assumed to be a pointer to a protocol message struct that is extendable. +func (tm *TextMarshaler) writeExtensions(w *textWriter, pv reflect.Value) error { + emap := extensionMaps[pv.Type().Elem()] + e := pv.Interface().(Message) + + var m map[int32]Extension + var mu sync.Locker + if em, ok := e.(extensionsBytes); ok { + eb := em.GetExtensions() + var err error + m, err = BytesToExtensionsMap(*eb) + if err != nil { + return err + } + mu = notLocker{} + } else if _, ok := e.(extendableProto); ok { + ep, _ := extendable(e) + m, mu = ep.extensionsRead() + if m == nil { + return nil + } + } + + // Order the extensions by ID. + // This isn't strictly necessary, but it will give us + // canonical output, which will also make testing easier. + + mu.Lock() + ids := make([]int32, 0, len(m)) + for id := range m { + ids = append(ids, id) + } + sort.Sort(int32Slice(ids)) + mu.Unlock() + + for _, extNum := range ids { + ext := m[extNum] + var desc *ExtensionDesc + if emap != nil { + desc = emap[extNum] + } + if desc == nil { + // Unknown extension. + if err := writeUnknownStruct(w, ext.enc); err != nil { + return err + } + continue + } + + pb, err := GetExtension(e, desc) + if err != nil { + return fmt.Errorf("failed getting extension: %v", err) + } + + // Repeated extensions will appear as a slice. + if !desc.repeated() { + if err := tm.writeExtension(w, desc.Name, pb); err != nil { + return err + } + } else { + v := reflect.ValueOf(pb) + for i := 0; i < v.Len(); i++ { + if err := tm.writeExtension(w, desc.Name, v.Index(i).Interface()); err != nil { + return err + } + } + } + } + return nil +} + +func (tm *TextMarshaler) writeExtension(w *textWriter, name string, pb interface{}) error { + if _, err := fmt.Fprintf(w, "[%s]:", name); err != nil { + return err + } + if !w.compact { + if err := w.WriteByte(' '); err != nil { + return err + } + } + if err := tm.writeAny(w, reflect.ValueOf(pb), nil); err != nil { + return err + } + if err := w.WriteByte('\n'); err != nil { + return err + } + return nil +} + +func (w *textWriter) writeIndent() { + if !w.complete { + return + } + remain := w.ind * 2 + for remain > 0 { + n := remain + if n > len(spaces) { + n = len(spaces) + } + w.w.Write(spaces[:n]) + remain -= n + } + w.complete = false +} + +// TextMarshaler is a configurable text format marshaler. +type TextMarshaler struct { + Compact bool // use compact text format (one line). + ExpandAny bool // expand google.protobuf.Any messages of known types +} + +// Marshal writes a given protocol buffer in text format. +// The only errors returned are from w. +func (tm *TextMarshaler) Marshal(w io.Writer, pb Message) error { + val := reflect.ValueOf(pb) + if pb == nil || val.IsNil() { + w.Write([]byte("")) + return nil + } + var bw *bufio.Writer + ww, ok := w.(writer) + if !ok { + bw = bufio.NewWriter(w) + ww = bw + } + aw := &textWriter{ + w: ww, + complete: true, + compact: tm.Compact, + } + + if etm, ok := pb.(encoding.TextMarshaler); ok { + text, err := etm.MarshalText() + if err != nil { + return err + } + if _, err = aw.Write(text); err != nil { + return err + } + if bw != nil { + return bw.Flush() + } + return nil + } + // Dereference the received pointer so we don't have outer < and >. + v := reflect.Indirect(val) + if err := tm.writeStruct(aw, v); err != nil { + return err + } + if bw != nil { + return bw.Flush() + } + return nil +} + +// Text is the same as Marshal, but returns the string directly. +func (tm *TextMarshaler) Text(pb Message) string { + var buf bytes.Buffer + tm.Marshal(&buf, pb) + return buf.String() +} + +var ( + defaultTextMarshaler = TextMarshaler{} + compactTextMarshaler = TextMarshaler{Compact: true} +) + +// TODO: consider removing some of the Marshal functions below. + +// MarshalText writes a given protocol buffer in text format. +// The only errors returned are from w. +func MarshalText(w io.Writer, pb Message) error { return defaultTextMarshaler.Marshal(w, pb) } + +// MarshalTextString is the same as MarshalText, but returns the string directly. +func MarshalTextString(pb Message) string { return defaultTextMarshaler.Text(pb) } + +// CompactText writes a given protocol buffer in compact text format (one line). +func CompactText(w io.Writer, pb Message) error { return compactTextMarshaler.Marshal(w, pb) } + +// CompactTextString is the same as CompactText, but returns the string directly. +func CompactTextString(pb Message) string { return compactTextMarshaler.Text(pb) } diff --git a/vendor/github.com/gogo/protobuf/proto/text_gogo.go b/vendor/github.com/gogo/protobuf/proto/text_gogo.go new file mode 100644 index 000000000..1d6c6aa0e --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/text_gogo.go @@ -0,0 +1,57 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "fmt" + "reflect" +) + +func (tm *TextMarshaler) writeEnum(w *textWriter, v reflect.Value, props *Properties) error { + m, ok := enumStringMaps[props.Enum] + if !ok { + if err := tm.writeAny(w, v, props); err != nil { + return err + } + } + key := int32(0) + if v.Kind() == reflect.Ptr { + key = int32(v.Elem().Int()) + } else { + key = int32(v.Int()) + } + s, ok := m[key] + if !ok { + if err := tm.writeAny(w, v, props); err != nil { + return err + } + } + _, err := fmt.Fprint(w, s) + return err +} diff --git a/vendor/github.com/gogo/protobuf/proto/text_parser.go b/vendor/github.com/gogo/protobuf/proto/text_parser.go new file mode 100644 index 000000000..9db12e960 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/text_parser.go @@ -0,0 +1,1013 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2010 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +// Functions for parsing the Text protocol buffer format. +// TODO: message sets. + +import ( + "encoding" + "errors" + "fmt" + "reflect" + "strconv" + "strings" + "time" + "unicode/utf8" +) + +// Error string emitted when deserializing Any and fields are already set +const anyRepeatedlyUnpacked = "Any message unpacked multiple times, or %q already set" + +type ParseError struct { + Message string + Line int // 1-based line number + Offset int // 0-based byte offset from start of input +} + +func (p *ParseError) Error() string { + if p.Line == 1 { + // show offset only for first line + return fmt.Sprintf("line 1.%d: %v", p.Offset, p.Message) + } + return fmt.Sprintf("line %d: %v", p.Line, p.Message) +} + +type token struct { + value string + err *ParseError + line int // line number + offset int // byte number from start of input, not start of line + unquoted string // the unquoted version of value, if it was a quoted string +} + +func (t *token) String() string { + if t.err == nil { + return fmt.Sprintf("%q (line=%d, offset=%d)", t.value, t.line, t.offset) + } + return fmt.Sprintf("parse error: %v", t.err) +} + +type textParser struct { + s string // remaining input + done bool // whether the parsing is finished (success or error) + backed bool // whether back() was called + offset, line int + cur token +} + +func newTextParser(s string) *textParser { + p := new(textParser) + p.s = s + p.line = 1 + p.cur.line = 1 + return p +} + +func (p *textParser) errorf(format string, a ...interface{}) *ParseError { + pe := &ParseError{fmt.Sprintf(format, a...), p.cur.line, p.cur.offset} + p.cur.err = pe + p.done = true + return pe +} + +// Numbers and identifiers are matched by [-+._A-Za-z0-9] +func isIdentOrNumberChar(c byte) bool { + switch { + case 'A' <= c && c <= 'Z', 'a' <= c && c <= 'z': + return true + case '0' <= c && c <= '9': + return true + } + switch c { + case '-', '+', '.', '_': + return true + } + return false +} + +func isWhitespace(c byte) bool { + switch c { + case ' ', '\t', '\n', '\r': + return true + } + return false +} + +func isQuote(c byte) bool { + switch c { + case '"', '\'': + return true + } + return false +} + +func (p *textParser) skipWhitespace() { + i := 0 + for i < len(p.s) && (isWhitespace(p.s[i]) || p.s[i] == '#') { + if p.s[i] == '#' { + // comment; skip to end of line or input + for i < len(p.s) && p.s[i] != '\n' { + i++ + } + if i == len(p.s) { + break + } + } + if p.s[i] == '\n' { + p.line++ + } + i++ + } + p.offset += i + p.s = p.s[i:len(p.s)] + if len(p.s) == 0 { + p.done = true + } +} + +func (p *textParser) advance() { + // Skip whitespace + p.skipWhitespace() + if p.done { + return + } + + // Start of non-whitespace + p.cur.err = nil + p.cur.offset, p.cur.line = p.offset, p.line + p.cur.unquoted = "" + switch p.s[0] { + case '<', '>', '{', '}', ':', '[', ']', ';', ',', '/': + // Single symbol + p.cur.value, p.s = p.s[0:1], p.s[1:len(p.s)] + case '"', '\'': + // Quoted string + i := 1 + for i < len(p.s) && p.s[i] != p.s[0] && p.s[i] != '\n' { + if p.s[i] == '\\' && i+1 < len(p.s) { + // skip escaped char + i++ + } + i++ + } + if i >= len(p.s) || p.s[i] != p.s[0] { + p.errorf("unmatched quote") + return + } + unq, err := unquoteC(p.s[1:i], rune(p.s[0])) + if err != nil { + p.errorf("invalid quoted string %s: %v", p.s[0:i+1], err) + return + } + p.cur.value, p.s = p.s[0:i+1], p.s[i+1:len(p.s)] + p.cur.unquoted = unq + default: + i := 0 + for i < len(p.s) && isIdentOrNumberChar(p.s[i]) { + i++ + } + if i == 0 { + p.errorf("unexpected byte %#x", p.s[0]) + return + } + p.cur.value, p.s = p.s[0:i], p.s[i:len(p.s)] + } + p.offset += len(p.cur.value) +} + +var ( + errBadUTF8 = errors.New("proto: bad UTF-8") + errBadHex = errors.New("proto: bad hexadecimal") +) + +func unquoteC(s string, quote rune) (string, error) { + // This is based on C++'s tokenizer.cc. + // Despite its name, this is *not* parsing C syntax. + // For instance, "\0" is an invalid quoted string. + + // Avoid allocation in trivial cases. + simple := true + for _, r := range s { + if r == '\\' || r == quote { + simple = false + break + } + } + if simple { + return s, nil + } + + buf := make([]byte, 0, 3*len(s)/2) + for len(s) > 0 { + r, n := utf8.DecodeRuneInString(s) + if r == utf8.RuneError && n == 1 { + return "", errBadUTF8 + } + s = s[n:] + if r != '\\' { + if r < utf8.RuneSelf { + buf = append(buf, byte(r)) + } else { + buf = append(buf, string(r)...) + } + continue + } + + ch, tail, err := unescape(s) + if err != nil { + return "", err + } + buf = append(buf, ch...) + s = tail + } + return string(buf), nil +} + +func unescape(s string) (ch string, tail string, err error) { + r, n := utf8.DecodeRuneInString(s) + if r == utf8.RuneError && n == 1 { + return "", "", errBadUTF8 + } + s = s[n:] + switch r { + case 'a': + return "\a", s, nil + case 'b': + return "\b", s, nil + case 'f': + return "\f", s, nil + case 'n': + return "\n", s, nil + case 'r': + return "\r", s, nil + case 't': + return "\t", s, nil + case 'v': + return "\v", s, nil + case '?': + return "?", s, nil // trigraph workaround + case '\'', '"', '\\': + return string(r), s, nil + case '0', '1', '2', '3', '4', '5', '6', '7', 'x', 'X': + if len(s) < 2 { + return "", "", fmt.Errorf(`\%c requires 2 following digits`, r) + } + base := 8 + ss := s[:2] + s = s[2:] + if r == 'x' || r == 'X' { + base = 16 + } else { + ss = string(r) + ss + } + i, err := strconv.ParseUint(ss, base, 8) + if err != nil { + return "", "", err + } + return string([]byte{byte(i)}), s, nil + case 'u', 'U': + n := 4 + if r == 'U' { + n = 8 + } + if len(s) < n { + return "", "", fmt.Errorf(`\%c requires %d digits`, r, n) + } + + bs := make([]byte, n/2) + for i := 0; i < n; i += 2 { + a, ok1 := unhex(s[i]) + b, ok2 := unhex(s[i+1]) + if !ok1 || !ok2 { + return "", "", errBadHex + } + bs[i/2] = a<<4 | b + } + s = s[n:] + return string(bs), s, nil + } + return "", "", fmt.Errorf(`unknown escape \%c`, r) +} + +// Adapted from src/pkg/strconv/quote.go. +func unhex(b byte) (v byte, ok bool) { + switch { + case '0' <= b && b <= '9': + return b - '0', true + case 'a' <= b && b <= 'f': + return b - 'a' + 10, true + case 'A' <= b && b <= 'F': + return b - 'A' + 10, true + } + return 0, false +} + +// Back off the parser by one token. Can only be done between calls to next(). +// It makes the next advance() a no-op. +func (p *textParser) back() { p.backed = true } + +// Advances the parser and returns the new current token. +func (p *textParser) next() *token { + if p.backed || p.done { + p.backed = false + return &p.cur + } + p.advance() + if p.done { + p.cur.value = "" + } else if len(p.cur.value) > 0 && isQuote(p.cur.value[0]) { + // Look for multiple quoted strings separated by whitespace, + // and concatenate them. + cat := p.cur + for { + p.skipWhitespace() + if p.done || !isQuote(p.s[0]) { + break + } + p.advance() + if p.cur.err != nil { + return &p.cur + } + cat.value += " " + p.cur.value + cat.unquoted += p.cur.unquoted + } + p.done = false // parser may have seen EOF, but we want to return cat + p.cur = cat + } + return &p.cur +} + +func (p *textParser) consumeToken(s string) error { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value != s { + p.back() + return p.errorf("expected %q, found %q", s, tok.value) + } + return nil +} + +// Return a RequiredNotSetError indicating which required field was not set. +func (p *textParser) missingRequiredFieldError(sv reflect.Value) *RequiredNotSetError { + st := sv.Type() + sprops := GetProperties(st) + for i := 0; i < st.NumField(); i++ { + if !isNil(sv.Field(i)) { + continue + } + + props := sprops.Prop[i] + if props.Required { + return &RequiredNotSetError{fmt.Sprintf("%v.%v", st, props.OrigName)} + } + } + return &RequiredNotSetError{fmt.Sprintf("%v.", st)} // should not happen +} + +// Returns the index in the struct for the named field, as well as the parsed tag properties. +func structFieldByName(sprops *StructProperties, name string) (int, *Properties, bool) { + i, ok := sprops.decoderOrigNames[name] + if ok { + return i, sprops.Prop[i], true + } + return -1, nil, false +} + +// Consume a ':' from the input stream (if the next token is a colon), +// returning an error if a colon is needed but not present. +func (p *textParser) checkForColon(props *Properties, typ reflect.Type) *ParseError { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value != ":" { + // Colon is optional when the field is a group or message. + needColon := true + switch props.Wire { + case "group": + needColon = false + case "bytes": + // A "bytes" field is either a message, a string, or a repeated field; + // those three become *T, *string and []T respectively, so we can check for + // this field being a pointer to a non-string. + if typ.Kind() == reflect.Ptr { + // *T or *string + if typ.Elem().Kind() == reflect.String { + break + } + } else if typ.Kind() == reflect.Slice { + // []T or []*T + if typ.Elem().Kind() != reflect.Ptr { + break + } + } else if typ.Kind() == reflect.String { + // The proto3 exception is for a string field, + // which requires a colon. + break + } + needColon = false + } + if needColon { + return p.errorf("expected ':', found %q", tok.value) + } + p.back() + } + return nil +} + +func (p *textParser) readStruct(sv reflect.Value, terminator string) error { + st := sv.Type() + sprops := GetProperties(st) + reqCount := sprops.reqCount + var reqFieldErr error + fieldSet := make(map[string]bool) + // A struct is a sequence of "name: value", terminated by one of + // '>' or '}', or the end of the input. A name may also be + // "[extension]" or "[type/url]". + // + // The whole struct can also be an expanded Any message, like: + // [type/url] < ... struct contents ... > + for { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value == terminator { + break + } + if tok.value == "[" { + // Looks like an extension or an Any. + // + // TODO: Check whether we need to handle + // namespace rooted names (e.g. ".something.Foo"). + extName, err := p.consumeExtName() + if err != nil { + return err + } + + if s := strings.LastIndex(extName, "/"); s >= 0 { + // If it contains a slash, it's an Any type URL. + messageName := extName[s+1:] + mt := MessageType(messageName) + if mt == nil { + return p.errorf("unrecognized message %q in google.protobuf.Any", messageName) + } + tok = p.next() + if tok.err != nil { + return tok.err + } + // consume an optional colon + if tok.value == ":" { + tok = p.next() + if tok.err != nil { + return tok.err + } + } + var terminator string + switch tok.value { + case "<": + terminator = ">" + case "{": + terminator = "}" + default: + return p.errorf("expected '{' or '<', found %q", tok.value) + } + v := reflect.New(mt.Elem()) + if pe := p.readStruct(v.Elem(), terminator); pe != nil { + return pe + } + b, err := Marshal(v.Interface().(Message)) + if err != nil { + return p.errorf("failed to marshal message of type %q: %v", messageName, err) + } + if fieldSet["type_url"] { + return p.errorf(anyRepeatedlyUnpacked, "type_url") + } + if fieldSet["value"] { + return p.errorf(anyRepeatedlyUnpacked, "value") + } + sv.FieldByName("TypeUrl").SetString(extName) + sv.FieldByName("Value").SetBytes(b) + fieldSet["type_url"] = true + fieldSet["value"] = true + continue + } + + var desc *ExtensionDesc + // This could be faster, but it's functional. + // TODO: Do something smarter than a linear scan. + for _, d := range RegisteredExtensions(reflect.New(st).Interface().(Message)) { + if d.Name == extName { + desc = d + break + } + } + if desc == nil { + return p.errorf("unrecognized extension %q", extName) + } + + props := &Properties{} + props.Parse(desc.Tag) + + typ := reflect.TypeOf(desc.ExtensionType) + if err := p.checkForColon(props, typ); err != nil { + return err + } + + rep := desc.repeated() + + // Read the extension structure, and set it in + // the value we're constructing. + var ext reflect.Value + if !rep { + ext = reflect.New(typ).Elem() + } else { + ext = reflect.New(typ.Elem()).Elem() + } + if err := p.readAny(ext, props); err != nil { + if _, ok := err.(*RequiredNotSetError); !ok { + return err + } + reqFieldErr = err + } + ep := sv.Addr().Interface().(Message) + if !rep { + SetExtension(ep, desc, ext.Interface()) + } else { + old, err := GetExtension(ep, desc) + var sl reflect.Value + if err == nil { + sl = reflect.ValueOf(old) // existing slice + } else { + sl = reflect.MakeSlice(typ, 0, 1) + } + sl = reflect.Append(sl, ext) + SetExtension(ep, desc, sl.Interface()) + } + if err := p.consumeOptionalSeparator(); err != nil { + return err + } + continue + } + + // This is a normal, non-extension field. + name := tok.value + var dst reflect.Value + fi, props, ok := structFieldByName(sprops, name) + if ok { + dst = sv.Field(fi) + } else if oop, ok := sprops.OneofTypes[name]; ok { + // It is a oneof. + props = oop.Prop + nv := reflect.New(oop.Type.Elem()) + dst = nv.Elem().Field(0) + field := sv.Field(oop.Field) + if !field.IsNil() { + return p.errorf("field '%s' would overwrite already parsed oneof '%s'", name, sv.Type().Field(oop.Field).Name) + } + field.Set(nv) + } + if !dst.IsValid() { + return p.errorf("unknown field name %q in %v", name, st) + } + + if dst.Kind() == reflect.Map { + // Consume any colon. + if err := p.checkForColon(props, dst.Type()); err != nil { + return err + } + + // Construct the map if it doesn't already exist. + if dst.IsNil() { + dst.Set(reflect.MakeMap(dst.Type())) + } + key := reflect.New(dst.Type().Key()).Elem() + val := reflect.New(dst.Type().Elem()).Elem() + + // The map entry should be this sequence of tokens: + // < key : KEY value : VALUE > + // However, implementations may omit key or value, and technically + // we should support them in any order. See b/28924776 for a time + // this went wrong. + + tok := p.next() + var terminator string + switch tok.value { + case "<": + terminator = ">" + case "{": + terminator = "}" + default: + return p.errorf("expected '{' or '<', found %q", tok.value) + } + for { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value == terminator { + break + } + switch tok.value { + case "key": + if err := p.consumeToken(":"); err != nil { + return err + } + if err := p.readAny(key, props.mkeyprop); err != nil { + return err + } + if err := p.consumeOptionalSeparator(); err != nil { + return err + } + case "value": + if err := p.checkForColon(props.mvalprop, dst.Type().Elem()); err != nil { + return err + } + if err := p.readAny(val, props.mvalprop); err != nil { + return err + } + if err := p.consumeOptionalSeparator(); err != nil { + return err + } + default: + p.back() + return p.errorf(`expected "key", "value", or %q, found %q`, terminator, tok.value) + } + } + + dst.SetMapIndex(key, val) + continue + } + + // Check that it's not already set if it's not a repeated field. + if !props.Repeated && fieldSet[name] { + return p.errorf("non-repeated field %q was repeated", name) + } + + if err := p.checkForColon(props, dst.Type()); err != nil { + return err + } + + // Parse into the field. + fieldSet[name] = true + if err := p.readAny(dst, props); err != nil { + if _, ok := err.(*RequiredNotSetError); !ok { + return err + } + reqFieldErr = err + } + if props.Required { + reqCount-- + } + + if err := p.consumeOptionalSeparator(); err != nil { + return err + } + + } + + if reqCount > 0 { + return p.missingRequiredFieldError(sv) + } + return reqFieldErr +} + +// consumeExtName consumes extension name or expanded Any type URL and the +// following ']'. It returns the name or URL consumed. +func (p *textParser) consumeExtName() (string, error) { + tok := p.next() + if tok.err != nil { + return "", tok.err + } + + // If extension name or type url is quoted, it's a single token. + if len(tok.value) > 2 && isQuote(tok.value[0]) && tok.value[len(tok.value)-1] == tok.value[0] { + name, err := unquoteC(tok.value[1:len(tok.value)-1], rune(tok.value[0])) + if err != nil { + return "", err + } + return name, p.consumeToken("]") + } + + // Consume everything up to "]" + var parts []string + for tok.value != "]" { + parts = append(parts, tok.value) + tok = p.next() + if tok.err != nil { + return "", p.errorf("unrecognized type_url or extension name: %s", tok.err) + } + } + return strings.Join(parts, ""), nil +} + +// consumeOptionalSeparator consumes an optional semicolon or comma. +// It is used in readStruct to provide backward compatibility. +func (p *textParser) consumeOptionalSeparator() error { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value != ";" && tok.value != "," { + p.back() + } + return nil +} + +func (p *textParser) readAny(v reflect.Value, props *Properties) error { + tok := p.next() + if tok.err != nil { + return tok.err + } + if tok.value == "" { + return p.errorf("unexpected EOF") + } + if len(props.CustomType) > 0 { + if props.Repeated { + t := reflect.TypeOf(v.Interface()) + if t.Kind() == reflect.Slice { + tc := reflect.TypeOf(new(Marshaler)) + ok := t.Elem().Implements(tc.Elem()) + if ok { + fv := v + flen := fv.Len() + if flen == fv.Cap() { + nav := reflect.MakeSlice(v.Type(), flen, 2*flen+1) + reflect.Copy(nav, fv) + fv.Set(nav) + } + fv.SetLen(flen + 1) + + // Read one. + p.back() + return p.readAny(fv.Index(flen), props) + } + } + } + if reflect.TypeOf(v.Interface()).Kind() == reflect.Ptr { + custom := reflect.New(props.ctype.Elem()).Interface().(Unmarshaler) + err := custom.Unmarshal([]byte(tok.unquoted)) + if err != nil { + return p.errorf("%v %v: %v", err, v.Type(), tok.value) + } + v.Set(reflect.ValueOf(custom)) + } else { + custom := reflect.New(reflect.TypeOf(v.Interface())).Interface().(Unmarshaler) + err := custom.Unmarshal([]byte(tok.unquoted)) + if err != nil { + return p.errorf("%v %v: %v", err, v.Type(), tok.value) + } + v.Set(reflect.Indirect(reflect.ValueOf(custom))) + } + return nil + } + if props.StdTime { + fv := v + p.back() + props.StdTime = false + tproto := ×tamp{} + err := p.readAny(reflect.ValueOf(tproto).Elem(), props) + props.StdTime = true + if err != nil { + return err + } + tim, err := timestampFromProto(tproto) + if err != nil { + return err + } + if props.Repeated { + t := reflect.TypeOf(v.Interface()) + if t.Kind() == reflect.Slice { + if t.Elem().Kind() == reflect.Ptr { + ts := fv.Interface().([]*time.Time) + ts = append(ts, &tim) + fv.Set(reflect.ValueOf(ts)) + return nil + } else { + ts := fv.Interface().([]time.Time) + ts = append(ts, tim) + fv.Set(reflect.ValueOf(ts)) + return nil + } + } + } + if reflect.TypeOf(v.Interface()).Kind() == reflect.Ptr { + v.Set(reflect.ValueOf(&tim)) + } else { + v.Set(reflect.Indirect(reflect.ValueOf(&tim))) + } + return nil + } + if props.StdDuration { + fv := v + p.back() + props.StdDuration = false + dproto := &duration{} + err := p.readAny(reflect.ValueOf(dproto).Elem(), props) + props.StdDuration = true + if err != nil { + return err + } + dur, err := durationFromProto(dproto) + if err != nil { + return err + } + if props.Repeated { + t := reflect.TypeOf(v.Interface()) + if t.Kind() == reflect.Slice { + if t.Elem().Kind() == reflect.Ptr { + ds := fv.Interface().([]*time.Duration) + ds = append(ds, &dur) + fv.Set(reflect.ValueOf(ds)) + return nil + } else { + ds := fv.Interface().([]time.Duration) + ds = append(ds, dur) + fv.Set(reflect.ValueOf(ds)) + return nil + } + } + } + if reflect.TypeOf(v.Interface()).Kind() == reflect.Ptr { + v.Set(reflect.ValueOf(&dur)) + } else { + v.Set(reflect.Indirect(reflect.ValueOf(&dur))) + } + return nil + } + switch fv := v; fv.Kind() { + case reflect.Slice: + at := v.Type() + if at.Elem().Kind() == reflect.Uint8 { + // Special case for []byte + if tok.value[0] != '"' && tok.value[0] != '\'' { + // Deliberately written out here, as the error after + // this switch statement would write "invalid []byte: ...", + // which is not as user-friendly. + return p.errorf("invalid string: %v", tok.value) + } + bytes := []byte(tok.unquoted) + fv.Set(reflect.ValueOf(bytes)) + return nil + } + // Repeated field. + if tok.value == "[" { + // Repeated field with list notation, like [1,2,3]. + for { + fv.Set(reflect.Append(fv, reflect.New(at.Elem()).Elem())) + err := p.readAny(fv.Index(fv.Len()-1), props) + if err != nil { + return err + } + ntok := p.next() + if ntok.err != nil { + return ntok.err + } + if ntok.value == "]" { + break + } + if ntok.value != "," { + return p.errorf("Expected ']' or ',' found %q", ntok.value) + } + } + return nil + } + // One value of the repeated field. + p.back() + fv.Set(reflect.Append(fv, reflect.New(at.Elem()).Elem())) + return p.readAny(fv.Index(fv.Len()-1), props) + case reflect.Bool: + // true/1/t/True or false/f/0/False. + switch tok.value { + case "true", "1", "t", "True": + fv.SetBool(true) + return nil + case "false", "0", "f", "False": + fv.SetBool(false) + return nil + } + case reflect.Float32, reflect.Float64: + v := tok.value + // Ignore 'f' for compatibility with output generated by C++, but don't + // remove 'f' when the value is "-inf" or "inf". + if strings.HasSuffix(v, "f") && tok.value != "-inf" && tok.value != "inf" { + v = v[:len(v)-1] + } + if f, err := strconv.ParseFloat(v, fv.Type().Bits()); err == nil { + fv.SetFloat(f) + return nil + } + case reflect.Int32: + if x, err := strconv.ParseInt(tok.value, 0, 32); err == nil { + fv.SetInt(x) + return nil + } + + if len(props.Enum) == 0 { + break + } + m, ok := enumValueMaps[props.Enum] + if !ok { + break + } + x, ok := m[tok.value] + if !ok { + break + } + fv.SetInt(int64(x)) + return nil + case reflect.Int64: + if x, err := strconv.ParseInt(tok.value, 0, 64); err == nil { + fv.SetInt(x) + return nil + } + + case reflect.Ptr: + // A basic field (indirected through pointer), or a repeated message/group + p.back() + fv.Set(reflect.New(fv.Type().Elem())) + return p.readAny(fv.Elem(), props) + case reflect.String: + if tok.value[0] == '"' || tok.value[0] == '\'' { + fv.SetString(tok.unquoted) + return nil + } + case reflect.Struct: + var terminator string + switch tok.value { + case "{": + terminator = "}" + case "<": + terminator = ">" + default: + return p.errorf("expected '{' or '<', found %q", tok.value) + } + // TODO: Handle nested messages which implement encoding.TextUnmarshaler. + return p.readStruct(fv, terminator) + case reflect.Uint32: + if x, err := strconv.ParseUint(tok.value, 0, 32); err == nil { + fv.SetUint(uint64(x)) + return nil + } + case reflect.Uint64: + if x, err := strconv.ParseUint(tok.value, 0, 64); err == nil { + fv.SetUint(x) + return nil + } + } + return p.errorf("invalid %v: %v", v.Type(), tok.value) +} + +// UnmarshalText reads a protocol buffer in Text format. UnmarshalText resets pb +// before starting to unmarshal, so any existing data in pb is always removed. +// If a required field is not set and no other error occurs, +// UnmarshalText returns *RequiredNotSetError. +func UnmarshalText(s string, pb Message) error { + if um, ok := pb.(encoding.TextUnmarshaler); ok { + err := um.UnmarshalText([]byte(s)) + return err + } + pb.Reset() + v := reflect.ValueOf(pb) + if pe := newTextParser(s).readStruct(v.Elem(), ""); pe != nil { + return pe + } + return nil +} diff --git a/vendor/github.com/gogo/protobuf/proto/timestamp.go b/vendor/github.com/gogo/protobuf/proto/timestamp.go new file mode 100644 index 000000000..9324f6542 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/timestamp.go @@ -0,0 +1,113 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +// This file implements operations on google.protobuf.Timestamp. + +import ( + "errors" + "fmt" + "time" +) + +const ( + // Seconds field of the earliest valid Timestamp. + // This is time.Date(1, 1, 1, 0, 0, 0, 0, time.UTC).Unix(). + minValidSeconds = -62135596800 + // Seconds field just after the latest valid Timestamp. + // This is time.Date(10000, 1, 1, 0, 0, 0, 0, time.UTC).Unix(). + maxValidSeconds = 253402300800 +) + +// validateTimestamp determines whether a Timestamp is valid. +// A valid timestamp represents a time in the range +// [0001-01-01, 10000-01-01) and has a Nanos field +// in the range [0, 1e9). +// +// If the Timestamp is valid, validateTimestamp returns nil. +// Otherwise, it returns an error that describes +// the problem. +// +// Every valid Timestamp can be represented by a time.Time, but the converse is not true. +func validateTimestamp(ts *timestamp) error { + if ts == nil { + return errors.New("timestamp: nil Timestamp") + } + if ts.Seconds < minValidSeconds { + return fmt.Errorf("timestamp: %#v before 0001-01-01", ts) + } + if ts.Seconds >= maxValidSeconds { + return fmt.Errorf("timestamp: %#v after 10000-01-01", ts) + } + if ts.Nanos < 0 || ts.Nanos >= 1e9 { + return fmt.Errorf("timestamp: %#v: nanos not in range [0, 1e9)", ts) + } + return nil +} + +// TimestampFromProto converts a google.protobuf.Timestamp proto to a time.Time. +// It returns an error if the argument is invalid. +// +// Unlike most Go functions, if Timestamp returns an error, the first return value +// is not the zero time.Time. Instead, it is the value obtained from the +// time.Unix function when passed the contents of the Timestamp, in the UTC +// locale. This may or may not be a meaningful time; many invalid Timestamps +// do map to valid time.Times. +// +// A nil Timestamp returns an error. The first return value in that case is +// undefined. +func timestampFromProto(ts *timestamp) (time.Time, error) { + // Don't return the zero value on error, because corresponds to a valid + // timestamp. Instead return whatever time.Unix gives us. + var t time.Time + if ts == nil { + t = time.Unix(0, 0).UTC() // treat nil like the empty Timestamp + } else { + t = time.Unix(ts.Seconds, int64(ts.Nanos)).UTC() + } + return t, validateTimestamp(ts) +} + +// TimestampProto converts the time.Time to a google.protobuf.Timestamp proto. +// It returns an error if the resulting Timestamp is invalid. +func timestampProto(t time.Time) (*timestamp, error) { + seconds := t.Unix() + nanos := int32(t.Sub(time.Unix(seconds, 0))) + ts := ×tamp{ + Seconds: seconds, + Nanos: nanos, + } + if err := validateTimestamp(ts); err != nil { + return nil, err + } + return ts, nil +} diff --git a/vendor/github.com/gogo/protobuf/proto/timestamp_gogo.go b/vendor/github.com/gogo/protobuf/proto/timestamp_gogo.go new file mode 100644 index 000000000..d42764743 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/proto/timestamp_gogo.go @@ -0,0 +1,229 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2016, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package proto + +import ( + "reflect" + "time" +) + +var timeType = reflect.TypeOf((*time.Time)(nil)).Elem() + +type timestamp struct { + Seconds int64 `protobuf:"varint,1,opt,name=seconds,proto3" json:"seconds,omitempty"` + Nanos int32 `protobuf:"varint,2,opt,name=nanos,proto3" json:"nanos,omitempty"` +} + +func (m *timestamp) Reset() { *m = timestamp{} } +func (*timestamp) ProtoMessage() {} +func (*timestamp) String() string { return "timestamp" } + +func init() { + RegisterType((*timestamp)(nil), "gogo.protobuf.proto.timestamp") +} + +func (o *Buffer) decTimestamp() (time.Time, error) { + b, err := o.DecodeRawBytes(true) + if err != nil { + return time.Time{}, err + } + tproto := ×tamp{} + if err := Unmarshal(b, tproto); err != nil { + return time.Time{}, err + } + return timestampFromProto(tproto) +} + +func (o *Buffer) dec_time(p *Properties, base structPointer) error { + t, err := o.decTimestamp() + if err != nil { + return err + } + setPtrCustomType(base, p.field, &t) + return nil +} + +func (o *Buffer) dec_ref_time(p *Properties, base structPointer) error { + t, err := o.decTimestamp() + if err != nil { + return err + } + setCustomType(base, p.field, &t) + return nil +} + +func (o *Buffer) dec_slice_time(p *Properties, base structPointer) error { + t, err := o.decTimestamp() + if err != nil { + return err + } + newBas := appendStructPointer(base, p.field, reflect.SliceOf(reflect.PtrTo(timeType))) + var zero field + setPtrCustomType(newBas, zero, &t) + return nil +} + +func (o *Buffer) dec_slice_ref_time(p *Properties, base structPointer) error { + t, err := o.decTimestamp() + if err != nil { + return err + } + newBas := appendStructPointer(base, p.field, reflect.SliceOf(timeType)) + var zero field + setCustomType(newBas, zero, &t) + return nil +} + +func size_time(p *Properties, base structPointer) (n int) { + structp := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(structp) { + return 0 + } + tim := structPointer_Interface(structp, timeType).(*time.Time) + t, err := timestampProto(*tim) + if err != nil { + return 0 + } + size := Size(t) + return size + sizeVarint(uint64(size)) + len(p.tagcode) +} + +func (o *Buffer) enc_time(p *Properties, base structPointer) error { + structp := structPointer_GetStructPointer(base, p.field) + if structPointer_IsNil(structp) { + return ErrNil + } + tim := structPointer_Interface(structp, timeType).(*time.Time) + t, err := timestampProto(*tim) + if err != nil { + return err + } + data, err := Marshal(t) + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + return nil +} + +func size_ref_time(p *Properties, base structPointer) (n int) { + tim := structPointer_InterfaceAt(base, p.field, timeType).(*time.Time) + t, err := timestampProto(*tim) + if err != nil { + return 0 + } + size := Size(t) + return size + sizeVarint(uint64(size)) + len(p.tagcode) +} + +func (o *Buffer) enc_ref_time(p *Properties, base structPointer) error { + tim := structPointer_InterfaceAt(base, p.field, timeType).(*time.Time) + t, err := timestampProto(*tim) + if err != nil { + return err + } + data, err := Marshal(t) + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + return nil +} + +func size_slice_time(p *Properties, base structPointer) (n int) { + ptims := structPointer_InterfaceAt(base, p.field, reflect.SliceOf(reflect.PtrTo(timeType))).(*[]*time.Time) + tims := *ptims + for i := 0; i < len(tims); i++ { + if tims[i] == nil { + return 0 + } + tproto, err := timestampProto(*tims[i]) + if err != nil { + return 0 + } + size := Size(tproto) + n += len(p.tagcode) + size + sizeVarint(uint64(size)) + } + return n +} + +func (o *Buffer) enc_slice_time(p *Properties, base structPointer) error { + ptims := structPointer_InterfaceAt(base, p.field, reflect.SliceOf(reflect.PtrTo(timeType))).(*[]*time.Time) + tims := *ptims + for i := 0; i < len(tims); i++ { + if tims[i] == nil { + return errRepeatedHasNil + } + tproto, err := timestampProto(*tims[i]) + if err != nil { + return err + } + data, err := Marshal(tproto) + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + } + return nil +} + +func size_slice_ref_time(p *Properties, base structPointer) (n int) { + ptims := structPointer_InterfaceAt(base, p.field, reflect.SliceOf(timeType)).(*[]time.Time) + tims := *ptims + for i := 0; i < len(tims); i++ { + tproto, err := timestampProto(tims[i]) + if err != nil { + return 0 + } + size := Size(tproto) + n += len(p.tagcode) + size + sizeVarint(uint64(size)) + } + return n +} + +func (o *Buffer) enc_slice_ref_time(p *Properties, base structPointer) error { + ptims := structPointer_InterfaceAt(base, p.field, reflect.SliceOf(timeType)).(*[]time.Time) + tims := *ptims + for i := 0; i < len(tims); i++ { + tproto, err := timestampProto(tims[i]) + if err != nil { + return err + } + data, err := Marshal(tproto) + if err != nil { + return err + } + o.buf = append(o.buf, p.tagcode...) + o.EncodeRawBytes(data) + } + return nil +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile new file mode 100644 index 000000000..3496dc99d --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/Makefile @@ -0,0 +1,36 @@ +# Go support for Protocol Buffers - Google's data interchange format +# +# Copyright 2010 The Go Authors. All rights reserved. +# https://github.com/golang/protobuf +# +# Redistribution and use in source and binary forms, with or without +# modification, are permitted provided that the following conditions are +# met: +# +# * Redistributions of source code must retain the above copyright +# notice, this list of conditions and the following disclaimer. +# * Redistributions in binary form must reproduce the above +# copyright notice, this list of conditions and the following disclaimer +# in the documentation and/or other materials provided with the +# distribution. +# * Neither the name of Google Inc. nor the names of its +# contributors may be used to endorse or promote products derived from +# this software without specific prior written permission. +# +# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +# "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +regenerate: + go install github.com/gogo/protobuf/protoc-gen-gogo + go install github.com/gogo/protobuf/protoc-gen-gostring + protoc --gogo_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto + protoc --gostring_out=. -I=../../protobuf/google/protobuf ../../protobuf/google/protobuf/descriptor.proto diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go new file mode 100644 index 000000000..e808a3fd0 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.go @@ -0,0 +1,92 @@ +// Go support for Protocol Buffers - Google's data interchange format +// +// Copyright 2016 The Go Authors. All rights reserved. +// https://github.com/golang/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// * Neither the name of Google Inc. nor the names of its +// contributors may be used to endorse or promote products derived from +// this software without specific prior written permission. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +// Package descriptor provides functions for obtaining protocol buffer +// descriptors for generated Go types. +// +// These functions cannot go in package proto because they depend on the +// generated protobuf descriptor messages, which themselves depend on proto. +package descriptor + +import ( + "bytes" + "compress/gzip" + "fmt" + "io/ioutil" + + "github.com/gogo/protobuf/proto" +) + +// extractFile extracts a FileDescriptorProto from a gzip'd buffer. +func extractFile(gz []byte) (*FileDescriptorProto, error) { + r, err := gzip.NewReader(bytes.NewReader(gz)) + if err != nil { + return nil, fmt.Errorf("failed to open gzip reader: %v", err) + } + defer r.Close() + + b, err := ioutil.ReadAll(r) + if err != nil { + return nil, fmt.Errorf("failed to uncompress descriptor: %v", err) + } + + fd := new(FileDescriptorProto) + if err := proto.Unmarshal(b, fd); err != nil { + return nil, fmt.Errorf("malformed FileDescriptorProto: %v", err) + } + + return fd, nil +} + +// Message is a proto.Message with a method to return its descriptor. +// +// Message types generated by the protocol compiler always satisfy +// the Message interface. +type Message interface { + proto.Message + Descriptor() ([]byte, []int) +} + +// ForMessage returns a FileDescriptorProto and a DescriptorProto from within it +// describing the given message. +func ForMessage(msg Message) (fd *FileDescriptorProto, md *DescriptorProto) { + gz, path := msg.Descriptor() + fd, err := extractFile(gz) + if err != nil { + panic(fmt.Sprintf("invalid FileDescriptorProto for %T: %v", msg, err)) + } + + md = fd.MessageType[path[0]] + for _, i := range path[1:] { + md = md.NestedType[i] + } + return fd, md +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go new file mode 100644 index 000000000..6c4d80f5f --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor.pb.go @@ -0,0 +1,2088 @@ +// Code generated by protoc-gen-gogo. +// source: descriptor.proto +// DO NOT EDIT! + +/* +Package descriptor is a generated protocol buffer package. + +It is generated from these files: + descriptor.proto + +It has these top-level messages: + FileDescriptorSet + FileDescriptorProto + DescriptorProto + FieldDescriptorProto + OneofDescriptorProto + EnumDescriptorProto + EnumValueDescriptorProto + ServiceDescriptorProto + MethodDescriptorProto + FileOptions + MessageOptions + FieldOptions + OneofOptions + EnumOptions + EnumValueOptions + ServiceOptions + MethodOptions + UninterpretedOption + SourceCodeInfo + GeneratedCodeInfo +*/ +package descriptor + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// This is a compile-time assertion to ensure that this generated file +// is compatible with the proto package it is being compiled against. +// A compilation error at this line likely means your copy of the +// proto package needs to be updated. +const _ = proto.GoGoProtoPackageIsVersion2 // please upgrade the proto package + +type FieldDescriptorProto_Type int32 + +const ( + // 0 is reserved for errors. + // Order is weird for historical reasons. + FieldDescriptorProto_TYPE_DOUBLE FieldDescriptorProto_Type = 1 + FieldDescriptorProto_TYPE_FLOAT FieldDescriptorProto_Type = 2 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT64 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT64 FieldDescriptorProto_Type = 3 + FieldDescriptorProto_TYPE_UINT64 FieldDescriptorProto_Type = 4 + // Not ZigZag encoded. Negative numbers take 10 bytes. Use TYPE_SINT32 if + // negative values are likely. + FieldDescriptorProto_TYPE_INT32 FieldDescriptorProto_Type = 5 + FieldDescriptorProto_TYPE_FIXED64 FieldDescriptorProto_Type = 6 + FieldDescriptorProto_TYPE_FIXED32 FieldDescriptorProto_Type = 7 + FieldDescriptorProto_TYPE_BOOL FieldDescriptorProto_Type = 8 + FieldDescriptorProto_TYPE_STRING FieldDescriptorProto_Type = 9 + FieldDescriptorProto_TYPE_GROUP FieldDescriptorProto_Type = 10 + FieldDescriptorProto_TYPE_MESSAGE FieldDescriptorProto_Type = 11 + // New in version 2. + FieldDescriptorProto_TYPE_BYTES FieldDescriptorProto_Type = 12 + FieldDescriptorProto_TYPE_UINT32 FieldDescriptorProto_Type = 13 + FieldDescriptorProto_TYPE_ENUM FieldDescriptorProto_Type = 14 + FieldDescriptorProto_TYPE_SFIXED32 FieldDescriptorProto_Type = 15 + FieldDescriptorProto_TYPE_SFIXED64 FieldDescriptorProto_Type = 16 + FieldDescriptorProto_TYPE_SINT32 FieldDescriptorProto_Type = 17 + FieldDescriptorProto_TYPE_SINT64 FieldDescriptorProto_Type = 18 +) + +var FieldDescriptorProto_Type_name = map[int32]string{ + 1: "TYPE_DOUBLE", + 2: "TYPE_FLOAT", + 3: "TYPE_INT64", + 4: "TYPE_UINT64", + 5: "TYPE_INT32", + 6: "TYPE_FIXED64", + 7: "TYPE_FIXED32", + 8: "TYPE_BOOL", + 9: "TYPE_STRING", + 10: "TYPE_GROUP", + 11: "TYPE_MESSAGE", + 12: "TYPE_BYTES", + 13: "TYPE_UINT32", + 14: "TYPE_ENUM", + 15: "TYPE_SFIXED32", + 16: "TYPE_SFIXED64", + 17: "TYPE_SINT32", + 18: "TYPE_SINT64", +} +var FieldDescriptorProto_Type_value = map[string]int32{ + "TYPE_DOUBLE": 1, + "TYPE_FLOAT": 2, + "TYPE_INT64": 3, + "TYPE_UINT64": 4, + "TYPE_INT32": 5, + "TYPE_FIXED64": 6, + "TYPE_FIXED32": 7, + "TYPE_BOOL": 8, + "TYPE_STRING": 9, + "TYPE_GROUP": 10, + "TYPE_MESSAGE": 11, + "TYPE_BYTES": 12, + "TYPE_UINT32": 13, + "TYPE_ENUM": 14, + "TYPE_SFIXED32": 15, + "TYPE_SFIXED64": 16, + "TYPE_SINT32": 17, + "TYPE_SINT64": 18, +} + +func (x FieldDescriptorProto_Type) Enum() *FieldDescriptorProto_Type { + p := new(FieldDescriptorProto_Type) + *p = x + return p +} +func (x FieldDescriptorProto_Type) String() string { + return proto.EnumName(FieldDescriptorProto_Type_name, int32(x)) +} +func (x *FieldDescriptorProto_Type) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Type_value, data, "FieldDescriptorProto_Type") + if err != nil { + return err + } + *x = FieldDescriptorProto_Type(value) + return nil +} +func (FieldDescriptorProto_Type) EnumDescriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{3, 0} +} + +type FieldDescriptorProto_Label int32 + +const ( + // 0 is reserved for errors + FieldDescriptorProto_LABEL_OPTIONAL FieldDescriptorProto_Label = 1 + FieldDescriptorProto_LABEL_REQUIRED FieldDescriptorProto_Label = 2 + FieldDescriptorProto_LABEL_REPEATED FieldDescriptorProto_Label = 3 +) + +var FieldDescriptorProto_Label_name = map[int32]string{ + 1: "LABEL_OPTIONAL", + 2: "LABEL_REQUIRED", + 3: "LABEL_REPEATED", +} +var FieldDescriptorProto_Label_value = map[string]int32{ + "LABEL_OPTIONAL": 1, + "LABEL_REQUIRED": 2, + "LABEL_REPEATED": 3, +} + +func (x FieldDescriptorProto_Label) Enum() *FieldDescriptorProto_Label { + p := new(FieldDescriptorProto_Label) + *p = x + return p +} +func (x FieldDescriptorProto_Label) String() string { + return proto.EnumName(FieldDescriptorProto_Label_name, int32(x)) +} +func (x *FieldDescriptorProto_Label) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldDescriptorProto_Label_value, data, "FieldDescriptorProto_Label") + if err != nil { + return err + } + *x = FieldDescriptorProto_Label(value) + return nil +} +func (FieldDescriptorProto_Label) EnumDescriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{3, 1} +} + +// Generated classes can be optimized for speed or code size. +type FileOptions_OptimizeMode int32 + +const ( + FileOptions_SPEED FileOptions_OptimizeMode = 1 + // etc. + FileOptions_CODE_SIZE FileOptions_OptimizeMode = 2 + FileOptions_LITE_RUNTIME FileOptions_OptimizeMode = 3 +) + +var FileOptions_OptimizeMode_name = map[int32]string{ + 1: "SPEED", + 2: "CODE_SIZE", + 3: "LITE_RUNTIME", +} +var FileOptions_OptimizeMode_value = map[string]int32{ + "SPEED": 1, + "CODE_SIZE": 2, + "LITE_RUNTIME": 3, +} + +func (x FileOptions_OptimizeMode) Enum() *FileOptions_OptimizeMode { + p := new(FileOptions_OptimizeMode) + *p = x + return p +} +func (x FileOptions_OptimizeMode) String() string { + return proto.EnumName(FileOptions_OptimizeMode_name, int32(x)) +} +func (x *FileOptions_OptimizeMode) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FileOptions_OptimizeMode_value, data, "FileOptions_OptimizeMode") + if err != nil { + return err + } + *x = FileOptions_OptimizeMode(value) + return nil +} +func (FileOptions_OptimizeMode) EnumDescriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{9, 0} +} + +type FieldOptions_CType int32 + +const ( + // Default mode. + FieldOptions_STRING FieldOptions_CType = 0 + FieldOptions_CORD FieldOptions_CType = 1 + FieldOptions_STRING_PIECE FieldOptions_CType = 2 +) + +var FieldOptions_CType_name = map[int32]string{ + 0: "STRING", + 1: "CORD", + 2: "STRING_PIECE", +} +var FieldOptions_CType_value = map[string]int32{ + "STRING": 0, + "CORD": 1, + "STRING_PIECE": 2, +} + +func (x FieldOptions_CType) Enum() *FieldOptions_CType { + p := new(FieldOptions_CType) + *p = x + return p +} +func (x FieldOptions_CType) String() string { + return proto.EnumName(FieldOptions_CType_name, int32(x)) +} +func (x *FieldOptions_CType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_CType_value, data, "FieldOptions_CType") + if err != nil { + return err + } + *x = FieldOptions_CType(value) + return nil +} +func (FieldOptions_CType) EnumDescriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{11, 0} +} + +type FieldOptions_JSType int32 + +const ( + // Use the default type. + FieldOptions_JS_NORMAL FieldOptions_JSType = 0 + // Use JavaScript strings. + FieldOptions_JS_STRING FieldOptions_JSType = 1 + // Use JavaScript numbers. + FieldOptions_JS_NUMBER FieldOptions_JSType = 2 +) + +var FieldOptions_JSType_name = map[int32]string{ + 0: "JS_NORMAL", + 1: "JS_STRING", + 2: "JS_NUMBER", +} +var FieldOptions_JSType_value = map[string]int32{ + "JS_NORMAL": 0, + "JS_STRING": 1, + "JS_NUMBER": 2, +} + +func (x FieldOptions_JSType) Enum() *FieldOptions_JSType { + p := new(FieldOptions_JSType) + *p = x + return p +} +func (x FieldOptions_JSType) String() string { + return proto.EnumName(FieldOptions_JSType_name, int32(x)) +} +func (x *FieldOptions_JSType) UnmarshalJSON(data []byte) error { + value, err := proto.UnmarshalJSONEnum(FieldOptions_JSType_value, data, "FieldOptions_JSType") + if err != nil { + return err + } + *x = FieldOptions_JSType(value) + return nil +} +func (FieldOptions_JSType) EnumDescriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{11, 1} +} + +// The protocol compiler can output a FileDescriptorSet containing the .proto +// files it parses. +type FileDescriptorSet struct { + File []*FileDescriptorProto `protobuf:"bytes,1,rep,name=file" json:"file,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *FileDescriptorSet) Reset() { *m = FileDescriptorSet{} } +func (m *FileDescriptorSet) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorSet) ProtoMessage() {} +func (*FileDescriptorSet) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{0} } + +func (m *FileDescriptorSet) GetFile() []*FileDescriptorProto { + if m != nil { + return m.File + } + return nil +} + +// Describes a complete .proto file. +type FileDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Package *string `protobuf:"bytes,2,opt,name=package" json:"package,omitempty"` + // Names of files imported by this file. + Dependency []string `protobuf:"bytes,3,rep,name=dependency" json:"dependency,omitempty"` + // Indexes of the public imported files in the dependency list above. + PublicDependency []int32 `protobuf:"varint,10,rep,name=public_dependency,json=publicDependency" json:"public_dependency,omitempty"` + // Indexes of the weak imported files in the dependency list. + // For Google-internal migration only. Do not use. + WeakDependency []int32 `protobuf:"varint,11,rep,name=weak_dependency,json=weakDependency" json:"weak_dependency,omitempty"` + // All top-level definitions in this file. + MessageType []*DescriptorProto `protobuf:"bytes,4,rep,name=message_type,json=messageType" json:"message_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,5,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + Service []*ServiceDescriptorProto `protobuf:"bytes,6,rep,name=service" json:"service,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,7,rep,name=extension" json:"extension,omitempty"` + Options *FileOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + // This field contains optional information about the original source code. + // You may safely remove this entire field without harming runtime + // functionality of the descriptors -- the information is needed only by + // development tools. + SourceCodeInfo *SourceCodeInfo `protobuf:"bytes,9,opt,name=source_code_info,json=sourceCodeInfo" json:"source_code_info,omitempty"` + // The syntax of the proto file. + // The supported values are "proto2" and "proto3". + Syntax *string `protobuf:"bytes,12,opt,name=syntax" json:"syntax,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *FileDescriptorProto) Reset() { *m = FileDescriptorProto{} } +func (m *FileDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FileDescriptorProto) ProtoMessage() {} +func (*FileDescriptorProto) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{1} } + +func (m *FileDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FileDescriptorProto) GetPackage() string { + if m != nil && m.Package != nil { + return *m.Package + } + return "" +} + +func (m *FileDescriptorProto) GetDependency() []string { + if m != nil { + return m.Dependency + } + return nil +} + +func (m *FileDescriptorProto) GetPublicDependency() []int32 { + if m != nil { + return m.PublicDependency + } + return nil +} + +func (m *FileDescriptorProto) GetWeakDependency() []int32 { + if m != nil { + return m.WeakDependency + } + return nil +} + +func (m *FileDescriptorProto) GetMessageType() []*DescriptorProto { + if m != nil { + return m.MessageType + } + return nil +} + +func (m *FileDescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *FileDescriptorProto) GetService() []*ServiceDescriptorProto { + if m != nil { + return m.Service + } + return nil +} + +func (m *FileDescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *FileDescriptorProto) GetOptions() *FileOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *FileDescriptorProto) GetSourceCodeInfo() *SourceCodeInfo { + if m != nil { + return m.SourceCodeInfo + } + return nil +} + +func (m *FileDescriptorProto) GetSyntax() string { + if m != nil && m.Syntax != nil { + return *m.Syntax + } + return "" +} + +// Describes a message type. +type DescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Field []*FieldDescriptorProto `protobuf:"bytes,2,rep,name=field" json:"field,omitempty"` + Extension []*FieldDescriptorProto `protobuf:"bytes,6,rep,name=extension" json:"extension,omitempty"` + NestedType []*DescriptorProto `protobuf:"bytes,3,rep,name=nested_type,json=nestedType" json:"nested_type,omitempty"` + EnumType []*EnumDescriptorProto `protobuf:"bytes,4,rep,name=enum_type,json=enumType" json:"enum_type,omitempty"` + ExtensionRange []*DescriptorProto_ExtensionRange `protobuf:"bytes,5,rep,name=extension_range,json=extensionRange" json:"extension_range,omitempty"` + OneofDecl []*OneofDescriptorProto `protobuf:"bytes,8,rep,name=oneof_decl,json=oneofDecl" json:"oneof_decl,omitempty"` + Options *MessageOptions `protobuf:"bytes,7,opt,name=options" json:"options,omitempty"` + ReservedRange []*DescriptorProto_ReservedRange `protobuf:"bytes,9,rep,name=reserved_range,json=reservedRange" json:"reserved_range,omitempty"` + // Reserved field names, which may not be used by fields in the same message. + // A given name may only be reserved once. + ReservedName []string `protobuf:"bytes,10,rep,name=reserved_name,json=reservedName" json:"reserved_name,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *DescriptorProto) Reset() { *m = DescriptorProto{} } +func (m *DescriptorProto) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto) ProtoMessage() {} +func (*DescriptorProto) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{2} } + +func (m *DescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *DescriptorProto) GetField() []*FieldDescriptorProto { + if m != nil { + return m.Field + } + return nil +} + +func (m *DescriptorProto) GetExtension() []*FieldDescriptorProto { + if m != nil { + return m.Extension + } + return nil +} + +func (m *DescriptorProto) GetNestedType() []*DescriptorProto { + if m != nil { + return m.NestedType + } + return nil +} + +func (m *DescriptorProto) GetEnumType() []*EnumDescriptorProto { + if m != nil { + return m.EnumType + } + return nil +} + +func (m *DescriptorProto) GetExtensionRange() []*DescriptorProto_ExtensionRange { + if m != nil { + return m.ExtensionRange + } + return nil +} + +func (m *DescriptorProto) GetOneofDecl() []*OneofDescriptorProto { + if m != nil { + return m.OneofDecl + } + return nil +} + +func (m *DescriptorProto) GetOptions() *MessageOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *DescriptorProto) GetReservedRange() []*DescriptorProto_ReservedRange { + if m != nil { + return m.ReservedRange + } + return nil +} + +func (m *DescriptorProto) GetReservedName() []string { + if m != nil { + return m.ReservedName + } + return nil +} + +type DescriptorProto_ExtensionRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *DescriptorProto_ExtensionRange) Reset() { *m = DescriptorProto_ExtensionRange{} } +func (m *DescriptorProto_ExtensionRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ExtensionRange) ProtoMessage() {} +func (*DescriptorProto_ExtensionRange) Descriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{2, 0} +} + +func (m *DescriptorProto_ExtensionRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ExtensionRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +// Range of reserved tag numbers. Reserved tag numbers may not be used by +// fields or extension ranges in the same message. Reserved ranges may +// not overlap. +type DescriptorProto_ReservedRange struct { + Start *int32 `protobuf:"varint,1,opt,name=start" json:"start,omitempty"` + End *int32 `protobuf:"varint,2,opt,name=end" json:"end,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *DescriptorProto_ReservedRange) Reset() { *m = DescriptorProto_ReservedRange{} } +func (m *DescriptorProto_ReservedRange) String() string { return proto.CompactTextString(m) } +func (*DescriptorProto_ReservedRange) ProtoMessage() {} +func (*DescriptorProto_ReservedRange) Descriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{2, 1} +} + +func (m *DescriptorProto_ReservedRange) GetStart() int32 { + if m != nil && m.Start != nil { + return *m.Start + } + return 0 +} + +func (m *DescriptorProto_ReservedRange) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +// Describes a field within a message. +type FieldDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,3,opt,name=number" json:"number,omitempty"` + Label *FieldDescriptorProto_Label `protobuf:"varint,4,opt,name=label,enum=google.protobuf.FieldDescriptorProto_Label" json:"label,omitempty"` + // If type_name is set, this need not be set. If both this and type_name + // are set, this must be one of TYPE_ENUM, TYPE_MESSAGE or TYPE_GROUP. + Type *FieldDescriptorProto_Type `protobuf:"varint,5,opt,name=type,enum=google.protobuf.FieldDescriptorProto_Type" json:"type,omitempty"` + // For message and enum types, this is the name of the type. If the name + // starts with a '.', it is fully-qualified. Otherwise, C++-like scoping + // rules are used to find the type (i.e. first the nested types within this + // message are searched, then within the parent, on up to the root + // namespace). + TypeName *string `protobuf:"bytes,6,opt,name=type_name,json=typeName" json:"type_name,omitempty"` + // For extensions, this is the name of the type being extended. It is + // resolved in the same manner as type_name. + Extendee *string `protobuf:"bytes,2,opt,name=extendee" json:"extendee,omitempty"` + // For numeric types, contains the original text representation of the value. + // For booleans, "true" or "false". + // For strings, contains the default text contents (not escaped in any way). + // For bytes, contains the C escaped value. All bytes >= 128 are escaped. + // TODO(kenton): Base-64 encode? + DefaultValue *string `protobuf:"bytes,7,opt,name=default_value,json=defaultValue" json:"default_value,omitempty"` + // If set, gives the index of a oneof in the containing type's oneof_decl + // list. This field is a member of that oneof. + OneofIndex *int32 `protobuf:"varint,9,opt,name=oneof_index,json=oneofIndex" json:"oneof_index,omitempty"` + // JSON name of this field. The value is set by protocol compiler. If the + // user has set a "json_name" option on this field, that option's value + // will be used. Otherwise, it's deduced from the field's name by converting + // it to camelCase. + JsonName *string `protobuf:"bytes,10,opt,name=json_name,json=jsonName" json:"json_name,omitempty"` + Options *FieldOptions `protobuf:"bytes,8,opt,name=options" json:"options,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *FieldDescriptorProto) Reset() { *m = FieldDescriptorProto{} } +func (m *FieldDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*FieldDescriptorProto) ProtoMessage() {} +func (*FieldDescriptorProto) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{3} } + +func (m *FieldDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *FieldDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *FieldDescriptorProto) GetLabel() FieldDescriptorProto_Label { + if m != nil && m.Label != nil { + return *m.Label + } + return FieldDescriptorProto_LABEL_OPTIONAL +} + +func (m *FieldDescriptorProto) GetType() FieldDescriptorProto_Type { + if m != nil && m.Type != nil { + return *m.Type + } + return FieldDescriptorProto_TYPE_DOUBLE +} + +func (m *FieldDescriptorProto) GetTypeName() string { + if m != nil && m.TypeName != nil { + return *m.TypeName + } + return "" +} + +func (m *FieldDescriptorProto) GetExtendee() string { + if m != nil && m.Extendee != nil { + return *m.Extendee + } + return "" +} + +func (m *FieldDescriptorProto) GetDefaultValue() string { + if m != nil && m.DefaultValue != nil { + return *m.DefaultValue + } + return "" +} + +func (m *FieldDescriptorProto) GetOneofIndex() int32 { + if m != nil && m.OneofIndex != nil { + return *m.OneofIndex + } + return 0 +} + +func (m *FieldDescriptorProto) GetJsonName() string { + if m != nil && m.JsonName != nil { + return *m.JsonName + } + return "" +} + +func (m *FieldDescriptorProto) GetOptions() *FieldOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a oneof. +type OneofDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Options *OneofOptions `protobuf:"bytes,2,opt,name=options" json:"options,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *OneofDescriptorProto) Reset() { *m = OneofDescriptorProto{} } +func (m *OneofDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*OneofDescriptorProto) ProtoMessage() {} +func (*OneofDescriptorProto) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{4} } + +func (m *OneofDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *OneofDescriptorProto) GetOptions() *OneofOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes an enum type. +type EnumDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Value []*EnumValueDescriptorProto `protobuf:"bytes,2,rep,name=value" json:"value,omitempty"` + Options *EnumOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *EnumDescriptorProto) Reset() { *m = EnumDescriptorProto{} } +func (m *EnumDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumDescriptorProto) ProtoMessage() {} +func (*EnumDescriptorProto) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{5} } + +func (m *EnumDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumDescriptorProto) GetValue() []*EnumValueDescriptorProto { + if m != nil { + return m.Value + } + return nil +} + +func (m *EnumDescriptorProto) GetOptions() *EnumOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a value within an enum. +type EnumValueDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Number *int32 `protobuf:"varint,2,opt,name=number" json:"number,omitempty"` + Options *EnumValueOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *EnumValueDescriptorProto) Reset() { *m = EnumValueDescriptorProto{} } +func (m *EnumValueDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*EnumValueDescriptorProto) ProtoMessage() {} +func (*EnumValueDescriptorProto) Descriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{6} +} + +func (m *EnumValueDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *EnumValueDescriptorProto) GetNumber() int32 { + if m != nil && m.Number != nil { + return *m.Number + } + return 0 +} + +func (m *EnumValueDescriptorProto) GetOptions() *EnumValueOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a service. +type ServiceDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + Method []*MethodDescriptorProto `protobuf:"bytes,2,rep,name=method" json:"method,omitempty"` + Options *ServiceOptions `protobuf:"bytes,3,opt,name=options" json:"options,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *ServiceDescriptorProto) Reset() { *m = ServiceDescriptorProto{} } +func (m *ServiceDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*ServiceDescriptorProto) ProtoMessage() {} +func (*ServiceDescriptorProto) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{7} } + +func (m *ServiceDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *ServiceDescriptorProto) GetMethod() []*MethodDescriptorProto { + if m != nil { + return m.Method + } + return nil +} + +func (m *ServiceDescriptorProto) GetOptions() *ServiceOptions { + if m != nil { + return m.Options + } + return nil +} + +// Describes a method of a service. +type MethodDescriptorProto struct { + Name *string `protobuf:"bytes,1,opt,name=name" json:"name,omitempty"` + // Input and output type names. These are resolved in the same way as + // FieldDescriptorProto.type_name, but must refer to a message type. + InputType *string `protobuf:"bytes,2,opt,name=input_type,json=inputType" json:"input_type,omitempty"` + OutputType *string `protobuf:"bytes,3,opt,name=output_type,json=outputType" json:"output_type,omitempty"` + Options *MethodOptions `protobuf:"bytes,4,opt,name=options" json:"options,omitempty"` + // Identifies if client streams multiple client messages + ClientStreaming *bool `protobuf:"varint,5,opt,name=client_streaming,json=clientStreaming,def=0" json:"client_streaming,omitempty"` + // Identifies if server streams multiple server messages + ServerStreaming *bool `protobuf:"varint,6,opt,name=server_streaming,json=serverStreaming,def=0" json:"server_streaming,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *MethodDescriptorProto) Reset() { *m = MethodDescriptorProto{} } +func (m *MethodDescriptorProto) String() string { return proto.CompactTextString(m) } +func (*MethodDescriptorProto) ProtoMessage() {} +func (*MethodDescriptorProto) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{8} } + +const Default_MethodDescriptorProto_ClientStreaming bool = false +const Default_MethodDescriptorProto_ServerStreaming bool = false + +func (m *MethodDescriptorProto) GetName() string { + if m != nil && m.Name != nil { + return *m.Name + } + return "" +} + +func (m *MethodDescriptorProto) GetInputType() string { + if m != nil && m.InputType != nil { + return *m.InputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOutputType() string { + if m != nil && m.OutputType != nil { + return *m.OutputType + } + return "" +} + +func (m *MethodDescriptorProto) GetOptions() *MethodOptions { + if m != nil { + return m.Options + } + return nil +} + +func (m *MethodDescriptorProto) GetClientStreaming() bool { + if m != nil && m.ClientStreaming != nil { + return *m.ClientStreaming + } + return Default_MethodDescriptorProto_ClientStreaming +} + +func (m *MethodDescriptorProto) GetServerStreaming() bool { + if m != nil && m.ServerStreaming != nil { + return *m.ServerStreaming + } + return Default_MethodDescriptorProto_ServerStreaming +} + +type FileOptions struct { + // Sets the Java package where classes generated from this .proto will be + // placed. By default, the proto package is used, but this is often + // inappropriate because proto packages do not normally start with backwards + // domain names. + JavaPackage *string `protobuf:"bytes,1,opt,name=java_package,json=javaPackage" json:"java_package,omitempty"` + // If set, all the classes from the .proto file are wrapped in a single + // outer class with the given name. This applies to both Proto1 + // (equivalent to the old "--one_java_file" option) and Proto2 (where + // a .proto always translates to a single class, but you may want to + // explicitly choose the class name). + JavaOuterClassname *string `protobuf:"bytes,8,opt,name=java_outer_classname,json=javaOuterClassname" json:"java_outer_classname,omitempty"` + // If set true, then the Java code generator will generate a separate .java + // file for each top-level message, enum, and service defined in the .proto + // file. Thus, these types will *not* be nested inside the outer class + // named by java_outer_classname. However, the outer class will still be + // generated to contain the file's getDescriptor() method as well as any + // top-level extensions defined in the file. + JavaMultipleFiles *bool `protobuf:"varint,10,opt,name=java_multiple_files,json=javaMultipleFiles,def=0" json:"java_multiple_files,omitempty"` + // If set true, then the Java code generator will generate equals() and + // hashCode() methods for all messages defined in the .proto file. + // This increases generated code size, potentially substantially for large + // protos, which may harm a memory-constrained application. + // - In the full runtime this is a speed optimization, as the + // AbstractMessage base class includes reflection-based implementations of + // these methods. + // - In the lite runtime, setting this option changes the semantics of + // equals() and hashCode() to more closely match those of the full runtime; + // the generated methods compute their results based on field values rather + // than object identity. (Implementations should not assume that hashcodes + // will be consistent across runtimes or versions of the protocol compiler.) + JavaGenerateEqualsAndHash *bool `protobuf:"varint,20,opt,name=java_generate_equals_and_hash,json=javaGenerateEqualsAndHash,def=0" json:"java_generate_equals_and_hash,omitempty"` + // If set true, then the Java2 code generator will generate code that + // throws an exception whenever an attempt is made to assign a non-UTF-8 + // byte sequence to a string field. + // Message reflection will do the same. + // However, an extension field still accepts non-UTF-8 byte sequences. + // This option has no effect on when used with the lite runtime. + JavaStringCheckUtf8 *bool `protobuf:"varint,27,opt,name=java_string_check_utf8,json=javaStringCheckUtf8,def=0" json:"java_string_check_utf8,omitempty"` + OptimizeFor *FileOptions_OptimizeMode `protobuf:"varint,9,opt,name=optimize_for,json=optimizeFor,enum=google.protobuf.FileOptions_OptimizeMode,def=1" json:"optimize_for,omitempty"` + // Sets the Go package where structs generated from this .proto will be + // placed. If omitted, the Go package will be derived from the following: + // - The basename of the package import path, if provided. + // - Otherwise, the package statement in the .proto file, if present. + // - Otherwise, the basename of the .proto file, without extension. + GoPackage *string `protobuf:"bytes,11,opt,name=go_package,json=goPackage" json:"go_package,omitempty"` + // Should generic services be generated in each language? "Generic" services + // are not specific to any particular RPC system. They are generated by the + // main code generators in each language (without additional plugins). + // Generic services were the only kind of service generation supported by + // early versions of google.protobuf. + // + // Generic services are now considered deprecated in favor of using plugins + // that generate code specific to your particular RPC system. Therefore, + // these default to false. Old code which depends on generic services should + // explicitly set them to true. + CcGenericServices *bool `protobuf:"varint,16,opt,name=cc_generic_services,json=ccGenericServices,def=0" json:"cc_generic_services,omitempty"` + JavaGenericServices *bool `protobuf:"varint,17,opt,name=java_generic_services,json=javaGenericServices,def=0" json:"java_generic_services,omitempty"` + PyGenericServices *bool `protobuf:"varint,18,opt,name=py_generic_services,json=pyGenericServices,def=0" json:"py_generic_services,omitempty"` + // Is this file deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for everything in the file, or it will be completely ignored; in the very + // least, this is a formalization for deprecating files. + Deprecated *bool `protobuf:"varint,23,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Enables the use of arenas for the proto messages in this file. This applies + // only to generated classes for C++. + CcEnableArenas *bool `protobuf:"varint,31,opt,name=cc_enable_arenas,json=ccEnableArenas,def=0" json:"cc_enable_arenas,omitempty"` + // Sets the objective c class prefix which is prepended to all objective c + // generated classes from this .proto. There is no default. + ObjcClassPrefix *string `protobuf:"bytes,36,opt,name=objc_class_prefix,json=objcClassPrefix" json:"objc_class_prefix,omitempty"` + // Namespace for generated classes; defaults to the package. + CsharpNamespace *string `protobuf:"bytes,37,opt,name=csharp_namespace,json=csharpNamespace" json:"csharp_namespace,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *FileOptions) Reset() { *m = FileOptions{} } +func (m *FileOptions) String() string { return proto.CompactTextString(m) } +func (*FileOptions) ProtoMessage() {} +func (*FileOptions) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{9} } + +var extRange_FileOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FileOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FileOptions +} + +const Default_FileOptions_JavaMultipleFiles bool = false +const Default_FileOptions_JavaGenerateEqualsAndHash bool = false +const Default_FileOptions_JavaStringCheckUtf8 bool = false +const Default_FileOptions_OptimizeFor FileOptions_OptimizeMode = FileOptions_SPEED +const Default_FileOptions_CcGenericServices bool = false +const Default_FileOptions_JavaGenericServices bool = false +const Default_FileOptions_PyGenericServices bool = false +const Default_FileOptions_Deprecated bool = false +const Default_FileOptions_CcEnableArenas bool = false + +func (m *FileOptions) GetJavaPackage() string { + if m != nil && m.JavaPackage != nil { + return *m.JavaPackage + } + return "" +} + +func (m *FileOptions) GetJavaOuterClassname() string { + if m != nil && m.JavaOuterClassname != nil { + return *m.JavaOuterClassname + } + return "" +} + +func (m *FileOptions) GetJavaMultipleFiles() bool { + if m != nil && m.JavaMultipleFiles != nil { + return *m.JavaMultipleFiles + } + return Default_FileOptions_JavaMultipleFiles +} + +func (m *FileOptions) GetJavaGenerateEqualsAndHash() bool { + if m != nil && m.JavaGenerateEqualsAndHash != nil { + return *m.JavaGenerateEqualsAndHash + } + return Default_FileOptions_JavaGenerateEqualsAndHash +} + +func (m *FileOptions) GetJavaStringCheckUtf8() bool { + if m != nil && m.JavaStringCheckUtf8 != nil { + return *m.JavaStringCheckUtf8 + } + return Default_FileOptions_JavaStringCheckUtf8 +} + +func (m *FileOptions) GetOptimizeFor() FileOptions_OptimizeMode { + if m != nil && m.OptimizeFor != nil { + return *m.OptimizeFor + } + return Default_FileOptions_OptimizeFor +} + +func (m *FileOptions) GetGoPackage() string { + if m != nil && m.GoPackage != nil { + return *m.GoPackage + } + return "" +} + +func (m *FileOptions) GetCcGenericServices() bool { + if m != nil && m.CcGenericServices != nil { + return *m.CcGenericServices + } + return Default_FileOptions_CcGenericServices +} + +func (m *FileOptions) GetJavaGenericServices() bool { + if m != nil && m.JavaGenericServices != nil { + return *m.JavaGenericServices + } + return Default_FileOptions_JavaGenericServices +} + +func (m *FileOptions) GetPyGenericServices() bool { + if m != nil && m.PyGenericServices != nil { + return *m.PyGenericServices + } + return Default_FileOptions_PyGenericServices +} + +func (m *FileOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FileOptions_Deprecated +} + +func (m *FileOptions) GetCcEnableArenas() bool { + if m != nil && m.CcEnableArenas != nil { + return *m.CcEnableArenas + } + return Default_FileOptions_CcEnableArenas +} + +func (m *FileOptions) GetObjcClassPrefix() string { + if m != nil && m.ObjcClassPrefix != nil { + return *m.ObjcClassPrefix + } + return "" +} + +func (m *FileOptions) GetCsharpNamespace() string { + if m != nil && m.CsharpNamespace != nil { + return *m.CsharpNamespace + } + return "" +} + +func (m *FileOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MessageOptions struct { + // Set true to use the old proto1 MessageSet wire format for extensions. + // This is provided for backwards-compatibility with the MessageSet wire + // format. You should not use this for any other reason: It's less + // efficient, has fewer features, and is more complicated. + // + // The message must be defined exactly as follows: + // message Foo { + // option message_set_wire_format = true; + // extensions 4 to max; + // } + // Note that the message cannot have any defined fields; MessageSets only + // have extensions. + // + // All extensions of your type must be singular messages; e.g. they cannot + // be int32s, enums, or repeated messages. + // + // Because this is an option, the above two restrictions are not enforced by + // the protocol compiler. + MessageSetWireFormat *bool `protobuf:"varint,1,opt,name=message_set_wire_format,json=messageSetWireFormat,def=0" json:"message_set_wire_format,omitempty"` + // Disables the generation of the standard "descriptor()" accessor, which can + // conflict with a field of the same name. This is meant to make migration + // from proto1 easier; new code should avoid fields named "descriptor". + NoStandardDescriptorAccessor *bool `protobuf:"varint,2,opt,name=no_standard_descriptor_accessor,json=noStandardDescriptorAccessor,def=0" json:"no_standard_descriptor_accessor,omitempty"` + // Is this message deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the message, or it will be completely ignored; in the very least, + // this is a formalization for deprecating messages. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // Whether the message is an automatically generated map entry type for the + // maps field. + // + // For maps fields: + // map map_field = 1; + // The parsed descriptor looks like: + // message MapFieldEntry { + // option map_entry = true; + // optional KeyType key = 1; + // optional ValueType value = 2; + // } + // repeated MapFieldEntry map_field = 1; + // + // Implementations may choose not to generate the map_entry=true message, but + // use a native map in the target language to hold the keys and values. + // The reflection APIs in such implementions still need to work as + // if the field is a repeated message field. + // + // NOTE: Do not set the option in .proto files. Always use the maps syntax + // instead. The option should only be implicitly set by the proto compiler + // parser. + MapEntry *bool `protobuf:"varint,7,opt,name=map_entry,json=mapEntry" json:"map_entry,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *MessageOptions) Reset() { *m = MessageOptions{} } +func (m *MessageOptions) String() string { return proto.CompactTextString(m) } +func (*MessageOptions) ProtoMessage() {} +func (*MessageOptions) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{10} } + +var extRange_MessageOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MessageOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MessageOptions +} + +const Default_MessageOptions_MessageSetWireFormat bool = false +const Default_MessageOptions_NoStandardDescriptorAccessor bool = false +const Default_MessageOptions_Deprecated bool = false + +func (m *MessageOptions) GetMessageSetWireFormat() bool { + if m != nil && m.MessageSetWireFormat != nil { + return *m.MessageSetWireFormat + } + return Default_MessageOptions_MessageSetWireFormat +} + +func (m *MessageOptions) GetNoStandardDescriptorAccessor() bool { + if m != nil && m.NoStandardDescriptorAccessor != nil { + return *m.NoStandardDescriptorAccessor + } + return Default_MessageOptions_NoStandardDescriptorAccessor +} + +func (m *MessageOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MessageOptions_Deprecated +} + +func (m *MessageOptions) GetMapEntry() bool { + if m != nil && m.MapEntry != nil { + return *m.MapEntry + } + return false +} + +func (m *MessageOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type FieldOptions struct { + // The ctype option instructs the C++ code generator to use a different + // representation of the field than it normally would. See the specific + // options below. This option is not yet implemented in the open source + // release -- sorry, we'll try to include it in a future version! + Ctype *FieldOptions_CType `protobuf:"varint,1,opt,name=ctype,enum=google.protobuf.FieldOptions_CType,def=0" json:"ctype,omitempty"` + // The packed option can be enabled for repeated primitive fields to enable + // a more efficient representation on the wire. Rather than repeatedly + // writing the tag and type for each element, the entire array is encoded as + // a single length-delimited blob. In proto3, only explicit setting it to + // false will avoid using packed encoding. + Packed *bool `protobuf:"varint,2,opt,name=packed" json:"packed,omitempty"` + // The jstype option determines the JavaScript type used for values of the + // field. The option is permitted only for 64 bit integral and fixed types + // (int64, uint64, sint64, fixed64, sfixed64). By default these types are + // represented as JavaScript strings. This avoids loss of precision that can + // happen when a large value is converted to a floating point JavaScript + // numbers. Specifying JS_NUMBER for the jstype causes the generated + // JavaScript code to use the JavaScript "number" type instead of strings. + // This option is an enum to permit additional types to be added, + // e.g. goog.math.Integer. + Jstype *FieldOptions_JSType `protobuf:"varint,6,opt,name=jstype,enum=google.protobuf.FieldOptions_JSType,def=0" json:"jstype,omitempty"` + // Should this field be parsed lazily? Lazy applies only to message-type + // fields. It means that when the outer message is initially parsed, the + // inner message's contents will not be parsed but instead stored in encoded + // form. The inner message will actually be parsed when it is first accessed. + // + // This is only a hint. Implementations are free to choose whether to use + // eager or lazy parsing regardless of the value of this option. However, + // setting this option true suggests that the protocol author believes that + // using lazy parsing on this field is worth the additional bookkeeping + // overhead typically needed to implement it. + // + // This option does not affect the public interface of any generated code; + // all method signatures remain the same. Furthermore, thread-safety of the + // interface is not affected by this option; const methods remain safe to + // call from multiple threads concurrently, while non-const methods continue + // to require exclusive access. + // + // + // Note that implementations may choose not to check required fields within + // a lazy sub-message. That is, calling IsInitialized() on the outher message + // may return true even if the inner message has missing required fields. + // This is necessary because otherwise the inner message would have to be + // parsed in order to perform the check, defeating the purpose of lazy + // parsing. An implementation which chooses not to check required fields + // must be consistent about it. That is, for any particular sub-message, the + // implementation must either *always* check its required fields, or *never* + // check its required fields, regardless of whether or not the message has + // been parsed. + Lazy *bool `protobuf:"varint,5,opt,name=lazy,def=0" json:"lazy,omitempty"` + // Is this field deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for accessors, or it will be completely ignored; in the very least, this + // is a formalization for deprecating fields. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // For Google-internal migration only. Do not use. + Weak *bool `protobuf:"varint,10,opt,name=weak,def=0" json:"weak,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *FieldOptions) Reset() { *m = FieldOptions{} } +func (m *FieldOptions) String() string { return proto.CompactTextString(m) } +func (*FieldOptions) ProtoMessage() {} +func (*FieldOptions) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{11} } + +var extRange_FieldOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*FieldOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_FieldOptions +} + +const Default_FieldOptions_Ctype FieldOptions_CType = FieldOptions_STRING +const Default_FieldOptions_Jstype FieldOptions_JSType = FieldOptions_JS_NORMAL +const Default_FieldOptions_Lazy bool = false +const Default_FieldOptions_Deprecated bool = false +const Default_FieldOptions_Weak bool = false + +func (m *FieldOptions) GetCtype() FieldOptions_CType { + if m != nil && m.Ctype != nil { + return *m.Ctype + } + return Default_FieldOptions_Ctype +} + +func (m *FieldOptions) GetPacked() bool { + if m != nil && m.Packed != nil { + return *m.Packed + } + return false +} + +func (m *FieldOptions) GetJstype() FieldOptions_JSType { + if m != nil && m.Jstype != nil { + return *m.Jstype + } + return Default_FieldOptions_Jstype +} + +func (m *FieldOptions) GetLazy() bool { + if m != nil && m.Lazy != nil { + return *m.Lazy + } + return Default_FieldOptions_Lazy +} + +func (m *FieldOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_FieldOptions_Deprecated +} + +func (m *FieldOptions) GetWeak() bool { + if m != nil && m.Weak != nil { + return *m.Weak + } + return Default_FieldOptions_Weak +} + +func (m *FieldOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type OneofOptions struct { + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *OneofOptions) Reset() { *m = OneofOptions{} } +func (m *OneofOptions) String() string { return proto.CompactTextString(m) } +func (*OneofOptions) ProtoMessage() {} +func (*OneofOptions) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{12} } + +var extRange_OneofOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*OneofOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_OneofOptions +} + +func (m *OneofOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumOptions struct { + // Set this option to true to allow mapping different tag names to the same + // value. + AllowAlias *bool `protobuf:"varint,2,opt,name=allow_alias,json=allowAlias" json:"allow_alias,omitempty"` + // Is this enum deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum, or it will be completely ignored; in the very least, this + // is a formalization for deprecating enums. + Deprecated *bool `protobuf:"varint,3,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *EnumOptions) Reset() { *m = EnumOptions{} } +func (m *EnumOptions) String() string { return proto.CompactTextString(m) } +func (*EnumOptions) ProtoMessage() {} +func (*EnumOptions) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{13} } + +var extRange_EnumOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumOptions +} + +const Default_EnumOptions_Deprecated bool = false + +func (m *EnumOptions) GetAllowAlias() bool { + if m != nil && m.AllowAlias != nil { + return *m.AllowAlias + } + return false +} + +func (m *EnumOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumOptions_Deprecated +} + +func (m *EnumOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type EnumValueOptions struct { + // Is this enum value deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the enum value, or it will be completely ignored; in the very least, + // this is a formalization for deprecating enum values. + Deprecated *bool `protobuf:"varint,1,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *EnumValueOptions) Reset() { *m = EnumValueOptions{} } +func (m *EnumValueOptions) String() string { return proto.CompactTextString(m) } +func (*EnumValueOptions) ProtoMessage() {} +func (*EnumValueOptions) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{14} } + +var extRange_EnumValueOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*EnumValueOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_EnumValueOptions +} + +const Default_EnumValueOptions_Deprecated bool = false + +func (m *EnumValueOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_EnumValueOptions_Deprecated +} + +func (m *EnumValueOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type ServiceOptions struct { + // Is this service deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the service, or it will be completely ignored; in the very least, + // this is a formalization for deprecating services. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *ServiceOptions) Reset() { *m = ServiceOptions{} } +func (m *ServiceOptions) String() string { return proto.CompactTextString(m) } +func (*ServiceOptions) ProtoMessage() {} +func (*ServiceOptions) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{15} } + +var extRange_ServiceOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*ServiceOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_ServiceOptions +} + +const Default_ServiceOptions_Deprecated bool = false + +func (m *ServiceOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_ServiceOptions_Deprecated +} + +func (m *ServiceOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +type MethodOptions struct { + // Is this method deprecated? + // Depending on the target platform, this can emit Deprecated annotations + // for the method, or it will be completely ignored; in the very least, + // this is a formalization for deprecating methods. + Deprecated *bool `protobuf:"varint,33,opt,name=deprecated,def=0" json:"deprecated,omitempty"` + // The parser stores options it doesn't recognize here. See above. + UninterpretedOption []*UninterpretedOption `protobuf:"bytes,999,rep,name=uninterpreted_option,json=uninterpretedOption" json:"uninterpreted_option,omitempty"` + proto.XXX_InternalExtensions `json:"-"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *MethodOptions) Reset() { *m = MethodOptions{} } +func (m *MethodOptions) String() string { return proto.CompactTextString(m) } +func (*MethodOptions) ProtoMessage() {} +func (*MethodOptions) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{16} } + +var extRange_MethodOptions = []proto.ExtensionRange{ + {Start: 1000, End: 536870911}, +} + +func (*MethodOptions) ExtensionRangeArray() []proto.ExtensionRange { + return extRange_MethodOptions +} + +const Default_MethodOptions_Deprecated bool = false + +func (m *MethodOptions) GetDeprecated() bool { + if m != nil && m.Deprecated != nil { + return *m.Deprecated + } + return Default_MethodOptions_Deprecated +} + +func (m *MethodOptions) GetUninterpretedOption() []*UninterpretedOption { + if m != nil { + return m.UninterpretedOption + } + return nil +} + +// A message representing a option the parser does not recognize. This only +// appears in options protos created by the compiler::Parser class. +// DescriptorPool resolves these when building Descriptor objects. Therefore, +// options protos in descriptor objects (e.g. returned by Descriptor::options(), +// or produced by Descriptor::CopyTo()) will never have UninterpretedOptions +// in them. +type UninterpretedOption struct { + Name []*UninterpretedOption_NamePart `protobuf:"bytes,2,rep,name=name" json:"name,omitempty"` + // The value of the uninterpreted option, in whatever type the tokenizer + // identified it as during parsing. Exactly one of these should be set. + IdentifierValue *string `protobuf:"bytes,3,opt,name=identifier_value,json=identifierValue" json:"identifier_value,omitempty"` + PositiveIntValue *uint64 `protobuf:"varint,4,opt,name=positive_int_value,json=positiveIntValue" json:"positive_int_value,omitempty"` + NegativeIntValue *int64 `protobuf:"varint,5,opt,name=negative_int_value,json=negativeIntValue" json:"negative_int_value,omitempty"` + DoubleValue *float64 `protobuf:"fixed64,6,opt,name=double_value,json=doubleValue" json:"double_value,omitempty"` + StringValue []byte `protobuf:"bytes,7,opt,name=string_value,json=stringValue" json:"string_value,omitempty"` + AggregateValue *string `protobuf:"bytes,8,opt,name=aggregate_value,json=aggregateValue" json:"aggregate_value,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *UninterpretedOption) Reset() { *m = UninterpretedOption{} } +func (m *UninterpretedOption) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption) ProtoMessage() {} +func (*UninterpretedOption) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{17} } + +func (m *UninterpretedOption) GetName() []*UninterpretedOption_NamePart { + if m != nil { + return m.Name + } + return nil +} + +func (m *UninterpretedOption) GetIdentifierValue() string { + if m != nil && m.IdentifierValue != nil { + return *m.IdentifierValue + } + return "" +} + +func (m *UninterpretedOption) GetPositiveIntValue() uint64 { + if m != nil && m.PositiveIntValue != nil { + return *m.PositiveIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetNegativeIntValue() int64 { + if m != nil && m.NegativeIntValue != nil { + return *m.NegativeIntValue + } + return 0 +} + +func (m *UninterpretedOption) GetDoubleValue() float64 { + if m != nil && m.DoubleValue != nil { + return *m.DoubleValue + } + return 0 +} + +func (m *UninterpretedOption) GetStringValue() []byte { + if m != nil { + return m.StringValue + } + return nil +} + +func (m *UninterpretedOption) GetAggregateValue() string { + if m != nil && m.AggregateValue != nil { + return *m.AggregateValue + } + return "" +} + +// The name of the uninterpreted option. Each string represents a segment in +// a dot-separated name. is_extension is true iff a segment represents an +// extension (denoted with parentheses in options specs in .proto files). +// E.g.,{ ["foo", false], ["bar.baz", true], ["qux", false] } represents +// "foo.(bar.baz).qux". +type UninterpretedOption_NamePart struct { + NamePart *string `protobuf:"bytes,1,req,name=name_part,json=namePart" json:"name_part,omitempty"` + IsExtension *bool `protobuf:"varint,2,req,name=is_extension,json=isExtension" json:"is_extension,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *UninterpretedOption_NamePart) Reset() { *m = UninterpretedOption_NamePart{} } +func (m *UninterpretedOption_NamePart) String() string { return proto.CompactTextString(m) } +func (*UninterpretedOption_NamePart) ProtoMessage() {} +func (*UninterpretedOption_NamePart) Descriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{17, 0} +} + +func (m *UninterpretedOption_NamePart) GetNamePart() string { + if m != nil && m.NamePart != nil { + return *m.NamePart + } + return "" +} + +func (m *UninterpretedOption_NamePart) GetIsExtension() bool { + if m != nil && m.IsExtension != nil { + return *m.IsExtension + } + return false +} + +// Encapsulates information about the original source file from which a +// FileDescriptorProto was generated. +type SourceCodeInfo struct { + // A Location identifies a piece of source code in a .proto file which + // corresponds to a particular definition. This information is intended + // to be useful to IDEs, code indexers, documentation generators, and similar + // tools. + // + // For example, say we have a file like: + // message Foo { + // optional string foo = 1; + // } + // Let's look at just the field definition: + // optional string foo = 1; + // ^ ^^ ^^ ^ ^^^ + // a bc de f ghi + // We have the following locations: + // span path represents + // [a,i) [ 4, 0, 2, 0 ] The whole field definition. + // [a,b) [ 4, 0, 2, 0, 4 ] The label (optional). + // [c,d) [ 4, 0, 2, 0, 5 ] The type (string). + // [e,f) [ 4, 0, 2, 0, 1 ] The name (foo). + // [g,h) [ 4, 0, 2, 0, 3 ] The number (1). + // + // Notes: + // - A location may refer to a repeated field itself (i.e. not to any + // particular index within it). This is used whenever a set of elements are + // logically enclosed in a single code segment. For example, an entire + // extend block (possibly containing multiple extension definitions) will + // have an outer location whose path refers to the "extensions" repeated + // field without an index. + // - Multiple locations may have the same path. This happens when a single + // logical declaration is spread out across multiple places. The most + // obvious example is the "extend" block again -- there may be multiple + // extend blocks in the same scope, each of which will have the same path. + // - A location's span is not always a subset of its parent's span. For + // example, the "extendee" of an extension declaration appears at the + // beginning of the "extend" block and is shared by all extensions within + // the block. + // - Just because a location's span is a subset of some other location's span + // does not mean that it is a descendent. For example, a "group" defines + // both a type and a field in a single declaration. Thus, the locations + // corresponding to the type and field and their components will overlap. + // - Code which tries to interpret locations should probably be designed to + // ignore those that it doesn't understand, as more types of locations could + // be recorded in the future. + Location []*SourceCodeInfo_Location `protobuf:"bytes,1,rep,name=location" json:"location,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *SourceCodeInfo) Reset() { *m = SourceCodeInfo{} } +func (m *SourceCodeInfo) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo) ProtoMessage() {} +func (*SourceCodeInfo) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{18} } + +func (m *SourceCodeInfo) GetLocation() []*SourceCodeInfo_Location { + if m != nil { + return m.Location + } + return nil +} + +type SourceCodeInfo_Location struct { + // Identifies which part of the FileDescriptorProto was defined at this + // location. + // + // Each element is a field number or an index. They form a path from + // the root FileDescriptorProto to the place where the definition. For + // example, this path: + // [ 4, 3, 2, 7, 1 ] + // refers to: + // file.message_type(3) // 4, 3 + // .field(7) // 2, 7 + // .name() // 1 + // This is because FileDescriptorProto.message_type has field number 4: + // repeated DescriptorProto message_type = 4; + // and DescriptorProto.field has field number 2: + // repeated FieldDescriptorProto field = 2; + // and FieldDescriptorProto.name has field number 1: + // optional string name = 1; + // + // Thus, the above path gives the location of a field name. If we removed + // the last element: + // [ 4, 3, 2, 7 ] + // this path refers to the whole field declaration (from the beginning + // of the label to the terminating semicolon). + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Always has exactly three or four elements: start line, start column, + // end line (optional, otherwise assumed same as start line), end column. + // These are packed into a single field for efficiency. Note that line + // and column numbers are zero-based -- typically you will want to add + // 1 to each before displaying to a user. + Span []int32 `protobuf:"varint,2,rep,packed,name=span" json:"span,omitempty"` + // If this SourceCodeInfo represents a complete declaration, these are any + // comments appearing before and after the declaration which appear to be + // attached to the declaration. + // + // A series of line comments appearing on consecutive lines, with no other + // tokens appearing on those lines, will be treated as a single comment. + // + // leading_detached_comments will keep paragraphs of comments that appear + // before (but not connected to) the current element. Each paragraph, + // separated by empty lines, will be one comment element in the repeated + // field. + // + // Only the comment content is provided; comment markers (e.g. //) are + // stripped out. For block comments, leading whitespace and an asterisk + // will be stripped from the beginning of each line other than the first. + // Newlines are included in the output. + // + // Examples: + // + // optional int32 foo = 1; // Comment attached to foo. + // // Comment attached to bar. + // optional int32 bar = 2; + // + // optional string baz = 3; + // // Comment attached to baz. + // // Another line attached to baz. + // + // // Comment attached to qux. + // // + // // Another line attached to qux. + // optional double qux = 4; + // + // // Detached comment for corge. This is not leading or trailing comments + // // to qux or corge because there are blank lines separating it from + // // both. + // + // // Detached comment for corge paragraph 2. + // + // optional string corge = 5; + // /* Block comment attached + // * to corge. Leading asterisks + // * will be removed. */ + // /* Block comment attached to + // * grault. */ + // optional int32 grault = 6; + // + // // ignored detached comments. + LeadingComments *string `protobuf:"bytes,3,opt,name=leading_comments,json=leadingComments" json:"leading_comments,omitempty"` + TrailingComments *string `protobuf:"bytes,4,opt,name=trailing_comments,json=trailingComments" json:"trailing_comments,omitempty"` + LeadingDetachedComments []string `protobuf:"bytes,6,rep,name=leading_detached_comments,json=leadingDetachedComments" json:"leading_detached_comments,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *SourceCodeInfo_Location) Reset() { *m = SourceCodeInfo_Location{} } +func (m *SourceCodeInfo_Location) String() string { return proto.CompactTextString(m) } +func (*SourceCodeInfo_Location) ProtoMessage() {} +func (*SourceCodeInfo_Location) Descriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{18, 0} +} + +func (m *SourceCodeInfo_Location) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *SourceCodeInfo_Location) GetSpan() []int32 { + if m != nil { + return m.Span + } + return nil +} + +func (m *SourceCodeInfo_Location) GetLeadingComments() string { + if m != nil && m.LeadingComments != nil { + return *m.LeadingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetTrailingComments() string { + if m != nil && m.TrailingComments != nil { + return *m.TrailingComments + } + return "" +} + +func (m *SourceCodeInfo_Location) GetLeadingDetachedComments() []string { + if m != nil { + return m.LeadingDetachedComments + } + return nil +} + +// Describes the relationship between generated code and its original source +// file. A GeneratedCodeInfo message is associated with only one generated +// source file, but may contain references to different source .proto files. +type GeneratedCodeInfo struct { + // An Annotation connects some span of text in generated code to an element + // of its generating .proto file. + Annotation []*GeneratedCodeInfo_Annotation `protobuf:"bytes,1,rep,name=annotation" json:"annotation,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *GeneratedCodeInfo) Reset() { *m = GeneratedCodeInfo{} } +func (m *GeneratedCodeInfo) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo) ProtoMessage() {} +func (*GeneratedCodeInfo) Descriptor() ([]byte, []int) { return fileDescriptorDescriptor, []int{19} } + +func (m *GeneratedCodeInfo) GetAnnotation() []*GeneratedCodeInfo_Annotation { + if m != nil { + return m.Annotation + } + return nil +} + +type GeneratedCodeInfo_Annotation struct { + // Identifies the element in the original source .proto file. This field + // is formatted the same as SourceCodeInfo.Location.path. + Path []int32 `protobuf:"varint,1,rep,packed,name=path" json:"path,omitempty"` + // Identifies the filesystem path to the original source .proto. + SourceFile *string `protobuf:"bytes,2,opt,name=source_file,json=sourceFile" json:"source_file,omitempty"` + // Identifies the starting offset in bytes in the generated code + // that relates to the identified object. + Begin *int32 `protobuf:"varint,3,opt,name=begin" json:"begin,omitempty"` + // Identifies the ending offset in bytes in the generated code that + // relates to the identified offset. The end offset should be one past + // the last relevant byte (so the length of the text = end - begin). + End *int32 `protobuf:"varint,4,opt,name=end" json:"end,omitempty"` + XXX_unrecognized []byte `json:"-"` +} + +func (m *GeneratedCodeInfo_Annotation) Reset() { *m = GeneratedCodeInfo_Annotation{} } +func (m *GeneratedCodeInfo_Annotation) String() string { return proto.CompactTextString(m) } +func (*GeneratedCodeInfo_Annotation) ProtoMessage() {} +func (*GeneratedCodeInfo_Annotation) Descriptor() ([]byte, []int) { + return fileDescriptorDescriptor, []int{19, 0} +} + +func (m *GeneratedCodeInfo_Annotation) GetPath() []int32 { + if m != nil { + return m.Path + } + return nil +} + +func (m *GeneratedCodeInfo_Annotation) GetSourceFile() string { + if m != nil && m.SourceFile != nil { + return *m.SourceFile + } + return "" +} + +func (m *GeneratedCodeInfo_Annotation) GetBegin() int32 { + if m != nil && m.Begin != nil { + return *m.Begin + } + return 0 +} + +func (m *GeneratedCodeInfo_Annotation) GetEnd() int32 { + if m != nil && m.End != nil { + return *m.End + } + return 0 +} + +func init() { + proto.RegisterType((*FileDescriptorSet)(nil), "google.protobuf.FileDescriptorSet") + proto.RegisterType((*FileDescriptorProto)(nil), "google.protobuf.FileDescriptorProto") + proto.RegisterType((*DescriptorProto)(nil), "google.protobuf.DescriptorProto") + proto.RegisterType((*DescriptorProto_ExtensionRange)(nil), "google.protobuf.DescriptorProto.ExtensionRange") + proto.RegisterType((*DescriptorProto_ReservedRange)(nil), "google.protobuf.DescriptorProto.ReservedRange") + proto.RegisterType((*FieldDescriptorProto)(nil), "google.protobuf.FieldDescriptorProto") + proto.RegisterType((*OneofDescriptorProto)(nil), "google.protobuf.OneofDescriptorProto") + proto.RegisterType((*EnumDescriptorProto)(nil), "google.protobuf.EnumDescriptorProto") + proto.RegisterType((*EnumValueDescriptorProto)(nil), "google.protobuf.EnumValueDescriptorProto") + proto.RegisterType((*ServiceDescriptorProto)(nil), "google.protobuf.ServiceDescriptorProto") + proto.RegisterType((*MethodDescriptorProto)(nil), "google.protobuf.MethodDescriptorProto") + proto.RegisterType((*FileOptions)(nil), "google.protobuf.FileOptions") + proto.RegisterType((*MessageOptions)(nil), "google.protobuf.MessageOptions") + proto.RegisterType((*FieldOptions)(nil), "google.protobuf.FieldOptions") + proto.RegisterType((*OneofOptions)(nil), "google.protobuf.OneofOptions") + proto.RegisterType((*EnumOptions)(nil), "google.protobuf.EnumOptions") + proto.RegisterType((*EnumValueOptions)(nil), "google.protobuf.EnumValueOptions") + proto.RegisterType((*ServiceOptions)(nil), "google.protobuf.ServiceOptions") + proto.RegisterType((*MethodOptions)(nil), "google.protobuf.MethodOptions") + proto.RegisterType((*UninterpretedOption)(nil), "google.protobuf.UninterpretedOption") + proto.RegisterType((*UninterpretedOption_NamePart)(nil), "google.protobuf.UninterpretedOption.NamePart") + proto.RegisterType((*SourceCodeInfo)(nil), "google.protobuf.SourceCodeInfo") + proto.RegisterType((*SourceCodeInfo_Location)(nil), "google.protobuf.SourceCodeInfo.Location") + proto.RegisterType((*GeneratedCodeInfo)(nil), "google.protobuf.GeneratedCodeInfo") + proto.RegisterType((*GeneratedCodeInfo_Annotation)(nil), "google.protobuf.GeneratedCodeInfo.Annotation") + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Type", FieldDescriptorProto_Type_name, FieldDescriptorProto_Type_value) + proto.RegisterEnum("google.protobuf.FieldDescriptorProto_Label", FieldDescriptorProto_Label_name, FieldDescriptorProto_Label_value) + proto.RegisterEnum("google.protobuf.FileOptions_OptimizeMode", FileOptions_OptimizeMode_name, FileOptions_OptimizeMode_value) + proto.RegisterEnum("google.protobuf.FieldOptions_CType", FieldOptions_CType_name, FieldOptions_CType_value) + proto.RegisterEnum("google.protobuf.FieldOptions_JSType", FieldOptions_JSType_name, FieldOptions_JSType_value) +} + +func init() { proto.RegisterFile("descriptor.proto", fileDescriptorDescriptor) } + +var fileDescriptorDescriptor = []byte{ + // 2273 bytes of a gzipped FileDescriptorProto + 0x1f, 0x8b, 0x08, 0x00, 0x00, 0x09, 0x6e, 0x88, 0x02, 0xff, 0xcc, 0x59, 0xcd, 0x6f, 0xdb, 0xc8, + 0x15, 0x5f, 0xea, 0xcb, 0xd2, 0x93, 0x2c, 0x8f, 0xc7, 0xde, 0x84, 0x71, 0x36, 0x1b, 0x47, 0x9b, + 0x34, 0x4e, 0xd2, 0x3a, 0x0b, 0xe7, 0x63, 0xb3, 0xde, 0x62, 0x0b, 0x59, 0x62, 0xbc, 0x0a, 0x64, + 0x4b, 0xa5, 0xec, 0x36, 0xbb, 0x3d, 0x10, 0x63, 0x72, 0x24, 0x33, 0xa1, 0x86, 0x2c, 0x49, 0x25, + 0xf1, 0x9e, 0x02, 0xf4, 0x54, 0xf4, 0x1f, 0x28, 0xda, 0xa2, 0x28, 0xf6, 0xb2, 0x40, 0xff, 0x80, + 0x1e, 0x7a, 0xef, 0xb5, 0x40, 0xef, 0x3d, 0x16, 0x68, 0xff, 0x83, 0x5e, 0x8b, 0x99, 0x21, 0x29, + 0xea, 0x6b, 0xe3, 0x2e, 0xb0, 0x1f, 0x27, 0x6b, 0x7e, 0xef, 0xf7, 0x1e, 0xdf, 0xbc, 0x79, 0x7c, + 0xef, 0x71, 0x0c, 0xc8, 0xa2, 0x81, 0xe9, 0xdb, 0x5e, 0xe8, 0xfa, 0xdb, 0x9e, 0xef, 0x86, 0x2e, + 0x5e, 0x19, 0xb8, 0xee, 0xc0, 0xa1, 0x72, 0x75, 0x32, 0xea, 0xd7, 0x0e, 0x60, 0xf5, 0xb1, 0xed, + 0xd0, 0x66, 0x42, 0xec, 0xd1, 0x10, 0x3f, 0x82, 0x5c, 0xdf, 0x76, 0xa8, 0xaa, 0x6c, 0x66, 0xb7, + 0xca, 0x3b, 0xd7, 0xb7, 0xa7, 0x94, 0xb6, 0x27, 0x35, 0xba, 0x1c, 0xd6, 0x85, 0x46, 0xed, 0x5f, + 0x39, 0x58, 0x9b, 0x23, 0xc5, 0x18, 0x72, 0x8c, 0x0c, 0xb9, 0x45, 0x65, 0xab, 0xa4, 0x8b, 0xdf, + 0x58, 0x85, 0x25, 0x8f, 0x98, 0xcf, 0xc9, 0x80, 0xaa, 0x19, 0x01, 0xc7, 0x4b, 0xfc, 0x2e, 0x80, + 0x45, 0x3d, 0xca, 0x2c, 0xca, 0xcc, 0x33, 0x35, 0xbb, 0x99, 0xdd, 0x2a, 0xe9, 0x29, 0x04, 0xdf, + 0x81, 0x55, 0x6f, 0x74, 0xe2, 0xd8, 0xa6, 0x91, 0xa2, 0xc1, 0x66, 0x76, 0x2b, 0xaf, 0x23, 0x29, + 0x68, 0x8e, 0xc9, 0x37, 0x61, 0xe5, 0x25, 0x25, 0xcf, 0xd3, 0xd4, 0xb2, 0xa0, 0x56, 0x39, 0x9c, + 0x22, 0x36, 0xa0, 0x32, 0xa4, 0x41, 0x40, 0x06, 0xd4, 0x08, 0xcf, 0x3c, 0xaa, 0xe6, 0xc4, 0xee, + 0x37, 0x67, 0x76, 0x3f, 0xbd, 0xf3, 0x72, 0xa4, 0x75, 0x74, 0xe6, 0x51, 0x5c, 0x87, 0x12, 0x65, + 0xa3, 0xa1, 0xb4, 0x90, 0x5f, 0x10, 0x3f, 0x8d, 0x8d, 0x86, 0xd3, 0x56, 0x8a, 0x5c, 0x2d, 0x32, + 0xb1, 0x14, 0x50, 0xff, 0x85, 0x6d, 0x52, 0xb5, 0x20, 0x0c, 0xdc, 0x9c, 0x31, 0xd0, 0x93, 0xf2, + 0x69, 0x1b, 0xb1, 0x1e, 0x6e, 0x40, 0x89, 0xbe, 0x0a, 0x29, 0x0b, 0x6c, 0x97, 0xa9, 0x4b, 0xc2, + 0xc8, 0x8d, 0x39, 0xa7, 0x48, 0x1d, 0x6b, 0xda, 0xc4, 0x58, 0x0f, 0x3f, 0x84, 0x25, 0xd7, 0x0b, + 0x6d, 0x97, 0x05, 0x6a, 0x71, 0x53, 0xd9, 0x2a, 0xef, 0xbc, 0x33, 0x37, 0x11, 0x3a, 0x92, 0xa3, + 0xc7, 0x64, 0xdc, 0x02, 0x14, 0xb8, 0x23, 0xdf, 0xa4, 0x86, 0xe9, 0x5a, 0xd4, 0xb0, 0x59, 0xdf, + 0x55, 0x4b, 0xc2, 0xc0, 0xd5, 0xd9, 0x8d, 0x08, 0x62, 0xc3, 0xb5, 0x68, 0x8b, 0xf5, 0x5d, 0xbd, + 0x1a, 0x4c, 0xac, 0xf1, 0x05, 0x28, 0x04, 0x67, 0x2c, 0x24, 0xaf, 0xd4, 0x8a, 0xc8, 0x90, 0x68, + 0x55, 0xfb, 0x6f, 0x1e, 0x56, 0xce, 0x93, 0x62, 0x1f, 0x41, 0xbe, 0xcf, 0x77, 0xa9, 0x66, 0xfe, + 0x9f, 0x18, 0x48, 0x9d, 0xc9, 0x20, 0x16, 0xbe, 0x66, 0x10, 0xeb, 0x50, 0x66, 0x34, 0x08, 0xa9, + 0x25, 0x33, 0x22, 0x7b, 0xce, 0x9c, 0x02, 0xa9, 0x34, 0x9b, 0x52, 0xb9, 0xaf, 0x95, 0x52, 0x4f, + 0x61, 0x25, 0x71, 0xc9, 0xf0, 0x09, 0x1b, 0xc4, 0xb9, 0x79, 0xf7, 0x4d, 0x9e, 0x6c, 0x6b, 0xb1, + 0x9e, 0xce, 0xd5, 0xf4, 0x2a, 0x9d, 0x58, 0xe3, 0x26, 0x80, 0xcb, 0xa8, 0xdb, 0x37, 0x2c, 0x6a, + 0x3a, 0x6a, 0x71, 0x41, 0x94, 0x3a, 0x9c, 0x32, 0x13, 0x25, 0x57, 0xa2, 0xa6, 0x83, 0x3f, 0x1c, + 0xa7, 0xda, 0xd2, 0x82, 0x4c, 0x39, 0x90, 0x2f, 0xd9, 0x4c, 0xb6, 0x1d, 0x43, 0xd5, 0xa7, 0x3c, + 0xef, 0xa9, 0x15, 0xed, 0xac, 0x24, 0x9c, 0xd8, 0x7e, 0xe3, 0xce, 0xf4, 0x48, 0x4d, 0x6e, 0x6c, + 0xd9, 0x4f, 0x2f, 0xf1, 0x7b, 0x90, 0x00, 0x86, 0x48, 0x2b, 0x10, 0x55, 0xa8, 0x12, 0x83, 0x87, + 0x64, 0x48, 0x37, 0x1e, 0x41, 0x75, 0x32, 0x3c, 0x78, 0x1d, 0xf2, 0x41, 0x48, 0xfc, 0x50, 0x64, + 0x61, 0x5e, 0x97, 0x0b, 0x8c, 0x20, 0x4b, 0x99, 0x25, 0xaa, 0x5c, 0x5e, 0xe7, 0x3f, 0x37, 0x3e, + 0x80, 0xe5, 0x89, 0xc7, 0x9f, 0x57, 0xb1, 0xf6, 0xdb, 0x02, 0xac, 0xcf, 0xcb, 0xb9, 0xb9, 0xe9, + 0x7f, 0x01, 0x0a, 0x6c, 0x34, 0x3c, 0xa1, 0xbe, 0x9a, 0x15, 0x16, 0xa2, 0x15, 0xae, 0x43, 0xde, + 0x21, 0x27, 0xd4, 0x51, 0x73, 0x9b, 0xca, 0x56, 0x75, 0xe7, 0xce, 0xb9, 0xb2, 0x7a, 0xbb, 0xcd, + 0x55, 0x74, 0xa9, 0x89, 0x3f, 0x86, 0x5c, 0x54, 0xe2, 0xb8, 0x85, 0xdb, 0xe7, 0xb3, 0xc0, 0x73, + 0x51, 0x17, 0x7a, 0xf8, 0x32, 0x94, 0xf8, 0x5f, 0x19, 0xdb, 0x82, 0xf0, 0xb9, 0xc8, 0x01, 0x1e, + 0x57, 0xbc, 0x01, 0x45, 0x91, 0x66, 0x16, 0x8d, 0x5b, 0x43, 0xb2, 0xe6, 0x07, 0x63, 0xd1, 0x3e, + 0x19, 0x39, 0xa1, 0xf1, 0x82, 0x38, 0x23, 0x2a, 0x12, 0xa6, 0xa4, 0x57, 0x22, 0xf0, 0x67, 0x1c, + 0xc3, 0x57, 0xa1, 0x2c, 0xb3, 0xd2, 0x66, 0x16, 0x7d, 0x25, 0xaa, 0x4f, 0x5e, 0x97, 0x89, 0xda, + 0xe2, 0x08, 0x7f, 0xfc, 0xb3, 0xc0, 0x65, 0xf1, 0xd1, 0x8a, 0x47, 0x70, 0x40, 0x3c, 0xfe, 0x83, + 0xe9, 0xc2, 0x77, 0x65, 0xfe, 0xf6, 0xa6, 0x73, 0xb1, 0xf6, 0x97, 0x0c, 0xe4, 0xc4, 0xfb, 0xb6, + 0x02, 0xe5, 0xa3, 0x4f, 0xbb, 0x9a, 0xd1, 0xec, 0x1c, 0xef, 0xb5, 0x35, 0xa4, 0xe0, 0x2a, 0x80, + 0x00, 0x1e, 0xb7, 0x3b, 0xf5, 0x23, 0x94, 0x49, 0xd6, 0xad, 0xc3, 0xa3, 0x87, 0xf7, 0x51, 0x36, + 0x51, 0x38, 0x96, 0x40, 0x2e, 0x4d, 0xb8, 0xb7, 0x83, 0xf2, 0x18, 0x41, 0x45, 0x1a, 0x68, 0x3d, + 0xd5, 0x9a, 0x0f, 0xef, 0xa3, 0xc2, 0x24, 0x72, 0x6f, 0x07, 0x2d, 0xe1, 0x65, 0x28, 0x09, 0x64, + 0xaf, 0xd3, 0x69, 0xa3, 0x62, 0x62, 0xb3, 0x77, 0xa4, 0xb7, 0x0e, 0xf7, 0x51, 0x29, 0xb1, 0xb9, + 0xaf, 0x77, 0x8e, 0xbb, 0x08, 0x12, 0x0b, 0x07, 0x5a, 0xaf, 0x57, 0xdf, 0xd7, 0x50, 0x39, 0x61, + 0xec, 0x7d, 0x7a, 0xa4, 0xf5, 0x50, 0x65, 0xc2, 0xad, 0x7b, 0x3b, 0x68, 0x39, 0x79, 0x84, 0x76, + 0x78, 0x7c, 0x80, 0xaa, 0x78, 0x15, 0x96, 0xe5, 0x23, 0x62, 0x27, 0x56, 0xa6, 0xa0, 0x87, 0xf7, + 0x11, 0x1a, 0x3b, 0x22, 0xad, 0xac, 0x4e, 0x00, 0x0f, 0xef, 0x23, 0x5c, 0x6b, 0x40, 0x5e, 0x64, + 0x17, 0xc6, 0x50, 0x6d, 0xd7, 0xf7, 0xb4, 0xb6, 0xd1, 0xe9, 0x1e, 0xb5, 0x3a, 0x87, 0xf5, 0x36, + 0x52, 0xc6, 0x98, 0xae, 0xfd, 0xf4, 0xb8, 0xa5, 0x6b, 0x4d, 0x94, 0x49, 0x63, 0x5d, 0xad, 0x7e, + 0xa4, 0x35, 0x51, 0xb6, 0x66, 0xc2, 0xfa, 0xbc, 0x3a, 0x33, 0xf7, 0xcd, 0x48, 0x1d, 0x71, 0x66, + 0xc1, 0x11, 0x0b, 0x5b, 0x33, 0x47, 0xfc, 0x85, 0x02, 0x6b, 0x73, 0x6a, 0xed, 0xdc, 0x87, 0xfc, + 0x04, 0xf2, 0x32, 0x45, 0x65, 0xf7, 0xb9, 0x35, 0xb7, 0x68, 0x8b, 0x84, 0x9d, 0xe9, 0x40, 0x42, + 0x2f, 0xdd, 0x81, 0xb3, 0x0b, 0x3a, 0x30, 0x37, 0x31, 0xe3, 0xe4, 0xaf, 0x14, 0x50, 0x17, 0xd9, + 0x7e, 0x43, 0xa1, 0xc8, 0x4c, 0x14, 0x8a, 0x8f, 0xa6, 0x1d, 0xb8, 0xb6, 0x78, 0x0f, 0x33, 0x5e, + 0x7c, 0xa9, 0xc0, 0x85, 0xf9, 0x83, 0xca, 0x5c, 0x1f, 0x3e, 0x86, 0xc2, 0x90, 0x86, 0xa7, 0x6e, + 0xdc, 0xac, 0x7f, 0x30, 0xa7, 0x05, 0x70, 0xf1, 0x74, 0xac, 0x22, 0xad, 0x74, 0x0f, 0xc9, 0x2e, + 0x9a, 0x36, 0xa4, 0x37, 0x33, 0x9e, 0xfe, 0x3a, 0x03, 0x6f, 0xcf, 0x35, 0x3e, 0xd7, 0xd1, 0x2b, + 0x00, 0x36, 0xf3, 0x46, 0xa1, 0x6c, 0xc8, 0xb2, 0x3e, 0x95, 0x04, 0x22, 0xde, 0x7d, 0x5e, 0x7b, + 0x46, 0x61, 0x22, 0xcf, 0x0a, 0x39, 0x48, 0x48, 0x10, 0x1e, 0x8d, 0x1d, 0xcd, 0x09, 0x47, 0xdf, + 0x5d, 0xb0, 0xd3, 0x99, 0x5e, 0xf7, 0x3e, 0x20, 0xd3, 0xb1, 0x29, 0x0b, 0x8d, 0x20, 0xf4, 0x29, + 0x19, 0xda, 0x6c, 0x20, 0x0a, 0x70, 0x71, 0x37, 0xdf, 0x27, 0x4e, 0x40, 0xf5, 0x15, 0x29, 0xee, + 0xc5, 0x52, 0xae, 0x21, 0xba, 0x8c, 0x9f, 0xd2, 0x28, 0x4c, 0x68, 0x48, 0x71, 0xa2, 0x51, 0xfb, + 0xcd, 0x12, 0x94, 0x53, 0x63, 0x1d, 0xbe, 0x06, 0x95, 0x67, 0xe4, 0x05, 0x31, 0xe2, 0x51, 0x5d, + 0x46, 0xa2, 0xcc, 0xb1, 0x6e, 0x34, 0xae, 0xbf, 0x0f, 0xeb, 0x82, 0xe2, 0x8e, 0x42, 0xea, 0x1b, + 0xa6, 0x43, 0x82, 0x40, 0x04, 0xad, 0x28, 0xa8, 0x98, 0xcb, 0x3a, 0x5c, 0xd4, 0x88, 0x25, 0xf8, + 0x01, 0xac, 0x09, 0x8d, 0xe1, 0xc8, 0x09, 0x6d, 0xcf, 0xa1, 0x06, 0xff, 0x78, 0x08, 0x44, 0x21, + 0x4e, 0x3c, 0x5b, 0xe5, 0x8c, 0x83, 0x88, 0xc0, 0x3d, 0x0a, 0xf0, 0x3e, 0x5c, 0x11, 0x6a, 0x03, + 0xca, 0xa8, 0x4f, 0x42, 0x6a, 0xd0, 0x5f, 0x8e, 0x88, 0x13, 0x18, 0x84, 0x59, 0xc6, 0x29, 0x09, + 0x4e, 0xd5, 0xf5, 0xb4, 0x81, 0x4b, 0x9c, 0xbb, 0x1f, 0x51, 0x35, 0xc1, 0xac, 0x33, 0xeb, 0x13, + 0x12, 0x9c, 0xe2, 0x5d, 0xb8, 0x20, 0x0c, 0x05, 0xa1, 0x6f, 0xb3, 0x81, 0x61, 0x9e, 0x52, 0xf3, + 0xb9, 0x31, 0x0a, 0xfb, 0x8f, 0xd4, 0xcb, 0x69, 0x0b, 0xc2, 0xc9, 0x9e, 0xe0, 0x34, 0x38, 0xe5, + 0x38, 0xec, 0x3f, 0xc2, 0x3d, 0xa8, 0xf0, 0xf3, 0x18, 0xda, 0x9f, 0x53, 0xa3, 0xef, 0xfa, 0xa2, + 0xb9, 0x54, 0xe7, 0xbc, 0xdc, 0xa9, 0x20, 0x6e, 0x77, 0x22, 0x85, 0x03, 0xd7, 0xa2, 0xbb, 0xf9, + 0x5e, 0x57, 0xd3, 0x9a, 0x7a, 0x39, 0xb6, 0xf2, 0xd8, 0xf5, 0x79, 0x4e, 0x0d, 0xdc, 0x24, 0xc6, + 0x65, 0x99, 0x53, 0x03, 0x37, 0x8e, 0xf0, 0x03, 0x58, 0x33, 0x4d, 0xb9, 0x6d, 0xdb, 0x34, 0xa2, + 0x29, 0x3f, 0x50, 0xd1, 0x44, 0xbc, 0x4c, 0x73, 0x5f, 0x12, 0xa2, 0x34, 0x0f, 0xf0, 0x87, 0xf0, + 0xf6, 0x38, 0x5e, 0x69, 0xc5, 0xd5, 0x99, 0x5d, 0x4e, 0xab, 0x3e, 0x80, 0x35, 0xef, 0x6c, 0x56, + 0x11, 0x4f, 0x3c, 0xd1, 0x3b, 0x9b, 0x56, 0xbb, 0x21, 0xbe, 0xdc, 0x7c, 0x6a, 0x92, 0x90, 0x5a, + 0xea, 0xc5, 0x34, 0x3b, 0x25, 0xc0, 0x77, 0x01, 0x99, 0xa6, 0x41, 0x19, 0x39, 0x71, 0xa8, 0x41, + 0x7c, 0xca, 0x48, 0xa0, 0x5e, 0x4d, 0x93, 0xab, 0xa6, 0xa9, 0x09, 0x69, 0x5d, 0x08, 0xf1, 0x6d, + 0x58, 0x75, 0x4f, 0x9e, 0x99, 0x32, 0xb9, 0x0c, 0xcf, 0xa7, 0x7d, 0xfb, 0x95, 0x7a, 0x5d, 0x84, + 0x69, 0x85, 0x0b, 0x44, 0x6a, 0x75, 0x05, 0x8c, 0x6f, 0x01, 0x32, 0x83, 0x53, 0xe2, 0x7b, 0xa2, + 0xbb, 0x07, 0x1e, 0x31, 0xa9, 0x7a, 0x43, 0x52, 0x25, 0x7e, 0x18, 0xc3, 0xf8, 0x29, 0xac, 0x8f, + 0x98, 0xcd, 0x42, 0xea, 0x7b, 0x3e, 0xe5, 0x43, 0xba, 0x7c, 0xd3, 0xd4, 0x7f, 0x2f, 0x2d, 0x18, + 0xb3, 0x8f, 0xd3, 0x6c, 0x79, 0xba, 0xfa, 0xda, 0x68, 0x16, 0xac, 0xed, 0x42, 0x25, 0x7d, 0xe8, + 0xb8, 0x04, 0xf2, 0xd8, 0x91, 0xc2, 0x7b, 0x68, 0xa3, 0xd3, 0xe4, 0xdd, 0xef, 0x33, 0x0d, 0x65, + 0x78, 0x17, 0x6e, 0xb7, 0x8e, 0x34, 0x43, 0x3f, 0x3e, 0x3c, 0x6a, 0x1d, 0x68, 0x28, 0x7b, 0xbb, + 0x54, 0xfc, 0xcf, 0x12, 0x7a, 0xfd, 0xfa, 0xf5, 0xeb, 0x4c, 0xed, 0x6f, 0x19, 0xa8, 0x4e, 0x4e, + 0xbe, 0xf8, 0xc7, 0x70, 0x31, 0xfe, 0x4c, 0x0d, 0x68, 0x68, 0xbc, 0xb4, 0x7d, 0x91, 0x87, 0x43, + 0x22, 0x67, 0xc7, 0x24, 0x84, 0xeb, 0x11, 0xab, 0x47, 0xc3, 0x9f, 0xdb, 0x3e, 0xcf, 0xb2, 0x21, + 0x09, 0x71, 0x1b, 0xae, 0x32, 0xd7, 0x08, 0x42, 0xc2, 0x2c, 0xe2, 0x5b, 0xc6, 0xf8, 0x82, 0xc0, + 0x20, 0xa6, 0x49, 0x83, 0xc0, 0x95, 0x2d, 0x20, 0xb1, 0xf2, 0x0e, 0x73, 0x7b, 0x11, 0x79, 0x5c, + 0x1b, 0xeb, 0x11, 0x75, 0xea, 0xb8, 0xb3, 0x8b, 0x8e, 0xfb, 0x32, 0x94, 0x86, 0xc4, 0x33, 0x28, + 0x0b, 0xfd, 0x33, 0x31, 0xaf, 0x15, 0xf5, 0xe2, 0x90, 0x78, 0x1a, 0x5f, 0x7f, 0x73, 0x67, 0x90, + 0x8e, 0xe3, 0x3f, 0xb3, 0x50, 0x49, 0xcf, 0x6c, 0x7c, 0x04, 0x36, 0x45, 0x7d, 0x56, 0xc4, 0xeb, + 0xfb, 0xde, 0x57, 0x4e, 0x78, 0xdb, 0x0d, 0x5e, 0xb8, 0x77, 0x0b, 0x72, 0x92, 0xd2, 0xa5, 0x26, + 0x6f, 0x9a, 0xfc, 0x85, 0xa5, 0x72, 0x3e, 0x2f, 0xea, 0xd1, 0x0a, 0xef, 0x43, 0xe1, 0x59, 0x20, + 0x6c, 0x17, 0x84, 0xed, 0xeb, 0x5f, 0x6d, 0xfb, 0x49, 0x4f, 0x18, 0x2f, 0x3d, 0xe9, 0x19, 0x87, + 0x1d, 0xfd, 0xa0, 0xde, 0xd6, 0x23, 0x75, 0x7c, 0x09, 0x72, 0x0e, 0xf9, 0xfc, 0x6c, 0xb2, 0xc4, + 0x0b, 0xe8, 0xbc, 0x81, 0xbf, 0x04, 0xb9, 0x97, 0x94, 0x3c, 0x9f, 0x2c, 0xac, 0x02, 0xfa, 0x06, + 0x53, 0xff, 0x2e, 0xe4, 0x45, 0xbc, 0x30, 0x40, 0x14, 0x31, 0xf4, 0x16, 0x2e, 0x42, 0xae, 0xd1, + 0xd1, 0x79, 0xfa, 0x23, 0xa8, 0x48, 0xd4, 0xe8, 0xb6, 0xb4, 0x86, 0x86, 0x32, 0xb5, 0x07, 0x50, + 0x90, 0x41, 0xe0, 0xaf, 0x46, 0x12, 0x06, 0xf4, 0x56, 0xb4, 0x8c, 0x6c, 0x28, 0xb1, 0xf4, 0xf8, + 0x60, 0x4f, 0xd3, 0x51, 0x26, 0x7d, 0xbc, 0x01, 0x54, 0xd2, 0xe3, 0xda, 0xb7, 0x93, 0x53, 0x7f, + 0x55, 0xa0, 0x9c, 0x1a, 0xbf, 0x78, 0xe3, 0x27, 0x8e, 0xe3, 0xbe, 0x34, 0x88, 0x63, 0x93, 0x20, + 0x4a, 0x0a, 0x10, 0x50, 0x9d, 0x23, 0xe7, 0x3d, 0xb4, 0x6f, 0xc5, 0xf9, 0x3f, 0x2a, 0x80, 0xa6, + 0x47, 0xb7, 0x29, 0x07, 0x95, 0xef, 0xd4, 0xc1, 0x3f, 0x28, 0x50, 0x9d, 0x9c, 0xd7, 0xa6, 0xdc, + 0xbb, 0xf6, 0x9d, 0xba, 0xf7, 0x7b, 0x05, 0x96, 0x27, 0xa6, 0xb4, 0xef, 0x95, 0x77, 0xbf, 0xcb, + 0xc2, 0xda, 0x1c, 0x3d, 0x5c, 0x8f, 0xc6, 0x59, 0x39, 0x61, 0xff, 0xe8, 0x3c, 0xcf, 0xda, 0xe6, + 0xdd, 0xb2, 0x4b, 0xfc, 0x30, 0x9a, 0x7e, 0x6f, 0x01, 0xb2, 0x2d, 0xca, 0x42, 0xbb, 0x6f, 0x53, + 0x3f, 0xfa, 0x04, 0x97, 0x33, 0xee, 0xca, 0x18, 0x97, 0x5f, 0xe1, 0x3f, 0x04, 0xec, 0xb9, 0x81, + 0x1d, 0xda, 0x2f, 0xa8, 0x61, 0xb3, 0xf8, 0x7b, 0x9d, 0xcf, 0xbc, 0x39, 0x1d, 0xc5, 0x92, 0x16, + 0x0b, 0x13, 0x36, 0xa3, 0x03, 0x32, 0xc5, 0xe6, 0xb5, 0x2f, 0xab, 0xa3, 0x58, 0x92, 0xb0, 0xaf, + 0x41, 0xc5, 0x72, 0x47, 0x7c, 0x7c, 0x90, 0x3c, 0x5e, 0x6a, 0x15, 0xbd, 0x2c, 0xb1, 0x84, 0x12, + 0xcd, 0x77, 0xe3, 0x8b, 0x82, 0x8a, 0x5e, 0x96, 0x98, 0xa4, 0xdc, 0x84, 0x15, 0x32, 0x18, 0xf8, + 0xdc, 0x78, 0x6c, 0x48, 0x0e, 0xad, 0xd5, 0x04, 0x16, 0xc4, 0x8d, 0x27, 0x50, 0x8c, 0xe3, 0xc0, + 0xbb, 0x19, 0x8f, 0x84, 0xe1, 0xc9, 0xeb, 0x9a, 0xcc, 0x56, 0x49, 0x2f, 0xb2, 0x58, 0x78, 0x0d, + 0x2a, 0x76, 0x60, 0x8c, 0xef, 0x0d, 0x33, 0x9b, 0x99, 0xad, 0xa2, 0x5e, 0xb6, 0x83, 0xe4, 0xa2, + 0xa8, 0xf6, 0x65, 0x06, 0xaa, 0x93, 0xf7, 0x9e, 0xb8, 0x09, 0x45, 0xc7, 0x35, 0x89, 0x48, 0x04, + 0x79, 0xe9, 0xbe, 0xf5, 0x86, 0xab, 0xd2, 0xed, 0x76, 0xc4, 0xd7, 0x13, 0xcd, 0x8d, 0xbf, 0x2b, + 0x50, 0x8c, 0x61, 0x7c, 0x01, 0x72, 0x1e, 0x09, 0x4f, 0x85, 0xb9, 0xfc, 0x5e, 0x06, 0x29, 0xba, + 0x58, 0x73, 0x3c, 0xf0, 0x08, 0x13, 0x29, 0x10, 0xe1, 0x7c, 0xcd, 0xcf, 0xd5, 0xa1, 0xc4, 0x12, + 0xe3, 0xb0, 0x3b, 0x1c, 0x52, 0x16, 0x06, 0xf1, 0xb9, 0x46, 0x78, 0x23, 0x82, 0xf1, 0x1d, 0x58, + 0x0d, 0x7d, 0x62, 0x3b, 0x13, 0xdc, 0x9c, 0xe0, 0xa2, 0x58, 0x90, 0x90, 0x77, 0xe1, 0x52, 0x6c, + 0xd7, 0xa2, 0x21, 0x31, 0x4f, 0xa9, 0x35, 0x56, 0x2a, 0x88, 0x4b, 0xb5, 0x8b, 0x11, 0xa1, 0x19, + 0xc9, 0x63, 0xdd, 0xda, 0x3f, 0x14, 0x58, 0x8d, 0x07, 0x78, 0x2b, 0x09, 0xd6, 0x01, 0x00, 0x61, + 0xcc, 0x0d, 0xd3, 0xe1, 0x9a, 0x4d, 0xe5, 0x19, 0xbd, 0xed, 0x7a, 0xa2, 0xa4, 0xa7, 0x0c, 0x6c, + 0x0c, 0x01, 0xc6, 0x92, 0x85, 0x61, 0xbb, 0x0a, 0xe5, 0xe8, 0x52, 0x5b, 0xfc, 0x67, 0x44, 0x7e, + 0xf5, 0x81, 0x84, 0xf8, 0xa4, 0x8f, 0xd7, 0x21, 0x7f, 0x42, 0x07, 0x36, 0x8b, 0xae, 0xda, 0xe4, + 0x22, 0xbe, 0xc0, 0xcb, 0x25, 0x17, 0x78, 0x7b, 0xbf, 0x80, 0x35, 0xd3, 0x1d, 0x4e, 0xbb, 0xbb, + 0x87, 0xa6, 0xbe, 0x3c, 0x83, 0x4f, 0x94, 0xcf, 0x60, 0x3c, 0x9d, 0xfd, 0x49, 0x51, 0xbe, 0xc8, + 0x64, 0xf7, 0xbb, 0x7b, 0x7f, 0xce, 0x6c, 0xec, 0x4b, 0xd5, 0x6e, 0xbc, 0x53, 0x9d, 0xf6, 0x1d, + 0x6a, 0x72, 0xef, 0xff, 0x17, 0x00, 0x00, 0xff, 0xff, 0xd0, 0xf2, 0xf3, 0xa9, 0xf1, 0x19, 0x00, + 0x00, +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go new file mode 100644 index 000000000..785d6f9fe --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/descriptor_gostring.gen.go @@ -0,0 +1,715 @@ +// Code generated by protoc-gen-gogo. +// source: descriptor.proto +// DO NOT EDIT! + +/* +Package descriptor is a generated protocol buffer package. + +It is generated from these files: + descriptor.proto + +It has these top-level messages: + FileDescriptorSet + FileDescriptorProto + DescriptorProto + FieldDescriptorProto + OneofDescriptorProto + EnumDescriptorProto + EnumValueDescriptorProto + ServiceDescriptorProto + MethodDescriptorProto + FileOptions + MessageOptions + FieldOptions + OneofOptions + EnumOptions + EnumValueOptions + ServiceOptions + MethodOptions + UninterpretedOption + SourceCodeInfo + GeneratedCodeInfo +*/ +package descriptor + +import fmt "fmt" +import strings "strings" +import github_com_gogo_protobuf_proto "github.com/gogo/protobuf/proto" +import sort "sort" +import strconv "strconv" +import reflect "reflect" +import proto "github.com/gogo/protobuf/proto" +import math "math" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +func (this *FileDescriptorSet) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.FileDescriptorSet{") + if this.File != nil { + s = append(s, "File: "+fmt.Sprintf("%#v", this.File)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 16) + s = append(s, "&descriptor.FileDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Package != nil { + s = append(s, "Package: "+valueToGoStringDescriptor(this.Package, "string")+",\n") + } + if this.Dependency != nil { + s = append(s, "Dependency: "+fmt.Sprintf("%#v", this.Dependency)+",\n") + } + if this.PublicDependency != nil { + s = append(s, "PublicDependency: "+fmt.Sprintf("%#v", this.PublicDependency)+",\n") + } + if this.WeakDependency != nil { + s = append(s, "WeakDependency: "+fmt.Sprintf("%#v", this.WeakDependency)+",\n") + } + if this.MessageType != nil { + s = append(s, "MessageType: "+fmt.Sprintf("%#v", this.MessageType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.Service != nil { + s = append(s, "Service: "+fmt.Sprintf("%#v", this.Service)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.SourceCodeInfo != nil { + s = append(s, "SourceCodeInfo: "+fmt.Sprintf("%#v", this.SourceCodeInfo)+",\n") + } + if this.Syntax != nil { + s = append(s, "Syntax: "+valueToGoStringDescriptor(this.Syntax, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.DescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Field != nil { + s = append(s, "Field: "+fmt.Sprintf("%#v", this.Field)+",\n") + } + if this.Extension != nil { + s = append(s, "Extension: "+fmt.Sprintf("%#v", this.Extension)+",\n") + } + if this.NestedType != nil { + s = append(s, "NestedType: "+fmt.Sprintf("%#v", this.NestedType)+",\n") + } + if this.EnumType != nil { + s = append(s, "EnumType: "+fmt.Sprintf("%#v", this.EnumType)+",\n") + } + if this.ExtensionRange != nil { + s = append(s, "ExtensionRange: "+fmt.Sprintf("%#v", this.ExtensionRange)+",\n") + } + if this.OneofDecl != nil { + s = append(s, "OneofDecl: "+fmt.Sprintf("%#v", this.OneofDecl)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ReservedRange != nil { + s = append(s, "ReservedRange: "+fmt.Sprintf("%#v", this.ReservedRange)+",\n") + } + if this.ReservedName != nil { + s = append(s, "ReservedName: "+fmt.Sprintf("%#v", this.ReservedName)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ExtensionRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.DescriptorProto_ExtensionRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *DescriptorProto_ReservedRange) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.DescriptorProto_ReservedRange{") + if this.Start != nil { + s = append(s, "Start: "+valueToGoStringDescriptor(this.Start, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 14) + s = append(s, "&descriptor.FieldDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Label != nil { + s = append(s, "Label: "+valueToGoStringDescriptor(this.Label, "descriptor.FieldDescriptorProto_Label")+",\n") + } + if this.Type != nil { + s = append(s, "Type: "+valueToGoStringDescriptor(this.Type, "descriptor.FieldDescriptorProto_Type")+",\n") + } + if this.TypeName != nil { + s = append(s, "TypeName: "+valueToGoStringDescriptor(this.TypeName, "string")+",\n") + } + if this.Extendee != nil { + s = append(s, "Extendee: "+valueToGoStringDescriptor(this.Extendee, "string")+",\n") + } + if this.DefaultValue != nil { + s = append(s, "DefaultValue: "+valueToGoStringDescriptor(this.DefaultValue, "string")+",\n") + } + if this.OneofIndex != nil { + s = append(s, "OneofIndex: "+valueToGoStringDescriptor(this.OneofIndex, "int32")+",\n") + } + if this.JsonName != nil { + s = append(s, "JsonName: "+valueToGoStringDescriptor(this.JsonName, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.OneofDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Value != nil { + s = append(s, "Value: "+fmt.Sprintf("%#v", this.Value)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumValueDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Number != nil { + s = append(s, "Number: "+valueToGoStringDescriptor(this.Number, "int32")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.ServiceDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.Method != nil { + s = append(s, "Method: "+fmt.Sprintf("%#v", this.Method)+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodDescriptorProto) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 10) + s = append(s, "&descriptor.MethodDescriptorProto{") + if this.Name != nil { + s = append(s, "Name: "+valueToGoStringDescriptor(this.Name, "string")+",\n") + } + if this.InputType != nil { + s = append(s, "InputType: "+valueToGoStringDescriptor(this.InputType, "string")+",\n") + } + if this.OutputType != nil { + s = append(s, "OutputType: "+valueToGoStringDescriptor(this.OutputType, "string")+",\n") + } + if this.Options != nil { + s = append(s, "Options: "+fmt.Sprintf("%#v", this.Options)+",\n") + } + if this.ClientStreaming != nil { + s = append(s, "ClientStreaming: "+valueToGoStringDescriptor(this.ClientStreaming, "bool")+",\n") + } + if this.ServerStreaming != nil { + s = append(s, "ServerStreaming: "+valueToGoStringDescriptor(this.ServerStreaming, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FileOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 19) + s = append(s, "&descriptor.FileOptions{") + if this.JavaPackage != nil { + s = append(s, "JavaPackage: "+valueToGoStringDescriptor(this.JavaPackage, "string")+",\n") + } + if this.JavaOuterClassname != nil { + s = append(s, "JavaOuterClassname: "+valueToGoStringDescriptor(this.JavaOuterClassname, "string")+",\n") + } + if this.JavaMultipleFiles != nil { + s = append(s, "JavaMultipleFiles: "+valueToGoStringDescriptor(this.JavaMultipleFiles, "bool")+",\n") + } + if this.JavaGenerateEqualsAndHash != nil { + s = append(s, "JavaGenerateEqualsAndHash: "+valueToGoStringDescriptor(this.JavaGenerateEqualsAndHash, "bool")+",\n") + } + if this.JavaStringCheckUtf8 != nil { + s = append(s, "JavaStringCheckUtf8: "+valueToGoStringDescriptor(this.JavaStringCheckUtf8, "bool")+",\n") + } + if this.OptimizeFor != nil { + s = append(s, "OptimizeFor: "+valueToGoStringDescriptor(this.OptimizeFor, "descriptor.FileOptions_OptimizeMode")+",\n") + } + if this.GoPackage != nil { + s = append(s, "GoPackage: "+valueToGoStringDescriptor(this.GoPackage, "string")+",\n") + } + if this.CcGenericServices != nil { + s = append(s, "CcGenericServices: "+valueToGoStringDescriptor(this.CcGenericServices, "bool")+",\n") + } + if this.JavaGenericServices != nil { + s = append(s, "JavaGenericServices: "+valueToGoStringDescriptor(this.JavaGenericServices, "bool")+",\n") + } + if this.PyGenericServices != nil { + s = append(s, "PyGenericServices: "+valueToGoStringDescriptor(this.PyGenericServices, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.CcEnableArenas != nil { + s = append(s, "CcEnableArenas: "+valueToGoStringDescriptor(this.CcEnableArenas, "bool")+",\n") + } + if this.ObjcClassPrefix != nil { + s = append(s, "ObjcClassPrefix: "+valueToGoStringDescriptor(this.ObjcClassPrefix, "string")+",\n") + } + if this.CsharpNamespace != nil { + s = append(s, "CsharpNamespace: "+valueToGoStringDescriptor(this.CsharpNamespace, "string")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MessageOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.MessageOptions{") + if this.MessageSetWireFormat != nil { + s = append(s, "MessageSetWireFormat: "+valueToGoStringDescriptor(this.MessageSetWireFormat, "bool")+",\n") + } + if this.NoStandardDescriptorAccessor != nil { + s = append(s, "NoStandardDescriptorAccessor: "+valueToGoStringDescriptor(this.NoStandardDescriptorAccessor, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.MapEntry != nil { + s = append(s, "MapEntry: "+valueToGoStringDescriptor(this.MapEntry, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *FieldOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.FieldOptions{") + if this.Ctype != nil { + s = append(s, "Ctype: "+valueToGoStringDescriptor(this.Ctype, "descriptor.FieldOptions_CType")+",\n") + } + if this.Packed != nil { + s = append(s, "Packed: "+valueToGoStringDescriptor(this.Packed, "bool")+",\n") + } + if this.Jstype != nil { + s = append(s, "Jstype: "+valueToGoStringDescriptor(this.Jstype, "descriptor.FieldOptions_JSType")+",\n") + } + if this.Lazy != nil { + s = append(s, "Lazy: "+valueToGoStringDescriptor(this.Lazy, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.Weak != nil { + s = append(s, "Weak: "+valueToGoStringDescriptor(this.Weak, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *OneofOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.OneofOptions{") + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 7) + s = append(s, "&descriptor.EnumOptions{") + if this.AllowAlias != nil { + s = append(s, "AllowAlias: "+valueToGoStringDescriptor(this.AllowAlias, "bool")+",\n") + } + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *EnumValueOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.EnumValueOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *ServiceOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.ServiceOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *MethodOptions) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.MethodOptions{") + if this.Deprecated != nil { + s = append(s, "Deprecated: "+valueToGoStringDescriptor(this.Deprecated, "bool")+",\n") + } + if this.UninterpretedOption != nil { + s = append(s, "UninterpretedOption: "+fmt.Sprintf("%#v", this.UninterpretedOption)+",\n") + } + s = append(s, "XXX_InternalExtensions: "+extensionToGoStringDescriptor(this)+",\n") + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 11) + s = append(s, "&descriptor.UninterpretedOption{") + if this.Name != nil { + s = append(s, "Name: "+fmt.Sprintf("%#v", this.Name)+",\n") + } + if this.IdentifierValue != nil { + s = append(s, "IdentifierValue: "+valueToGoStringDescriptor(this.IdentifierValue, "string")+",\n") + } + if this.PositiveIntValue != nil { + s = append(s, "PositiveIntValue: "+valueToGoStringDescriptor(this.PositiveIntValue, "uint64")+",\n") + } + if this.NegativeIntValue != nil { + s = append(s, "NegativeIntValue: "+valueToGoStringDescriptor(this.NegativeIntValue, "int64")+",\n") + } + if this.DoubleValue != nil { + s = append(s, "DoubleValue: "+valueToGoStringDescriptor(this.DoubleValue, "float64")+",\n") + } + if this.StringValue != nil { + s = append(s, "StringValue: "+valueToGoStringDescriptor(this.StringValue, "byte")+",\n") + } + if this.AggregateValue != nil { + s = append(s, "AggregateValue: "+valueToGoStringDescriptor(this.AggregateValue, "string")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *UninterpretedOption_NamePart) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 6) + s = append(s, "&descriptor.UninterpretedOption_NamePart{") + if this.NamePart != nil { + s = append(s, "NamePart: "+valueToGoStringDescriptor(this.NamePart, "string")+",\n") + } + if this.IsExtension != nil { + s = append(s, "IsExtension: "+valueToGoStringDescriptor(this.IsExtension, "bool")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.SourceCodeInfo{") + if this.Location != nil { + s = append(s, "Location: "+fmt.Sprintf("%#v", this.Location)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *SourceCodeInfo_Location) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 9) + s = append(s, "&descriptor.SourceCodeInfo_Location{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.Span != nil { + s = append(s, "Span: "+fmt.Sprintf("%#v", this.Span)+",\n") + } + if this.LeadingComments != nil { + s = append(s, "LeadingComments: "+valueToGoStringDescriptor(this.LeadingComments, "string")+",\n") + } + if this.TrailingComments != nil { + s = append(s, "TrailingComments: "+valueToGoStringDescriptor(this.TrailingComments, "string")+",\n") + } + if this.LeadingDetachedComments != nil { + s = append(s, "LeadingDetachedComments: "+fmt.Sprintf("%#v", this.LeadingDetachedComments)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 5) + s = append(s, "&descriptor.GeneratedCodeInfo{") + if this.Annotation != nil { + s = append(s, "Annotation: "+fmt.Sprintf("%#v", this.Annotation)+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func (this *GeneratedCodeInfo_Annotation) GoString() string { + if this == nil { + return "nil" + } + s := make([]string, 0, 8) + s = append(s, "&descriptor.GeneratedCodeInfo_Annotation{") + if this.Path != nil { + s = append(s, "Path: "+fmt.Sprintf("%#v", this.Path)+",\n") + } + if this.SourceFile != nil { + s = append(s, "SourceFile: "+valueToGoStringDescriptor(this.SourceFile, "string")+",\n") + } + if this.Begin != nil { + s = append(s, "Begin: "+valueToGoStringDescriptor(this.Begin, "int32")+",\n") + } + if this.End != nil { + s = append(s, "End: "+valueToGoStringDescriptor(this.End, "int32")+",\n") + } + if this.XXX_unrecognized != nil { + s = append(s, "XXX_unrecognized:"+fmt.Sprintf("%#v", this.XXX_unrecognized)+",\n") + } + s = append(s, "}") + return strings.Join(s, "") +} +func valueToGoStringDescriptor(v interface{}, typ string) string { + rv := reflect.ValueOf(v) + if rv.IsNil() { + return "nil" + } + pv := reflect.Indirect(rv).Interface() + return fmt.Sprintf("func(v %v) *%v { return &v } ( %#v )", typ, typ, pv) +} +func extensionToGoStringDescriptor(m github_com_gogo_protobuf_proto.Message) string { + e := github_com_gogo_protobuf_proto.GetUnsafeExtensionsMap(m) + if e == nil { + return "nil" + } + s := "proto.NewUnsafeXXX_InternalExtensions(map[int32]proto.Extension{" + keys := make([]int, 0, len(e)) + for k := range e { + keys = append(keys, int(k)) + } + sort.Ints(keys) + ss := []string{} + for _, k := range keys { + ss = append(ss, strconv.Itoa(k)+": "+e[int32(k)].GoString()) + } + s += strings.Join(ss, ",") + "})" + return s +} diff --git a/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go new file mode 100644 index 000000000..861f4d028 --- /dev/null +++ b/vendor/github.com/gogo/protobuf/protoc-gen-gogo/descriptor/helper.go @@ -0,0 +1,357 @@ +// Protocol Buffers for Go with Gadgets +// +// Copyright (c) 2013, The GoGo Authors. All rights reserved. +// http://github.com/gogo/protobuf +// +// Redistribution and use in source and binary forms, with or without +// modification, are permitted provided that the following conditions are +// met: +// +// * Redistributions of source code must retain the above copyright +// notice, this list of conditions and the following disclaimer. +// * Redistributions in binary form must reproduce the above +// copyright notice, this list of conditions and the following disclaimer +// in the documentation and/or other materials provided with the +// distribution. +// +// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +// "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +// LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +// A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +// OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +// SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +// LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +// DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +// THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + +package descriptor + +import ( + "strings" +) + +func (msg *DescriptorProto) GetMapFields() (*FieldDescriptorProto, *FieldDescriptorProto) { + if !msg.GetOptions().GetMapEntry() { + return nil, nil + } + return msg.GetField()[0], msg.GetField()[1] +} + +func dotToUnderscore(r rune) rune { + if r == '.' { + return '_' + } + return r +} + +func (field *FieldDescriptorProto) WireType() (wire int) { + switch *field.Type { + case FieldDescriptorProto_TYPE_DOUBLE: + return 1 + case FieldDescriptorProto_TYPE_FLOAT: + return 5 + case FieldDescriptorProto_TYPE_INT64: + return 0 + case FieldDescriptorProto_TYPE_UINT64: + return 0 + case FieldDescriptorProto_TYPE_INT32: + return 0 + case FieldDescriptorProto_TYPE_UINT32: + return 0 + case FieldDescriptorProto_TYPE_FIXED64: + return 1 + case FieldDescriptorProto_TYPE_FIXED32: + return 5 + case FieldDescriptorProto_TYPE_BOOL: + return 0 + case FieldDescriptorProto_TYPE_STRING: + return 2 + case FieldDescriptorProto_TYPE_GROUP: + return 2 + case FieldDescriptorProto_TYPE_MESSAGE: + return 2 + case FieldDescriptorProto_TYPE_BYTES: + return 2 + case FieldDescriptorProto_TYPE_ENUM: + return 0 + case FieldDescriptorProto_TYPE_SFIXED32: + return 5 + case FieldDescriptorProto_TYPE_SFIXED64: + return 1 + case FieldDescriptorProto_TYPE_SINT32: + return 0 + case FieldDescriptorProto_TYPE_SINT64: + return 0 + } + panic("unreachable") +} + +func (field *FieldDescriptorProto) GetKeyUint64() (x uint64) { + packed := field.IsPacked() + wireType := field.WireType() + fieldNumber := field.GetNumber() + if packed { + wireType = 2 + } + x = uint64(uint32(fieldNumber)<<3 | uint32(wireType)) + return x +} + +func (field *FieldDescriptorProto) GetKey() []byte { + x := field.GetKeyUint64() + i := 0 + keybuf := make([]byte, 0) + for i = 0; x > 127; i++ { + keybuf = append(keybuf, 0x80|uint8(x&0x7F)) + x >>= 7 + } + keybuf = append(keybuf, uint8(x)) + return keybuf +} + +func (desc *FileDescriptorSet) GetField(packageName, messageName, fieldName string) *FieldDescriptorProto { + msg := desc.GetMessage(packageName, messageName) + if msg == nil { + return nil + } + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (file *FileDescriptorProto) GetMessage(typeName string) *DescriptorProto { + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + nes := file.GetNestedMessage(msg, strings.TrimPrefix(typeName, msg.GetName()+".")) + if nes != nil { + return nes + } + } + return nil +} + +func (file *FileDescriptorProto) GetNestedMessage(msg *DescriptorProto, typeName string) *DescriptorProto { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + res := file.GetNestedMessage(nes, strings.TrimPrefix(typeName, nes.GetName()+".")) + if res != nil { + return res + } + } + return nil +} + +func (desc *FileDescriptorSet) GetMessage(packageName string, typeName string) *DescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return msg + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return nes + } + if msg.GetName()+"."+nes.GetName() == typeName { + return nes + } + } + } + } + return nil +} + +func (desc *FileDescriptorSet) IsProto3(packageName string, typeName string) bool { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, msg := range file.GetMessageType() { + if msg.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + for _, msg := range file.GetMessageType() { + for _, nes := range msg.GetNestedType() { + if nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + if msg.GetName()+"."+nes.GetName() == typeName { + return file.GetSyntax() == "proto3" + } + } + } + } + return false +} + +func (msg *DescriptorProto) IsExtendable() bool { + return len(msg.GetExtensionRange()) > 0 +} + +func (desc *FileDescriptorSet) FindExtension(packageName string, typeName string, fieldName string) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetName() == fieldName { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindExtensionByFieldNumber(packageName string, typeName string, fieldNum int32) (extPackageName string, field *FieldDescriptorProto) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", nil + } + if !parent.IsExtendable() { + return "", nil + } + extendee := "." + packageName + "." + typeName + for _, file := range desc.GetFile() { + for _, ext := range file.GetExtension() { + if strings.Map(dotToUnderscore, file.GetPackage()) == strings.Map(dotToUnderscore, packageName) { + if !(ext.GetExtendee() == typeName || ext.GetExtendee() == extendee) { + continue + } + } else { + if ext.GetExtendee() != extendee { + continue + } + } + if ext.GetNumber() == fieldNum { + return file.GetPackage(), ext + } + } + } + return "", nil +} + +func (desc *FileDescriptorSet) FindMessage(packageName string, typeName string, fieldName string) (msgPackageName string, msgName string) { + parent := desc.GetMessage(packageName, typeName) + if parent == nil { + return "", "" + } + field := parent.GetFieldDescriptor(fieldName) + if field == nil { + var extPackageName string + extPackageName, field = desc.FindExtension(packageName, typeName, fieldName) + if field == nil { + return "", "" + } + packageName = extPackageName + } + typeNames := strings.Split(field.GetTypeName(), ".") + if len(typeNames) == 1 { + msg := desc.GetMessage(packageName, typeName) + if msg == nil { + return "", "" + } + return packageName, msg.GetName() + } + if len(typeNames) > 2 { + for i := 1; i < len(typeNames)-1; i++ { + packageName = strings.Join(typeNames[1:len(typeNames)-i], ".") + typeName = strings.Join(typeNames[len(typeNames)-i:], ".") + msg := desc.GetMessage(packageName, typeName) + if msg != nil { + typeNames := strings.Split(msg.GetName(), ".") + if len(typeNames) == 1 { + return packageName, msg.GetName() + } + return strings.Join(typeNames[1:len(typeNames)-1], "."), typeNames[len(typeNames)-1] + } + } + } + return "", "" +} + +func (msg *DescriptorProto) GetFieldDescriptor(fieldName string) *FieldDescriptorProto { + for _, field := range msg.GetField() { + if field.GetName() == fieldName { + return field + } + } + return nil +} + +func (desc *FileDescriptorSet) GetEnum(packageName string, typeName string) *EnumDescriptorProto { + for _, file := range desc.GetFile() { + if strings.Map(dotToUnderscore, file.GetPackage()) != strings.Map(dotToUnderscore, packageName) { + continue + } + for _, enum := range file.GetEnumType() { + if enum.GetName() == typeName { + return enum + } + } + } + return nil +} + +func (f *FieldDescriptorProto) IsEnum() bool { + return *f.Type == FieldDescriptorProto_TYPE_ENUM +} + +func (f *FieldDescriptorProto) IsMessage() bool { + return *f.Type == FieldDescriptorProto_TYPE_MESSAGE +} + +func (f *FieldDescriptorProto) IsBytes() bool { + return *f.Type == FieldDescriptorProto_TYPE_BYTES +} + +func (f *FieldDescriptorProto) IsRepeated() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REPEATED +} + +func (f *FieldDescriptorProto) IsString() bool { + return *f.Type == FieldDescriptorProto_TYPE_STRING +} + +func (f *FieldDescriptorProto) IsBool() bool { + return *f.Type == FieldDescriptorProto_TYPE_BOOL +} + +func (f *FieldDescriptorProto) IsRequired() bool { + return f.Label != nil && *f.Label == FieldDescriptorProto_LABEL_REQUIRED +} + +func (f *FieldDescriptorProto) IsPacked() bool { + return f.Options != nil && f.GetOptions().GetPacked() +} + +func (m *DescriptorProto) HasExtension() bool { + return len(m.ExtensionRange) > 0 +} diff --git a/vendor/github.com/nats-io/go-nats-streaming/LICENSE b/vendor/github.com/nats-io/go-nats-streaming/LICENSE new file mode 100644 index 000000000..d5cf6aa5f --- /dev/null +++ b/vendor/github.com/nats-io/go-nats-streaming/LICENSE @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2016 Apcera Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/vendor/github.com/nats-io/go-nats-streaming/README.md b/vendor/github.com/nats-io/go-nats-streaming/README.md new file mode 100644 index 000000000..945eb0650 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats-streaming/README.md @@ -0,0 +1,350 @@ +# NATS Streaming + +NATS Streaming is an extremely performant, lightweight reliable streaming platform powered by [NATS](https://nats.io). + +[![License MIT](https://img.shields.io/npm/l/express.svg)](http://opensource.org/licenses/MIT) +[![Build Status](https://travis-ci.org/nats-io/go-nats-streaming.svg?branch=master)](http://travis-ci.org/nats-io/go-nats-streaming) +[![Coverage Status](https://coveralls.io/repos/nats-io/go-nats-streaming/badge.svg?branch=master)](https://coveralls.io/r/nats-io/go-nats-streaming?branch=master) + +NATS Streaming provides the following high-level feature set: +- Log based persistence +- At-Least-Once Delivery model, giving reliable message delivery +- Rate matched on a per subscription basis +- Replay/Restart +- Last Value Semantics + +## Notes + +- Please raise questions/issues via the [Issue Tracker](https://github.com/nats-io/go-nats-streaming/issues). + +## Known Issues +- Time- and sequence-based subscriptions are exact. Requesting a time or seqno before the earliest stored message for a subject will result in an error (in SubscriptionRequest.Error) + +## Installation + +```bash +# Go client +go get github.com/nats-io/go-nats-streaming +``` + +## Basic Usage + +```go + +sc, _ := stan.Connect(clusterID, clientID) + +// Simple Synchronous Publisher +sc.Publish("foo", []byte("Hello World")) // does not return until an ack has been received from NATS Streaming + +// Simple Async Subscriber +sub, _ := sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}) + +// Unsubscribe +sub.Unsubscribe() + +// Close connection +sc.Close() +``` + +### Subscription Start (i.e. Replay) Options + +NATS Streaming subscriptions are similar to NATS subscriptions, but clients may start their subscription at an earlier point in the message stream, allowing them to receive messages that were published before this client registered interest. + +The options are described with examples below: + +```go + +// Subscribe starting with most recently published value +sub, err := sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}, StartWithLastReceived()) + +// Receive all stored values in order +sub, err := sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}, DeliverAllAvailable()) + +// Receive messages starting at a specific sequence number +sub, err := sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}, StartAtSequence(22)) + +// Subscribe starting at a specific time +var startTime time.Time +... +sub, err := sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}, StartAtTime(startTime)) + +// Subscribe starting a specific amount of time in the past (e.g. 30 seconds ago) +sub, err := sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}, StartAtTimeDelta(time.ParseDuration("30s"))) +``` + +### Durable Subscriptions + +Replay of messages offers great flexibility for clients wishing to begin processing at some earlier point in the data stream. +However, some clients just need to pick up where they left off from an earlier session, without having to manually track their position in the stream of messages. +Durable subscriptions allow clients to assign a durable name to a subscription when it is created. +Doing this causes the NATS Streaming server to track the last acknowledged message for that clientID + durable name, so that only messages since the last acknowledged message will be delivered to the client. + +```go +sc, _ := stan.Connect("test-cluster", "client-123") + +// Subscribe with durable name +sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}, stan.DurableName("my-durable")) +... +// client receives message sequence 1-40 +... +// client disconnects for an hour +... +// client reconnects with same clientID "client-123" +sc, _ := stan.Connect("test-cluster", "client-123") + +// client re-subscribes to "foo" with same durable name "my-durable" +sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}, stan.DurableName("my-durable")) +... +// client receives messages 41-current +``` + +### Queue Groups + +All subscriptions with the same queue name (regardless of the connection +they originate from) will form a queue group. +Each message will be delivered to only one subscriber per queue group, +using queuing semantics. You can have as many queue groups as you wish. + +Normal subscribers will continue to work as expected. + +#### Creating a Queue Group + +A queue group is automatically created when the first queue subscriber is +created. If the group already exists, the member is added to the group. + +```go +sc, _ := stan.Connect("test-cluster", "clientid") + +// Create a queue subscriber on "foo" for group "bar" +qsub1, _ := sc.QueueSubscribe("foo", "bar", qcb) + +// Add a second member +qsub2, _ := sc.QueueSubscribe("foo", "bar", qcb) + +// Notice that you can have a regular subscriber on that subject +sub, _ := sc.Subscribe("foo", cb) + +// A message on "foo" will be received by sub and qsub1 or qsub2. +``` + +#### Start Position + +Note that once a queue group is formed, a member's start position is ignored +when added to the group. It will start receive messages from the last +position in the group. + +Suppose the channel `foo` exists and there are `500` messages stored, the group +`bar` is already created, there are two members and the last +message sequence sent is `100`. A new member is added. Note its start position: + +```go +sc.QueueSubscribe("foo", "bar", qcb, stan.StartAtSequence(200)) +``` + +This will not produce an error, but the start position will be ignored. Assuming +this member would be the one receiving the next message, it would receive message +sequence `101`. + +#### Leaving the Group + +There are two ways of leaving the group: closing the subscriber's connection or +calling `Unsubscribe`: + +```go +// Have qsub leave the queue group +qsub.Unsubscribe() +``` + +If the leaving member had un-acknowledged messages, those messages are reassigned +to the remaining members. + +#### Closing a Queue Group + +There is no special API for that. Once all members have left (either calling `Unsubscribe`, +or their connections are closed), the group is removed from the server. + +The next call to `QueueSubscribe` with the same group name will create a brand new group, +that is, the start position will take effect and delivery will start from there. + +### Durable Queue Groups + +As described above, for non durable queue subsribers, when the last member leaves the group, +that group is removed. A durable queue group allows you to have all members leave but still +maintain state. When a member re-joins, it starts at the last position in that group. + +#### Creating a Durable Queue Group + +A durable queue group is created in a similar manner as that of a standard queue group, +except the `DurableName` option must be used to specify durability. + +```go +sc.QueueSubscribe("foo", "bar", qcb, stan.DurableName("dur")) +``` +A group called `dur:bar` (the concatenation of durable name and group name) is created in +the server. This means two things: + +- The character `:` is not allowed for a queue subscriber's durable name. +- Durable and non-durable queue groups with the same name can coexist. + +```go +// Non durable queue subscriber on group "bar" +qsub, _ := sc.QueueSubscribe("foo", "bar", qcb) + +// Durable queue subscriber on group "bar" +durQsub, _ := sc.QueueSubscribe("foo", "bar", qcb, stan.DurableName("mydurablegroup")) + +// The same message produced on "foo" would be received by both queue subscribers. +``` + +#### Start Position + +The rules for non-durable queue subscribers apply to durable subscribers. + +#### Leaving the Group + +As for non-durable queue subscribers, if a member's connection is closed, or if +`Unsubscribe` its called, the member leaves the group. Any unacknowledged message +is transfered to remaining members. See *Closing the Group* for important difference +with non-durable queue subscribers. + +#### Closing the Group + +The *last* member calling `Unsubscribe` will close (that is destroy) the +group. So if you want to maintain durability of the group, you should not be +calling `Unsubscribe`. + +So unlike for non-durable queue subscribers, it is possible to maintain a queue group +with no member in the server. When a new member re-joins the durable queue group, +it will resume from where the group left of, actually first receiving all unacknowledged +messages that may have been left when the last member previously left. + + +### Wildcard Subscriptions + +NATS Streaming subscriptions **do not** support wildcards. + + +## Advanced Usage + +### Asynchronous Publishing + +The basic publish API (`Publish(subject, payload)`) is synchronous; it does not return control to the caller until the NATS Streaming server has acknowledged receipt of the message. To accomplish this, a [NUID](https://github.com/nats-io/nuid) is generated for the message on creation, and the client library waits for a publish acknowledgement from the server with a matching NUID before it returns control to the caller, possibly with an error indicating that the operation was not successful due to some server problem or authorization error. + +Advanced users may wish to process these publish acknowledgements manually to achieve higher publish throughput by not waiting on individual acknowledgements during the publish operation. An asynchronous publish API is provided for this purpose: + +```go + ackHandler := func(ackedNuid string, err error) { + if err != nil { + log.Printf("Warning: error publishing msg id %s: %v\n", ackedNuid, err.Error()) + } else { + log.Printf("Received ack for msg id %s\n", ackedNuid) + } + } + + // can also use PublishAsyncWithReply(subj, replysubj, payload, ah) + nuid, err := sc.PublishAsync("foo", []byte("Hello World"), ackHandler) // returns immediately + if err != nil { + log.Printf("Error publishing msg %s: %v\n", nuid, err.Error()) + } +``` + +### Message Acknowledgements and Redelivery + +NATS Streaming offers At-Least-Once delivery semantics, meaning that once a message has been delivered to an eligible subscriber, if an acknowledgement is not received within the configured timeout interval, NATS Streaming will attempt redelivery of the message. +This timeout interval is specified by the subscription option `AckWait`, which defaults to 30 seconds. + +By default, messages are automatically acknowledged by the NATS Streaming client library after the subscriber's message handler is invoked. However, there may be cases in which the subscribing client wishes to accelerate or defer acknowledgement of the message. +To do this, the client must set manual acknowledgement mode on the subscription, and invoke `Ack()` on the `Msg`. ex: + +```go +// Subscribe with manual ack mode, and set AckWait to 60 seconds +aw, _ := time.ParseDuration("60s") +sub, err := sc.Subscribe("foo", func(m *stan.Msg) { + m.Ack() // ack message before performing I/O intensive operation + ///... + fmt.Printf("Received a message: %s\n", string(m.Data)) +}, stan.SetManualAckMode(), stan.AckWait(aw)) +``` + +## Rate limiting/matching + +A classic problem of publish-subscribe messaging is matching the rate of message producers with the rate of message consumers. +Message producers can often outpace the speed of the subscribers that are consuming their messages. +This mismatch is commonly called a "fast producer/slow consumer" problem, and may result in dramatic resource utilization spikes in the underlying messaging system as it tries to buffer messages until the slow consumer(s) can catch up. + +### Publisher rate limiting + +NATS Streaming provides a connection option called `MaxPubAcksInflight` that effectively limits the number of unacknowledged messages that a publisher may have in-flight at any given time. When this maximum is reached, further `PublishAsync()` calls will block until the number of unacknowledged messages falls below the specified limit. ex: + +```go +sc, _ := stan.Connect(clusterID, clientID, MaxPubAcksInflight(25)) + +ah := func(nuid string, err error) { + // process the ack + ... +} + +for i := 1; i < 1000; i++ { + // If the server is unable to keep up with the publisher, the number of oustanding acks will eventually + // reach the max and this call will block + guid, _ := sc.PublishAsync("foo", []byte("Hello World"), ah) +} +``` + +### Subscriber rate limiting + +Rate limiting may also be accomplished on the subscriber side, on a per-subscription basis, using a subscription option called `MaxInflight`. +This option specifies the maximum number of outstanding acknowledgements (messages that have been delivered but not acknowledged) that NATS Streaming will allow for a given subscription. +When this limit is reached, NATS Streaming will suspend delivery of messages to this subscription until the number of unacknowledged messages falls below the specified limit. ex: + +```go +// Subscribe with manual ack mode and a max in-flight limit of 25 +sc.Subscribe("foo", func(m *stan.Msg) { + fmt.Printf("Received message #: %s\n", string(m.Data)) + ... + // Does not ack, or takes a very long time to ack + ... + // Message delivery will suspend when the number of unacknowledged messages reaches 25 +}, stan.SetManualAckMode(), stan.MaxInflight(25)) + +``` + +## License + +(The MIT License) + +Copyright (c) 2012-2016 Apcera Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to +deal in the Software without restriction, including without limitation the +rights to use, copy, modify, merge, publish, distribute, sublicense, and/or +sell copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS +IN THE SOFTWARE. diff --git a/vendor/github.com/nats-io/go-nats-streaming/TODO.md b/vendor/github.com/nats-io/go-nats-streaming/TODO.md new file mode 100644 index 000000000..581d347bf --- /dev/null +++ b/vendor/github.com/nats-io/go-nats-streaming/TODO.md @@ -0,0 +1,15 @@ + +- [ ] Retry limits? +- [ ] Server Store Limits (time, msgs, byte) +- [X] Change time to deltas +- [X] Server heartbeat, release dead clients. +- [X] Require clientID for published messages, error if not registered. +- [X] Check for need of ackMap (out of order re-delivery to queue subscribers). +- [X] Redelivered Flag for Msg. +- [X] Queue Subscribers +- [X] Durable Subscribers (survive reconnect, etc) +- [X] Start Positions on Subscribers +- [X] Ack for delivered just Reply? No need on ConnectedResponse? +- [X] PublishWithReply, or option. +- [X] Data Races in Server. +- [X] Manual Ack? diff --git a/vendor/github.com/nats-io/go-nats-streaming/pb/protocol.pb.go b/vendor/github.com/nats-io/go-nats-streaming/pb/protocol.pb.go new file mode 100644 index 000000000..e0a3da527 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats-streaming/pb/protocol.pb.go @@ -0,0 +1,2794 @@ +// Code generated by protoc-gen-gogo. +// source: protocol.proto +// DO NOT EDIT! + +/* + Package pb is a generated protocol buffer package. + + It is generated from these files: + protocol.proto + + It has these top-level messages: + PubMsg + PubAck + MsgProto + Ack + ConnectRequest + ConnectResponse + SubscriptionRequest + SubscriptionResponse + UnsubscribeRequest + CloseRequest + CloseResponse +*/ +package pb + +import proto "github.com/gogo/protobuf/proto" +import fmt "fmt" +import math "math" +import _ "github.com/gogo/protobuf/gogoproto" + +import io "io" + +// Reference imports to suppress errors if they are not otherwise used. +var _ = proto.Marshal +var _ = fmt.Errorf +var _ = math.Inf + +// Enum for start position type. +type StartPosition int32 + +const ( + StartPosition_NewOnly StartPosition = 0 + StartPosition_LastReceived StartPosition = 1 + StartPosition_TimeDeltaStart StartPosition = 2 + StartPosition_SequenceStart StartPosition = 3 + StartPosition_First StartPosition = 4 +) + +var StartPosition_name = map[int32]string{ + 0: "NewOnly", + 1: "LastReceived", + 2: "TimeDeltaStart", + 3: "SequenceStart", + 4: "First", +} +var StartPosition_value = map[string]int32{ + "NewOnly": 0, + "LastReceived": 1, + "TimeDeltaStart": 2, + "SequenceStart": 3, + "First": 4, +} + +func (x StartPosition) String() string { + return proto.EnumName(StartPosition_name, int32(x)) +} + +// How messages are delivered to the STAN cluster +type PubMsg struct { + ClientID string `protobuf:"bytes,1,opt,name=clientID,proto3" json:"clientID,omitempty"` + Guid string `protobuf:"bytes,2,opt,name=guid,proto3" json:"guid,omitempty"` + Subject string `protobuf:"bytes,3,opt,name=subject,proto3" json:"subject,omitempty"` + Reply string `protobuf:"bytes,4,opt,name=reply,proto3" json:"reply,omitempty"` + Data []byte `protobuf:"bytes,5,opt,name=data,proto3" json:"data,omitempty"` + Sha256 []byte `protobuf:"bytes,10,opt,name=sha256,proto3" json:"sha256,omitempty"` +} + +func (m *PubMsg) Reset() { *m = PubMsg{} } +func (m *PubMsg) String() string { return proto.CompactTextString(m) } +func (*PubMsg) ProtoMessage() {} + +// Used to ACK to publishers +type PubAck struct { + Guid string `protobuf:"bytes,1,opt,name=guid,proto3" json:"guid,omitempty"` + Error string `protobuf:"bytes,2,opt,name=error,proto3" json:"error,omitempty"` +} + +func (m *PubAck) Reset() { *m = PubAck{} } +func (m *PubAck) String() string { return proto.CompactTextString(m) } +func (*PubAck) ProtoMessage() {} + +// Msg struct. Sequence is assigned for global ordering by +// the cluster after the publisher has been acknowledged. +type MsgProto struct { + Sequence uint64 `protobuf:"varint,1,opt,name=sequence,proto3" json:"sequence,omitempty"` + Subject string `protobuf:"bytes,2,opt,name=subject,proto3" json:"subject,omitempty"` + Reply string `protobuf:"bytes,3,opt,name=reply,proto3" json:"reply,omitempty"` + Data []byte `protobuf:"bytes,4,opt,name=data,proto3" json:"data,omitempty"` + Timestamp int64 `protobuf:"varint,5,opt,name=timestamp,proto3" json:"timestamp,omitempty"` + Redelivered bool `protobuf:"varint,6,opt,name=redelivered,proto3" json:"redelivered,omitempty"` + CRC32 uint32 `protobuf:"varint,10,opt,name=CRC32,proto3" json:"CRC32,omitempty"` +} + +func (m *MsgProto) Reset() { *m = MsgProto{} } +func (m *MsgProto) String() string { return proto.CompactTextString(m) } +func (*MsgProto) ProtoMessage() {} + +// Ack will deliver an ack for a delivered msg. +type Ack struct { + Subject string `protobuf:"bytes,1,opt,name=subject,proto3" json:"subject,omitempty"` + Sequence uint64 `protobuf:"varint,2,opt,name=sequence,proto3" json:"sequence,omitempty"` +} + +func (m *Ack) Reset() { *m = Ack{} } +func (m *Ack) String() string { return proto.CompactTextString(m) } +func (*Ack) ProtoMessage() {} + +// Connection Request +type ConnectRequest struct { + ClientID string `protobuf:"bytes,1,opt,name=clientID,proto3" json:"clientID,omitempty"` + HeartbeatInbox string `protobuf:"bytes,2,opt,name=heartbeatInbox,proto3" json:"heartbeatInbox,omitempty"` +} + +func (m *ConnectRequest) Reset() { *m = ConnectRequest{} } +func (m *ConnectRequest) String() string { return proto.CompactTextString(m) } +func (*ConnectRequest) ProtoMessage() {} + +// Response to a client connect +type ConnectResponse struct { + PubPrefix string `protobuf:"bytes,1,opt,name=pubPrefix,proto3" json:"pubPrefix,omitempty"` + SubRequests string `protobuf:"bytes,2,opt,name=subRequests,proto3" json:"subRequests,omitempty"` + UnsubRequests string `protobuf:"bytes,3,opt,name=unsubRequests,proto3" json:"unsubRequests,omitempty"` + CloseRequests string `protobuf:"bytes,4,opt,name=closeRequests,proto3" json:"closeRequests,omitempty"` + Error string `protobuf:"bytes,5,opt,name=error,proto3" json:"error,omitempty"` + SubCloseRequests string `protobuf:"bytes,6,opt,name=subCloseRequests,proto3" json:"subCloseRequests,omitempty"` + PublicKey string `protobuf:"bytes,100,opt,name=publicKey,proto3" json:"publicKey,omitempty"` +} + +func (m *ConnectResponse) Reset() { *m = ConnectResponse{} } +func (m *ConnectResponse) String() string { return proto.CompactTextString(m) } +func (*ConnectResponse) ProtoMessage() {} + +// Protocol for a client to subscribe +type SubscriptionRequest struct { + ClientID string `protobuf:"bytes,1,opt,name=clientID,proto3" json:"clientID,omitempty"` + Subject string `protobuf:"bytes,2,opt,name=subject,proto3" json:"subject,omitempty"` + QGroup string `protobuf:"bytes,3,opt,name=qGroup,proto3" json:"qGroup,omitempty"` + Inbox string `protobuf:"bytes,4,opt,name=inbox,proto3" json:"inbox,omitempty"` + MaxInFlight int32 `protobuf:"varint,5,opt,name=maxInFlight,proto3" json:"maxInFlight,omitempty"` + AckWaitInSecs int32 `protobuf:"varint,6,opt,name=ackWaitInSecs,proto3" json:"ackWaitInSecs,omitempty"` + DurableName string `protobuf:"bytes,7,opt,name=durableName,proto3" json:"durableName,omitempty"` + StartPosition StartPosition `protobuf:"varint,10,opt,name=startPosition,proto3,enum=pb.StartPosition" json:"startPosition,omitempty"` + StartSequence uint64 `protobuf:"varint,11,opt,name=startSequence,proto3" json:"startSequence,omitempty"` + StartTimeDelta int64 `protobuf:"varint,12,opt,name=startTimeDelta,proto3" json:"startTimeDelta,omitempty"` +} + +func (m *SubscriptionRequest) Reset() { *m = SubscriptionRequest{} } +func (m *SubscriptionRequest) String() string { return proto.CompactTextString(m) } +func (*SubscriptionRequest) ProtoMessage() {} + +// Response for SubscriptionRequest and UnsubscribeRequests +type SubscriptionResponse struct { + AckInbox string `protobuf:"bytes,2,opt,name=ackInbox,proto3" json:"ackInbox,omitempty"` + Error string `protobuf:"bytes,3,opt,name=error,proto3" json:"error,omitempty"` +} + +func (m *SubscriptionResponse) Reset() { *m = SubscriptionResponse{} } +func (m *SubscriptionResponse) String() string { return proto.CompactTextString(m) } +func (*SubscriptionResponse) ProtoMessage() {} + +// Protocol for a clients to unsubscribe. Will return a SubscriptionResponse +type UnsubscribeRequest struct { + ClientID string `protobuf:"bytes,1,opt,name=clientID,proto3" json:"clientID,omitempty"` + Subject string `protobuf:"bytes,2,opt,name=subject,proto3" json:"subject,omitempty"` + Inbox string `protobuf:"bytes,3,opt,name=inbox,proto3" json:"inbox,omitempty"` + DurableName string `protobuf:"bytes,4,opt,name=durableName,proto3" json:"durableName,omitempty"` +} + +func (m *UnsubscribeRequest) Reset() { *m = UnsubscribeRequest{} } +func (m *UnsubscribeRequest) String() string { return proto.CompactTextString(m) } +func (*UnsubscribeRequest) ProtoMessage() {} + +// Protocol for a client to close a connection +type CloseRequest struct { + ClientID string `protobuf:"bytes,1,opt,name=clientID,proto3" json:"clientID,omitempty"` +} + +func (m *CloseRequest) Reset() { *m = CloseRequest{} } +func (m *CloseRequest) String() string { return proto.CompactTextString(m) } +func (*CloseRequest) ProtoMessage() {} + +// Response for CloseRequest +type CloseResponse struct { + Error string `protobuf:"bytes,1,opt,name=error,proto3" json:"error,omitempty"` +} + +func (m *CloseResponse) Reset() { *m = CloseResponse{} } +func (m *CloseResponse) String() string { return proto.CompactTextString(m) } +func (*CloseResponse) ProtoMessage() {} + +func init() { + proto.RegisterType((*PubMsg)(nil), "pb.PubMsg") + proto.RegisterType((*PubAck)(nil), "pb.PubAck") + proto.RegisterType((*MsgProto)(nil), "pb.MsgProto") + proto.RegisterType((*Ack)(nil), "pb.Ack") + proto.RegisterType((*ConnectRequest)(nil), "pb.ConnectRequest") + proto.RegisterType((*ConnectResponse)(nil), "pb.ConnectResponse") + proto.RegisterType((*SubscriptionRequest)(nil), "pb.SubscriptionRequest") + proto.RegisterType((*SubscriptionResponse)(nil), "pb.SubscriptionResponse") + proto.RegisterType((*UnsubscribeRequest)(nil), "pb.UnsubscribeRequest") + proto.RegisterType((*CloseRequest)(nil), "pb.CloseRequest") + proto.RegisterType((*CloseResponse)(nil), "pb.CloseResponse") + proto.RegisterEnum("pb.StartPosition", StartPosition_name, StartPosition_value) +} +func (m *PubMsg) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *PubMsg) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ClientID) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.ClientID))) + i += copy(data[i:], m.ClientID) + } + if len(m.Guid) > 0 { + data[i] = 0x12 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Guid))) + i += copy(data[i:], m.Guid) + } + if len(m.Subject) > 0 { + data[i] = 0x1a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Subject))) + i += copy(data[i:], m.Subject) + } + if len(m.Reply) > 0 { + data[i] = 0x22 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Reply))) + i += copy(data[i:], m.Reply) + } + if m.Data != nil { + if len(m.Data) > 0 { + data[i] = 0x2a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Data))) + i += copy(data[i:], m.Data) + } + } + if m.Sha256 != nil { + if len(m.Sha256) > 0 { + data[i] = 0x52 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Sha256))) + i += copy(data[i:], m.Sha256) + } + } + return i, nil +} + +func (m *PubAck) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *PubAck) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Guid) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Guid))) + i += copy(data[i:], m.Guid) + } + if len(m.Error) > 0 { + data[i] = 0x12 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Error))) + i += copy(data[i:], m.Error) + } + return i, nil +} + +func (m *MsgProto) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *MsgProto) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if m.Sequence != 0 { + data[i] = 0x8 + i++ + i = encodeVarintProtocol(data, i, uint64(m.Sequence)) + } + if len(m.Subject) > 0 { + data[i] = 0x12 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Subject))) + i += copy(data[i:], m.Subject) + } + if len(m.Reply) > 0 { + data[i] = 0x1a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Reply))) + i += copy(data[i:], m.Reply) + } + if m.Data != nil { + if len(m.Data) > 0 { + data[i] = 0x22 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Data))) + i += copy(data[i:], m.Data) + } + } + if m.Timestamp != 0 { + data[i] = 0x28 + i++ + i = encodeVarintProtocol(data, i, uint64(m.Timestamp)) + } + if m.Redelivered { + data[i] = 0x30 + i++ + if m.Redelivered { + data[i] = 1 + } else { + data[i] = 0 + } + i++ + } + if m.CRC32 != 0 { + data[i] = 0x50 + i++ + i = encodeVarintProtocol(data, i, uint64(m.CRC32)) + } + return i, nil +} + +func (m *Ack) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *Ack) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Subject) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Subject))) + i += copy(data[i:], m.Subject) + } + if m.Sequence != 0 { + data[i] = 0x10 + i++ + i = encodeVarintProtocol(data, i, uint64(m.Sequence)) + } + return i, nil +} + +func (m *ConnectRequest) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *ConnectRequest) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ClientID) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.ClientID))) + i += copy(data[i:], m.ClientID) + } + if len(m.HeartbeatInbox) > 0 { + data[i] = 0x12 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.HeartbeatInbox))) + i += copy(data[i:], m.HeartbeatInbox) + } + return i, nil +} + +func (m *ConnectResponse) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *ConnectResponse) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.PubPrefix) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.PubPrefix))) + i += copy(data[i:], m.PubPrefix) + } + if len(m.SubRequests) > 0 { + data[i] = 0x12 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.SubRequests))) + i += copy(data[i:], m.SubRequests) + } + if len(m.UnsubRequests) > 0 { + data[i] = 0x1a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.UnsubRequests))) + i += copy(data[i:], m.UnsubRequests) + } + if len(m.CloseRequests) > 0 { + data[i] = 0x22 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.CloseRequests))) + i += copy(data[i:], m.CloseRequests) + } + if len(m.Error) > 0 { + data[i] = 0x2a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Error))) + i += copy(data[i:], m.Error) + } + if len(m.SubCloseRequests) > 0 { + data[i] = 0x32 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.SubCloseRequests))) + i += copy(data[i:], m.SubCloseRequests) + } + if len(m.PublicKey) > 0 { + data[i] = 0xa2 + i++ + data[i] = 0x6 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.PublicKey))) + i += copy(data[i:], m.PublicKey) + } + return i, nil +} + +func (m *SubscriptionRequest) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *SubscriptionRequest) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ClientID) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.ClientID))) + i += copy(data[i:], m.ClientID) + } + if len(m.Subject) > 0 { + data[i] = 0x12 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Subject))) + i += copy(data[i:], m.Subject) + } + if len(m.QGroup) > 0 { + data[i] = 0x1a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.QGroup))) + i += copy(data[i:], m.QGroup) + } + if len(m.Inbox) > 0 { + data[i] = 0x22 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Inbox))) + i += copy(data[i:], m.Inbox) + } + if m.MaxInFlight != 0 { + data[i] = 0x28 + i++ + i = encodeVarintProtocol(data, i, uint64(m.MaxInFlight)) + } + if m.AckWaitInSecs != 0 { + data[i] = 0x30 + i++ + i = encodeVarintProtocol(data, i, uint64(m.AckWaitInSecs)) + } + if len(m.DurableName) > 0 { + data[i] = 0x3a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.DurableName))) + i += copy(data[i:], m.DurableName) + } + if m.StartPosition != 0 { + data[i] = 0x50 + i++ + i = encodeVarintProtocol(data, i, uint64(m.StartPosition)) + } + if m.StartSequence != 0 { + data[i] = 0x58 + i++ + i = encodeVarintProtocol(data, i, uint64(m.StartSequence)) + } + if m.StartTimeDelta != 0 { + data[i] = 0x60 + i++ + i = encodeVarintProtocol(data, i, uint64(m.StartTimeDelta)) + } + return i, nil +} + +func (m *SubscriptionResponse) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *SubscriptionResponse) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.AckInbox) > 0 { + data[i] = 0x12 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.AckInbox))) + i += copy(data[i:], m.AckInbox) + } + if len(m.Error) > 0 { + data[i] = 0x1a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Error))) + i += copy(data[i:], m.Error) + } + return i, nil +} + +func (m *UnsubscribeRequest) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *UnsubscribeRequest) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ClientID) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.ClientID))) + i += copy(data[i:], m.ClientID) + } + if len(m.Subject) > 0 { + data[i] = 0x12 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Subject))) + i += copy(data[i:], m.Subject) + } + if len(m.Inbox) > 0 { + data[i] = 0x1a + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Inbox))) + i += copy(data[i:], m.Inbox) + } + if len(m.DurableName) > 0 { + data[i] = 0x22 + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.DurableName))) + i += copy(data[i:], m.DurableName) + } + return i, nil +} + +func (m *CloseRequest) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *CloseRequest) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.ClientID) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.ClientID))) + i += copy(data[i:], m.ClientID) + } + return i, nil +} + +func (m *CloseResponse) Marshal() (data []byte, err error) { + size := m.Size() + data = make([]byte, size) + n, err := m.MarshalTo(data) + if err != nil { + return nil, err + } + return data[:n], nil +} + +func (m *CloseResponse) MarshalTo(data []byte) (int, error) { + var i int + _ = i + var l int + _ = l + if len(m.Error) > 0 { + data[i] = 0xa + i++ + i = encodeVarintProtocol(data, i, uint64(len(m.Error))) + i += copy(data[i:], m.Error) + } + return i, nil +} + +func encodeFixed64Protocol(data []byte, offset int, v uint64) int { + data[offset] = uint8(v) + data[offset+1] = uint8(v >> 8) + data[offset+2] = uint8(v >> 16) + data[offset+3] = uint8(v >> 24) + data[offset+4] = uint8(v >> 32) + data[offset+5] = uint8(v >> 40) + data[offset+6] = uint8(v >> 48) + data[offset+7] = uint8(v >> 56) + return offset + 8 +} +func encodeFixed32Protocol(data []byte, offset int, v uint32) int { + data[offset] = uint8(v) + data[offset+1] = uint8(v >> 8) + data[offset+2] = uint8(v >> 16) + data[offset+3] = uint8(v >> 24) + return offset + 4 +} +func encodeVarintProtocol(data []byte, offset int, v uint64) int { + for v >= 1<<7 { + data[offset] = uint8(v&0x7f | 0x80) + v >>= 7 + offset++ + } + data[offset] = uint8(v) + return offset + 1 +} +func (m *PubMsg) Size() (n int) { + var l int + _ = l + l = len(m.ClientID) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Guid) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Subject) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Reply) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + if m.Data != nil { + l = len(m.Data) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + } + if m.Sha256 != nil { + l = len(m.Sha256) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + } + return n +} + +func (m *PubAck) Size() (n int) { + var l int + _ = l + l = len(m.Guid) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Error) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + return n +} + +func (m *MsgProto) Size() (n int) { + var l int + _ = l + if m.Sequence != 0 { + n += 1 + sovProtocol(uint64(m.Sequence)) + } + l = len(m.Subject) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Reply) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + if m.Data != nil { + l = len(m.Data) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + } + if m.Timestamp != 0 { + n += 1 + sovProtocol(uint64(m.Timestamp)) + } + if m.Redelivered { + n += 2 + } + if m.CRC32 != 0 { + n += 1 + sovProtocol(uint64(m.CRC32)) + } + return n +} + +func (m *Ack) Size() (n int) { + var l int + _ = l + l = len(m.Subject) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + if m.Sequence != 0 { + n += 1 + sovProtocol(uint64(m.Sequence)) + } + return n +} + +func (m *ConnectRequest) Size() (n int) { + var l int + _ = l + l = len(m.ClientID) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.HeartbeatInbox) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + return n +} + +func (m *ConnectResponse) Size() (n int) { + var l int + _ = l + l = len(m.PubPrefix) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.SubRequests) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.UnsubRequests) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.CloseRequests) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Error) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.SubCloseRequests) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.PublicKey) + if l > 0 { + n += 2 + l + sovProtocol(uint64(l)) + } + return n +} + +func (m *SubscriptionRequest) Size() (n int) { + var l int + _ = l + l = len(m.ClientID) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Subject) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.QGroup) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Inbox) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + if m.MaxInFlight != 0 { + n += 1 + sovProtocol(uint64(m.MaxInFlight)) + } + if m.AckWaitInSecs != 0 { + n += 1 + sovProtocol(uint64(m.AckWaitInSecs)) + } + l = len(m.DurableName) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + if m.StartPosition != 0 { + n += 1 + sovProtocol(uint64(m.StartPosition)) + } + if m.StartSequence != 0 { + n += 1 + sovProtocol(uint64(m.StartSequence)) + } + if m.StartTimeDelta != 0 { + n += 1 + sovProtocol(uint64(m.StartTimeDelta)) + } + return n +} + +func (m *SubscriptionResponse) Size() (n int) { + var l int + _ = l + l = len(m.AckInbox) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Error) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + return n +} + +func (m *UnsubscribeRequest) Size() (n int) { + var l int + _ = l + l = len(m.ClientID) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Subject) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.Inbox) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + l = len(m.DurableName) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + return n +} + +func (m *CloseRequest) Size() (n int) { + var l int + _ = l + l = len(m.ClientID) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + return n +} + +func (m *CloseResponse) Size() (n int) { + var l int + _ = l + l = len(m.Error) + if l > 0 { + n += 1 + l + sovProtocol(uint64(l)) + } + return n +} + +func sovProtocol(x uint64) (n int) { + for { + n++ + x >>= 7 + if x == 0 { + break + } + } + return n +} +func sozProtocol(x uint64) (n int) { + return sovProtocol(uint64((x << 1) ^ uint64((int64(x) >> 63)))) +} +func (m *PubMsg) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PubMsg: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PubMsg: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ClientID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ClientID = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Guid", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Guid = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Subject", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Subject = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Reply", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Reply = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Data", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + byteLen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + byteLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Data = append(m.Data[:0], data[iNdEx:postIndex]...) + if m.Data == nil { + m.Data = []byte{} + } + iNdEx = postIndex + case 10: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Sha256", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + byteLen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + byteLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Sha256 = append(m.Sha256[:0], data[iNdEx:postIndex]...) + if m.Sha256 == nil { + m.Sha256 = []byte{} + } + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *PubAck) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: PubAck: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: PubAck: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Guid", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Guid = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Error", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Error = string(data[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *MsgProto) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: MsgProto: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: MsgProto: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Sequence", wireType) + } + m.Sequence = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.Sequence |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Subject", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Subject = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Reply", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Reply = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Data", wireType) + } + var byteLen int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + byteLen |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + if byteLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + byteLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Data = append(m.Data[:0], data[iNdEx:postIndex]...) + if m.Data == nil { + m.Data = []byte{} + } + iNdEx = postIndex + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Timestamp", wireType) + } + m.Timestamp = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.Timestamp |= (int64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Redelivered", wireType) + } + var v int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + v |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + m.Redelivered = bool(v != 0) + case 10: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field CRC32", wireType) + } + m.CRC32 = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.CRC32 |= (uint32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *Ack) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: Ack: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: Ack: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Subject", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Subject = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field Sequence", wireType) + } + m.Sequence = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.Sequence |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ConnectRequest) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ConnectRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ConnectRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ClientID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ClientID = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field HeartbeatInbox", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.HeartbeatInbox = string(data[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *ConnectResponse) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: ConnectResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: ConnectResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field PubPrefix", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.PubPrefix = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SubRequests", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SubRequests = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field UnsubRequests", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.UnsubRequests = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field CloseRequests", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.CloseRequests = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 5: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Error", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Error = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 6: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field SubCloseRequests", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.SubCloseRequests = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 100: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field PublicKey", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.PublicKey = string(data[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *SubscriptionRequest) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: SubscriptionRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: SubscriptionRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ClientID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ClientID = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Subject", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Subject = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field QGroup", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.QGroup = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Inbox", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Inbox = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 5: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field MaxInFlight", wireType) + } + m.MaxInFlight = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.MaxInFlight |= (int32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 6: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field AckWaitInSecs", wireType) + } + m.AckWaitInSecs = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.AckWaitInSecs |= (int32(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 7: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field DurableName", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.DurableName = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 10: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field StartPosition", wireType) + } + m.StartPosition = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.StartPosition |= (StartPosition(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 11: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field StartSequence", wireType) + } + m.StartSequence = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.StartSequence |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + case 12: + if wireType != 0 { + return fmt.Errorf("proto: wrong wireType = %d for field StartTimeDelta", wireType) + } + m.StartTimeDelta = 0 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + m.StartTimeDelta |= (int64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *SubscriptionResponse) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: SubscriptionResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: SubscriptionResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field AckInbox", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.AckInbox = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Error", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Error = string(data[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *UnsubscribeRequest) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: UnsubscribeRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: UnsubscribeRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ClientID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ClientID = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 2: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Subject", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Subject = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 3: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Inbox", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Inbox = string(data[iNdEx:postIndex]) + iNdEx = postIndex + case 4: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field DurableName", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.DurableName = string(data[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CloseRequest) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CloseRequest: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CloseRequest: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field ClientID", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.ClientID = string(data[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func (m *CloseResponse) Unmarshal(data []byte) error { + l := len(data) + iNdEx := 0 + for iNdEx < l { + preIndex := iNdEx + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + fieldNum := int32(wire >> 3) + wireType := int(wire & 0x7) + if wireType == 4 { + return fmt.Errorf("proto: CloseResponse: wiretype end group for non-group") + } + if fieldNum <= 0 { + return fmt.Errorf("proto: CloseResponse: illegal tag %d (wire type %d)", fieldNum, wire) + } + switch fieldNum { + case 1: + if wireType != 2 { + return fmt.Errorf("proto: wrong wireType = %d for field Error", wireType) + } + var stringLen uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return ErrIntOverflowProtocol + } + if iNdEx >= l { + return io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + stringLen |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + intStringLen := int(stringLen) + if intStringLen < 0 { + return ErrInvalidLengthProtocol + } + postIndex := iNdEx + intStringLen + if postIndex > l { + return io.ErrUnexpectedEOF + } + m.Error = string(data[iNdEx:postIndex]) + iNdEx = postIndex + default: + iNdEx = preIndex + skippy, err := skipProtocol(data[iNdEx:]) + if err != nil { + return err + } + if skippy < 0 { + return ErrInvalidLengthProtocol + } + if (iNdEx + skippy) > l { + return io.ErrUnexpectedEOF + } + iNdEx += skippy + } + } + + if iNdEx > l { + return io.ErrUnexpectedEOF + } + return nil +} +func skipProtocol(data []byte) (n int, err error) { + l := len(data) + iNdEx := 0 + for iNdEx < l { + var wire uint64 + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowProtocol + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + wire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + wireType := int(wire & 0x7) + switch wireType { + case 0: + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowProtocol + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + iNdEx++ + if data[iNdEx-1] < 0x80 { + break + } + } + return iNdEx, nil + case 1: + iNdEx += 8 + return iNdEx, nil + case 2: + var length int + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowProtocol + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + length |= (int(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + iNdEx += length + if length < 0 { + return 0, ErrInvalidLengthProtocol + } + return iNdEx, nil + case 3: + for { + var innerWire uint64 + var start int = iNdEx + for shift := uint(0); ; shift += 7 { + if shift >= 64 { + return 0, ErrIntOverflowProtocol + } + if iNdEx >= l { + return 0, io.ErrUnexpectedEOF + } + b := data[iNdEx] + iNdEx++ + innerWire |= (uint64(b) & 0x7F) << shift + if b < 0x80 { + break + } + } + innerWireType := int(innerWire & 0x7) + if innerWireType == 4 { + break + } + next, err := skipProtocol(data[start:]) + if err != nil { + return 0, err + } + iNdEx = start + next + } + return iNdEx, nil + case 4: + return iNdEx, nil + case 5: + iNdEx += 4 + return iNdEx, nil + default: + return 0, fmt.Errorf("proto: illegal wireType %d", wireType) + } + } + panic("unreachable") +} + +var ( + ErrInvalidLengthProtocol = fmt.Errorf("proto: negative length found during unmarshaling") + ErrIntOverflowProtocol = fmt.Errorf("proto: integer overflow") +) diff --git a/vendor/github.com/nats-io/go-nats-streaming/pb/protocol.proto b/vendor/github.com/nats-io/go-nats-streaming/pb/protocol.proto new file mode 100644 index 000000000..a1eea67af --- /dev/null +++ b/vendor/github.com/nats-io/go-nats-streaming/pb/protocol.proto @@ -0,0 +1,115 @@ +// Copyright 2016 Apcera Inc. All rights reserved. +// +// Uses https://github.com/gogo/protobuf +// compiled via `protoc -I=. -I=$GOPATH/src --gogofaster_out=. protocol.proto` + +syntax = "proto3"; +package pb; + +import "github.com/gogo/protobuf/gogoproto/gogo.proto"; + +option (gogoproto.marshaler_all) = true; +option (gogoproto.sizer_all) = true; +option (gogoproto.unmarshaler_all) = true; +option (gogoproto.goproto_getters_all) = false; + +// How messages are delivered to the STAN cluster +message PubMsg { + string clientID = 1; // ClientID + string guid = 2; // guid + string subject = 3; // subject + string reply = 4; // optional reply + bytes data = 5; // payload + + bytes sha256 = 10; // optional sha256 of data +} + +// Used to ACK to publishers +message PubAck { + string guid = 1; // guid + string error = 2; // err string, empty/omitted if no error +} + +// Msg struct. Sequence is assigned for global ordering by +// the cluster after the publisher has been acknowledged. +message MsgProto { + uint64 sequence = 1; // globally ordered sequence number for the subject's channel + string subject = 2; // subject + string reply = 3; // optional reply + bytes data = 4; // payload + int64 timestamp = 5; // received timestamp + bool redelivered = 6; // Flag specifying if the message is being redelivered + + uint32 CRC32 = 10; // optional IEEE CRC32 +} + +// Ack will deliver an ack for a delivered msg. +message Ack { + string subject = 1; // Subject + uint64 sequence = 2; // Sequence to acknowledge +} + +// Connection Request +message ConnectRequest { + string clientID = 1; // Client name/identifier. + string heartbeatInbox = 2; // Inbox for server initiated heartbeats. +} + +// Response to a client connect +message ConnectResponse { + string pubPrefix = 1; // Prefix to use when publishing to this STAN cluster + string subRequests = 2; // Subject to use for subscription requests + string unsubRequests = 3; // Subject to use for unsubscribe requests + string closeRequests = 4; // Subject for closing the stan connection + string error = 5; // err string, empty/omitted if no error + string subCloseRequests = 6; // Subject to use for subscription close requests + + string publicKey = 100; // Possibly used to sign acks, etc. +} + +// Enum for start position type. +enum StartPosition { + NewOnly = 0; + LastReceived = 1; + TimeDeltaStart = 2; + SequenceStart = 3; + First = 4; + } + +// Protocol for a client to subscribe +message SubscriptionRequest { + string clientID = 1; // ClientID + string subject = 2; // Formal subject to subscribe to, e.g. foo.bar + string qGroup = 3; // Optional queue group + string inbox = 4; // Inbox subject to deliver messages on + int32 maxInFlight = 5; // Maximum inflight messages without an ack allowed + int32 ackWaitInSecs = 6; // Timeout for receiving an ack from the client + string durableName = 7; // Optional durable name which survives client restarts + StartPosition startPosition = 10; // Start position + uint64 startSequence = 11; // Optional start sequence number + int64 startTimeDelta = 12; // Optional start time +} + +// Response for SubscriptionRequest and UnsubscribeRequests +message SubscriptionResponse { + string ackInbox = 2; // ackInbox for sending acks + string error = 3; // err string, empty/omitted if no error +} + +// Protocol for a clients to unsubscribe. Will return a SubscriptionResponse +message UnsubscribeRequest { + string clientID = 1; // ClientID + string subject = 2; // subject for the subscription + string inbox = 3; // Inbox subject to identify subscription + string durableName = 4; // Optional durable name which survives client restarts +} + +// Protocol for a client to close a connection +message CloseRequest { + string clientID = 1; // Client name provided to Connect() requests +} + +// Response for CloseRequest +message CloseResponse { + string error = 1; // err string, empty/omitted if no error +} diff --git a/vendor/github.com/nats-io/go-nats-streaming/stan.go b/vendor/github.com/nats-io/go-nats-streaming/stan.go new file mode 100644 index 000000000..0bfea014c --- /dev/null +++ b/vendor/github.com/nats-io/go-nats-streaming/stan.go @@ -0,0 +1,476 @@ +// Copyright 2016 Apcera Inc. All rights reserved. + +// Package stan is a Go client for the NATS Streaming messaging system (https://nats.io). +package stan + +import ( + "errors" + "fmt" + "runtime" + "sync" + "time" + + "github.com/nats-io/go-nats" + "github.com/nats-io/go-nats-streaming/pb" + "github.com/nats-io/nuid" +) + +// Version is the NATS Streaming Go Client version +const Version = "0.3.4" + +const ( + // DefaultNatsURL is the default URL the client connects to + DefaultNatsURL = "nats://localhost:4222" + // DefaultConnectWait is the default timeout used for the connect operation + DefaultConnectWait = 2 * time.Second + // DefaultDiscoverPrefix is the prefix subject used to connect to the NATS Streaming server + DefaultDiscoverPrefix = "_STAN.discover" + // DefaultACKPrefix is the prefix subject used to send ACKs to the NATS Streaming server + DefaultACKPrefix = "_STAN.acks" + // DefaultMaxPubAcksInflight is the default maximum number of published messages + // without outstanding ACKs from the server + DefaultMaxPubAcksInflight = 16384 +) + +// Conn represents a connection to the NATS Streaming subsystem. It can Publish and +// Subscribe to messages within the NATS Streaming cluster. +type Conn interface { + // Publish + Publish(subject string, data []byte) error + PublishAsync(subject string, data []byte, ah AckHandler) (string, error) + + // Subscribe + Subscribe(subject string, cb MsgHandler, opts ...SubscriptionOption) (Subscription, error) + + // QueueSubscribe + QueueSubscribe(subject, qgroup string, cb MsgHandler, opts ...SubscriptionOption) (Subscription, error) + + // Close + Close() error + + // NatsConn returns the underlying NATS conn. Use this with care. For + // example, closing the wrapped NATS conn will put the NATS Streaming Conn + // in an invalid state. + NatsConn() *nats.Conn +} + +// Errors +var ( + ErrConnectReqTimeout = errors.New("stan: connect request timeout") + ErrCloseReqTimeout = errors.New("stan: close request timeout") + ErrSubReqTimeout = errors.New("stan: subscribe request timeout") + ErrUnsubReqTimeout = errors.New("stan: unsubscribe request timeout") + ErrConnectionClosed = errors.New("stan: connection closed") + ErrTimeout = errors.New("stan: publish ack timeout") + ErrBadAck = errors.New("stan: malformed ack") + ErrBadSubscription = errors.New("stan: invalid subscription") + ErrBadConnection = errors.New("stan: invalid connection") + ErrManualAck = errors.New("stan: cannot manually ack in auto-ack mode") + ErrNilMsg = errors.New("stan: nil message") + ErrNoServerSupport = errors.New("stan: not supported by server") +) + +// AckHandler is used for Async Publishing to provide status of the ack. +// The func will be passed teh GUID and any error state. No error means the +// message was successfully received by NATS Streaming. +type AckHandler func(string, error) + +// Options can be used to a create a customized connection. +type Options struct { + NatsURL string + NatsConn *nats.Conn + ConnectTimeout time.Duration + AckTimeout time.Duration + DiscoverPrefix string + MaxPubAcksInflight int +} + +// DefaultOptions are the NATS Streaming client's default options +var DefaultOptions = Options{ + NatsURL: DefaultNatsURL, + ConnectTimeout: DefaultConnectWait, + AckTimeout: DefaultAckWait, + DiscoverPrefix: DefaultDiscoverPrefix, + MaxPubAcksInflight: DefaultMaxPubAcksInflight, +} + +// Option is a function on the options for a connection. +type Option func(*Options) error + +// NatsURL is an Option to set the URL the client should connect to. +func NatsURL(u string) Option { + return func(o *Options) error { + o.NatsURL = u + return nil + } +} + +// ConnectWait is an Option to set the timeout for establishing a connection. +func ConnectWait(t time.Duration) Option { + return func(o *Options) error { + o.ConnectTimeout = t + return nil + } +} + +// PubAckWait is an Option to set the timeout for waiting for an ACK for a +// published message. +func PubAckWait(t time.Duration) Option { + return func(o *Options) error { + o.AckTimeout = t + return nil + } +} + +// MaxPubAcksInflight is an Option to set the maximum number of published +// messages without outstanding ACKs from the server. +func MaxPubAcksInflight(max int) Option { + return func(o *Options) error { + o.MaxPubAcksInflight = max + return nil + } +} + +// NatsConn is an Option to set the underlying NATS connection to be used +// by a NATS Streaming Conn object. +func NatsConn(nc *nats.Conn) Option { + return func(o *Options) error { + o.NatsConn = nc + return nil + } +} + +// A conn represents a bare connection to a stan cluster. +type conn struct { + sync.RWMutex + clientID string + serverID string + pubPrefix string // Publish prefix set by stan, append our subject. + subRequests string // Subject to send subscription requests. + unsubRequests string // Subject to send unsubscribe requests. + subCloseRequests string // Subject to send subscription close requests. + closeRequests string // Subject to send close requests. + ackSubject string // publish acks + ackSubscription *nats.Subscription + hbSubscription *nats.Subscription + subMap map[string]*subscription + pubAckMap map[string]*ack + pubAckChan chan (struct{}) + opts Options + nc *nats.Conn + ncOwned bool // NATS Streaming created the connection, so needs to close it. +} + +// Closure for ack contexts. +type ack struct { + t *time.Timer + ah AckHandler + ch chan error +} + +// Connect will form a connection to the NATS Streaming subsystem. +func Connect(stanClusterID, clientID string, options ...Option) (Conn, error) { + // Process Options + c := conn{clientID: clientID, opts: DefaultOptions} + for _, opt := range options { + if err := opt(&c.opts); err != nil { + return nil, err + } + } + // Check if the user has provided a connection as an option + c.nc = c.opts.NatsConn + // Create a NATS connection if it doesn't exist. + if c.nc == nil { + nc, err := nats.Connect(c.opts.NatsURL, nats.Name(clientID)) + if err != nil { + return nil, err + } + c.nc = nc + c.ncOwned = true + } else if !c.nc.IsConnected() { + // Bail if the custom NATS connection is disconnected + return nil, ErrBadConnection + } + + // Create a heartbeat inbox + hbInbox := nats.NewInbox() + var err error + if c.hbSubscription, err = c.nc.Subscribe(hbInbox, c.processHeartBeat); err != nil { + c.Close() + return nil, err + } + + // Send Request to discover the cluster + discoverSubject := c.opts.DiscoverPrefix + "." + stanClusterID + req := &pb.ConnectRequest{ClientID: clientID, HeartbeatInbox: hbInbox} + b, _ := req.Marshal() + reply, err := c.nc.Request(discoverSubject, b, c.opts.ConnectTimeout) + if err != nil { + c.Close() + if err == nats.ErrTimeout { + return nil, ErrConnectReqTimeout + } + return nil, err + } + // Process the response, grab server pubPrefix + cr := &pb.ConnectResponse{} + err = cr.Unmarshal(reply.Data) + if err != nil { + c.Close() + return nil, err + } + if cr.Error != "" { + c.Close() + return nil, errors.New(cr.Error) + } + + // Capture cluster configuration endpoints to publish and subscribe/unsubscribe. + c.pubPrefix = cr.PubPrefix + c.subRequests = cr.SubRequests + c.unsubRequests = cr.UnsubRequests + c.subCloseRequests = cr.SubCloseRequests + c.closeRequests = cr.CloseRequests + + // Setup the ACK subscription + c.ackSubject = DefaultACKPrefix + "." + nuid.Next() + if c.ackSubscription, err = c.nc.Subscribe(c.ackSubject, c.processAck); err != nil { + c.Close() + return nil, err + } + c.ackSubscription.SetPendingLimits(1024*1024, 32*1024*1024) + c.pubAckMap = make(map[string]*ack) + + // Create Subscription map + c.subMap = make(map[string]*subscription) + + c.pubAckChan = make(chan struct{}, c.opts.MaxPubAcksInflight) + + // Attach a finalizer + runtime.SetFinalizer(&c, func(sc *conn) { sc.Close() }) + + return &c, nil +} + +// Close a connection to the stan system. +func (sc *conn) Close() error { + if sc == nil { + return ErrBadConnection + } + + sc.Lock() + defer sc.Unlock() + + if sc.nc == nil { + // We are already closed. + return nil + } + + // Capture for NATS calls below. + nc := sc.nc + if sc.ncOwned { + defer nc.Close() + } + + // Signals we are closed. + sc.nc = nil + + // Now close ourselves. + if sc.ackSubscription != nil { + sc.ackSubscription.Unsubscribe() + } + + req := &pb.CloseRequest{ClientID: sc.clientID} + b, _ := req.Marshal() + reply, err := nc.Request(sc.closeRequests, b, sc.opts.ConnectTimeout) + if err != nil { + if err == nats.ErrTimeout { + return ErrCloseReqTimeout + } + return err + } + cr := &pb.CloseResponse{} + err = cr.Unmarshal(reply.Data) + if err != nil { + return err + } + if cr.Error != "" { + return errors.New(cr.Error) + } + return nil +} + +// NatsConn returns the underlying NATS conn. Use this with care. For example, +// closing the wrapped NATS conn will put the NATS Streaming Conn in an invalid +// state. +func (sc *conn) NatsConn() *nats.Conn { + return sc.nc +} + +// Process a heartbeat from the NATS Streaming cluster +func (sc *conn) processHeartBeat(m *nats.Msg) { + // No payload assumed, just reply. + sc.RLock() + nc := sc.nc + sc.RUnlock() + if nc != nil { + nc.Publish(m.Reply, nil) + } +} + +// Process an ack from the NATS Streaming cluster +func (sc *conn) processAck(m *nats.Msg) { + pa := &pb.PubAck{} + err := pa.Unmarshal(m.Data) + if err != nil { + // FIXME, make closure to have context? + fmt.Printf("Error processing unmarshal\n") + return + } + + // Remove + a := sc.removeAck(pa.Guid) + if a != nil { + // Capture error if it exists. + if pa.Error != "" { + err = errors.New(pa.Error) + } + if a.ah != nil { + // Perform the ackHandler callback + a.ah(pa.Guid, err) + } else if a.ch != nil { + // Send to channel directly + a.ch <- err + } + } +} + +// Publish will publish to the cluster and wait for an ACK. +func (sc *conn) Publish(subject string, data []byte) error { + ch := make(chan error) + _, err := sc.publishAsync(subject, data, nil, ch) + if err == nil { + err = <-ch + } + return err +} + +// PublishAsync will publish to the cluster on pubPrefix+subject and asynchronously +// process the ACK or error state. It will return the GUID for the message being sent. +func (sc *conn) PublishAsync(subject string, data []byte, ah AckHandler) (string, error) { + return sc.publishAsync(subject, data, ah, nil) +} + +func (sc *conn) publishAsync(subject string, data []byte, ah AckHandler, ch chan error) (string, error) { + a := &ack{ah: ah, ch: ch} + sc.Lock() + if sc.nc == nil { + sc.Unlock() + return "", ErrConnectionClosed + } + + subj := sc.pubPrefix + "." + subject + // This is only what we need from PubMsg in the timer below, + // so do this so that pe doesn't escape (and we same on new object) + peGUID := nuid.Next() + pe := &pb.PubMsg{ClientID: sc.clientID, Guid: peGUID, Subject: subject, Data: data} + b, _ := pe.Marshal() + + // Map ack to guid. + sc.pubAckMap[peGUID] = a + // snapshot + ackSubject := sc.ackSubject + ackTimeout := sc.opts.AckTimeout + pac := sc.pubAckChan + sc.Unlock() + + // Use the buffered channel to control the number of outstanding acks. + pac <- struct{}{} + + err := sc.nc.PublishRequest(subj, ackSubject, b) + if err != nil { + sc.removeAck(peGUID) + return "", err + } + + // Setup the timer for expiration. + sc.Lock() + a.t = time.AfterFunc(ackTimeout, func() { + sc.removeAck(peGUID) + if a.ah != nil { + ah(peGUID, ErrTimeout) + } else if a.ch != nil { + a.ch <- ErrTimeout + } + }) + sc.Unlock() + + return peGUID, nil +} + +// removeAck removes the ack from the pubAckMap and cancels any state, e.g. timers +func (sc *conn) removeAck(guid string) *ack { + var t *time.Timer + sc.Lock() + a := sc.pubAckMap[guid] + if a != nil { + t = a.t + delete(sc.pubAckMap, guid) + } + pac := sc.pubAckChan + sc.Unlock() + + // Cancel timer if needed. + if t != nil { + t.Stop() + } + + // Remove from channel to unblock PublishAsync + if a != nil && len(pac) > 0 { + <-pac + } + return a +} + +// Process an msg from the NATS Streaming cluster +func (sc *conn) processMsg(raw *nats.Msg) { + msg := &Msg{} + err := msg.Unmarshal(raw.Data) + if err != nil { + panic("Error processing unmarshal for msg") + } + // Lookup the subscription + sc.RLock() + nc := sc.nc + isClosed := nc == nil + sub := sc.subMap[raw.Subject] + sc.RUnlock() + + // Check if sub is no longer valid or connection has been closed. + if sub == nil || isClosed { + return + } + + // Store in msg for backlink + msg.Sub = sub + + sub.RLock() + cb := sub.cb + ackSubject := sub.ackInbox + isManualAck := sub.opts.ManualAcks + subsc := sub.sc // Can be nil if sub has been unsubscribed. + sub.RUnlock() + + // Perform the callback + if cb != nil && subsc != nil { + cb(msg) + } + + // Proces auto-ack + if !isManualAck && nc != nil { + ack := &pb.Ack{Subject: msg.Subject, Sequence: msg.Sequence} + b, _ := ack.Marshal() + if err := nc.Publish(ackSubject, b); err != nil { + // FIXME(dlc) - Async error handler? Retry? + } + } +} diff --git a/vendor/github.com/nats-io/go-nats-streaming/sub.go b/vendor/github.com/nats-io/go-nats-streaming/sub.go new file mode 100644 index 000000000..164ab81de --- /dev/null +++ b/vendor/github.com/nats-io/go-nats-streaming/sub.go @@ -0,0 +1,472 @@ +// Copyright 2016 Apcera Inc. All rights reserved. + +// Package stan is a Go client for the NATS Streaming messaging system (https://nats.io). +package stan + +import ( + "errors" + "sync" + "time" + + "github.com/nats-io/go-nats" + "github.com/nats-io/go-nats-streaming/pb" +) + +const ( + // DefaultAckWait indicates how long the server should wait for an ACK before resending a message + DefaultAckWait = 30 * time.Second + // DefaultMaxInflight indicates how many messages with outstanding ACKs the server can send + DefaultMaxInflight = 1024 +) + +// Msg is the client defined message, which includes proto, then back link to subscription. +type Msg struct { + pb.MsgProto // MsgProto: Seq, Subject, Reply[opt], Data, Timestamp, CRC32[opt] + Sub Subscription +} + +// Subscriptions and Options + +// Subscription represents a subscription within the NATS Streaming cluster. Subscriptions +// will be rate matched and follow at-least delivery semantics. +type Subscription interface { + ClearMaxPending() error + Delivered() (int64, error) + Dropped() (int, error) + IsValid() bool + MaxPending() (int, int, error) + Pending() (int, int, error) + PendingLimits() (int, int, error) + SetPendingLimits(msgLimit, bytesLimit int) error + // Unsubscribe removes interest in the subscription. + // For durables, it means that the durable interest is also removed from + // the server. Restarting a durable with the same name will not resume + // the subscription, it will be considered a new one. + Unsubscribe() error + + // Close removes this subscriber from the server, but unlike Unsubscribe(), + // the durable interest is not removed. If the client has connected to a server + // for which this feature is not available, Close() will return a ErrNoServerSupport + // error. + Close() error +} + +// A subscription represents a subscription to a stan cluster. +type subscription struct { + sync.RWMutex + sc *conn + subject string + qgroup string + inbox string + ackInbox string + inboxSub *nats.Subscription + opts SubscriptionOptions + cb MsgHandler +} + +// SubscriptionOption is a function on the options for a subscription. +type SubscriptionOption func(*SubscriptionOptions) error + +// MsgHandler is a callback function that processes messages delivered to +// asynchronous subscribers. +type MsgHandler func(msg *Msg) + +// SubscriptionOptions are used to control the Subscription's behavior. +type SubscriptionOptions struct { + // DurableName, if set will survive client restarts. + DurableName string + // Controls the number of messages the cluster will have inflight without an ACK. + MaxInflight int + // Controls the time the cluster will wait for an ACK for a given message. + AckWait time.Duration + // StartPosition enum from proto. + StartAt pb.StartPosition + // Optional start sequence number. + StartSequence uint64 + // Optional start time. + StartTime time.Time + // Option to do Manual Acks + ManualAcks bool +} + +// DefaultSubscriptionOptions are the default subscriptions' options +var DefaultSubscriptionOptions = SubscriptionOptions{ + MaxInflight: DefaultMaxInflight, + AckWait: DefaultAckWait, +} + +// MaxInflight is an Option to set the maximum number of messages the cluster will send +// without an ACK. +func MaxInflight(m int) SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.MaxInflight = m + return nil + } +} + +// AckWait is an Option to set the timeout for waiting for an ACK from the cluster's +// point of view for delivered messages. +func AckWait(t time.Duration) SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.AckWait = t + return nil + } +} + +// StartAt sets the desired start position for the message stream. +func StartAt(sp pb.StartPosition) SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.StartAt = sp + return nil + } +} + +// StartAtSequence sets the desired start sequence position and state. +func StartAtSequence(seq uint64) SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.StartAt = pb.StartPosition_SequenceStart + o.StartSequence = seq + return nil + } +} + +// StartAtTime sets the desired start time position and state. +func StartAtTime(start time.Time) SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.StartAt = pb.StartPosition_TimeDeltaStart + o.StartTime = start + return nil + } +} + +// StartAtTimeDelta sets the desired start time position and state using the delta. +func StartAtTimeDelta(ago time.Duration) SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.StartAt = pb.StartPosition_TimeDeltaStart + o.StartTime = time.Now().Add(-ago) + return nil + } +} + +// StartWithLastReceived is a helper function to set start position to last received. +func StartWithLastReceived() SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.StartAt = pb.StartPosition_LastReceived + return nil + } +} + +// DeliverAllAvailable will deliver all messages available. +func DeliverAllAvailable() SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.StartAt = pb.StartPosition_First + return nil + } +} + +// SetManualAckMode will allow clients to control their own acks to delivered messages. +func SetManualAckMode() SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.ManualAcks = true + return nil + } +} + +// DurableName sets the DurableName for the subcriber. +func DurableName(name string) SubscriptionOption { + return func(o *SubscriptionOptions) error { + o.DurableName = name + return nil + } +} + +// Subscribe will perform a subscription with the given options to the NATS Streaming cluster. +func (sc *conn) Subscribe(subject string, cb MsgHandler, options ...SubscriptionOption) (Subscription, error) { + return sc.subscribe(subject, "", cb, options...) +} + +// QueueSubscribe will perform a queue subscription with the given options to the NATS Streaming cluster. +func (sc *conn) QueueSubscribe(subject, qgroup string, cb MsgHandler, options ...SubscriptionOption) (Subscription, error) { + return sc.subscribe(subject, qgroup, cb, options...) +} + +// subscribe will perform a subscription with the given options to the NATS Streaming cluster. +func (sc *conn) subscribe(subject, qgroup string, cb MsgHandler, options ...SubscriptionOption) (Subscription, error) { + sub := &subscription{subject: subject, qgroup: qgroup, inbox: nats.NewInbox(), cb: cb, sc: sc, opts: DefaultSubscriptionOptions} + for _, opt := range options { + if err := opt(&sub.opts); err != nil { + return nil, err + } + } + sc.Lock() + if sc.nc == nil { + sc.Unlock() + return nil, ErrConnectionClosed + } + + // Register subscription. + sc.subMap[sub.inbox] = sub + nc := sc.nc + sc.Unlock() + + // Hold lock throughout. + sub.Lock() + defer sub.Unlock() + + // Listen for actual messages. + nsub, err := nc.Subscribe(sub.inbox, sc.processMsg) + if err != nil { + return nil, err + } + sub.inboxSub = nsub + + // Create a subscription request + // FIXME(dlc) add others. + sr := &pb.SubscriptionRequest{ + ClientID: sc.clientID, + Subject: subject, + QGroup: qgroup, + Inbox: sub.inbox, + MaxInFlight: int32(sub.opts.MaxInflight), + AckWaitInSecs: int32(sub.opts.AckWait / time.Second), + StartPosition: sub.opts.StartAt, + DurableName: sub.opts.DurableName, + } + + // Conditionals + switch sr.StartPosition { + case pb.StartPosition_TimeDeltaStart: + sr.StartTimeDelta = time.Now().UnixNano() - sub.opts.StartTime.UnixNano() + case pb.StartPosition_SequenceStart: + sr.StartSequence = sub.opts.StartSequence + } + + b, _ := sr.Marshal() + reply, err := sc.nc.Request(sc.subRequests, b, sc.opts.ConnectTimeout) + if err != nil { + sub.inboxSub.Unsubscribe() + if err == nats.ErrTimeout { + err = ErrSubReqTimeout + } + return nil, err + } + r := &pb.SubscriptionResponse{} + if err := r.Unmarshal(reply.Data); err != nil { + sub.inboxSub.Unsubscribe() + return nil, err + } + if r.Error != "" { + sub.inboxSub.Unsubscribe() + return nil, errors.New(r.Error) + } + sub.ackInbox = r.AckInbox + + return sub, nil +} + +// ClearMaxPending resets the maximums seen so far. +func (sub *subscription) ClearMaxPending() error { + sub.Lock() + defer sub.Unlock() + if sub.inboxSub == nil { + return ErrBadSubscription + } + return sub.inboxSub.ClearMaxPending() +} + +// Delivered returns the number of delivered messages for this subscription. +func (sub *subscription) Delivered() (int64, error) { + sub.Lock() + defer sub.Unlock() + if sub.inboxSub == nil { + return -1, ErrBadSubscription + } + return sub.inboxSub.Delivered() +} + +// Dropped returns the number of known dropped messages for this subscription. +// This will correspond to messages dropped by violations of PendingLimits. If +// the server declares the connection a SlowConsumer, this number may not be +// valid. +func (sub *subscription) Dropped() (int, error) { + sub.Lock() + defer sub.Unlock() + if sub.inboxSub == nil { + return -1, ErrBadSubscription + } + return sub.inboxSub.Dropped() +} + +// IsValid returns a boolean indicating whether the subscription +// is still active. This will return false if the subscription has +// already been closed. +func (sub *subscription) IsValid() bool { + sub.Lock() + defer sub.Unlock() + if sub.inboxSub == nil { + return false + } + return sub.inboxSub.IsValid() +} + +// MaxPending returns the maximum number of queued messages and queued bytes seen so far. +func (sub *subscription) MaxPending() (int, int, error) { + sub.Lock() + defer sub.Unlock() + if sub.inboxSub == nil { + return -1, -1, ErrBadSubscription + } + return sub.inboxSub.MaxPending() +} + +// Pending returns the number of queued messages and queued bytes in the client for this subscription. +func (sub *subscription) Pending() (int, int, error) { + sub.Lock() + defer sub.Unlock() + if sub.inboxSub == nil { + return -1, -1, ErrBadSubscription + } + return sub.inboxSub.Pending() +} + +// PendingLimits returns the current limits for this subscription. +// If no error is returned, a negative value indicates that the +// given metric is not limited. +func (sub *subscription) PendingLimits() (int, int, error) { + sub.Lock() + defer sub.Unlock() + if sub.inboxSub == nil { + return -1, -1, ErrBadSubscription + } + return sub.inboxSub.PendingLimits() +} + +// SetPendingLimits sets the limits for pending msgs and bytes for this subscription. +// Zero is not allowed. Any negative value means that the given metric is not limited. +func (sub *subscription) SetPendingLimits(msgLimit, bytesLimit int) error { + sub.Lock() + defer sub.Unlock() + if sub.inboxSub == nil { + return ErrBadSubscription + } + return sub.inboxSub.SetPendingLimits(msgLimit, bytesLimit) +} + +// closeOrUnsubscribe performs either close or unsubsribe based on +// given boolean. +func (sub *subscription) closeOrUnsubscribe(doClose bool) error { + if sub == nil { + return ErrBadSubscription + } + sub.Lock() + sc := sub.sc + if sc == nil { + // Already closed. + sub.Unlock() + return ErrBadSubscription + } + sub.sc = nil + sub.inboxSub.Unsubscribe() + sub.inboxSub = nil + sub.Unlock() + + if sc == nil { + return ErrBadSubscription + } + + sc.Lock() + if sc.nc == nil { + sc.Unlock() + return ErrConnectionClosed + } + + delete(sc.subMap, sub.inbox) + reqSubject := sc.unsubRequests + if doClose { + reqSubject = sc.subCloseRequests + if reqSubject == "" { + sc.Unlock() + return ErrNoServerSupport + } + } + + // Snapshot connection to avoid data race, since the connection may be + // closing while we try to send the request + nc := sc.nc + sc.Unlock() + + usr := &pb.UnsubscribeRequest{ + ClientID: sc.clientID, + Subject: sub.subject, + Inbox: sub.ackInbox, + } + b, _ := usr.Marshal() + reply, err := nc.Request(reqSubject, b, sc.opts.ConnectTimeout) + if err != nil { + if err == nats.ErrTimeout { + if doClose { + return ErrCloseReqTimeout + } + return ErrUnsubReqTimeout + } + return err + } + r := &pb.SubscriptionResponse{} + if err := r.Unmarshal(reply.Data); err != nil { + return err + } + if r.Error != "" { + return errors.New(r.Error) + } + + return nil +} + +// Unsubscribe implements the Subscription interface +func (sub *subscription) Unsubscribe() error { + return sub.closeOrUnsubscribe(false) +} + +// Close implements the Subscription interface +func (sub *subscription) Close() error { + return sub.closeOrUnsubscribe(true) +} + +// Ack manually acknowledges a message. +// The subscriber had to be created with SetManualAckMode() option. +func (msg *Msg) Ack() error { + if msg == nil { + return ErrNilMsg + } + // Look up subscription + sub := msg.Sub.(*subscription) + if sub == nil { + return ErrBadSubscription + } + + sub.RLock() + ackSubject := sub.ackInbox + isManualAck := sub.opts.ManualAcks + sc := sub.sc + sub.RUnlock() + + // Check for error conditions. + if sc == nil { + return ErrBadSubscription + } + // Get nc from the connection (needs locking to avoid race) + sc.RLock() + nc := sc.nc + sc.RUnlock() + if nc == nil { + return ErrBadConnection + } + if !isManualAck { + return ErrManualAck + } + + // Ack here. + ack := &pb.Ack{Subject: msg.Subject, Sequence: msg.Sequence} + b, _ := ack.Marshal() + return nc.Publish(ackSubject, b) +} diff --git a/vendor/github.com/nats-io/go-nats/LICENSE b/vendor/github.com/nats-io/go-nats/LICENSE new file mode 100644 index 000000000..4cfd668f2 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/LICENSE @@ -0,0 +1,20 @@ +The MIT License (MIT) + +Copyright (c) 2012-2016 Apcera Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy of +this software and associated documentation files (the "Software"), to deal in +the Software without restriction, including without limitation the rights to +use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of +the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS +FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR +COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER +IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN +CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/vendor/github.com/nats-io/go-nats/README.md b/vendor/github.com/nats-io/go-nats/README.md new file mode 100644 index 000000000..ad95e0a7e --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/README.md @@ -0,0 +1,322 @@ +# NATS - Go Client +A [Go](http://golang.org) client for the [NATS messaging system](https://nats.io). + +[![License MIT](https://img.shields.io/npm/l/express.svg)](http://opensource.org/licenses/MIT) +[![Go Report Card](https://goreportcard.com/badge/github.com/nats-io/go-nats)](https://goreportcard.com/report/github.com/nats-io/go-nats) [![Build Status](https://travis-ci.org/nats-io/go-nats.svg?branch=master)](http://travis-ci.org/nats-io/go-nats) [![GoDoc](https://godoc.org/github.com/nats-io/go-nats?status.svg)](http://godoc.org/github.com/nats-io/go-nats) [![Coverage Status](https://coveralls.io/repos/nats-io/go-nats/badge.svg?branch=master)](https://coveralls.io/r/nats-io/go-nats?branch=master) + +## Installation + +```bash +# Go client +go get github.com/nats-io/go-nats + +# Server +go get github.com/nats-io/gnatsd +``` + +## Basic Usage + +```go + +nc, _ := nats.Connect(nats.DefaultURL) + +// Simple Publisher +nc.Publish("foo", []byte("Hello World")) + +// Simple Async Subscriber +nc.Subscribe("foo", func(m *nats.Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}) + +// Simple Sync Subscriber +sub, err := nc.SubscribeSync("foo") +m, err := sub.NextMsg(timeout) + +// Channel Subscriber +ch := make(chan *nats.Msg, 64) +sub, err := nc.ChanSubscribe("foo", ch) +msg <- ch + +// Unsubscribe +sub.Unsubscribe() + +// Requests +msg, err := nc.Request("help", []byte("help me"), 10*time.Millisecond) + +// Replies +nc.Subscribe("help", func(m *Msg) { + nc.Publish(m.Reply, []byte("I can help!")) +}) + +// Close connection +nc := nats.Connect("nats://localhost:4222") +nc.Close(); +``` + +## Encoded Connections + +```go + +nc, _ := nats.Connect(nats.DefaultURL) +c, _ := nats.NewEncodedConn(nc, nats.JSON_ENCODER) +defer c.Close() + +// Simple Publisher +c.Publish("foo", "Hello World") + +// Simple Async Subscriber +c.Subscribe("foo", func(s string) { + fmt.Printf("Received a message: %s\n", s) +}) + +// EncodedConn can Publish any raw Go type using the registered Encoder +type person struct { + Name string + Address string + Age int +} + +// Go type Subscriber +c.Subscribe("hello", func(p *person) { + fmt.Printf("Received a person: %+v\n", p) +}) + +me := &person{Name: "derek", Age: 22, Address: "140 New Montgomery Street, San Francisco, CA"} + +// Go type Publisher +c.Publish("hello", me) + +// Unsubscribe +sub, err := c.Subscribe("foo", nil) +... +sub.Unsubscribe() + +// Requests +var response string +err := c.Request("help", "help me", &response, 10*time.Millisecond) +if err != nil { + fmt.Printf("Request failed: %v\n", err) +} + +// Replying +c.Subscribe("help", func(subj, reply string, msg string) { + c.Publish(reply, "I can help!") +}) + +// Close connection +c.Close(); +``` + +## TLS + +```go +// tls as a scheme will enable secure connections by default. This will also verify the server name. +nc, err := nats.Connect("tls://nats.demo.io:4443") + +// If you are using a self-signed certificate, you need to have a tls.Config with RootCAs setup. +// We provide a helper method to make this case easier. +nc, err = nats.Connect("tls://localhost:4443", nats.RootCAs("./configs/certs/ca.pem")) + +// If the server requires client certificate, there is an helper function for that too: +cert := nats.ClientCert("./configs/certs/client-cert.pem", "./configs/certs/client-key.pem") +nc, err = nats.Connect("tls://localhost:4443", cert) + +// You can also supply a complete tls.Config + +certFile := "./configs/certs/client-cert.pem" +keyFile := "./configs/certs/client-key.pem" +cert, err := tls.LoadX509KeyPair(certFile, keyFile) +if err != nil { + t.Fatalf("error parsing X509 certificate/key pair: %v", err) +} + +config := &tls.Config{ + ServerName: opts.Host, + Certificates: []tls.Certificate{cert}, + RootCAs: pool, + MinVersion: tls.VersionTLS12, +} + +nc, err = nats.Connect("nats://localhost:4443", nats.Secure(config)) +if err != nil { + t.Fatalf("Got an error on Connect with Secure Options: %+v\n", err) +} + +``` + +## Using Go Channels (netchan) + +```go +nc, _ := nats.Connect(nats.DefaultURL) +ec, _ := nats.NewEncodedConn(nc, nats.JSON_ENCODER) +defer ec.Close() + +type person struct { + Name string + Address string + Age int +} + +recvCh := make(chan *person) +ec.BindRecvChan("hello", recvCh) + +sendCh := make(chan *person) +ec.BindSendChan("hello", sendCh) + +me := &person{Name: "derek", Age: 22, Address: "140 New Montgomery Street"} + +// Send via Go channels +sendCh <- me + +// Receive via Go channels +who := <- recvCh +``` + +## Wildcard Subscriptions + +```go + +// "*" matches any token, at any level of the subject. +nc.Subscribe("foo.*.baz", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +nc.Subscribe("foo.bar.*", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +// ">" matches any length of the tail of a subject, and can only be the last token +// E.g. 'foo.>' will match 'foo.bar', 'foo.bar.baz', 'foo.foo.bar.bax.22' +nc.Subscribe("foo.>", func(m *Msg) { + fmt.Printf("Msg received on [%s] : %s\n", m.Subject, string(m.Data)); +}) + +// Matches all of the above +nc.Publish("foo.bar.baz", []byte("Hello World")) + +``` + +## Queue Groups + +```go +// All subscriptions with the same queue name will form a queue group. +// Each message will be delivered to only one subscriber per queue group, +// using queuing semantics. You can have as many queue groups as you wish. +// Normal subscribers will continue to work as expected. + +nc.QueueSubscribe("foo", "job_workers", func(_ *Msg) { + received += 1; +}) + +``` + +## Advanced Usage + +```go + +// Flush connection to server, returns when all messages have been processed. +nc.Flush() +fmt.Println("All clear!") + +// FlushTimeout specifies a timeout value as well. +err := nc.FlushTimeout(1*time.Second) +if err != nil { + fmt.Println("All clear!") +} else { + fmt.Println("Flushed timed out!") +} + +// Auto-unsubscribe after MAX_WANTED messages received +const MAX_WANTED = 10 +sub, err := nc.Subscribe("foo") +sub.AutoUnsubscribe(MAX_WANTED) + +// Multiple connections +nc1 := nats.Connect("nats://host1:4222") +nc2 := nats.Connect("nats://host2:4222") + +nc1.Subscribe("foo", func(m *Msg) { + fmt.Printf("Received a message: %s\n", string(m.Data)) +}) + +nc2.Publish("foo", []byte("Hello World!")); + +``` + +## Clustered Usage + +```go + +var servers = "nats://localhost:1222, nats://localhost:1223, nats://localhost:1224" + +nc, err := nats.Connect(servers) + +// Optionally set ReconnectWait and MaxReconnect attempts. +// This example means 10 seconds total per backend. +nc, err = nats.Connect(servers, nats.MaxReconnects(5), nats.ReconnectWait(2 * time.Second)) + +// Optionally disable randomization of the server pool +nc, err = nats.Connect(servers, nats.DontRandomize()) + +// Setup callbacks to be notified on disconnects, reconnects and connection closed. +nc, err = nats.Connect(servers, + nats.DisconnectHandler(func(nc *nats.Conn) { + fmt.Printf("Got disconnected!\n") + }), + nats.ReconnectHandler(func(_ *nats.Conn) { + fmt.Printf("Got reconnected to %v!\n", nc.ConnectedUrl()) + }), + nats.ClosedHandler(func(nc *nats.Conn) { + fmt.Printf("Connection closed. Reason: %q\n", nc.LastError()) + }) +) + +// When connecting to a mesh of servers with auto-discovery capabilities, +// you may need to provide a username/password or token in order to connect +// to any server in that mesh when authentication is required. +// Instead of providing the credentials in the initial URL, you will use +// new option setters: +nc, err = nats.Connect("nats://localhost:4222", nats.UserInfo("foo", "bar")) + +// For token based authentication: +nc, err = nats.Connect("nats://localhost:4222", nats.Token("S3cretT0ken")) + +// You can even pass the two at the same time in case one of the server +// in the mesh requires token instead of user name and password. +nc, err = nats.Connect("nats://localhost:4222", + nats.UserInfo("foo", "bar"), + nats.Token("S3cretT0ken")) + +// Note that if credentials are specified in the initial URLs, they take +// precedence on the credentials specfied through the options. +// For instance, in the connect call below, the client library will use +// the user "my" and password "pwd" to connect to locahost:4222, however, +// it will use username "foo" and password "bar" when (re)connecting to +// a different server URL that it got as part of the auto-discovery. +nc, err = nats.Connect("nats://my:pwd@localhost:4222", nats.UserInfo("foo", "bar")) + +``` + +## License + +(The MIT License) + +Copyright (c) 2012-2016 Apcera Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to +deal in the Software without restriction, including without limitation the +rights to use, copy, modify, merge, publish, distribute, sublicense, and/or +sell copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING +FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS +IN THE SOFTWARE. diff --git a/vendor/github.com/nats-io/go-nats/TODO.md b/vendor/github.com/nats-io/go-nats/TODO.md new file mode 100644 index 000000000..213aaeca8 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/TODO.md @@ -0,0 +1,26 @@ + +- [ ] Better constructors, options handling +- [ ] Functions for callback settings after connection created. +- [ ] Better options for subscriptions. Slow Consumer state settable, Go routines vs Inline. +- [ ] Move off of channels for subscribers, use syncPool linkedLists, etc with highwater. +- [ ] Test for valid subjects on publish and subscribe? +- [ ] SyncSubscriber and Next for EncodedConn +- [ ] Fast Publisher? +- [ ] pooling for structs used? leaky bucket? +- [ ] Timeout 0 should work as no timeout +- [x] Ping timer +- [x] Name in Connect for gnatsd +- [x] Asynchronous error handling +- [x] Parser rewrite +- [x] Reconnect +- [x] Hide Lock +- [x] Easier encoder interface +- [x] QueueSubscribeSync +- [x] Make nats specific errors prefixed with 'nats:' +- [x] API test for closed connection +- [x] TLS/SSL +- [x] Stats collection +- [x] Disconnect detection +- [x] Optimized Publish (coalescing) +- [x] Do Examples via Go style +- [x] Standardized Errors diff --git a/vendor/github.com/nats-io/go-nats/enc.go b/vendor/github.com/nats-io/go-nats/enc.go new file mode 100644 index 000000000..f29b0343a --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/enc.go @@ -0,0 +1,249 @@ +// Copyright 2012-2015 Apcera Inc. All rights reserved. + +package nats + +import ( + "errors" + "fmt" + "reflect" + "sync" + "time" + + // Default Encoders + . "github.com/nats-io/go-nats/encoders/builtin" +) + +// Encoder interface is for all register encoders +type Encoder interface { + Encode(subject string, v interface{}) ([]byte, error) + Decode(subject string, data []byte, vPtr interface{}) error +} + +var encMap map[string]Encoder +var encLock sync.Mutex + +// Indexe names into the Registered Encoders. +const ( + JSON_ENCODER = "json" + GOB_ENCODER = "gob" + DEFAULT_ENCODER = "default" +) + +func init() { + encMap = make(map[string]Encoder) + // Register json, gob and default encoder + RegisterEncoder(JSON_ENCODER, &JsonEncoder{}) + RegisterEncoder(GOB_ENCODER, &GobEncoder{}) + RegisterEncoder(DEFAULT_ENCODER, &DefaultEncoder{}) +} + +// EncodedConn are the preferred way to interface with NATS. They wrap a bare connection to +// a nats server and have an extendable encoder system that will encode and decode messages +// from raw Go types. +type EncodedConn struct { + Conn *Conn + Enc Encoder +} + +// NewEncodedConn will wrap an existing Connection and utilize the appropriate registered +// encoder. +func NewEncodedConn(c *Conn, encType string) (*EncodedConn, error) { + if c == nil { + return nil, errors.New("nats: Nil Connection") + } + if c.IsClosed() { + return nil, ErrConnectionClosed + } + ec := &EncodedConn{Conn: c, Enc: EncoderForType(encType)} + if ec.Enc == nil { + return nil, fmt.Errorf("No encoder registered for '%s'", encType) + } + return ec, nil +} + +// RegisterEncoder will register the encType with the given Encoder. Useful for customization. +func RegisterEncoder(encType string, enc Encoder) { + encLock.Lock() + defer encLock.Unlock() + encMap[encType] = enc +} + +// EncoderForType will return the registered Encoder for the encType. +func EncoderForType(encType string) Encoder { + encLock.Lock() + defer encLock.Unlock() + return encMap[encType] +} + +// Publish publishes the data argument to the given subject. The data argument +// will be encoded using the associated encoder. +func (c *EncodedConn) Publish(subject string, v interface{}) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + return c.Conn.publish(subject, _EMPTY_, b) +} + +// PublishRequest will perform a Publish() expecting a response on the +// reply subject. Use Request() for automatically waiting for a response +// inline. +func (c *EncodedConn) PublishRequest(subject, reply string, v interface{}) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + return c.Conn.publish(subject, reply, b) +} + +// Request will create an Inbox and perform a Request() call +// with the Inbox reply for the data v. A response will be +// decoded into the vPtrResponse. +func (c *EncodedConn) Request(subject string, v interface{}, vPtr interface{}, timeout time.Duration) error { + b, err := c.Enc.Encode(subject, v) + if err != nil { + return err + } + m, err := c.Conn.Request(subject, b, timeout) + if err != nil { + return err + } + if reflect.TypeOf(vPtr) == emptyMsgType { + mPtr := vPtr.(*Msg) + *mPtr = *m + } else { + err = c.Enc.Decode(m.Subject, m.Data, vPtr) + } + return err +} + +// Handler is a specific callback used for Subscribe. It is generalized to +// an interface{}, but we will discover its format and arguments at runtime +// and perform the correct callback, including de-marshalling JSON strings +// back into the appropriate struct based on the signature of the Handler. +// +// Handlers are expected to have one of four signatures. +// +// type person struct { +// Name string `json:"name,omitempty"` +// Age uint `json:"age,omitempty"` +// } +// +// handler := func(m *Msg) +// handler := func(p *person) +// handler := func(subject string, o *obj) +// handler := func(subject, reply string, o *obj) +// +// These forms allow a callback to request a raw Msg ptr, where the processing +// of the message from the wire is untouched. Process a JSON representation +// and demarshal it into the given struct, e.g. person. +// There are also variants where the callback wants either the subject, or the +// subject and the reply subject. +type Handler interface{} + +// Dissect the cb Handler's signature +func argInfo(cb Handler) (reflect.Type, int) { + cbType := reflect.TypeOf(cb) + if cbType.Kind() != reflect.Func { + panic("nats: Handler needs to be a func") + } + numArgs := cbType.NumIn() + if numArgs == 0 { + return nil, numArgs + } + return cbType.In(numArgs - 1), numArgs +} + +var emptyMsgType = reflect.TypeOf(&Msg{}) + +// Subscribe will create a subscription on the given subject and process incoming +// messages using the specified Handler. The Handler should be a func that matches +// a signature from the description of Handler from above. +func (c *EncodedConn) Subscribe(subject string, cb Handler) (*Subscription, error) { + return c.subscribe(subject, _EMPTY_, cb) +} + +// QueueSubscribe will create a queue subscription on the given subject and process +// incoming messages using the specified Handler. The Handler should be a func that +// matches a signature from the description of Handler from above. +func (c *EncodedConn) QueueSubscribe(subject, queue string, cb Handler) (*Subscription, error) { + return c.subscribe(subject, queue, cb) +} + +// Internal implementation that all public functions will use. +func (c *EncodedConn) subscribe(subject, queue string, cb Handler) (*Subscription, error) { + if cb == nil { + return nil, errors.New("nats: Handler required for EncodedConn Subscription") + } + argType, numArgs := argInfo(cb) + if argType == nil { + return nil, errors.New("nats: Handler requires at least one argument") + } + + cbValue := reflect.ValueOf(cb) + wantsRaw := (argType == emptyMsgType) + + natsCB := func(m *Msg) { + var oV []reflect.Value + if wantsRaw { + oV = []reflect.Value{reflect.ValueOf(m)} + } else { + var oPtr reflect.Value + if argType.Kind() != reflect.Ptr { + oPtr = reflect.New(argType) + } else { + oPtr = reflect.New(argType.Elem()) + } + if err := c.Enc.Decode(m.Subject, m.Data, oPtr.Interface()); err != nil { + if c.Conn.Opts.AsyncErrorCB != nil { + c.Conn.ach <- func() { + c.Conn.Opts.AsyncErrorCB(c.Conn, m.Sub, errors.New("nats: Got an error trying to unmarshal: "+err.Error())) + } + } + return + } + if argType.Kind() != reflect.Ptr { + oPtr = reflect.Indirect(oPtr) + } + + // Callback Arity + switch numArgs { + case 1: + oV = []reflect.Value{oPtr} + case 2: + subV := reflect.ValueOf(m.Subject) + oV = []reflect.Value{subV, oPtr} + case 3: + subV := reflect.ValueOf(m.Subject) + replyV := reflect.ValueOf(m.Reply) + oV = []reflect.Value{subV, replyV, oPtr} + } + + } + cbValue.Call(oV) + } + + return c.Conn.subscribe(subject, queue, natsCB, nil) +} + +// FlushTimeout allows a Flush operation to have an associated timeout. +func (c *EncodedConn) FlushTimeout(timeout time.Duration) (err error) { + return c.Conn.FlushTimeout(timeout) +} + +// Flush will perform a round trip to the server and return when it +// receives the internal reply. +func (c *EncodedConn) Flush() error { + return c.Conn.Flush() +} + +// Close will close the connection to the server. This call will release +// all blocking calls, such as Flush(), etc. +func (c *EncodedConn) Close() { + c.Conn.Close() +} + +// LastError reports the last error encountered via the Connection. +func (c *EncodedConn) LastError() error { + return c.Conn.err +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go new file mode 100644 index 000000000..82467ce78 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/default_enc.go @@ -0,0 +1,106 @@ +// Copyright 2012-2015 Apcera Inc. All rights reserved. + +package builtin + +import ( + "bytes" + "fmt" + "reflect" + "strconv" + "unsafe" +) + +// DefaultEncoder implementation for EncodedConn. +// This encoder will leave []byte and string untouched, but will attempt to +// turn numbers into appropriate strings that can be decoded. It will also +// propely encoded and decode bools. If will encode a struct, but if you want +// to properly handle structures you should use JsonEncoder. +type DefaultEncoder struct { + // Empty +} + +var trueB = []byte("true") +var falseB = []byte("false") +var nilB = []byte("") + +// Encode +func (je *DefaultEncoder) Encode(subject string, v interface{}) ([]byte, error) { + switch arg := v.(type) { + case string: + bytes := *(*[]byte)(unsafe.Pointer(&arg)) + return bytes, nil + case []byte: + return arg, nil + case bool: + if arg { + return trueB, nil + } else { + return falseB, nil + } + case nil: + return nilB, nil + default: + var buf bytes.Buffer + fmt.Fprintf(&buf, "%+v", arg) + return buf.Bytes(), nil + } +} + +// Decode +func (je *DefaultEncoder) Decode(subject string, data []byte, vPtr interface{}) error { + // Figure out what it's pointing to... + sData := *(*string)(unsafe.Pointer(&data)) + switch arg := vPtr.(type) { + case *string: + *arg = sData + return nil + case *[]byte: + *arg = data + return nil + case *int: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int(n) + return nil + case *int32: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int32(n) + return nil + case *int64: + n, err := strconv.ParseInt(sData, 10, 64) + if err != nil { + return err + } + *arg = int64(n) + return nil + case *float32: + n, err := strconv.ParseFloat(sData, 32) + if err != nil { + return err + } + *arg = float32(n) + return nil + case *float64: + n, err := strconv.ParseFloat(sData, 64) + if err != nil { + return err + } + *arg = float64(n) + return nil + case *bool: + b, err := strconv.ParseBool(sData) + if err != nil { + return err + } + *arg = b + return nil + default: + vt := reflect.TypeOf(arg).Elem() + return fmt.Errorf("nats: Default Encoder can't decode to type %s", vt) + } +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go new file mode 100644 index 000000000..988ff42f5 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/gob_enc.go @@ -0,0 +1,34 @@ +// Copyright 2013-2015 Apcera Inc. All rights reserved. + +package builtin + +import ( + "bytes" + "encoding/gob" +) + +// GobEncoder is a Go specific GOB Encoder implementation for EncodedConn. +// This encoder will use the builtin encoding/gob to Marshal +// and Unmarshal most types, including structs. +type GobEncoder struct { + // Empty +} + +// FIXME(dlc) - This could probably be more efficient. + +// Encode +func (ge *GobEncoder) Encode(subject string, v interface{}) ([]byte, error) { + b := new(bytes.Buffer) + enc := gob.NewEncoder(b) + if err := enc.Encode(v); err != nil { + return nil, err + } + return b.Bytes(), nil +} + +// Decode +func (ge *GobEncoder) Decode(subject string, data []byte, vPtr interface{}) (err error) { + dec := gob.NewDecoder(bytes.NewBuffer(data)) + err = dec.Decode(vPtr) + return +} diff --git a/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go b/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go new file mode 100644 index 000000000..3b269ef02 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/encoders/builtin/json_enc.go @@ -0,0 +1,45 @@ +// Copyright 2012-2015 Apcera Inc. All rights reserved. + +package builtin + +import ( + "encoding/json" + "strings" +) + +// JsonEncoder is a JSON Encoder implementation for EncodedConn. +// This encoder will use the builtin encoding/json to Marshal +// and Unmarshal most types, including structs. +type JsonEncoder struct { + // Empty +} + +// Encode +func (je *JsonEncoder) Encode(subject string, v interface{}) ([]byte, error) { + b, err := json.Marshal(v) + if err != nil { + return nil, err + } + return b, nil +} + +// Decode +func (je *JsonEncoder) Decode(subject string, data []byte, vPtr interface{}) (err error) { + switch arg := vPtr.(type) { + case *string: + // If they want a string and it is a JSON string, strip quotes + // This allows someone to send a struct but receive as a plain string + // This cast should be efficient for Go 1.3 and beyond. + str := string(data) + if strings.HasPrefix(str, `"`) && strings.HasSuffix(str, `"`) { + *arg = str[1 : len(str)-1] + } else { + *arg = str + } + case *[]byte: + *arg = data + default: + err = json.Unmarshal(data, arg) + } + return +} diff --git a/vendor/github.com/nats-io/go-nats/nats.go b/vendor/github.com/nats-io/go-nats/nats.go new file mode 100644 index 000000000..52a3bb083 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/nats.go @@ -0,0 +1,2630 @@ +// Copyright 2012-2016 Apcera Inc. All rights reserved. + +// A Go client for the NATS messaging system (https://nats.io). +package nats + +import ( + "bufio" + "bytes" + "crypto/tls" + "crypto/x509" + "encoding/json" + "errors" + "fmt" + "io/ioutil" + "math/rand" + "net" + "net/url" + "regexp" + "runtime" + "strconv" + "strings" + "sync" + "sync/atomic" + "time" + + "github.com/nats-io/go-nats/util" + "github.com/nats-io/nuid" +) + +// Default Constants +const ( + Version = "1.2.2" + DefaultURL = "nats://localhost:4222" + DefaultPort = 4222 + DefaultMaxReconnect = 60 + DefaultReconnectWait = 2 * time.Second + DefaultTimeout = 2 * time.Second + DefaultPingInterval = 2 * time.Minute + DefaultMaxPingOut = 2 + DefaultMaxChanLen = 8192 // 8k + DefaultReconnectBufSize = 8 * 1024 * 1024 // 8MB + RequestChanLen = 8 + LangString = "go" +) + +// STALE_CONNECTION is for detection and proper handling of stale connections. +const STALE_CONNECTION = "stale connection" + +// PERMISSIONS_ERR is for when nats server subject authorization has failed. +const PERMISSIONS_ERR = "permissions violation" + +// Errors +var ( + ErrConnectionClosed = errors.New("nats: connection closed") + ErrSecureConnRequired = errors.New("nats: secure connection required") + ErrSecureConnWanted = errors.New("nats: secure connection not available") + ErrBadSubscription = errors.New("nats: invalid subscription") + ErrTypeSubscription = errors.New("nats: invalid subscription type") + ErrBadSubject = errors.New("nats: invalid subject") + ErrSlowConsumer = errors.New("nats: slow consumer, messages dropped") + ErrTimeout = errors.New("nats: timeout") + ErrBadTimeout = errors.New("nats: timeout invalid") + ErrAuthorization = errors.New("nats: authorization violation") + ErrNoServers = errors.New("nats: no servers available for connection") + ErrJsonParse = errors.New("nats: connect message, json parse error") + ErrChanArg = errors.New("nats: argument needs to be a channel type") + ErrMaxPayload = errors.New("nats: maximum payload exceeded") + ErrMaxMessages = errors.New("nats: maximum messages delivered") + ErrSyncSubRequired = errors.New("nats: illegal call on an async subscription") + ErrMultipleTLSConfigs = errors.New("nats: multiple tls.Configs not allowed") + ErrNoInfoReceived = errors.New("nats: protocol exception, INFO not received") + ErrReconnectBufExceeded = errors.New("nats: outbound buffer limit exceeded") + ErrInvalidConnection = errors.New("nats: invalid connection") + ErrInvalidMsg = errors.New("nats: invalid message or message nil") + ErrInvalidArg = errors.New("nats: invalid argument") + ErrStaleConnection = errors.New("nats: " + STALE_CONNECTION) +) + +var DefaultOptions = Options{ + AllowReconnect: true, + MaxReconnect: DefaultMaxReconnect, + ReconnectWait: DefaultReconnectWait, + Timeout: DefaultTimeout, + PingInterval: DefaultPingInterval, + MaxPingsOut: DefaultMaxPingOut, + SubChanLen: DefaultMaxChanLen, + ReconnectBufSize: DefaultReconnectBufSize, + Dialer: &net.Dialer{ + Timeout: DefaultTimeout, + }, +} + +// Status represents the state of the connection. +type Status int + +const ( + DISCONNECTED = Status(iota) + CONNECTED + CLOSED + RECONNECTING + CONNECTING +) + +// ConnHandler is used for asynchronous events such as +// disconnected and closed connections. +type ConnHandler func(*Conn) + +// ErrHandler is used to process asynchronous errors encountered +// while processing inbound messages. +type ErrHandler func(*Conn, *Subscription, error) + +// asyncCB is used to preserve order for async callbacks. +type asyncCB func() + +// Option is a function on the options for a connection. +type Option func(*Options) error + +// Options can be used to create a customized connection. +type Options struct { + Url string + Servers []string + NoRandomize bool + Name string + Verbose bool + Pedantic bool + Secure bool + TLSConfig *tls.Config + AllowReconnect bool + MaxReconnect int + ReconnectWait time.Duration + Timeout time.Duration + PingInterval time.Duration // disabled if 0 or negative + MaxPingsOut int + ClosedCB ConnHandler + DisconnectedCB ConnHandler + ReconnectedCB ConnHandler + AsyncErrorCB ErrHandler + + // Size of the backing bufio buffer during reconnect. Once this + // has been exhausted publish operations will error. + ReconnectBufSize int + + // The size of the buffered channel used between the socket + // Go routine and the message delivery for SyncSubscriptions. + // NOTE: This does not affect AsyncSubscriptions which are + // dictated by PendingLimits() + SubChanLen int + + User string + Password string + Token string + + // Dialer allows users setting a custom Dialer + Dialer *net.Dialer +} + +const ( + // Scratch storage for assembling protocol headers + scratchSize = 512 + + // The size of the bufio reader/writer on top of the socket. + defaultBufSize = 32768 + + // The buffered size of the flush "kick" channel + flushChanSize = 1024 + + // Default server pool size + srvPoolSize = 4 + + // Channel size for the async callback handler. + asyncCBChanSize = 32 +) + +// A Conn represents a bare connection to a nats-server. +// It can send and receive []byte payloads. +type Conn struct { + // Keep all members for which we use atomic at the beginning of the + // struct and make sure they are all 64bits (or use padding if necessary). + // atomic.* functions crash on 32bit machines if operand is not aligned + // at 64bit. See https://github.com/golang/go/issues/599 + ssid int64 + + Statistics + mu sync.Mutex + Opts Options + wg sync.WaitGroup + url *url.URL + conn net.Conn + srvPool []*srv + urls map[string]struct{} // Keep track of all known URLs (used by processInfo) + bw *bufio.Writer + pending *bytes.Buffer + fch chan bool + info serverInfo + subs map[int64]*Subscription + mch chan *Msg + ach chan asyncCB + pongs []chan bool + scratch [scratchSize]byte + status Status + err error + ps *parseState + ptmr *time.Timer + pout int +} + +// A Subscription represents interest in a given subject. +type Subscription struct { + mu sync.Mutex + sid int64 + + // Subject that represents this subscription. This can be different + // than the received subject inside a Msg if this is a wildcard. + Subject string + + // Optional queue group name. If present, all subscriptions with the + // same name will form a distributed queue, and each message will + // only be processed by one member of the group. + Queue string + + delivered uint64 + max uint64 + conn *Conn + mcb MsgHandler + mch chan *Msg + closed bool + sc bool + connClosed bool + + // Type of Subscription + typ SubscriptionType + + // Async linked list + pHead *Msg + pTail *Msg + pCond *sync.Cond + + // Pending stats, async subscriptions, high-speed etc. + pMsgs int + pBytes int + pMsgsMax int + pBytesMax int + pMsgsLimit int + pBytesLimit int + dropped int +} + +// Msg is a structure used by Subscribers and PublishMsg(). +type Msg struct { + Subject string + Reply string + Data []byte + Sub *Subscription + next *Msg +} + +// Tracks various stats received and sent on this connection, +// including counts for messages and bytes. +type Statistics struct { + InMsgs uint64 + OutMsgs uint64 + InBytes uint64 + OutBytes uint64 + Reconnects uint64 +} + +// Tracks individual backend servers. +type srv struct { + url *url.URL + didConnect bool + reconnects int + lastAttempt time.Time + isImplicit bool +} + +type serverInfo struct { + Id string `json:"server_id"` + Host string `json:"host"` + Port uint `json:"port"` + Version string `json:"version"` + AuthRequired bool `json:"auth_required"` + TLSRequired bool `json:"tls_required"` + MaxPayload int64 `json:"max_payload"` + ConnectURLs []string `json:"connect_urls,omitempty"` +} + +const ( + // clientProtoZero is the original client protocol from 2009. + // http://nats.io/documentation/internals/nats-protocol/ + clientProtoZero = iota + // clientProtoInfo signals a client can receive more then the original INFO block. + // This can be used to update clients on other cluster members, etc. + clientProtoInfo +) + +type connectInfo struct { + Verbose bool `json:"verbose"` + Pedantic bool `json:"pedantic"` + User string `json:"user,omitempty"` + Pass string `json:"pass,omitempty"` + Token string `json:"auth_token,omitempty"` + TLS bool `json:"tls_required"` + Name string `json:"name"` + Lang string `json:"lang"` + Version string `json:"version"` + Protocol int `json:"protocol"` +} + +// MsgHandler is a callback function that processes messages delivered to +// asynchronous subscribers. +type MsgHandler func(msg *Msg) + +// Connect will attempt to connect to the NATS system. +// The url can contain username/password semantics. e.g. nats://derek:pass@localhost:4222 +// Comma separated arrays are also supported, e.g. urlA, urlB. +// Options start with the defaults but can be overridden. +func Connect(url string, options ...Option) (*Conn, error) { + opts := DefaultOptions + opts.Servers = processUrlString(url) + for _, opt := range options { + if err := opt(&opts); err != nil { + return nil, err + } + } + return opts.Connect() +} + +// Options that can be passed to Connect. + +// Name is an Option to set the client name. +func Name(name string) Option { + return func(o *Options) error { + o.Name = name + return nil + } +} + +// Secure is an Option to enable TLS secure connections that skip server verification by default. +// Pass a TLS Configuration for proper TLS. +func Secure(tls ...*tls.Config) Option { + return func(o *Options) error { + o.Secure = true + // Use of variadic just simplifies testing scenarios. We only take the first one. + // fixme(DLC) - Could panic if more than one. Could also do TLS option. + if len(tls) > 1 { + return ErrMultipleTLSConfigs + } + if len(tls) == 1 { + o.TLSConfig = tls[0] + } + return nil + } +} + +// RootCAs is a helper option to provide the RootCAs pool from a list of filenames. If Secure is +// not already set this will set it as well. +func RootCAs(file ...string) Option { + return func(o *Options) error { + pool := x509.NewCertPool() + for _, f := range file { + rootPEM, err := ioutil.ReadFile(f) + if err != nil || rootPEM == nil { + return fmt.Errorf("nats: error loading or parsing rootCA file: %v", err) + } + ok := pool.AppendCertsFromPEM([]byte(rootPEM)) + if !ok { + return fmt.Errorf("nats: failed to parse root certificate from %q", f) + } + } + if o.TLSConfig == nil { + o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + o.TLSConfig.RootCAs = pool + o.Secure = true + return nil + } +} + +// ClientCert is a helper option to provide the client certificate from a file. If Secure is +// not already set this will set it as well +func ClientCert(certFile, keyFile string) Option { + return func(o *Options) error { + cert, err := tls.LoadX509KeyPair(certFile, keyFile) + if err != nil { + return fmt.Errorf("nats: error loading client certificate: %v", err) + } + cert.Leaf, err = x509.ParseCertificate(cert.Certificate[0]) + if err != nil { + return fmt.Errorf("nats: error parsing client certificate: %v", err) + } + if o.TLSConfig == nil { + o.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + o.TLSConfig.Certificates = []tls.Certificate{cert} + o.Secure = true + return nil + } +} + +// NoReconnect is an Option to turn off reconnect behavior. +func NoReconnect() Option { + return func(o *Options) error { + o.AllowReconnect = false + return nil + } +} + +// DontRandomize is an Option to turn off randomizing the server pool. +func DontRandomize() Option { + return func(o *Options) error { + o.NoRandomize = true + return nil + } +} + +// ReconnectWait is an Option to set the wait time between reconnect attempts. +func ReconnectWait(t time.Duration) Option { + return func(o *Options) error { + o.ReconnectWait = t + return nil + } +} + +// MaxReconnects is an Option to set the maximum number of reconnect attempts. +func MaxReconnects(max int) Option { + return func(o *Options) error { + o.MaxReconnect = max + return nil + } +} + +// Timeout is an Option to set the timeout for Dial on a connection. +func Timeout(t time.Duration) Option { + return func(o *Options) error { + o.Timeout = t + return nil + } +} + +// DisconnectHandler is an Option to set the disconnected handler. +func DisconnectHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.DisconnectedCB = cb + return nil + } +} + +// ReconnectHandler is an Option to set the reconnected handler. +func ReconnectHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.ReconnectedCB = cb + return nil + } +} + +// ClosedHandler is an Option to set the closed handler. +func ClosedHandler(cb ConnHandler) Option { + return func(o *Options) error { + o.ClosedCB = cb + return nil + } +} + +// ErrHandler is an Option to set the async error handler. +func ErrorHandler(cb ErrHandler) Option { + return func(o *Options) error { + o.AsyncErrorCB = cb + return nil + } +} + +// UserInfo is an Option to set the username and password to +// use when not included directly in the URLs. +func UserInfo(user, password string) Option { + return func(o *Options) error { + o.User = user + o.Password = password + return nil + } +} + +// Token is an Option to set the token to use when not included +// directly in the URLs. +func Token(token string) Option { + return func(o *Options) error { + o.Token = token + return nil + } +} + +// Dialer is an Option to set the dialer which will be used when +// attempting to establish a connection. +func Dialer(dialer *net.Dialer) Option { + return func(o *Options) error { + o.Dialer = dialer + return nil + } +} + +// Handler processing + +// SetDisconnectHandler will set the disconnect event handler. +func (nc *Conn) SetDisconnectHandler(dcb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.DisconnectedCB = dcb +} + +// SetReconnectHandler will set the reconnect event handler. +func (nc *Conn) SetReconnectHandler(rcb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.ReconnectedCB = rcb +} + +// SetClosedHandler will set the reconnect event handler. +func (nc *Conn) SetClosedHandler(cb ConnHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.ClosedCB = cb +} + +// SetErrHandler will set the async error handler. +func (nc *Conn) SetErrorHandler(cb ErrHandler) { + if nc == nil { + return + } + nc.mu.Lock() + defer nc.mu.Unlock() + nc.Opts.AsyncErrorCB = cb +} + +// Process the url string argument to Connect. Return an array of +// urls, even if only one. +func processUrlString(url string) []string { + urls := strings.Split(url, ",") + for i, s := range urls { + urls[i] = strings.TrimSpace(s) + } + return urls +} + +// Connect will attempt to connect to a NATS server with multiple options. +func (o Options) Connect() (*Conn, error) { + nc := &Conn{Opts: o} + + // Some default options processing. + if nc.Opts.MaxPingsOut == 0 { + nc.Opts.MaxPingsOut = DefaultMaxPingOut + } + // Allow old default for channel length to work correctly. + if nc.Opts.SubChanLen == 0 { + nc.Opts.SubChanLen = DefaultMaxChanLen + } + // Default ReconnectBufSize + if nc.Opts.ReconnectBufSize == 0 { + nc.Opts.ReconnectBufSize = DefaultReconnectBufSize + } + // Ensure that Timeout is not 0 + if nc.Opts.Timeout == 0 { + nc.Opts.Timeout = DefaultTimeout + } + + // Allow custom Dialer for connecting using DialTimeout by default + if nc.Opts.Dialer == nil { + nc.Opts.Dialer = &net.Dialer{ + Timeout: nc.Opts.Timeout, + } + } + + if err := nc.setupServerPool(); err != nil { + return nil, err + } + + // Create the async callback channel. + nc.ach = make(chan asyncCB, asyncCBChanSize) + + if err := nc.connect(); err != nil { + return nil, err + } + + // Spin up the async cb dispatcher on success + go nc.asyncDispatch() + + return nc, nil +} + +const ( + _CRLF_ = "\r\n" + _EMPTY_ = "" + _SPC_ = " " + _PUB_P_ = "PUB " +) + +const ( + _OK_OP_ = "+OK" + _ERR_OP_ = "-ERR" + _MSG_OP_ = "MSG" + _PING_OP_ = "PING" + _PONG_OP_ = "PONG" + _INFO_OP_ = "INFO" +) + +const ( + conProto = "CONNECT %s" + _CRLF_ + pingProto = "PING" + _CRLF_ + pongProto = "PONG" + _CRLF_ + pubProto = "PUB %s %s %d" + _CRLF_ + subProto = "SUB %s %s %d" + _CRLF_ + unsubProto = "UNSUB %d %s" + _CRLF_ + okProto = _OK_OP_ + _CRLF_ +) + +// Return the currently selected server +func (nc *Conn) currentServer() (int, *srv) { + for i, s := range nc.srvPool { + if s == nil { + continue + } + if s.url == nc.url { + return i, s + } + } + return -1, nil +} + +// Pop the current server and put onto the end of the list. Select head of list as long +// as number of reconnect attempts under MaxReconnect. +func (nc *Conn) selectNextServer() (*srv, error) { + i, s := nc.currentServer() + if i < 0 { + return nil, ErrNoServers + } + sp := nc.srvPool + num := len(sp) + copy(sp[i:num-1], sp[i+1:num]) + maxReconnect := nc.Opts.MaxReconnect + if maxReconnect < 0 || s.reconnects < maxReconnect { + nc.srvPool[num-1] = s + } else { + nc.srvPool = sp[0 : num-1] + } + if len(nc.srvPool) <= 0 { + nc.url = nil + return nil, ErrNoServers + } + nc.url = nc.srvPool[0].url + return nc.srvPool[0], nil +} + +// Will assign the correct server to the nc.Url +func (nc *Conn) pickServer() error { + nc.url = nil + if len(nc.srvPool) <= 0 { + return ErrNoServers + } + for _, s := range nc.srvPool { + if s != nil { + nc.url = s.url + return nil + } + } + return ErrNoServers +} + +const tlsScheme = "tls" + +// Create the server pool using the options given. +// We will place a Url option first, followed by any +// Server Options. We will randomize the server pool unlesss +// the NoRandomize flag is set. +func (nc *Conn) setupServerPool() error { + nc.srvPool = make([]*srv, 0, srvPoolSize) + nc.urls = make(map[string]struct{}, srvPoolSize) + + // Create srv objects from each url string in nc.Opts.Servers + // and add them to the pool + for _, urlString := range nc.Opts.Servers { + if err := nc.addURLToPool(urlString, false); err != nil { + return err + } + } + + // Randomize if allowed to + if !nc.Opts.NoRandomize { + nc.shufflePool() + } + + // Normally, if this one is set, Options.Servers should not be, + // but we always allowed that, so continue to do so. + if nc.Opts.Url != _EMPTY_ { + // Add to the end of the array + if err := nc.addURLToPool(nc.Opts.Url, false); err != nil { + return err + } + // Then swap it with first to guarantee that Options.Url is tried first. + last := len(nc.srvPool) - 1 + if last > 0 { + nc.srvPool[0], nc.srvPool[last] = nc.srvPool[last], nc.srvPool[0] + } + } else if len(nc.srvPool) <= 0 { + // Place default URL if pool is empty. + if err := nc.addURLToPool(DefaultURL, false); err != nil { + return err + } + } + + // Check for Scheme hint to move to TLS mode. + for _, srv := range nc.srvPool { + if srv.url.Scheme == tlsScheme { + // FIXME(dlc), this is for all in the pool, should be case by case. + nc.Opts.Secure = true + if nc.Opts.TLSConfig == nil { + nc.Opts.TLSConfig = &tls.Config{MinVersion: tls.VersionTLS12} + } + } + } + + return nc.pickServer() +} + +// addURLToPool adds an entry to the server pool +func (nc *Conn) addURLToPool(sURL string, implicit bool) error { + u, err := url.Parse(sURL) + if err != nil { + return err + } + s := &srv{url: u, isImplicit: implicit} + nc.srvPool = append(nc.srvPool, s) + nc.urls[u.Host] = struct{}{} + return nil +} + +// shufflePool swaps randomly elements in the server pool +func (nc *Conn) shufflePool() { + if len(nc.srvPool) <= 1 { + return + } + source := rand.NewSource(time.Now().UnixNano()) + r := rand.New(source) + for i := range nc.srvPool { + j := r.Intn(i + 1) + nc.srvPool[i], nc.srvPool[j] = nc.srvPool[j], nc.srvPool[i] + } +} + +// createConn will connect to the server and wrap the appropriate +// bufio structures. It will do the right thing when an existing +// connection is in place. +func (nc *Conn) createConn() (err error) { + if nc.Opts.Timeout < 0 { + return ErrBadTimeout + } + if _, cur := nc.currentServer(); cur == nil { + return ErrNoServers + } else { + cur.lastAttempt = time.Now() + } + + dialer := nc.Opts.Dialer + nc.conn, err = dialer.Dial("tcp", nc.url.Host) + if err != nil { + return err + } + + // No clue why, but this stalls and kills performance on Mac (Mavericks). + // https://code.google.com/p/go/issues/detail?id=6930 + //if ip, ok := nc.conn.(*net.TCPConn); ok { + // ip.SetReadBuffer(defaultBufSize) + //} + + if nc.pending != nil && nc.bw != nil { + // Move to pending buffer. + nc.bw.Flush() + } + nc.bw = bufio.NewWriterSize(nc.conn, defaultBufSize) + return nil +} + +// makeTLSConn will wrap an existing Conn using TLS +func (nc *Conn) makeTLSConn() { + // Allow the user to configure their own tls.Config structure, otherwise + // default to InsecureSkipVerify. + // TODO(dlc) - We should make the more secure version the default. + if nc.Opts.TLSConfig != nil { + tlsCopy := util.CloneTLSConfig(nc.Opts.TLSConfig) + // If its blank we will override it with the current host + if tlsCopy.ServerName == _EMPTY_ { + h, _, _ := net.SplitHostPort(nc.url.Host) + tlsCopy.ServerName = h + } + nc.conn = tls.Client(nc.conn, tlsCopy) + } else { + nc.conn = tls.Client(nc.conn, &tls.Config{InsecureSkipVerify: true}) + } + conn := nc.conn.(*tls.Conn) + conn.Handshake() + nc.bw = bufio.NewWriterSize(nc.conn, defaultBufSize) +} + +// waitForExits will wait for all socket watcher Go routines to +// be shutdown before proceeding. +func (nc *Conn) waitForExits() { + // Kick old flusher forcefully. + select { + case nc.fch <- true: + default: + } + + // Wait for any previous go routines. + nc.wg.Wait() +} + +// spinUpGoRoutines will launch the Go routines responsible for +// reading and writing to the socket. This will be launched via a +// go routine itself to release any locks that may be held. +// We also use a WaitGroup to make sure we only start them on a +// reconnect when the previous ones have exited. +func (nc *Conn) spinUpGoRoutines() { + // Make sure everything has exited. + nc.waitForExits() + + // We will wait on both. + nc.wg.Add(2) + + // Spin up the readLoop and the socket flusher. + go nc.readLoop() + go nc.flusher() + + nc.mu.Lock() + if nc.Opts.PingInterval > 0 { + if nc.ptmr == nil { + nc.ptmr = time.AfterFunc(nc.Opts.PingInterval, nc.processPingTimer) + } else { + nc.ptmr.Reset(nc.Opts.PingInterval) + } + } + nc.mu.Unlock() +} + +// Report the connected server's Url +func (nc *Conn) ConnectedUrl() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.url.String() +} + +// Report the connected server's Id +func (nc *Conn) ConnectedServerId() string { + if nc == nil { + return _EMPTY_ + } + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.status != CONNECTED { + return _EMPTY_ + } + return nc.info.Id +} + +// Low level setup for structs, etc +func (nc *Conn) setup() { + nc.subs = make(map[int64]*Subscription) + nc.pongs = make([]chan bool, 0, 8) + + nc.fch = make(chan bool, flushChanSize) + + // Setup scratch outbound buffer for PUB + pub := nc.scratch[:len(_PUB_P_)] + copy(pub, _PUB_P_) +} + +// Process a connected connection and initialize properly. +func (nc *Conn) processConnectInit() error { + + // Set out deadline for the whole connect process + nc.conn.SetDeadline(time.Now().Add(nc.Opts.Timeout)) + defer nc.conn.SetDeadline(time.Time{}) + + // Set our status to connecting. + nc.status = CONNECTING + + // Process the INFO protocol received from the server + err := nc.processExpectedInfo() + if err != nil { + return err + } + + // Send the CONNECT protocol along with the initial PING protocol. + // Wait for the PONG response (or any error that we get from the server). + err = nc.sendConnect() + if err != nil { + return err + } + + // Reset the number of PING sent out + nc.pout = 0 + + go nc.spinUpGoRoutines() + + return nil +} + +// Main connect function. Will connect to the nats-server +func (nc *Conn) connect() error { + var returnedErr error + + // Create actual socket connection + // For first connect we walk all servers in the pool and try + // to connect immediately. + nc.mu.Lock() + // The pool may change inside theloop iteration due to INFO protocol. + for i := 0; i < len(nc.srvPool); i++ { + nc.url = nc.srvPool[i].url + + if err := nc.createConn(); err == nil { + // This was moved out of processConnectInit() because + // that function is now invoked from doReconnect() too. + nc.setup() + + err = nc.processConnectInit() + + if err == nil { + nc.srvPool[i].didConnect = true + nc.srvPool[i].reconnects = 0 + returnedErr = nil + break + } else { + returnedErr = err + nc.mu.Unlock() + nc.close(DISCONNECTED, false) + nc.mu.Lock() + nc.url = nil + } + } else { + // Cancel out default connection refused, will trigger the + // No servers error conditional + if matched, _ := regexp.Match(`connection refused`, []byte(err.Error())); matched { + returnedErr = nil + } + } + } + defer nc.mu.Unlock() + + if returnedErr == nil && nc.status != CONNECTED { + returnedErr = ErrNoServers + } + return returnedErr +} + +// This will check to see if the connection should be +// secure. This can be dictated from either end and should +// only be called after the INIT protocol has been received. +func (nc *Conn) checkForSecure() error { + // Check to see if we need to engage TLS + o := nc.Opts + + // Check for mismatch in setups + if o.Secure && !nc.info.TLSRequired { + return ErrSecureConnWanted + } else if nc.info.TLSRequired && !o.Secure { + return ErrSecureConnRequired + } + + // Need to rewrap with bufio + if o.Secure { + nc.makeTLSConn() + } + return nil +} + +// processExpectedInfo will look for the expected first INFO message +// sent when a connection is established. The lock should be held entering. +func (nc *Conn) processExpectedInfo() error { + + c := &control{} + + // Read the protocol + err := nc.readOp(c) + if err != nil { + return err + } + + // The nats protocol should send INFO first always. + if c.op != _INFO_OP_ { + return ErrNoInfoReceived + } + + // Parse the protocol + if err := nc.processInfo(c.args); err != nil { + return err + } + + err = nc.checkForSecure() + if err != nil { + return err + } + + return nil +} + +// Sends a protocol control message by queuing into the bufio writer +// and kicking the flush Go routine. These writes are protected. +func (nc *Conn) sendProto(proto string) { + nc.mu.Lock() + nc.bw.WriteString(proto) + nc.kickFlusher() + nc.mu.Unlock() +} + +// Generate a connect protocol message, issuing user/password if +// applicable. The lock is assumed to be held upon entering. +func (nc *Conn) connectProto() (string, error) { + o := nc.Opts + var user, pass, token string + u := nc.url.User + if u != nil { + // if no password, assume username is authToken + if _, ok := u.Password(); !ok { + token = u.Username() + } else { + user = u.Username() + pass, _ = u.Password() + } + } else { + // Take from options (pssibly all empty strings) + user = nc.Opts.User + pass = nc.Opts.Password + token = nc.Opts.Token + } + cinfo := connectInfo{o.Verbose, o.Pedantic, + user, pass, token, + o.Secure, o.Name, LangString, Version, clientProtoInfo} + b, err := json.Marshal(cinfo) + if err != nil { + return _EMPTY_, ErrJsonParse + } + return fmt.Sprintf(conProto, b), nil +} + +// normalizeErr removes the prefix -ERR, trim spaces and remove the quotes. +func normalizeErr(line string) string { + s := strings.ToLower(strings.TrimSpace(strings.TrimPrefix(line, _ERR_OP_))) + s = strings.TrimLeft(strings.TrimRight(s, "'"), "'") + return s +} + +// Send a connect protocol message to the server, issue user/password if +// applicable. Will wait for a flush to return from the server for error +// processing. +func (nc *Conn) sendConnect() error { + + // Construct the CONNECT protocol string + cProto, err := nc.connectProto() + if err != nil { + return err + } + + // Write the protocol into the buffer + _, err = nc.bw.WriteString(cProto) + if err != nil { + return err + } + + // Add to the buffer the PING protocol + _, err = nc.bw.WriteString(pingProto) + if err != nil { + return err + } + + // Flush the buffer + err = nc.bw.Flush() + if err != nil { + return err + } + + // Now read the response from the server. + br := bufio.NewReaderSize(nc.conn, defaultBufSize) + line, err := br.ReadString('\n') + if err != nil { + return err + } + + // If opts.Verbose is set, handle +OK + if nc.Opts.Verbose && line == okProto { + // Read the rest now... + line, err = br.ReadString('\n') + if err != nil { + return err + } + } + + // We expect a PONG + if line != pongProto { + // But it could be something else, like -ERR + + // Since we no longer use ReadLine(), trim the trailing "\r\n" + line = strings.TrimRight(line, "\r\n") + + // If it's a server error... + if strings.HasPrefix(line, _ERR_OP_) { + // Remove -ERR, trim spaces and quotes, and convert to lower case. + line = normalizeErr(line) + return errors.New("nats: " + line) + } + + // Notify that we got an unexpected protocol. + return errors.New(fmt.Sprintf("nats: expected '%s', got '%s'", _PONG_OP_, line)) + } + + // This is where we are truly connected. + nc.status = CONNECTED + + return nil +} + +// A control protocol line. +type control struct { + op, args string +} + +// Read a control line and process the intended op. +func (nc *Conn) readOp(c *control) error { + br := bufio.NewReaderSize(nc.conn, defaultBufSize) + line, err := br.ReadString('\n') + if err != nil { + return err + } + parseControl(line, c) + return nil +} + +// Parse a control line from the server. +func parseControl(line string, c *control) { + toks := strings.SplitN(line, _SPC_, 2) + if len(toks) == 1 { + c.op = strings.TrimSpace(toks[0]) + c.args = _EMPTY_ + } else if len(toks) == 2 { + c.op, c.args = strings.TrimSpace(toks[0]), strings.TrimSpace(toks[1]) + } else { + c.op = _EMPTY_ + } +} + +// flushReconnectPending will push the pending items that were +// gathered while we were in a RECONNECTING state to the socket. +func (nc *Conn) flushReconnectPendingItems() { + if nc.pending == nil { + return + } + if nc.pending.Len() > 0 { + nc.bw.Write(nc.pending.Bytes()) + } +} + +// Try to reconnect using the option parameters. +// This function assumes we are allowed to reconnect. +func (nc *Conn) doReconnect() { + // We want to make sure we have the other watchers shutdown properly + // here before we proceed past this point. + nc.waitForExits() + + // FIXME(dlc) - We have an issue here if we have + // outstanding flush points (pongs) and they were not + // sent out, but are still in the pipe. + + // Hold the lock manually and release where needed below, + // can't do defer here. + nc.mu.Lock() + + // Clear any queued pongs, e.g. pending flush calls. + nc.clearPendingFlushCalls() + + // Clear any errors. + nc.err = nil + + // Perform appropriate callback if needed for a disconnect. + if nc.Opts.DisconnectedCB != nil { + nc.ach <- func() { nc.Opts.DisconnectedCB(nc) } + } + + for len(nc.srvPool) > 0 { + cur, err := nc.selectNextServer() + if err != nil { + nc.err = err + break + } + + sleepTime := int64(0) + + // Sleep appropriate amount of time before the + // connection attempt if connecting to same server + // we just got disconnected from.. + if time.Since(cur.lastAttempt) < nc.Opts.ReconnectWait { + sleepTime = int64(nc.Opts.ReconnectWait - time.Since(cur.lastAttempt)) + } + + // On Windows, createConn() will take more than a second when no + // server is running at that address. So it could be that the + // time elapsed between reconnect attempts is always > than + // the set option. Release the lock to give a chance to a parallel + // nc.Close() to break the loop. + nc.mu.Unlock() + if sleepTime <= 0 { + runtime.Gosched() + } else { + time.Sleep(time.Duration(sleepTime)) + } + nc.mu.Lock() + + // Check if we have been closed first. + if nc.isClosed() { + break + } + + // Mark that we tried a reconnect + cur.reconnects++ + + // Try to create a new connection + err = nc.createConn() + + // Not yet connected, retry... + // Continue to hold the lock + if err != nil { + nc.err = nil + continue + } + + // We are reconnected + nc.Reconnects++ + + // Process connect logic + if nc.err = nc.processConnectInit(); nc.err != nil { + nc.status = RECONNECTING + continue + } + + // Clear out server stats for the server we connected to.. + cur.didConnect = true + cur.reconnects = 0 + + // Send existing subscription state + nc.resendSubscriptions() + + // Now send off and clear pending buffer + nc.flushReconnectPendingItems() + + // Flush the buffer + nc.err = nc.bw.Flush() + if nc.err != nil { + nc.status = RECONNECTING + continue + } + + // Done with the pending buffer + nc.pending = nil + + // This is where we are truly connected. + nc.status = CONNECTED + + // Queue up the reconnect callback. + if nc.Opts.ReconnectedCB != nil { + nc.ach <- func() { nc.Opts.ReconnectedCB(nc) } + } + + // Release lock here, we will return below. + nc.mu.Unlock() + + // Make sure to flush everything + nc.Flush() + + return + } + + // Call into close.. We have no servers left.. + if nc.err == nil { + nc.err = ErrNoServers + } + nc.mu.Unlock() + nc.Close() +} + +// processOpErr handles errors from reading or parsing the protocol. +// The lock should not be held entering this function. +func (nc *Conn) processOpErr(err error) { + nc.mu.Lock() + if nc.isConnecting() || nc.isClosed() || nc.isReconnecting() { + nc.mu.Unlock() + return + } + + if nc.Opts.AllowReconnect && nc.status == CONNECTED { + // Set our new status + nc.status = RECONNECTING + if nc.ptmr != nil { + nc.ptmr.Stop() + } + if nc.conn != nil { + nc.bw.Flush() + nc.conn.Close() + nc.conn = nil + } + + // Create a new pending buffer to underpin the bufio Writer while + // we are reconnecting. + nc.pending = &bytes.Buffer{} + nc.bw = bufio.NewWriterSize(nc.pending, nc.Opts.ReconnectBufSize) + + go nc.doReconnect() + nc.mu.Unlock() + return + } + + nc.status = DISCONNECTED + nc.err = err + nc.mu.Unlock() + nc.Close() +} + +// Marker to close the channel to kick out the Go routine. +func (nc *Conn) closeAsyncFunc() asyncCB { + return func() { + nc.mu.Lock() + if nc.ach != nil { + close(nc.ach) + nc.ach = nil + } + nc.mu.Unlock() + } +} + +// asyncDispatch is responsible for calling any async callbacks +func (nc *Conn) asyncDispatch() { + // snapshot since they can change from underneath of us. + nc.mu.Lock() + ach := nc.ach + nc.mu.Unlock() + + // Loop on the channel and process async callbacks. + for { + if f, ok := <-ach; !ok { + return + } else { + f() + } + } +} + +// readLoop() will sit on the socket reading and processing the +// protocol from the server. It will dispatch appropriately based +// on the op type. +func (nc *Conn) readLoop() { + // Release the wait group on exit + defer nc.wg.Done() + + // Create a parseState if needed. + nc.mu.Lock() + if nc.ps == nil { + nc.ps = &parseState{} + } + nc.mu.Unlock() + + // Stack based buffer. + b := make([]byte, defaultBufSize) + + for { + // FIXME(dlc): RWLock here? + nc.mu.Lock() + sb := nc.isClosed() || nc.isReconnecting() + if sb { + nc.ps = &parseState{} + } + conn := nc.conn + nc.mu.Unlock() + + if sb || conn == nil { + break + } + + n, err := conn.Read(b) + if err != nil { + nc.processOpErr(err) + break + } + + if err := nc.parse(b[:n]); err != nil { + nc.processOpErr(err) + break + } + } + // Clear the parseState here.. + nc.mu.Lock() + nc.ps = nil + nc.mu.Unlock() +} + +// waitForMsgs waits on the conditional shared with readLoop and processMsg. +// It is used to deliver messages to asynchronous subscribers. +func (nc *Conn) waitForMsgs(s *Subscription) { + var closed bool + var delivered, max uint64 + + for { + s.mu.Lock() + if s.pHead == nil && !s.closed { + s.pCond.Wait() + } + // Pop the msg off the list + m := s.pHead + if m != nil { + s.pHead = m.next + if s.pHead == nil { + s.pTail = nil + } + s.pMsgs-- + s.pBytes -= len(m.Data) + } + mcb := s.mcb + max = s.max + closed = s.closed + if !s.closed { + s.delivered++ + delivered = s.delivered + } + s.mu.Unlock() + + if closed { + break + } + + // Deliver the message. + if m != nil && (max == 0 || delivered <= max) { + mcb(m) + } + // If we have hit the max for delivered msgs, remove sub. + if max > 0 && delivered >= max { + nc.mu.Lock() + nc.removeSub(s) + nc.mu.Unlock() + break + } + } +} + +// processMsg is called by parse and will place the msg on the +// appropriate channel/pending queue for processing. If the channel is full, +// or the pending queue is over the pending limits, the connection is +// considered a slow consumer. +func (nc *Conn) processMsg(data []byte) { + // Lock from here on out. + nc.mu.Lock() + + // Stats + nc.InMsgs++ + nc.InBytes += uint64(len(data)) + + sub := nc.subs[nc.ps.ma.sid] + if sub == nil { + nc.mu.Unlock() + return + } + + // Copy them into string + subj := string(nc.ps.ma.subject) + reply := string(nc.ps.ma.reply) + + // Doing message create outside of the sub's lock to reduce contention. + // It's possible that we end-up not using the message, but that's ok. + + // FIXME(dlc): Need to copy, should/can do COW? + msgPayload := make([]byte, len(data)) + copy(msgPayload, data) + + // FIXME(dlc): Should we recycle these containers? + m := &Msg{Data: msgPayload, Subject: subj, Reply: reply, Sub: sub} + + sub.mu.Lock() + + // Subscription internal stats (applicable only for non ChanSubscription's) + if sub.typ != ChanSubscription { + sub.pMsgs++ + if sub.pMsgs > sub.pMsgsMax { + sub.pMsgsMax = sub.pMsgs + } + sub.pBytes += len(m.Data) + if sub.pBytes > sub.pBytesMax { + sub.pBytesMax = sub.pBytes + } + + // Check for a Slow Consumer + if (sub.pMsgsLimit > 0 && sub.pMsgs > sub.pMsgsLimit) || + (sub.pBytesLimit > 0 && sub.pBytes > sub.pBytesLimit) { + goto slowConsumer + } + } + + // We have two modes of delivery. One is the channel, used by channel + // subscribers and syncSubscribers, the other is a linked list for async. + if sub.mch != nil { + select { + case sub.mch <- m: + default: + goto slowConsumer + } + } else { + // Push onto the async pList + if sub.pHead == nil { + sub.pHead = m + sub.pTail = m + sub.pCond.Signal() + } else { + sub.pTail.next = m + sub.pTail = m + } + } + + // Clear SlowConsumer status. + sub.sc = false + + sub.mu.Unlock() + nc.mu.Unlock() + return + +slowConsumer: + sub.dropped++ + nc.processSlowConsumer(sub) + // Undo stats from above + if sub.typ != ChanSubscription { + sub.pMsgs-- + sub.pBytes -= len(m.Data) + } + sub.mu.Unlock() + nc.mu.Unlock() + return +} + +// processSlowConsumer will set SlowConsumer state and fire the +// async error handler if registered. +func (nc *Conn) processSlowConsumer(s *Subscription) { + nc.err = ErrSlowConsumer + if nc.Opts.AsyncErrorCB != nil && !s.sc { + nc.ach <- func() { nc.Opts.AsyncErrorCB(nc, s, ErrSlowConsumer) } + } + s.sc = true +} + +// processPermissionsViolation is called when the server signals a subject +// permissions violation on either publish or subscribe. +func (nc *Conn) processPermissionsViolation(err string) { + nc.err = errors.New("nats: " + err) + if nc.Opts.AsyncErrorCB != nil { + nc.ach <- func() { nc.Opts.AsyncErrorCB(nc, nil, nc.err) } + } +} + +// flusher is a separate Go routine that will process flush requests for the write +// bufio. This allows coalescing of writes to the underlying socket. +func (nc *Conn) flusher() { + // Release the wait group + defer nc.wg.Done() + + // snapshot the bw and conn since they can change from underneath of us. + nc.mu.Lock() + bw := nc.bw + conn := nc.conn + fch := nc.fch + nc.mu.Unlock() + + if conn == nil || bw == nil { + return + } + + for { + if _, ok := <-fch; !ok { + return + } + nc.mu.Lock() + + // Check to see if we should bail out. + if !nc.isConnected() || nc.isConnecting() || bw != nc.bw || conn != nc.conn { + nc.mu.Unlock() + return + } + if bw.Buffered() > 0 { + if err := bw.Flush(); err != nil { + if nc.err == nil { + nc.err = err + } + } + } + nc.mu.Unlock() + } +} + +// processPing will send an immediate pong protocol response to the +// server. The server uses this mechanism to detect dead clients. +func (nc *Conn) processPing() { + nc.sendProto(pongProto) +} + +// processPong is used to process responses to the client's ping +// messages. We use pings for the flush mechanism as well. +func (nc *Conn) processPong() { + var ch chan bool + + nc.mu.Lock() + if len(nc.pongs) > 0 { + ch = nc.pongs[0] + nc.pongs = nc.pongs[1:] + } + nc.pout = 0 + nc.mu.Unlock() + if ch != nil { + ch <- true + } +} + +// processOK is a placeholder for processing OK messages. +func (nc *Conn) processOK() { + // do nothing +} + +// processInfo is used to parse the info messages sent +// from the server. +// This function may update the server pool. +func (nc *Conn) processInfo(info string) error { + if info == _EMPTY_ { + return nil + } + if err := json.Unmarshal([]byte(info), &nc.info); err != nil { + return err + } + updated := false + urls := nc.info.ConnectURLs + for _, curl := range urls { + if _, present := nc.urls[curl]; !present { + if err := nc.addURLToPool(fmt.Sprintf("nats://%s", curl), true); err != nil { + continue + } + updated = true + } + } + if updated && !nc.Opts.NoRandomize { + nc.shufflePool() + } + return nil +} + +// processAsyncInfo does the same than processInfo, but is called +// from the parser. Calls processInfo under connection's lock +// protection. +func (nc *Conn) processAsyncInfo(info []byte) { + nc.mu.Lock() + // Ignore errors, we will simply not update the server pool... + nc.processInfo(string(info)) + nc.mu.Unlock() +} + +// LastError reports the last error encountered via the connection. +// It can be used reliably within ClosedCB in order to find out reason +// why connection was closed for example. +func (nc *Conn) LastError() error { + if nc == nil { + return ErrInvalidConnection + } + nc.mu.Lock() + err := nc.err + nc.mu.Unlock() + return err +} + +// processErr processes any error messages from the server and +// sets the connection's lastError. +func (nc *Conn) processErr(e string) { + // Trim, remove quotes, convert to lower case. + e = normalizeErr(e) + + // FIXME(dlc) - process Slow Consumer signals special. + if e == STALE_CONNECTION { + nc.processOpErr(ErrStaleConnection) + } else if strings.HasPrefix(e, PERMISSIONS_ERR) { + nc.processPermissionsViolation(e) + } else { + nc.mu.Lock() + nc.err = errors.New("nats: " + e) + nc.mu.Unlock() + nc.Close() + } +} + +// kickFlusher will send a bool on a channel to kick the +// flush Go routine to flush data to the server. +func (nc *Conn) kickFlusher() { + if nc.bw != nil { + select { + case nc.fch <- true: + default: + } + } +} + +// Publish publishes the data argument to the given subject. The data +// argument is left untouched and needs to be correctly interpreted on +// the receiver. +func (nc *Conn) Publish(subj string, data []byte) error { + return nc.publish(subj, _EMPTY_, data) +} + +// PublishMsg publishes the Msg structure, which includes the +// Subject, an optional Reply and an optional Data field. +func (nc *Conn) PublishMsg(m *Msg) error { + if m == nil { + return ErrInvalidMsg + } + return nc.publish(m.Subject, m.Reply, m.Data) +} + +// PublishRequest will perform a Publish() excpecting a response on the +// reply subject. Use Request() for automatically waiting for a response +// inline. +func (nc *Conn) PublishRequest(subj, reply string, data []byte) error { + return nc.publish(subj, reply, data) +} + +// Used for handrolled itoa +const digits = "0123456789" + +// publish is the internal function to publish messages to a nats-server. +// Sends a protocol data message by queuing into the bufio writer +// and kicking the flush go routine. These writes should be protected. +func (nc *Conn) publish(subj, reply string, data []byte) error { + if nc == nil { + return ErrInvalidConnection + } + if subj == "" { + return ErrBadSubject + } + nc.mu.Lock() + + // Proactively reject payloads over the threshold set by server. + var msgSize int64 + msgSize = int64(len(data)) + if msgSize > nc.info.MaxPayload { + nc.mu.Unlock() + return ErrMaxPayload + } + + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + + // Check if we are reconnecting, and if so check if + // we have exceeded our reconnect outbound buffer limits. + if nc.isReconnecting() { + // Flush to underlying buffer. + nc.bw.Flush() + // Check if we are over + if nc.pending.Len() >= nc.Opts.ReconnectBufSize { + nc.mu.Unlock() + return ErrReconnectBufExceeded + } + } + + msgh := nc.scratch[:len(_PUB_P_)] + msgh = append(msgh, subj...) + msgh = append(msgh, ' ') + if reply != "" { + msgh = append(msgh, reply...) + msgh = append(msgh, ' ') + } + + // We could be smarter here, but simple loop is ok, + // just avoid strconv in fast path + // FIXME(dlc) - Find a better way here. + // msgh = strconv.AppendInt(msgh, int64(len(data)), 10) + + var b [12]byte + var i = len(b) + if len(data) > 0 { + for l := len(data); l > 0; l /= 10 { + i -= 1 + b[i] = digits[l%10] + } + } else { + i -= 1 + b[i] = digits[0] + } + + msgh = append(msgh, b[i:]...) + msgh = append(msgh, _CRLF_...) + + // FIXME, do deadlines here + _, err := nc.bw.Write(msgh) + if err == nil { + _, err = nc.bw.Write(data) + } + if err == nil { + _, err = nc.bw.WriteString(_CRLF_) + } + if err != nil { + nc.mu.Unlock() + return err + } + + nc.OutMsgs++ + nc.OutBytes += uint64(len(data)) + + if len(nc.fch) == 0 { + nc.kickFlusher() + } + nc.mu.Unlock() + return nil +} + +// Request will create an Inbox and perform a Request() call +// with the Inbox reply and return the first reply received. +// This is optimized for the case of multiple responses. +func (nc *Conn) Request(subj string, data []byte, timeout time.Duration) (*Msg, error) { + inbox := NewInbox() + ch := make(chan *Msg, RequestChanLen) + + s, err := nc.subscribe(inbox, _EMPTY_, nil, ch) + if err != nil { + return nil, err + } + s.AutoUnsubscribe(1) + defer s.Unsubscribe() + + err = nc.PublishRequest(subj, inbox, data) + if err != nil { + return nil, err + } + return s.NextMsg(timeout) +} + +// InboxPrefix is the prefix for all inbox subjects. +const InboxPrefix = "_INBOX." +const inboxPrefixLen = len(InboxPrefix) + +// NewInbox will return an inbox string which can be used for directed replies from +// subscribers. These are guaranteed to be unique, but can be shared and subscribed +// to by others. +func NewInbox() string { + var b [inboxPrefixLen + 22]byte + pres := b[:inboxPrefixLen] + copy(pres, InboxPrefix) + ns := b[inboxPrefixLen:] + copy(ns, nuid.Next()) + return string(b[:]) +} + +// Subscribe will express interest in the given subject. The subject +// can have wildcards (partial:*, full:>). Messages will be delivered +// to the associated MsgHandler. If no MsgHandler is given, the +// subscription is a synchronous subscription and can be polled via +// Subscription.NextMsg(). +func (nc *Conn) Subscribe(subj string, cb MsgHandler) (*Subscription, error) { + return nc.subscribe(subj, _EMPTY_, cb, nil) +} + +// ChanSubscribe will place all messages received on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +func (nc *Conn) ChanSubscribe(subj string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, _EMPTY_, nil, ch) +} + +// ChanQueueSubscribe will place all messages received on the channel. +// You should not close the channel until sub.Unsubscribe() has been called. +func (nc *Conn) ChanQueueSubscribe(subj, group string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, group, nil, ch) +} + +// SubscribeSync is syntactic sugar for Subscribe(subject, nil). +func (nc *Conn) SubscribeSync(subj string) (*Subscription, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + mch := make(chan *Msg, nc.Opts.SubChanLen) + s, e := nc.subscribe(subj, _EMPTY_, nil, mch) + if s != nil { + s.typ = SyncSubscription + } + return s, e +} + +// QueueSubscribe creates an asynchronous queue subscriber on the given subject. +// All subscribers with the same queue name will form the queue group and +// only one member of the group will be selected to receive any given +// message asynchronously. +func (nc *Conn) QueueSubscribe(subj, queue string, cb MsgHandler) (*Subscription, error) { + return nc.subscribe(subj, queue, cb, nil) +} + +// QueueSubscribeSync creates a synchronous queue subscriber on the given +// subject. All subscribers with the same queue name will form the queue +// group and only one member of the group will be selected to receive any +// given message synchronously. +func (nc *Conn) QueueSubscribeSync(subj, queue string) (*Subscription, error) { + mch := make(chan *Msg, nc.Opts.SubChanLen) + s, e := nc.subscribe(subj, queue, nil, mch) + if s != nil { + s.typ = SyncSubscription + } + return s, e +} + +// QueueSubscribeSyncWithChan is syntactic sugar for ChanQueueSubscribe(subject, group, ch). +func (nc *Conn) QueueSubscribeSyncWithChan(subj, queue string, ch chan *Msg) (*Subscription, error) { + return nc.subscribe(subj, queue, nil, ch) +} + +// subscribe is the internal subscribe function that indicates interest in a subject. +func (nc *Conn) subscribe(subj, queue string, cb MsgHandler, ch chan *Msg) (*Subscription, error) { + if nc == nil { + return nil, ErrInvalidConnection + } + nc.mu.Lock() + // ok here, but defer is generally expensive + defer nc.mu.Unlock() + defer nc.kickFlusher() + + // Check for some error conditions. + if nc.isClosed() { + return nil, ErrConnectionClosed + } + + if cb == nil && ch == nil { + return nil, ErrBadSubscription + } + + sub := &Subscription{Subject: subj, Queue: queue, mcb: cb, conn: nc} + // Set pending limits. + sub.pMsgsLimit = DefaultSubPendingMsgsLimit + sub.pBytesLimit = DefaultSubPendingBytesLimit + + // If we have an async callback, start up a sub specific + // Go routine to deliver the messages. + if cb != nil { + sub.typ = AsyncSubscription + sub.pCond = sync.NewCond(&sub.mu) + go nc.waitForMsgs(sub) + } else { + sub.typ = ChanSubscription + sub.mch = ch + } + + sub.sid = atomic.AddInt64(&nc.ssid, 1) + nc.subs[sub.sid] = sub + + // We will send these for all subs when we reconnect + // so that we can suppress here. + if !nc.isReconnecting() { + nc.bw.WriteString(fmt.Sprintf(subProto, subj, queue, sub.sid)) + } + return sub, nil +} + +// Lock for nc should be held here upon entry +func (nc *Conn) removeSub(s *Subscription) { + delete(nc.subs, s.sid) + s.mu.Lock() + defer s.mu.Unlock() + // Release callers on NextMsg for SyncSubscription only + if s.mch != nil && s.typ == SyncSubscription { + close(s.mch) + } + s.mch = nil + + // Mark as invalid + s.conn = nil + s.closed = true + if s.pCond != nil { + s.pCond.Broadcast() + } +} + +// SubscriptionType is the type of the Subscription. +type SubscriptionType int + +// The different types of subscription types. +const ( + AsyncSubscription = SubscriptionType(iota) + SyncSubscription + ChanSubscription + NilSubscription +) + +// Type returns the type of Subscription. +func (s *Subscription) Type() SubscriptionType { + if s == nil { + return NilSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + return s.typ +} + +// IsValid returns a boolean indicating whether the subscription +// is still active. This will return false if the subscription has +// already been closed. +func (s *Subscription) IsValid() bool { + if s == nil { + return false + } + s.mu.Lock() + defer s.mu.Unlock() + return s.conn != nil +} + +// Unsubscribe will remove interest in the given subject. +func (s *Subscription) Unsubscribe() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + return conn.unsubscribe(s, 0) +} + +// AutoUnsubscribe will issue an automatic Unsubscribe that is +// processed by the server when max messages have been received. +// This can be useful when sending a request to an unknown number +// of subscribers. Request() uses this functionality. +func (s *Subscription) AutoUnsubscribe(max int) error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + conn := s.conn + s.mu.Unlock() + if conn == nil { + return ErrBadSubscription + } + return conn.unsubscribe(s, max) +} + +// unsubscribe performs the low level unsubscribe to the server. +// Use Subscription.Unsubscribe() +func (nc *Conn) unsubscribe(sub *Subscription, max int) error { + nc.mu.Lock() + // ok here, but defer is expensive + defer nc.mu.Unlock() + defer nc.kickFlusher() + + if nc.isClosed() { + return ErrConnectionClosed + } + + s := nc.subs[sub.sid] + // Already unsubscribed + if s == nil { + return nil + } + + maxStr := _EMPTY_ + if max > 0 { + s.max = uint64(max) + maxStr = strconv.Itoa(max) + } else { + nc.removeSub(s) + } + // We will send these for all subs when we reconnect + // so that we can suppress here. + if !nc.isReconnecting() { + nc.bw.WriteString(fmt.Sprintf(unsubProto, s.sid, maxStr)) + } + return nil +} + +// NextMsg() will return the next message available to a synchronous subscriber +// or block until one is available. A timeout can be used to return when no +// message has been delivered. +func (s *Subscription) NextMsg(timeout time.Duration) (*Msg, error) { + if s == nil { + return nil, ErrBadSubscription + } + s.mu.Lock() + if s.connClosed { + s.mu.Unlock() + return nil, ErrConnectionClosed + } + if s.mch == nil { + if s.max > 0 && s.delivered >= s.max { + s.mu.Unlock() + return nil, ErrMaxMessages + } else if s.closed { + s.mu.Unlock() + return nil, ErrBadSubscription + } + } + if s.mcb != nil { + s.mu.Unlock() + return nil, ErrSyncSubRequired + } + if s.sc { + s.sc = false + s.mu.Unlock() + return nil, ErrSlowConsumer + } + + // snapshot + nc := s.conn + mch := s.mch + max := s.max + s.mu.Unlock() + + var ok bool + var msg *Msg + + t := time.NewTimer(timeout) + defer t.Stop() + + select { + case msg, ok = <-mch: + if !ok { + return nil, ErrConnectionClosed + } + // Update some stats. + s.mu.Lock() + s.delivered++ + delivered := s.delivered + if s.typ == SyncSubscription { + s.pMsgs-- + s.pBytes -= len(msg.Data) + } + s.mu.Unlock() + + if max > 0 { + if delivered > max { + return nil, ErrMaxMessages + } + // Remove subscription if we have reached max. + if delivered == max { + nc.mu.Lock() + nc.removeSub(s) + nc.mu.Unlock() + } + } + + case <-t.C: + return nil, ErrTimeout + } + + return msg, nil +} + +// Queued returns the number of queued messages in the client for this subscription. +// DEPRECATED: Use Pending() +func (s *Subscription) QueuedMsgs() (int, error) { + m, _, err := s.Pending() + return int(m), err +} + +// Pending returns the number of queued messages and queued bytes in the client for this subscription. +func (s *Subscription) Pending() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgs, s.pBytes, nil +} + +// MaxPending returns the maximum number of queued messages and queued bytes seen so far. +func (s *Subscription) MaxPending() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgsMax, s.pBytesMax, nil +} + +// ClearMaxPending resets the maximums seen so far. +func (s *Subscription) ClearMaxPending() error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return ErrBadSubscription + } + if s.typ == ChanSubscription { + return ErrTypeSubscription + } + s.pMsgsMax, s.pBytesMax = 0, 0 + return nil +} + +// Pending Limits +const ( + DefaultSubPendingMsgsLimit = 65536 + DefaultSubPendingBytesLimit = 65536 * 1024 +) + +// PendingLimits returns the current limits for this subscription. +// If no error is returned, a negative value indicates that the +// given metric is not limited. +func (s *Subscription) PendingLimits() (int, int, error) { + if s == nil { + return -1, -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, -1, ErrBadSubscription + } + if s.typ == ChanSubscription { + return -1, -1, ErrTypeSubscription + } + return s.pMsgsLimit, s.pBytesLimit, nil +} + +// SetPendingLimits sets the limits for pending msgs and bytes for this subscription. +// Zero is not allowed. Any negative value means that the given metric is not limited. +func (s *Subscription) SetPendingLimits(msgLimit, bytesLimit int) error { + if s == nil { + return ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return ErrBadSubscription + } + if s.typ == ChanSubscription { + return ErrTypeSubscription + } + if msgLimit == 0 || bytesLimit == 0 { + return ErrInvalidArg + } + s.pMsgsLimit, s.pBytesLimit = msgLimit, bytesLimit + return nil +} + +// Delivered returns the number of delivered messages for this subscription. +func (s *Subscription) Delivered() (int64, error) { + if s == nil { + return -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, ErrBadSubscription + } + return int64(s.delivered), nil +} + +// Dropped returns the number of known dropped messages for this subscription. +// This will correspond to messages dropped by violations of PendingLimits. If +// the server declares the connection a SlowConsumer, this number may not be +// valid. +func (s *Subscription) Dropped() (int, error) { + if s == nil { + return -1, ErrBadSubscription + } + s.mu.Lock() + defer s.mu.Unlock() + if s.conn == nil { + return -1, ErrBadSubscription + } + return s.dropped, nil +} + +// FIXME: This is a hack +// removeFlushEntry is needed when we need to discard queued up responses +// for our pings as part of a flush call. This happens when we have a flush +// call outstanding and we call close. +func (nc *Conn) removeFlushEntry(ch chan bool) bool { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.pongs == nil { + return false + } + for i, c := range nc.pongs { + if c == ch { + nc.pongs[i] = nil + return true + } + } + return false +} + +// The lock must be held entering this function. +func (nc *Conn) sendPing(ch chan bool) { + nc.pongs = append(nc.pongs, ch) + nc.bw.WriteString(pingProto) + // Flush in place. + nc.bw.Flush() +} + +// This will fire periodically and send a client origin +// ping to the server. Will also check that we have received +// responses from the server. +func (nc *Conn) processPingTimer() { + nc.mu.Lock() + + if nc.status != CONNECTED { + nc.mu.Unlock() + return + } + + // Check for violation + nc.pout++ + if nc.pout > nc.Opts.MaxPingsOut { + nc.mu.Unlock() + nc.processOpErr(ErrStaleConnection) + return + } + + nc.sendPing(nil) + nc.ptmr.Reset(nc.Opts.PingInterval) + nc.mu.Unlock() +} + +// FlushTimeout allows a Flush operation to have an associated timeout. +func (nc *Conn) FlushTimeout(timeout time.Duration) (err error) { + if nc == nil { + return ErrInvalidConnection + } + if timeout <= 0 { + return ErrBadTimeout + } + + nc.mu.Lock() + if nc.isClosed() { + nc.mu.Unlock() + return ErrConnectionClosed + } + t := time.NewTimer(timeout) + defer t.Stop() + + ch := make(chan bool) // FIXME: Inefficient? + nc.sendPing(ch) + nc.mu.Unlock() + + select { + case _, ok := <-ch: + if !ok { + err = ErrConnectionClosed + } else { + close(ch) + } + case <-t.C: + err = ErrTimeout + } + + if err != nil { + nc.removeFlushEntry(ch) + } + return +} + +// Flush will perform a round trip to the server and return when it +// receives the internal reply. +func (nc *Conn) Flush() error { + return nc.FlushTimeout(60 * time.Second) +} + +// Buffered will return the number of bytes buffered to be sent to the server. +// FIXME(dlc) take into account disconnected state. +func (nc *Conn) Buffered() (int, error) { + nc.mu.Lock() + defer nc.mu.Unlock() + if nc.isClosed() || nc.bw == nil { + return -1, ErrConnectionClosed + } + return nc.bw.Buffered(), nil +} + +// resendSubscriptions will send our subscription state back to the +// server. Used in reconnects +func (nc *Conn) resendSubscriptions() { + for _, s := range nc.subs { + adjustedMax := uint64(0) + s.mu.Lock() + if s.max > 0 { + if s.delivered < s.max { + adjustedMax = s.max - s.delivered + } + + // adjustedMax could be 0 here if the number of delivered msgs + // reached the max, if so unsubscribe. + if adjustedMax == 0 { + s.mu.Unlock() + nc.bw.WriteString(fmt.Sprintf(unsubProto, s.sid, _EMPTY_)) + continue + } + } + s.mu.Unlock() + + nc.bw.WriteString(fmt.Sprintf(subProto, s.Subject, s.Queue, s.sid)) + if adjustedMax > 0 { + maxStr := strconv.Itoa(int(adjustedMax)) + nc.bw.WriteString(fmt.Sprintf(unsubProto, s.sid, maxStr)) + } + } +} + +// This will clear any pending flush calls and release pending calls. +// Lock is assumed to be held by the caller. +func (nc *Conn) clearPendingFlushCalls() { + // Clear any queued pongs, e.g. pending flush calls. + for _, ch := range nc.pongs { + if ch != nil { + close(ch) + } + } + nc.pongs = nil +} + +// Low level close call that will do correct cleanup and set +// desired status. Also controls whether user defined callbacks +// will be triggered. The lock should not be held entering this +// function. This function will handle the locking manually. +func (nc *Conn) close(status Status, doCBs bool) { + nc.mu.Lock() + if nc.isClosed() { + nc.status = status + nc.mu.Unlock() + return + } + nc.status = CLOSED + + // Kick the Go routines so they fall out. + nc.kickFlusher() + nc.mu.Unlock() + + nc.mu.Lock() + + // Clear any queued pongs, e.g. pending flush calls. + nc.clearPendingFlushCalls() + + if nc.ptmr != nil { + nc.ptmr.Stop() + } + + // Go ahead and make sure we have flushed the outbound + if nc.conn != nil { + nc.bw.Flush() + defer nc.conn.Close() + } + + // Close sync subscriber channels and release any + // pending NextMsg() calls. + for _, s := range nc.subs { + s.mu.Lock() + + // Release callers on NextMsg for SyncSubscription only + if s.mch != nil && s.typ == SyncSubscription { + close(s.mch) + } + s.mch = nil + // Mark as invalid, for signalling to deliverMsgs + s.closed = true + // Mark connection closed in subscription + s.connClosed = true + // If we have an async subscription, signals it to exit + if s.typ == AsyncSubscription && s.pCond != nil { + s.pCond.Signal() + } + + s.mu.Unlock() + } + nc.subs = nil + + // Perform appropriate callback if needed for a disconnect. + if doCBs { + if nc.Opts.DisconnectedCB != nil && nc.conn != nil { + nc.ach <- func() { nc.Opts.DisconnectedCB(nc) } + } + if nc.Opts.ClosedCB != nil { + nc.ach <- func() { nc.Opts.ClosedCB(nc) } + } + nc.ach <- nc.closeAsyncFunc() + } + nc.status = status + nc.mu.Unlock() +} + +// Close will close the connection to the server. This call will release +// all blocking calls, such as Flush() and NextMsg() +func (nc *Conn) Close() { + nc.close(CLOSED, true) +} + +// IsClosed tests if a Conn has been closed. +func (nc *Conn) IsClosed() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isClosed() +} + +// IsReconnecting tests if a Conn is reconnecting. +func (nc *Conn) IsReconnecting() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isReconnecting() +} + +// IsConnected tests if a Conn is connected. +func (nc *Conn) IsConnected() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.isConnected() +} + +// caller must lock +func (nc *Conn) getServers(implicitOnly bool) []string { + poolSize := len(nc.srvPool) + var servers = make([]string, 0) + for i := 0; i < poolSize; i++ { + if implicitOnly && !nc.srvPool[i].isImplicit { + continue + } + url := nc.srvPool[i].url + servers = append(servers, fmt.Sprintf("%s://%s", url.Scheme, url.Host)) + } + return servers +} + +// Servers returns the list of known server urls, including additional +// servers discovered after a connection has been established. If +// authentication is enabled, use UserInfo or Token when connecting with +// these urls. +func (nc *Conn) Servers() []string { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.getServers(false) +} + +// DiscoveredServers returns only the server urls that have been discovered +// after a connection has been established. If authentication is enabled, +// use UserInfo or Token when connecting with these urls. +func (nc *Conn) DiscoveredServers() []string { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.getServers(true) +} + +// Status returns the current state of the connection. +func (nc *Conn) Status() Status { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.status +} + +// Test if Conn has been closed Lock is assumed held. +func (nc *Conn) isClosed() bool { + return nc.status == CLOSED +} + +// Test if Conn is in the process of connecting +func (nc *Conn) isConnecting() bool { + return nc.status == CONNECTING +} + +// Test if Conn is being reconnected. +func (nc *Conn) isReconnecting() bool { + return nc.status == RECONNECTING +} + +// Test if Conn is connected or connecting. +func (nc *Conn) isConnected() bool { + return nc.status == CONNECTED +} + +// Stats will return a race safe copy of the Statistics section for the connection. +func (nc *Conn) Stats() Statistics { + nc.mu.Lock() + defer nc.mu.Unlock() + stats := nc.Statistics + return stats +} + +// MaxPayload returns the size limit that a message payload can have. +// This is set by the server configuration and delivered to the client +// upon connect. +func (nc *Conn) MaxPayload() int64 { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.MaxPayload +} + +// AuthRequired will return if the connected server requires authorization. +func (nc *Conn) AuthRequired() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.AuthRequired +} + +// TLSRequired will return if the connected server requires TLS connections. +func (nc *Conn) TLSRequired() bool { + nc.mu.Lock() + defer nc.mu.Unlock() + return nc.info.TLSRequired +} diff --git a/vendor/github.com/nats-io/go-nats/netchan.go b/vendor/github.com/nats-io/go-nats/netchan.go new file mode 100644 index 000000000..337674e04 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/netchan.go @@ -0,0 +1,100 @@ +// Copyright 2013-2014 Apcera Inc. All rights reserved. + +package nats + +import ( + "errors" + "reflect" +) + +// This allows the functionality for network channels by binding send and receive Go chans +// to subjects and optionally queue groups. +// Data will be encoded and decoded via the EncodedConn and its associated encoders. + +// BindSendChan binds a channel for send operations to NATS. +func (c *EncodedConn) BindSendChan(subject string, channel interface{}) error { + chVal := reflect.ValueOf(channel) + if chVal.Kind() != reflect.Chan { + return ErrChanArg + } + go chPublish(c, chVal, subject) + return nil +} + +// Publish all values that arrive on the channel until it is closed or we +// encounter an error. +func chPublish(c *EncodedConn, chVal reflect.Value, subject string) { + for { + val, ok := chVal.Recv() + if !ok { + // Channel has most likely been closed. + return + } + if e := c.Publish(subject, val.Interface()); e != nil { + // Do this under lock. + c.Conn.mu.Lock() + defer c.Conn.mu.Unlock() + + if c.Conn.Opts.AsyncErrorCB != nil { + // FIXME(dlc) - Not sure this is the right thing to do. + // FIXME(ivan) - If the connection is not yet closed, try to schedule the callback + if c.Conn.isClosed() { + go c.Conn.Opts.AsyncErrorCB(c.Conn, nil, e) + } else { + c.Conn.ach <- func() { c.Conn.Opts.AsyncErrorCB(c.Conn, nil, e) } + } + } + return + } + } +} + +// BindRecvChan binds a channel for receive operations from NATS. +func (c *EncodedConn) BindRecvChan(subject string, channel interface{}) (*Subscription, error) { + return c.bindRecvChan(subject, _EMPTY_, channel) +} + +// BindRecvQueueChan binds a channel for queue-based receive operations from NATS. +func (c *EncodedConn) BindRecvQueueChan(subject, queue string, channel interface{}) (*Subscription, error) { + return c.bindRecvChan(subject, queue, channel) +} + +// Internal function to bind receive operations for a channel. +func (c *EncodedConn) bindRecvChan(subject, queue string, channel interface{}) (*Subscription, error) { + chVal := reflect.ValueOf(channel) + if chVal.Kind() != reflect.Chan { + return nil, ErrChanArg + } + argType := chVal.Type().Elem() + + cb := func(m *Msg) { + var oPtr reflect.Value + if argType.Kind() != reflect.Ptr { + oPtr = reflect.New(argType) + } else { + oPtr = reflect.New(argType.Elem()) + } + if err := c.Enc.Decode(m.Subject, m.Data, oPtr.Interface()); err != nil { + c.Conn.err = errors.New("nats: Got an error trying to unmarshal: " + err.Error()) + if c.Conn.Opts.AsyncErrorCB != nil { + c.Conn.ach <- func() { c.Conn.Opts.AsyncErrorCB(c.Conn, m.Sub, c.Conn.err) } + } + return + } + if argType.Kind() != reflect.Ptr { + oPtr = reflect.Indirect(oPtr) + } + // This is a bit hacky, but in this instance we may be trying to send to a closed channel. + // and the user does not know when it is safe to close the channel. + defer func() { + // If we have panicked, recover and close the subscription. + if r := recover(); r != nil { + m.Sub.Unsubscribe() + } + }() + // Actually do the send to the channel. + chVal.Send(oPtr) + } + + return c.Conn.subscribe(subject, queue, cb, nil) +} diff --git a/vendor/github.com/nats-io/go-nats/parser.go b/vendor/github.com/nats-io/go-nats/parser.go new file mode 100644 index 000000000..0911954a1 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/parser.go @@ -0,0 +1,470 @@ +// Copyright 2012-2014 Apcera Inc. All rights reserved. + +package nats + +import ( + "fmt" +) + +type msgArg struct { + subject []byte + reply []byte + sid int64 + size int +} + +const MAX_CONTROL_LINE_SIZE = 1024 + +type parseState struct { + state int + as int + drop int + ma msgArg + argBuf []byte + msgBuf []byte + scratch [MAX_CONTROL_LINE_SIZE]byte +} + +const ( + OP_START = iota + OP_PLUS + OP_PLUS_O + OP_PLUS_OK + OP_MINUS + OP_MINUS_E + OP_MINUS_ER + OP_MINUS_ERR + OP_MINUS_ERR_SPC + MINUS_ERR_ARG + OP_M + OP_MS + OP_MSG + OP_MSG_SPC + MSG_ARG + MSG_PAYLOAD + MSG_END + OP_P + OP_PI + OP_PIN + OP_PING + OP_PO + OP_PON + OP_PONG + OP_I + OP_IN + OP_INF + OP_INFO + OP_INFO_SPC + INFO_ARG +) + +// parse is the fast protocol parser engine. +func (nc *Conn) parse(buf []byte) error { + var i int + var b byte + + // Move to loop instead of range syntax to allow jumping of i + for i = 0; i < len(buf); i++ { + b = buf[i] + + switch nc.ps.state { + case OP_START: + switch b { + case 'M', 'm': + nc.ps.state = OP_M + case 'P', 'p': + nc.ps.state = OP_P + case '+': + nc.ps.state = OP_PLUS + case '-': + nc.ps.state = OP_MINUS + case 'I', 'i': + nc.ps.state = OP_I + default: + goto parseErr + } + case OP_M: + switch b { + case 'S', 's': + nc.ps.state = OP_MS + default: + goto parseErr + } + case OP_MS: + switch b { + case 'G', 'g': + nc.ps.state = OP_MSG + default: + goto parseErr + } + case OP_MSG: + switch b { + case ' ', '\t': + nc.ps.state = OP_MSG_SPC + default: + goto parseErr + } + case OP_MSG_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = MSG_ARG + nc.ps.as = i + } + case MSG_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + if err := nc.processMsgArgs(arg); err != nil { + return err + } + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, MSG_PAYLOAD + + // jump ahead with the index. If this overruns + // what is left we fall out and process split + // buffer. + i = nc.ps.as + nc.ps.ma.size - 1 + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + case MSG_PAYLOAD: + if nc.ps.msgBuf != nil { + if len(nc.ps.msgBuf) >= nc.ps.ma.size { + nc.processMsg(nc.ps.msgBuf) + nc.ps.argBuf, nc.ps.msgBuf, nc.ps.state = nil, nil, MSG_END + } else { + // copy as much as we can to the buffer and skip ahead. + toCopy := nc.ps.ma.size - len(nc.ps.msgBuf) + avail := len(buf) - i + + if avail < toCopy { + toCopy = avail + } + + if toCopy > 0 { + start := len(nc.ps.msgBuf) + // This is needed for copy to work. + nc.ps.msgBuf = nc.ps.msgBuf[:start+toCopy] + copy(nc.ps.msgBuf[start:], buf[i:i+toCopy]) + // Update our index + i = (i + toCopy) - 1 + } else { + nc.ps.msgBuf = append(nc.ps.msgBuf, b) + } + } + } else if i-nc.ps.as >= nc.ps.ma.size { + nc.processMsg(buf[nc.ps.as:i]) + nc.ps.argBuf, nc.ps.msgBuf, nc.ps.state = nil, nil, MSG_END + } + case MSG_END: + switch b { + case '\n': + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + continue + } + case OP_PLUS: + switch b { + case 'O', 'o': + nc.ps.state = OP_PLUS_O + default: + goto parseErr + } + case OP_PLUS_O: + switch b { + case 'K', 'k': + nc.ps.state = OP_PLUS_OK + default: + goto parseErr + } + case OP_PLUS_OK: + switch b { + case '\n': + nc.processOK() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_MINUS: + switch b { + case 'E', 'e': + nc.ps.state = OP_MINUS_E + default: + goto parseErr + } + case OP_MINUS_E: + switch b { + case 'R', 'r': + nc.ps.state = OP_MINUS_ER + default: + goto parseErr + } + case OP_MINUS_ER: + switch b { + case 'R', 'r': + nc.ps.state = OP_MINUS_ERR + default: + goto parseErr + } + case OP_MINUS_ERR: + switch b { + case ' ', '\t': + nc.ps.state = OP_MINUS_ERR_SPC + default: + goto parseErr + } + case OP_MINUS_ERR_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = MINUS_ERR_ARG + nc.ps.as = i + } + case MINUS_ERR_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + nc.ps.argBuf = nil + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + nc.processErr(string(arg)) + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + case OP_P: + switch b { + case 'I', 'i': + nc.ps.state = OP_PI + case 'O', 'o': + nc.ps.state = OP_PO + default: + goto parseErr + } + case OP_PO: + switch b { + case 'N', 'n': + nc.ps.state = OP_PON + default: + goto parseErr + } + case OP_PON: + switch b { + case 'G', 'g': + nc.ps.state = OP_PONG + default: + goto parseErr + } + case OP_PONG: + switch b { + case '\n': + nc.processPong() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_PI: + switch b { + case 'N', 'n': + nc.ps.state = OP_PIN + default: + goto parseErr + } + case OP_PIN: + switch b { + case 'G', 'g': + nc.ps.state = OP_PING + default: + goto parseErr + } + case OP_PING: + switch b { + case '\n': + nc.processPing() + nc.ps.drop, nc.ps.state = 0, OP_START + } + case OP_I: + switch b { + case 'N', 'n': + nc.ps.state = OP_IN + default: + goto parseErr + } + case OP_IN: + switch b { + case 'F', 'f': + nc.ps.state = OP_INF + default: + goto parseErr + } + case OP_INF: + switch b { + case 'O', 'o': + nc.ps.state = OP_INFO + default: + goto parseErr + } + case OP_INFO: + switch b { + case ' ', '\t': + nc.ps.state = OP_INFO_SPC + default: + goto parseErr + } + case OP_INFO_SPC: + switch b { + case ' ', '\t': + continue + default: + nc.ps.state = INFO_ARG + nc.ps.as = i + } + case INFO_ARG: + switch b { + case '\r': + nc.ps.drop = 1 + case '\n': + var arg []byte + if nc.ps.argBuf != nil { + arg = nc.ps.argBuf + nc.ps.argBuf = nil + } else { + arg = buf[nc.ps.as : i-nc.ps.drop] + } + nc.processAsyncInfo(arg) + nc.ps.drop, nc.ps.as, nc.ps.state = 0, i+1, OP_START + default: + if nc.ps.argBuf != nil { + nc.ps.argBuf = append(nc.ps.argBuf, b) + } + } + default: + goto parseErr + } + } + // Check for split buffer scenarios + if (nc.ps.state == MSG_ARG || nc.ps.state == MINUS_ERR_ARG || nc.ps.state == INFO_ARG) && nc.ps.argBuf == nil { + nc.ps.argBuf = nc.ps.scratch[:0] + nc.ps.argBuf = append(nc.ps.argBuf, buf[nc.ps.as:i-nc.ps.drop]...) + // FIXME, check max len + } + // Check for split msg + if nc.ps.state == MSG_PAYLOAD && nc.ps.msgBuf == nil { + // We need to clone the msgArg if it is still referencing the + // read buffer and we are not able to process the msg. + if nc.ps.argBuf == nil { + nc.cloneMsgArg() + } + + // If we will overflow the scratch buffer, just create a + // new buffer to hold the split message. + if nc.ps.ma.size > cap(nc.ps.scratch)-len(nc.ps.argBuf) { + lrem := len(buf[nc.ps.as:]) + + nc.ps.msgBuf = make([]byte, lrem, nc.ps.ma.size) + copy(nc.ps.msgBuf, buf[nc.ps.as:]) + } else { + nc.ps.msgBuf = nc.ps.scratch[len(nc.ps.argBuf):len(nc.ps.argBuf)] + nc.ps.msgBuf = append(nc.ps.msgBuf, (buf[nc.ps.as:])...) + } + } + + return nil + +parseErr: + return fmt.Errorf("nats: Parse Error [%d]: '%s'", nc.ps.state, buf[i:]) +} + +// cloneMsgArg is used when the split buffer scenario has the pubArg in the existing read buffer, but +// we need to hold onto it into the next read. +func (nc *Conn) cloneMsgArg() { + nc.ps.argBuf = nc.ps.scratch[:0] + nc.ps.argBuf = append(nc.ps.argBuf, nc.ps.ma.subject...) + nc.ps.argBuf = append(nc.ps.argBuf, nc.ps.ma.reply...) + nc.ps.ma.subject = nc.ps.argBuf[:len(nc.ps.ma.subject)] + if nc.ps.ma.reply != nil { + nc.ps.ma.reply = nc.ps.argBuf[len(nc.ps.ma.subject):] + } +} + +const argsLenMax = 4 + +func (nc *Conn) processMsgArgs(arg []byte) error { + // Unroll splitArgs to avoid runtime/heap issues + a := [argsLenMax][]byte{} + args := a[:0] + start := -1 + for i, b := range arg { + switch b { + case ' ', '\t', '\r', '\n': + if start >= 0 { + args = append(args, arg[start:i]) + start = -1 + } + default: + if start < 0 { + start = i + } + } + } + if start >= 0 { + args = append(args, arg[start:]) + } + + switch len(args) { + case 3: + nc.ps.ma.subject = args[0] + nc.ps.ma.sid = parseInt64(args[1]) + nc.ps.ma.reply = nil + nc.ps.ma.size = int(parseInt64(args[2])) + case 4: + nc.ps.ma.subject = args[0] + nc.ps.ma.sid = parseInt64(args[1]) + nc.ps.ma.reply = args[2] + nc.ps.ma.size = int(parseInt64(args[3])) + default: + return fmt.Errorf("nats: processMsgArgs Parse Error: '%s'", arg) + } + if nc.ps.ma.sid < 0 { + return fmt.Errorf("nats: processMsgArgs Bad or Missing Sid: '%s'", arg) + } + if nc.ps.ma.size < 0 { + return fmt.Errorf("nats: processMsgArgs Bad or Missing Size: '%s'", arg) + } + return nil +} + +// Ascii numbers 0-9 +const ( + ascii_0 = 48 + ascii_9 = 57 +) + +// parseInt64 expects decimal positive numbers. We +// return -1 to signal error +func parseInt64(d []byte) (n int64) { + if len(d) == 0 { + return -1 + } + for _, dec := range d { + if dec < ascii_0 || dec > ascii_9 { + return -1 + } + n = n*10 + (int64(dec) - ascii_0) + } + return n +} diff --git a/vendor/github.com/nats-io/go-nats/util/tls.go b/vendor/github.com/nats-io/go-nats/util/tls.go new file mode 100644 index 000000000..51da0b88c --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/util/tls.go @@ -0,0 +1,37 @@ +// Copyright 2016 Apcera Inc. All rights reserved. +// +build go1.7 + +package util + +import ( + "crypto/tls" +) + +// CloneTLSConfig returns a copy of c. Only the exported fields are copied. +// This is temporary, until this is provided by the language. +// https://go-review.googlesource.com/#/c/28075/ +func CloneTLSConfig(c *tls.Config) *tls.Config { + return &tls.Config{ + Rand: c.Rand, + Time: c.Time, + Certificates: c.Certificates, + NameToCertificate: c.NameToCertificate, + GetCertificate: c.GetCertificate, + RootCAs: c.RootCAs, + NextProtos: c.NextProtos, + ServerName: c.ServerName, + ClientAuth: c.ClientAuth, + ClientCAs: c.ClientCAs, + InsecureSkipVerify: c.InsecureSkipVerify, + CipherSuites: c.CipherSuites, + PreferServerCipherSuites: c.PreferServerCipherSuites, + SessionTicketsDisabled: c.SessionTicketsDisabled, + SessionTicketKey: c.SessionTicketKey, + ClientSessionCache: c.ClientSessionCache, + MinVersion: c.MinVersion, + MaxVersion: c.MaxVersion, + CurvePreferences: c.CurvePreferences, + DynamicRecordSizingDisabled: c.DynamicRecordSizingDisabled, + Renegotiation: c.Renegotiation, + } +} diff --git a/vendor/github.com/nats-io/go-nats/util/tls_pre17.go b/vendor/github.com/nats-io/go-nats/util/tls_pre17.go new file mode 100644 index 000000000..db198ae31 --- /dev/null +++ b/vendor/github.com/nats-io/go-nats/util/tls_pre17.go @@ -0,0 +1,35 @@ +// Copyright 2016 Apcera Inc. All rights reserved. +// +build go1.5,!go1.7 + +package util + +import ( + "crypto/tls" +) + +// CloneTLSConfig returns a copy of c. Only the exported fields are copied. +// This is temporary, until this is provided by the language. +// https://go-review.googlesource.com/#/c/28075/ +func CloneTLSConfig(c *tls.Config) *tls.Config { + return &tls.Config{ + Rand: c.Rand, + Time: c.Time, + Certificates: c.Certificates, + NameToCertificate: c.NameToCertificate, + GetCertificate: c.GetCertificate, + RootCAs: c.RootCAs, + NextProtos: c.NextProtos, + ServerName: c.ServerName, + ClientAuth: c.ClientAuth, + ClientCAs: c.ClientCAs, + InsecureSkipVerify: c.InsecureSkipVerify, + CipherSuites: c.CipherSuites, + PreferServerCipherSuites: c.PreferServerCipherSuites, + SessionTicketsDisabled: c.SessionTicketsDisabled, + SessionTicketKey: c.SessionTicketKey, + ClientSessionCache: c.ClientSessionCache, + MinVersion: c.MinVersion, + MaxVersion: c.MaxVersion, + CurvePreferences: c.CurvePreferences, + } +} diff --git a/vendor/vendor.json b/vendor/vendor.json index 549f66740..0ec019075 100644 --- a/vendor/vendor.json +++ b/vendor/vendor.json @@ -61,6 +61,24 @@ "revision": "87d4004f2ab62d0d255e0a38f1680aa534549fe3", "revisionTime": "2016-06-10T14:06:02+03:00" }, + { + "checksumSHA1": "3yco0089CSJ4qbyUccpbDC2+dPg=", + "path": "github.com/gogo/protobuf/gogoproto", + "revision": "84af2615df1ba1d35cc975ba94b64ee67d6c196e", + "revisionTime": "2016-12-20T17:02:12Z" + }, + { + "checksumSHA1": "6ZxSmrIx3Jd15aou16oG0HPylP4=", + "path": "github.com/gogo/protobuf/proto", + "revision": "84af2615df1ba1d35cc975ba94b64ee67d6c196e", + "revisionTime": "2016-12-20T17:02:12Z" + }, + { + "checksumSHA1": "EaY86bsi1nucvO0/UKvp/A72aC8=", + "path": "github.com/gogo/protobuf/protoc-gen-gogo/descriptor", + "revision": "84af2615df1ba1d35cc975ba94b64ee67d6c196e", + "revisionTime": "2016-12-20T17:02:12Z" + }, { "checksumSHA1": "W+E/2xXcE1GmJ0Qb784ald0Fn6I=", "path": "github.com/golang/snappy", @@ -199,6 +217,36 @@ "revision": "e82e73b775766b9011503e80e6772fc32b9afc5b", "revisionTime": "2016-12-19T23:17:30Z" }, + { + "checksumSHA1": "zvQr4zOz1/g/Fui6co0sctxrJ28=", + "path": "github.com/nats-io/go-nats", + "revision": "6b6bf392d34d01f57cc563ae123f00c13778bd57", + "revisionTime": "2016-11-20T20:21:26Z" + }, + { + "checksumSHA1": "8Z7LvciW35L7fbH0IaSoBMae+3o=", + "path": "github.com/nats-io/go-nats-streaming", + "revision": "077898146bfbb849a620202e7e5eaaf707492206", + "revisionTime": "2016-12-16T19:10:29Z" + }, + { + "checksumSHA1": "16sV1MZ45lYmv2tXfKHCz+ZLvyY=", + "path": "github.com/nats-io/go-nats-streaming/pb", + "revision": "077898146bfbb849a620202e7e5eaaf707492206", + "revisionTime": "2016-12-16T19:10:29Z" + }, + { + "checksumSHA1": "Q2c9uTEIGhSIddv5pntYdFNtUdk=", + "path": "github.com/nats-io/go-nats/encoders/builtin", + "revision": "6b6bf392d34d01f57cc563ae123f00c13778bd57", + "revisionTime": "2016-11-20T20:21:26Z" + }, + { + "checksumSHA1": "LhbIA/oMWpscEPPK9Wrx5GLcz44=", + "path": "github.com/nats-io/go-nats/util", + "revision": "6b6bf392d34d01f57cc563ae123f00c13778bd57", + "revisionTime": "2016-11-20T20:21:26Z" + }, { "checksumSHA1": "Nj7vQ2GlvJiPP7sqJX5AurrDSD4=", "path": "github.com/nats-io/nats",