98 lines
3.3 KiB
Zig
98 lines
3.3 KiB
Zig
//! A structure containing all theme-related values of zenolith's builtin widgets.
|
|
//! This allows for convenient handling of themes for default widgets.
|
|
const std = @import("std");
|
|
|
|
const AttreebuteMap = @import("attreebute.zig").AttreebuteMap;
|
|
const BoxStyle = @import("attreebutes/BoxStyle.zig");
|
|
const ButtonStyle = @import("attreebutes/ButtonStyle.zig");
|
|
const Color = @import("Color.zig");
|
|
const LabelStyle = @import("attreebutes/LabelStyle.zig");
|
|
|
|
pub const catppuccin_latte = Theme{
|
|
.box = .{ .background = .{ .fill = Color.fromInt(0xeff1f5ff) } },
|
|
.button = .{
|
|
.background = .{ .stroked = .{
|
|
.stroke = Color.fromInt(0xe64553ff),
|
|
.fill = Color.fromInt(0xccd0daff),
|
|
.width = 4,
|
|
} },
|
|
.background_hovered = .{ .stroked = .{
|
|
.stroke = Color.fromInt(0xe64553ff),
|
|
.fill = Color.fromInt(0xbcc0ccff),
|
|
.width = 2,
|
|
} },
|
|
.padding = 4,
|
|
.font_style = .{ .color = Color.fromInt(0x4c4f69ff) },
|
|
},
|
|
.label = .{ .font_style = .{ .color = Color.fromInt(0x4c4f69ff) } },
|
|
};
|
|
|
|
pub const catppuccin_frappe = Theme{
|
|
.box = .{ .background = .{ .fill = Color.fromInt(0x303446ff) } },
|
|
.button = .{
|
|
.background = .{ .stroked = .{
|
|
.stroke = Color.fromInt(0xea999cff),
|
|
.fill = Color.fromInt(0x414559ff),
|
|
.width = 4,
|
|
} },
|
|
.background_hovered = .{ .stroked = .{
|
|
.stroke = Color.fromInt(0xea999cff),
|
|
.fill = Color.fromInt(0x51576dff),
|
|
.width = 2,
|
|
} },
|
|
.padding = 4,
|
|
.font_style = .{ .color = Color.fromInt(0xc6d0f5ff) },
|
|
},
|
|
.label = .{ .font_style = .{ .color = Color.fromInt(0xc6d0f5ff) } },
|
|
};
|
|
|
|
pub const catppuccin_macchiato = Theme{
|
|
.box = .{ .background = .{ .fill = Color.fromInt(0x24273aff) } },
|
|
.button = .{
|
|
.background = .{ .stroked = .{
|
|
.stroke = Color.fromInt(0xee99a0ff),
|
|
.fill = Color.fromInt(0x363a4fff),
|
|
.width = 4,
|
|
} },
|
|
.background_hovered = .{ .stroked = .{
|
|
.stroke = Color.fromInt(0xee99a0ff),
|
|
.fill = Color.fromInt(0x494d64ff),
|
|
.width = 2,
|
|
} },
|
|
.padding = 4,
|
|
.font_style = .{ .color = Color.fromInt(0xcad3f5ff) },
|
|
},
|
|
.label = .{ .font_style = .{ .color = Color.fromInt(0xcad3f5ff) } },
|
|
};
|
|
|
|
pub const catppuccin_mocha = Theme{
|
|
.box = .{ .background = .{ .fill = Color.fromInt(0x1e1e2eff) } },
|
|
.button = .{
|
|
.background = .{ .stroked = .{
|
|
.stroke = Color.fromInt(0xeba0acff),
|
|
.fill = Color.fromInt(0x313244ff),
|
|
.width = 4,
|
|
} },
|
|
.background_hovered = .{ .stroked = .{
|
|
.stroke = Color.fromInt(0xeba0acff),
|
|
.fill = Color.fromInt(0x45475aff),
|
|
.width = 2,
|
|
} },
|
|
.padding = 4,
|
|
.font_style = .{ .color = Color.fromInt(0xcdd6f4ff) },
|
|
},
|
|
.label = .{ .font_style = .{ .color = Color.fromInt(0xcdd6f4ff) } },
|
|
};
|
|
|
|
box: BoxStyle,
|
|
button: ButtonStyle,
|
|
label: LabelStyle,
|
|
|
|
const Theme = @This();
|
|
|
|
pub fn apply(self: Theme, alloc: std.mem.Allocator, map: *AttreebuteMap) !void {
|
|
(try map.mod(alloc, BoxStyle)).* = self.box;
|
|
(try map.mod(alloc, ButtonStyle)).* = self.button;
|
|
(try map.mod(alloc, LabelStyle)).* = self.label;
|
|
}
|