Init

.gitignore

@@ -0,0 +1,3 @@
+.mpt
+build
+.idea

modpacktoolsconfig.toml

@@ -0,0 +1,14 @@
+[Locations]
+    #The location of the twitch manifest file (will be replaced with addonscript in later versions)
+    manifestFile = "src/twitch/manifest.json"
+    #The location of the source
+    src = "src"
+    #The location used to store temporary files
+    tempDir = ".mpt"
+[Local]
+    selectedVersion = -1
+[Downloads]
+    #The maximum number of threads that will be used for downloads
+    maxThreads = 2
+    #The timeout of http requests in ms
+    httpTimeout = 2147483647

mpt

@@ -0,0 +1,43 @@
+#!/bin/sh
+cd "$(dirname "$0")" || exit
+case $1 in
+install)
+  if ! [ -d "$HOME/.mpt" ];
+  then mkdir $HOME/.mpt
+  fi
+  if ! [ -f "$HOME/.mpt/mpt.jar" ];
+  then
+    dl=$(curl https://data.tilera.xyz/api/mpt.php/latest)
+    echo Downloading $dl ...
+    curl $dl --output $HOME/.mpt/mpt.jar
+  fi
+  ;;
+update)
+  dl=$(curl https://data.tilera.xyz/api/mpt.php/latest)
+  echo Downloading $dl ...
+  if [ -f ".mpt/mpt.jar" ]
+  then
+    curl $dl --output .mpt/mpt.jar
+  else
+    curl $dl --output $HOME/.mpt/mpt.jar
+  fi
+  echo Updating Script
+  curl https://data.tilera.xyz/api/mpt.php/script > mpt
+  ;;
+*)
+  if ! [ -d ".mpt" ];
+  then mkdir .mpt
+  fi
+  if [ -f ".mpt/mpt.jar" ];
+  then jar=.mpt/mpt.jar
+  elif [ -f "$HOME.mpt/mpt.jar" ];
+  then jar=$HOME.mpt/mpt.jar
+  else
+    dl=$(curl https://data.tilera.xyz/api/mpt.php/latest)
+    echo Downloading $dl ...
+    curl $dl --output .mpt/mpt.jar
+    jar=.mpt/mpt.jar
+  fi
+  java -jar $jar $*
+  ;;
+esac

src/overrides/config/AE2Stuff/readme.txt

@@ -0,0 +1,2 @@
+Any .cfg files in this directory will be loaded after the internal configuration, in alphabetic order
+Files in 'overrides' directory with matching names cab be used to override internal configuration

src/overrides/config/AE2WirelessTerminals.cfg

@@ -0,0 +1,47 @@
+# Configuration file
+
+"client configs" {
+    # Wireless Terminal will show a warning when Infinty Energy drops below this point and infinite range is active [range: 10 ~ 1000000, default: 5000]
+    I:InfinityEnergyWarningAmount=5000
+
+    # Will shift-clicking a bauble try to put said bauble in a bauble slot before trying to store in system [default: true]
+    B:ShiftClickBaubles=true
+}
+
+
+general {
+    # Should Infinity Booster Card Recipe be disabled? [default: false]
+    B:DisableBoosterRecipe=false
+
+    # Should Dragons drop Infinity Booster Card? [default: true]
+    B:DragonDropsBooster=true
+
+    # Enable Infinity Booster Card [default: true]
+    B:EnableBooster=true
+
+    # If true, AE2 controller will chunk load itself [default: false]
+    B:EnableControllerChunkLoading=false
+
+    # Percentage chance that booster card will drop upon killing an Enderman. (between 1 and 100) [range: 1 ~ 100, default: 5]
+    I:EndermanBoosterDropChance=5
+
+    # Will Enderman randomly drop infinity booster cards on death? [default: true]
+    B:EndermanDropBoosters=true
+
+    # Amount of Infinity Energy Consumed every 10 ticks when not in range of a WAP [range: 5 ~ 100, default: 15]
+    I:InfinityEnergyDrainAmount=15
+
+    # Amount of Infinity Energy 1 Infinity Booster Card will convert to [range: 5 ~ 1000, default: 100]
+    I:InfinityEnergyPerBooster=100
+
+    # If true, then simply inserting 1 Infinity Booster Card into the slot, will give limitless infinite range. [default: false]
+    B:UseOldInfinityMechanic=false
+
+    # Percentage chance that booster card will drop upon killing a wither. (between 1 and 100) [range: 1 ~ 100, default: 30]
+    I:WitherBoosterDropChance=30
+
+    # Should Withers drop Infinity Booster Card? [default: true]
+    B:WitherDropsBooster=true
+}
+
+

src/overrides/config/AdvGenerators/client.config

@@ -0,0 +1,17 @@
+# Configuration file
+
+display {
+    # Units to use when displaying power. Valid values: MJ, EU, RF, T
+    S:PowerShowUnits=RF
+}
+
+
+tooltips {
+    # If false will only show tooltip in Syngas Producer GUI
+    B:AlwaysShowCarbonTooltip=true
+
+    # If false will only show tooltip in Turbine GUI
+    B:AlwaysShowFuelTooltip=true
+}
+
+

src/overrides/config/AdvGenerators/readme.txt

@@ -0,0 +1,2 @@
+Any .cfg files in this directory will be loaded after the internal configuration, in alphabetic order
+Files in 'overrides' directory with matching names cab be used to override internal configuration

src/overrides/config/AppliedEnergistics2/AppliedEnergistics2.cfg

@@ -0,0 +1,456 @@
+# Configuration file
+
+automation {
+    I:formationPlaneEntityLimit=128
+}
+
+
+battery {
+    I:chargedStaff=8000
+    I:colorApplicator=20000
+    I:entropyManipulator=200000
+    I:matterCannon=200000
+    I:portableCell=20000
+    I:wirelessTerminal=1600000
+}
+
+
+client {
+    # Possible Values: AE, EU, RF
+    S:PowerUnit=AE
+
+    # Possible Values: AUTOSEARCH, AUTOSEARCH_KEEP, MANUAL_SEARCH, MANUAL_SEARCH_KEEP, JEI_AUTOSEARCH, JEI_AUTOSEARCH_KEEP, JEI_MANUAL_SEARCH, JEI_MANUAL_SEARCH_KEEP
+    S:SEARCH_MODE=AUTOSEARCH
+
+    # Possible Values: YES, NO, UNDECIDED
+    S:SEARCH_TOOLTIPS=YES
+
+    # Possible Values: TALL, FULL, SMALL
+    S:TERMINAL_STYLE=TALL
+
+    # Controls buttons on Crafting Screen : Capped at 9
+    I:craftAmtButton1=1
+
+    # Controls buttons on Crafting Screen : Capped at 99
+    I:craftAmtButton2=10
+
+    # Controls buttons on Crafting Screen : Capped at 999
+    I:craftAmtButton3=100
+
+    # Controls buttons on Crafting Screen : Capped at 9999
+    I:craftAmtButton4=1000
+    B:disableColoredCableRecipesInJEI=true
+    B:enableEffects=true
+
+    # Controls buttons on Level Emitter Screen : Capped at 9
+    I:levelAmtButton1=1
+
+    # Controls buttons on Level Emitter Screen : Capped at 99
+    I:levelAmtButton2=10
+
+    # Controls buttons on Level Emitter Screen : Capped at 999
+    I:levelAmtButton3=100
+
+    # Controls buttons on Level Emitter Screen : Capped at 9999
+    I:levelAmtButton4=1000
+
+    # Controls buttons on Priority Screen : Capped at 9
+    I:priorityAmtButton1=1
+
+    # Controls buttons on Priority Screen : Capped at 99
+    I:priorityAmtButton2=10
+
+    # Controls buttons on Priority Screen : Capped at 999
+    I:priorityAmtButton3=100
+
+    # Controls buttons on Priority Screen : Capped at 9999
+    I:priorityAmtButton4=1000
+    B:useColoredCraftingStatus=true
+    B:useTerminalUseLargeFont=false
+}
+
+
+condenser {
+    I:MatterBalls=256
+    I:Singularity=256000
+}
+
+
+craftingcpu {
+    I:craftingCalculationTimePerTick=5
+}
+
+
+##########################################################################################################
+# features
+#--------------------------------------------------------------------------------------------------------#
+# Warning: Disabling a feature may disable other features depending on it.
+##########################################################################################################
+
+features {
+
+    world {
+        B:CertusOre=true
+        B:CertusQuartzWorldGen=true
+        B:ChargedCertusOre=true
+        B:ChestLoot=true
+
+        # Blocks that are not used in any essential recipes, also slabs and stairs.
+        B:DecorativeBlocks=true
+        B:DecorativeLights=true
+        B:Flour=true
+        B:MeteoriteWorldGen=true
+        B:SkyStoneChests=true
+        B:SpawnPressesInMeteorites=true
+        B:TinyTNT=true
+        B:VillagerTrading=true
+    }
+
+    machines {
+        B:Charger=true
+        B:CrystalGrowthAccelerator=true
+        B:GrindStone=true
+        B:Inscriber=true
+        B:VibrationChamber=true
+    }
+
+    toolsclassifications {
+        B:CertusQuartzTools=true
+        B:NetherQuartzTools=true
+        B:PoweredTools=true
+    }
+
+    tools {
+        B:ChargedStaff=true
+        B:ColorApplicator=true
+        B:EntropyManipulator=true
+        B:MatterCannon=true
+        B:MeteoriteCompass=true
+        B:PaintBalls=true
+        B:QuartzAxe=true
+        B:QuartzHoe=true
+        B:QuartzKnife=true
+        B:QuartzPickaxe=true
+        B:QuartzSpade=true
+        B:QuartzSword=true
+        B:QuartzWrench=true
+        B:WirelessAccessTerminal=true
+    }
+
+    networkfeatures {
+        B:Channels=true
+        B:QuantumNetworkBridge=true
+        B:Security=true
+        B:SpatialIO=true
+    }
+
+    networkbuses {
+        B:AnnihilationPlane=true
+        B:CableAnchor=true
+        B:CraftingTerminal=true
+        B:ExportBus=true
+        B:FluidAnnihilationPlane=true
+        B:FluidExportBus=true
+        B:FluidFormationPlane=true
+        B:FluidImportBus=true
+        B:FluidInterface=true
+        B:FluidLevelEmitter=true
+        B:FluidStorageBus=true
+        B:FluidTerminal=true
+        B:FormationPlane=true
+        B:IdentityAnnihilationPlane=true
+        B:ImportBus=true
+        B:Interface=true
+        B:LevelEmitter=true
+        B:P2PTunnel=true
+        B:Panels=true
+        B:PartConversionMonitor=true
+        B:QuartzFiber=true
+        B:StorageBus=true
+        B:StorageMonitor=true
+        B:Terminal=true
+        B:ToggleBus=true
+    }
+
+    portablecell {
+        B:PortableCell=true
+    }
+
+    storage {
+        B:Condenser=true
+        B:IOPort=true
+        B:MEChest=true
+        B:MEDrive=true
+        B:StorageCells=true
+    }
+
+    networktool {
+        B:MemoryCard=true
+        B:NetworkTool=true
+    }
+
+    cables {
+        B:CoveredCables=true
+        B:DenseCables=true
+        B:GlassCables=true
+        B:SmartCables=true
+    }
+
+    energy {
+        B:DenseEnergyCells=true
+        B:EnergyAcceptor=true
+        B:EnergyCells=true
+    }
+
+    p2ptunnels {
+        B:P2PTunnelEU=true
+        B:P2PTunnelFE=true
+        B:P2PTunnelFluids=true
+        B:P2PTunnelItems=true
+        B:P2PTunnelLight=true
+        B:P2PTunnelME=true
+        B:P2PTunnelOpenComputers=true
+        B:P2PTunnelPressure=true
+        B:P2PTunnelRedstone=true
+    }
+
+    blockfeatures {
+        B:MassCannonBlockDamage=true
+        B:TinyTNTBlockDamage=true
+    }
+
+    facades {
+        B:Facades=true
+    }
+
+    misc {
+        B:Achievements=true
+        B:CraftingLog=false
+        B:Creative=true
+        B:DebugLogging=false
+        B:GrinderLogging=false
+        B:IntegrationLogging=false
+        B:LightDetector=true
+        B:LogSecurityAudits=false
+        B:Logging=true
+        B:PacketLogging=false
+        B:UnsupportedDeveloperTools=false
+        B:UpdateLogging=false
+        B:WebsiteRecipes=false
+    }
+
+    crafting {
+        B:EnableDisassemblyCrafting=true
+        B:EnableFacadeCrafting=true
+        B:InWorldFluix=true
+        B:InWorldPurification=true
+        B:InWorldSingularity=true
+        B:InterfaceTerminal=true
+    }
+
+    rendering {
+        B:AlphaPass=true
+    }
+
+    craftingfeatures {
+        B:CraftingCPU=true
+
+        # Use CraftingManager to find an alternative recipe, after a pattern rejected an ingredient. Should be enabled to avoid issues, but can have a minor performance impact.
+        B:CraftingManagerFallback=true
+        B:MolecularAssembler=true
+        B:Patterns=true
+    }
+
+    upgrades {
+        B:AdvancedCards=true
+        B:BasicCards=true
+        B:ViewCell=true
+    }
+
+    materials {
+        B:Certus=true
+        B:CrystalSeeds=true
+        B:Dusts=true
+        B:Fluix=true
+        B:Nuggets=true
+        B:PureCrystals=true
+        B:QuartzGlass=true
+        B:Silicon=true
+        B:SkyStone=true
+    }
+
+    craftingcomponents {
+        B:Cores=true
+        B:MatterBall=true
+        B:Presses=true
+        B:PrintedCircuits=true
+        B:Processors=true
+    }
+
+    commands {
+        B:ChunkLoggerTrace=false
+    }
+
+}
+
+
+general {
+    # Will auto-remove items that crash when being loaded from storage. This will destroy those items instead of crashing the game!
+    B:removeCrashingItemsOnLoad=false
+}
+
+
+##########################################################################################################
+# grindstone
+#--------------------------------------------------------------------------------------------------------#
+# Creates recipe of the following pattern automatically: '1 oreTYPE => 2 dustTYPE' and '(1 ingotTYPE or 1 crystalTYPE or 1 gemTYPE) => 1 dustTYPE'
+##########################################################################################################
+
+grindstone {
+    # Blacklists the exact oredict name from being handled by any recipe.
+    S:blacklist <
+     >
+
+    # The list of types to handle. Specify without a prefix like ore or dust.
+    S:grinderOres <
+        Obsidian
+        Ender
+        EnderPearl
+        Coal
+        Iron
+        Gold
+        Charcoal
+        NetherQuartz
+        CertusQuartz
+        Wheat
+        Fluix
+        Copper
+        Tin
+        Silver
+        Lead
+        Bronze
+        Brass
+        Platinum
+        Nickel
+        Invar
+        Aluminium
+        Electrum
+        Osmium
+        Zinc
+     >
+
+    # Chance to actually get an output with stacksize > 1.
+    D:oreDoublePercentage=90.0
+}
+
+
+##########################################################################################################
+# modintegration
+#--------------------------------------------------------------------------------------------------------#
+# Valid Values are 'AUTO', 'ON', or 'OFF' - defaults to 'AUTO' ; Suggested that you leave this alone unless your experiencing an issue, or wish to disable the integration for a reason.
+##########################################################################################################
+
+modintegration {
+    S:CraftTweaker=AUTO
+    S:IndustrialCraft2=AUTO
+    S:InventoryTweaks=AUTO
+    S:JustEnoughItems=AUTO
+    S:Mekanism=AUTO
+    S:MineFactoryReloaded=AUTO
+    S:OpenComputers=AUTO
+    S:Railcraft=AUTO
+    S:Tesla=AUTO
+    S:TheOneProbe=AUTO
+    S:Waila=AUTO
+}
+
+
+powerratios {
+    D:ForgeEnergy=0.5
+    D:IC2=2.0
+    D:UsageMultiplier=1.0
+}
+
+
+spatialio {
+    D:spatialPowerExponent=1.35
+    D:spatialPowerMultiplier=1250.0
+    I:storageDimensionID=2
+    I:storageProviderID=-11
+}
+
+
+##########################################################################################################
+# tickrates
+#--------------------------------------------------------------------------------------------------------#
+#  Min / Max Tickrates for dynamic ticking, most of these components also use sleeping, to prevent constant ticking, adjust with care, non standard rates are not supported or tested.
+##########################################################################################################
+
+tickrates {
+    I:AnnihilationPlane.max=120
+    I:AnnihilationPlane.min=2
+    I:Charger.max=120
+    I:Charger.min=10
+    I:ExportBus.max=60
+    I:ExportBus.min=5
+    I:FluidExportBus.max=60
+    I:FluidExportBus.min=5
+    I:FluidImportBus.max=40
+    I:FluidImportBus.min=5
+    I:FluidStorageBus.max=60
+    I:FluidStorageBus.min=5
+    I:IOPort.max=5
+    I:IOPort.min=1
+    I:ImportBus.max=40
+    I:ImportBus.min=5
+    I:Inscriber.max=1
+    I:Inscriber.min=1
+    I:Interface.max=120
+    I:Interface.min=5
+    I:ItemTunnel.max=60
+    I:ItemTunnel.min=5
+    I:LightTunnel.max=60
+    I:LightTunnel.min=5
+    I:METunnel.max=20
+    I:METunnel.min=5
+    I:OpenComputersTunnel.max=5
+    I:OpenComputersTunnel.min=1
+    I:PressureTunnel.max=120
+    I:PressureTunnel.min=1
+    I:StorageBus.max=60
+    I:StorageBus.min=5
+    I:VibrationChamber.max=40
+    I:VibrationChamber.min=10
+}
+
+
+##########################################################################################################
+# wireless
+#--------------------------------------------------------------------------------------------------------#
+# Range= wirelessBaseRange + wirelessBoosterRangeMultiplier * Math.pow( boosters, wirelessBoosterExp )
+# PowerDrain= wirelessBaseCost + wirelessCostMultiplier * Math.pow( boosters, 1 + boosters / wirelessHighWirelessCount )
+##########################################################################################################
+
+wireless {
+    D:wirelessBaseCost=8.0
+    D:wirelessBaseRange=16.0
+    D:wirelessBoosterExp=1.5
+    D:wirelessBoosterRangeMultiplier=1.0
+    D:wirelessCostMultiplier=1.0
+    D:wirelessTerminalDrainMultiplier=1.0
+}
+
+
+worldgen {
+    D:meteoriteClusterChance=0.1
+    I:meteoriteDimensionWhitelist <
+        0
+     >
+    I:meteoriteMaximumSpawnHeight=180
+    I:minMeteoriteDistance=707
+    I:quartzOresClusterAmount=15
+    I:quartzOresPerCluster=4
+    D:spawnChargedChance=0.07999998331069946
+}
+
+

src/overrides/config/AppliedEnergistics2/CustomRecipes.cfg

@@ -0,0 +1,22 @@
+# Configuration file
+
+cache {
+    S:digest=63dc840fc16ac07c6d9753d872a957b9
+
+    # Caching can save processing time, if there are a lot of items. [default: true]
+    B:enableCache=true
+}
+
+
+general {
+    # Will output more detailed information into the CSV like corresponding items [default: false]
+    B:enableAdditionalInfo=false
+
+    # If true, the CSV exporting will always happen. This will not use the cache to reduce the computation. [default: false]
+    B:enableForceRefresh=false
+
+    # If true, all registered items will be exported containing the internal minecraft name and the localized name to actually find the item you are using. This also contains the item representation of the blocks, but are missing items, which are too much to display e.g. FMP. [default: true]
+    B:exportItemNames=true
+}
+
+

src/overrides/config/AppliedEnergistics2/Facades.cfg

@@ -0,0 +1,45 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+##########################################################################################################
+# common
+#--------------------------------------------------------------------------------------------------------#
+# Settings applied to all facades.
+# 
+# By default full blocks with no tile entity and a model do not need whitelisting.
+# This will only be read once during client startup.
+##########################################################################################################
+
+common {
+    # Unsupported: Allows whitelisting TileEntity as facades. Could work, have render issues, or corrupt your world. USE AT YOUR OWN RISK.
+    B:allowTileEntityFacades=false
+}
+
+
+##########################################################################################################
+# facades
+#--------------------------------------------------------------------------------------------------------#
+# A way to explicitly handle certain blocks as facades.
+# 
+# Blocks can be added by their resource location under the following rules.
+#  - One category per domain like minecraft or appliedenergistics2
+#  - One key per id. E.g. glass in case of minecraft:glass
+#  - An integer value ranging from 0 to 16 representing the metadata 0-15 and 16 as wildcard for all - Multiple entries for the same id but different metadata are possible when needed
+##########################################################################################################
+
+facades {
+
+    minecraft {
+        I:glass=16
+        I:stained_glass=16
+    }
+
+    appliedenergistics2 {
+        I:quartz_glass=16
+        I:quartz_vibrant_glass=16
+    }
+
+}
+
+

src/overrides/config/AppliedEnergistics2/VersionChecker.cfg

@@ -0,0 +1,30 @@
+# Configuration file
+
+cache {
+    # Waits as many hours, until it checks again. [range: 0 ~ 168, default: 24]
+    I:interval=24
+    S:lastCheck=1653558068820
+}
+
+
+channel {
+    # Determines the channel level which should be checked for updates. Can be either Stable, Beta or Alpha. [default: Beta]
+    S:level=Beta
+}
+
+
+client {
+    # If true, the player is getting a notification including changelog. Only happens if notification are enabled. [default: true]
+    B:changelog=true
+
+    # If true, the player is getting a notification, that a new version is available. [default: true]
+    B:notify=true
+}
+
+
+general {
+    # If true, the version checker is enabled. Acts as a master switch. [default: true]
+    B:enabled=true
+}
+
+

src/overrides/config/Building Gadgets.cfg

@@ -0,0 +1,205 @@
+# Configuration file
+
+general {
+    # Disable absolute coords-mode for the Copy-Paste gadget
+    B:"Allow absolute Coord-Mode"=true
+
+    # Whether the Building / CopyPaste Gadget can overwrite blocks like water, lava, grass, etc (like a player can).
+    # False will only allow it to overwrite air blocks.
+    B:"Allow non-Air-Block-Overwrite"=true
+
+    # The maximum number of construction paste items dropped by a dense construction block.
+    # Min: 0
+    # Max: 2147483647
+    I:"Construction Paste Drop Count - Max"=3
+
+    # The minimum number of construction paste items dropped by a dense construction block.
+    # Min: 0
+    # Max: 2147483647
+    I:"Construction Paste Drop Count - Min"=1
+
+    # Determines if the Copy/Paste GUI's coordinate mode starts in 'Absolute' mode by default.
+    # Set to true for Absolute, set to False for Relative.
+    B:"Default to absolute Coord-Mode"=false
+
+    # Set to false to disable the recipe for construction paste.
+    B:"Enable Construction Paste"=true
+
+    # Set to false to disable the Destruction Gadget.
+    B:"Enable Destruction Gadget"=true
+
+    # Defines how far away you can build
+    # Min: 1.0
+    # Max: 48.0
+    D:"Max Build Distance"=32.0
+
+    # Set to true for Forge Energy Support, set to False for vanilla Item Damage
+    B:"Powered by Forge Energy"=true
+
+    ##########################################################################################################
+    # blacklist settings
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure your Blacklist-Settings here
+    ##########################################################################################################
+
+    "blacklist settings" {
+        # All Blocks added to this will be treated similar to TileEntities. Not at all.
+        # Notice that you can use Regular Expressions as defined by Java Patterns to express more complex name combinations.
+        # Use for example "awfulmod:.*" to blacklist all awfulmod Blocks.
+        S:"Blacklisted Blocks" <
+            minecraft:.*_door.*
+            minecraft:piston_head
+            astralsorcery:blockflarelight
+         >
+    }
+
+    ##########################################################################################################
+    # gadgets
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure the Gadgets here
+    ##########################################################################################################
+
+    gadgets {
+        # The max energy of Building, Exchanging & Copy-Paste Gadget
+        # Min: 0
+        # Max: 2147483647
+        I:"Maximum Energy"=500000
+
+        # The max range of the Gadgets
+        # Min: 1
+        # Max: 25
+        I:"Maximum allowed Range"=15
+
+        ##########################################################################################################
+        # building gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Building Gadget
+        ##########################################################################################################
+
+        "building gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=1
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=10000
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=50
+        }
+
+        ##########################################################################################################
+        # exchanging gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Exchanging Gadget
+        ##########################################################################################################
+
+        "exchanging gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=2
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=10000
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=100
+        }
+
+        ##########################################################################################################
+        # destruction gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost, Durability & Maximum Energy of the Destruction Gadget
+        ##########################################################################################################
+
+        "destruction gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=2
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=10000
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=200
+
+            # The max energy of the Destruction Gadget
+            # Min: 0
+            # Max: 2147483647
+            I:"Maximum Energy"=1000000
+
+            # If enabled, the Destruction Gadget can be taken out of fuzzy mode, allowing only instances of the block clicked to be removed (at a higher cost)
+            B:"Non-Fuzzy Mode Enabled"=false
+
+            # The cost in energy/durability will increase by this amount when not in fuzzy mode
+            # Min: 0.0
+            # Max: 1.7976931348623157E308
+            D:"Non-Fuzzy Mode Multiplier"=2.0
+        }
+
+        ##########################################################################################################
+        # copy-paste gadget
+        #--------------------------------------------------------------------------------------------------------#
+        # Energy Cost & Durability of the Copy-Paste Gadget
+        ##########################################################################################################
+
+        "copy-paste gadget" {
+            # The Gadget's Damage cost per Operation
+            # Min: 0
+            # Max: 2000
+            I:"Damage Cost"=1
+
+            # The Gadget's Durability (0 means no durability is used) (Ignored if powered by FE)
+            # Min: 0
+            # Max: 100000
+            I:Durability=10000
+
+            # The Gadget's Energy cost per Operation
+            # Min: 0
+            # Max: 100000
+            I:"Energy Cost"=50
+        }
+
+    }
+
+    ##########################################################################################################
+    # paste containers
+    #--------------------------------------------------------------------------------------------------------#
+    # Configure the Paste Containers here
+    ##########################################################################################################
+
+    "paste containers" {
+        # The maximum capacity of a tier 1 (iron) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T1 Container Capacity"=512
+
+        # The maximum capacity of a tier 2 (gold) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T2 Container Capacity"=2048
+
+        # The maximum capacity of a tier 3 (diamond) Construction Paste Container
+        # Min: 1
+        # Max: 2147483647
+        I:"T3 Container Capacity"=8192
+    }
+
+}
+
+

src/overrides/config/CustomNpcs.cfg

@@ -0,0 +1,64 @@
+#Whether scripting is enabled or not
+EnableScripting=true
+
+#Arguments given to the Nashorn scripting library
+NashorArguments=-strict
+
+#Disable Chat Bubbles
+EnableChatBubbles=true
+
+#Navigation search range for NPCs. Not recommended to increase if you have a slow pc or on a server
+NpcNavRange=32
+
+#Set to true if you want the dialog command option to be able to use op commands like tp etc
+NpcUseOpCommands=false
+
+InventoryGuiEnabled=true
+
+FixUpdateFromPre_1_12=false
+
+#If you are running sponge and you want to disable the permissions set this to true
+DisablePermissions=false
+
+SceneButtonsEnabled=true
+
+EnableDefaultEyes=true
+
+#Enables CustomNpcs startup update message
+EnableUpdateChecker=true
+
+#Only ops can create and edit npcs
+OpsOnly=false
+
+#Default interact line. Leave empty to not have one
+DefaultInteractLine=Hello @p
+
+#Number of chunk loading npcs that can be active at the same time
+ChuckLoaders=20
+
+#Enables leaves decay
+LeavesDecayEnabled=true
+
+#Enables Vine Growth
+VineGrowthEnabled=true
+
+#Enables Ice Melting
+IceMeltsEnabled=true
+
+#Normal players can use soulstone on animals
+SoulStoneAnimals=true
+
+#Normal players can use soulstone on all npcs
+SoulStoneNPCs=false
+
+#Type 0 = Normal, Type 1 = Solid
+HeadWearType=1
+
+#When set to Minecraft it will use minecrafts font, when Default it will use OpenSans. Can only use fonts installed on your PC
+FontType=Default
+
+#Font size for custom fonts (doesn't work with minecrafts font)
+FontSize=18
+
+NpcSpeachTriggersChatEvent=false
+

src/overrides/config/ExtraBitManipulation/armor_data.cfg

@@ -0,0 +1,47 @@
+# Configuration file
+
+"chiseled armor" {
+    #  [range: -2147483648 ~ 2147483647, default: 30]
+    I:"Armor Button X Position With Baubles Loaded"=30
+
+    #  [range: -2147483648 ~ 2147483647, default: 8]
+    I:"Armor Button Y Position With Baubles Loaded"=8
+
+    #  [range: 0 ~ 1, default: 0]
+    I:"Boots Moving Part"=0
+
+    #  [range: 0 ~ 2, default: 0]
+    I:"Chestplate Moving Part"=0
+
+    #  [default: false]
+    B:"Full Illumination"=false
+
+    #  [range: 0 ~ 0, default: 0]
+    I:"Helmet Moving Part"=0
+
+    #  [range: 0 ~ 2, default: 0]
+    I:"Leggings Moving Part"=0
+
+    #  [default: true]
+    B:"Look At Cursor"=true
+
+    #  [range: 0 ~ 1, default: 0]
+    I:Mode=0
+
+    #  [range: 0 ~ 2, default: 0]
+    I:Scale=0
+
+    #  [range: 0 ~ 4, default: 0]
+    I:"Selected Set Tab Index"=0
+
+    #  [range: 0 ~ 3, default: 0]
+    I:"Selected Tab Index"=0
+
+    #  [default: false]
+    B:"Target Bits"=false
+
+    #  [default: true]
+    B:"Translation In Pixels"=true
+}
+
+

src/overrides/config/ExtraBitManipulation/client.cfg

@@ -0,0 +1,455 @@
+# Configuration file
+
+"bit addition bounding box" {
+    # Sets the alpha value of the portion of the box that is behind other textures. (default = 28) [range: 0 ~ 255, default: 28]
+    I:"Alpha Inner Box"=28
+
+    # Sets the alpha value of the portion of the box that is in front of other textures. (default = 115) [range: 0 ~ 255, default: 115]
+    I:"Alpha Outer Box"=115
+
+    # Sets the blue value of the box. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Blue"=0
+
+    # Sets the green value of the box. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Green"=0
+
+    # Sets the red value of the box. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Red"=0
+
+    # Sets the line width of the box. (default = 2.0) [range: 0.0 ~ 3.4028235E38, default: 2.0]
+    S:"Line Width"=2.0
+
+    # Causes the portion of the box that is behind other textures to be rendered. (default = false) [default: false]
+    B:"Render Inner Box"=false
+
+    # Causes the portion of the box that is in front of other textures to be rendered. (default = true) [default: true]
+    B:"Render Outer Box"=true
+}
+
+
+"bit addition enveloped shape" {
+    # Sets the alpha value of the portion of the shape that is behind other textures. (default = 115) [range: 0 ~ 255, default: 115]
+    I:"Alpha Inner Shape"=115
+
+    # Sets the alpha value of the portion of the shape that is in front of other textures. (default = 38) [range: 0 ~ 255, default: 38]
+    I:"Alpha Outer Shape"=38
+
+    # Sets the blue value of the shape. (default = 255) [range: 0 ~ 255, default: 255]
+    I:"Color - Blue"=255
+
+    # Sets the green value of the shape. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Green"=0
+
+    # Sets the red value of the shape. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Red"=0
+
+    # Sets the line width of the shape. (default = 2.0) [range: 0.0 ~ 3.4028235E38, default: 2.0]
+    S:"Line Width"=2.0
+
+    # Causes the portion of the shape that is behind other textures to be rendered. (default = false) [default: false]
+    B:"Render Inner Shape"=false
+
+    # Causes the portion of the shape that is in front of other textures to be rendered. (default = true) [default: true]
+    B:"Render Outer Shape"=true
+}
+
+
+"bit removal bounding box" {
+    # Sets the alpha value of the portion of the box that is behind other textures. (default = 28) [range: 0 ~ 255, default: 28]
+    I:"Alpha Inner Box"=28
+
+    # Sets the alpha value of the portion of the box that is in front of other textures. (default = 115) [range: 0 ~ 255, default: 115]
+    I:"Alpha Outer Box"=115
+
+    # Sets the blue value of the box. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Blue"=0
+
+    # Sets the green value of the box. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Green"=0
+
+    # Sets the red value of the box. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Red"=0
+
+    # Sets the line width of the box. (default = 2.0) [range: 0.0 ~ 3.4028235E38, default: 2.0]
+    S:"Line Width"=2.0
+
+    # Causes the portion of the box that is behind other textures to be rendered. (default = true) [default: true]
+    B:"Render Inner Box"=true
+
+    # Causes the portion of the box that is in front of other textures to be rendered. (default = true) [default: true]
+    B:"Render Outer Box"=true
+}
+
+
+"bit removal enveloped shape" {
+    # Sets the alpha value of the portion of the shape that is behind other textures. (default = 115) [range: 0 ~ 255, default: 115]
+    I:"Alpha Inner Shape"=115
+
+    # Sets the alpha value of the portion of the shape that is in front of other textures. (default = 38) [range: 0 ~ 255, default: 38]
+    I:"Alpha Outer Shape"=38
+
+    # Sets the blue value of the shape. (default = 255) [range: 0 ~ 255, default: 255]
+    I:"Color - Blue"=255
+
+    # Sets the green value of the shape. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Green"=0
+
+    # Sets the red value of the shape. (default = 0) [range: 0 ~ 255, default: 0]
+    I:"Color - Red"=0
+
+    # Sets the line width of the shape. (default = 2.0) [range: 0.0 ~ 3.4028235E38, default: 2.0]
+    S:"Line Width"=2.0
+
+    # Causes the portion of the shape that is behind other textures to be rendered. (default = true) [default: true]
+    B:"Render Inner Shape"=true
+
+    # Causes the portion of the shape that is in front of other textures to be rendered. (default = false) [default: false]
+    B:"Render Outer Shape"=false
+}
+
+
+"bit wrench overlays" {
+    # Distance over which the arrowhead overlay used in block/texture translation/rotation will fade in (as well as out) as it moves. If this is set to the minimum value of 0, no fading will occur. (default = 0.3 meters) [range: 0.0 ~ 1.7976931348623157E308, default: 0.3]
+    S:"Arrow Fade Distance"=0.3
+
+    # Total travel distance of the arrowhead overlay used in block/texture translation/rotation as measured from the center of the block face the player is looking at. If this is set to the minimum value of 0, only one arrow head will be rendered and no movement will occur. (default = 0.75 meters) [range: 0.0 ~ 1.7976931348623157E308, default: 0.75]
+    S:"Arrow Movement Distance"=0.75
+
+    # Number of milliseconds over which the arrowhead overlay used in block/texture translation/rotation will travel from one end to the other of the distance specified by 'Arrow Movement Distance'. (default = 2 seconds) [range: 1 ~ 2147483647, default: 2000]
+    I:"Arrow Movement Period"=2000
+
+    # Distance between the three moving arrowhead overlays used in block/texture translation/rotation. If this is set to the minimum value of 0, only one arrow head will be rendered. (default = 1/3 of the default distance of 0.75 meters, i.e. evenly spaced) [range: 0.0 ~ 1.7976931348623157E308, default: 0.25]
+    S:"Arrow Spacing"=0.25
+
+    # Prevents overlays from rendering. (default = enabled) [default: false]
+    B:"Disable Overlay Rendering"=false
+
+    # Half the total travel distance of the bidirectional arrow overlay used in block/texture mirroring as measured from the center of the block face the player is looking at. If this is set to the minimum value of 0, no oscillation will occur. (default = 0.1 meters) [range: 0.0 ~ 1.7976931348623157E308, default: 0.1]
+    S:"Mirror Oscillation Amplitude"=0.1
+
+    # Number of milliseconds over which the bidirectional arrow overlay used in block/texture mirroring will complete one oscillation. (default = 0.83 seconds) [range: 1 ~ 2147483647, default: 830]
+    I:"Mirror Oscillation Period"=830
+
+    # Number of milliseconds over which the cyclic arrow overlay used in block/texture rotation will complete one rotation. (default = 3 seconds) [range: 1 ~ 2147483647, default: 3000]
+    I:"Rotation Period"=3000
+
+    # Number of milliseconds over which the circle overlay used in block translation will complete one cycle of scaling from a point to full-sized or vice versa. (default = 1.3 seconds) [range: 1 ~ 2147483647, default: 1300]
+    I:"Translation Scale Period"=1300
+}
+
+
+"chiseled armor settings" {
+    # If set to true, pressing E or Escape will switch back to the main inventory GUI. If set to false, doing so will simply close the GUI. [default: false]
+    B:"Exit To Main Inventory From Slots GUI"=false
+
+    # Specifies when to render the default Chiseled Armor model for a given armor piece. If set to 'If Empty', it will only render for an armor piece if there are no non-empty itemstacks in the itemstack lists of any of its moving parts. It will never/always render, if set to 'Never'/'Always', respectively. [default: If Empty]
+    S:"Render Default Armor Model"=If Empty
+
+    # Specifies when to render the Chiseled Armor itemstacks as they render when worn, rather than the default model. The specified model will either will always render, or will only render if the player is holding shift. [default: Default Model If Holding Shift]
+    S:"Rendered Armor Stack Models"=Default Model If Holding Shift
+
+    # Specifies when to show the button in the vanilla survival inventory that allows switching between it and the Chiseled Armor slots inventory. It will either be shown when in possession of any items, only Extra Bit Manipulation items, only EBM or Chisels & Bits items, only Chiseled Armor items, or will always/never be shown. [default: EBM Or C&B Items]
+    S:"Show Armor Slots Inventory Button"=EBM Or C&B Items
+
+    # A scale of this many pixels will be applied to all items rendered for all moving parts of all Chiseled Armor pieces, so as to prevent z-fighting of those items with the player model. [range: 0.0 ~ 3.4028235E38, default: 0.05]
+    S:"Z-Fighting Buffer Scale - Global"=0.05
+
+    # A scale of this many pixels will be additionally applied to all items rendered for the right leg and foot moving parts of Chiseled Armor boots, so as to prevent z-fighting of those items with the items of the left leg and foot moving parts. [range: 0.0 ~ 3.4028235E38, default: 0.05]
+    S:"Z-Fighting Buffer Scale - Leg & Foot"=0.05
+
+    # The items of both feet will be translated down by this many pixels to prevent z-fighting with the items of both legs. [range: 0.0 ~ 3.4028235E38, default: 0.05]
+    S:"Z-Fighting Buffer Translation - Feet"=0.05
+}
+
+
+"default values chiseled armor" {
+    # Players and bit tools will initialize with this moving part (specifies a moving part of this armor piece to import blocks into in collection mode). (default = Right Foot) [default: Right Foot]
+    S:"Boots Moving Part"=Right Foot
+
+    # Players and bit tools will initialize with this moving part (specifies a moving part of this armor piece to import blocks into in collection mode). (default = Torso) [default: Torso]
+    S:"Chestplate Moving Part"=Torso
+
+    # Players and bit tools will initialize with this moving part (specifies a moving part of this armor piece to import blocks into in collection mode). (default = Head) [default: Head]
+    S:"Helmet Moving Part"=Head
+
+    # Players and bit tools will initialize with this moving part (specifies a moving part of this armor piece to import blocks into in collection mode). (default = Pelvis) [default: Pelvis]
+    S:"Leggings Moving Part"=Pelvis
+
+    # Players and bit tools will initialize with this mode (either template creation mode to set the reference area of the moving part the blocks will be rendered relative to (and to optionally fill that area with bits), or block collection mode to import blocks into a moving part of the armor piece). (default = Template Creation) [default: Template Creation]
+    S:Mode=Template Creation
+
+    # Players and bit tools will initialize with this scale (which sets the scale of the bodypart templates, and of the block copies imported into the armor piece from the world). (default = 1:1) [default: 1:1]
+    S:Scale=1:1
+
+    # Players and bit tools will initialize with this targeting mode (if true, when importing blocks into the armor piece in collection mode, the drawn collection area will be determined by the bit click and the bit released on. If false, it will be determined by the block click and block released on). (default = false) [default: false]
+    B:"Target Bits"=false
+}
+
+
+"default values modeling tool" {
+    # Players and bit tools will initialize with this area mode (the area is either drawn (drawn), centered on the nearest block grid vertex (centered), or the area faces away from the player with one of the corners of the area at the nearest block grid vertex (corner)). (default = Centered) [default: Centered]
+    S:"Area Mode"=Centered
+
+    # Players and bit tools will initialize with this chunk-snap mode (either the area does not snap at all (off), it snaps in the X and Z axes (Y axis is unaffected) to whichever chunk the block the player is looking at is in (snap-to-chunk XZ), or it additionally snaps in the Y axis to the 'vertical chunk' (as visualized by pressing F3 + G) the block the player is looking at is in (snap-to-chunk XYZ)). (default = Snap-to-Chunk XYZ) [default: Snap-to-Chunk XYZ]
+    S:"Chunk-Snap Mode"=Snap-to-Chunk XYZ
+
+    # Players and bit tools will initialize with this whether the modeling tool GUI opens upon reading block states (if true, upon reading an area of block states in the world, the GUI that allows the player to preview the model and to manually map bits to block states will open. If set to false, it will not do so. Regardless of this setting, the GUI can be opened by right-clicking while sneaking). (default = true) [default: true]
+    B:"Open Gui Upon Read"=true
+}
+
+
+"default values sculpting tool" {
+    # Players and bit tools will initialize with this addition bit type (sets the block form [as specified by 'modID:name'] of the bit type that sculpting spades add to the world (an empty string, an unsupported block, or any misspelling will specify no bit type - the type will have to be set before the spade can be used)). (default = None) [default: minecraft:air]
+    S:"Bit Type - Addition (spade)"=minecraft:air
+
+    # Players and bit tools will initialize with this filtered bit type (sculpting can remove only one bit type rather than any - this config sets the block [as specified by 'modID:name'] of the bit type that sculpting wires remove (an empty string, an unsupported block, or any misspelling will specify any/all bit types)). (default = Any) [default: minecraft:air]
+    S:"Bit Type - Filter (wire)"=minecraft:air
+
+    # Players and bit tools will initialize with this direction. (default = Up) [default: Up]
+    S:Direction=Up
+
+    # Players and bit tools will initialize with this sculpting spade hollow property value (shape is either hollow or solid). (default = false) [default: false]
+    B:"Hollow Shapes (spade)"=false
+
+    # Players and bit tools will initialize with this sculpting wire hollow property value (shape is either hollow or solid). (default = false) [default: false]
+    B:"Hollow Shapes (wire)"=false
+
+    # Players and bit tools will initialize with this shape placement property value (shapes added with spades can be centered around the bit clicked, of offset opposite the side clicked). (default = true) [default: true]
+    B:"Offset Shape for Placement"=true
+
+    # Players and bit tools will initialize with this hollow sculpting shape open-ended property value (hollow shapes, such as cylinders, pyramids, etc., can have open or closed ends). (default = false) [default: false]
+    B:"Open Ends"=false
+
+    # Players and bit tools will initialize with this sculpting mode (local mode affects only the block clicked - global/drawn modes affects any bits from any blocks that intersect the sculpting shape when a block is clicked (global) or when the mouse is released after a click and drag (drawn)). (default = Local) [default: Local]
+    S:"Sculpting Mode"=Local
+
+    # Players and bit tools will initialize with this sculpting shape semi-diameter (in bits). (default = 5 bits) [range: 0 ~ 2147483647, default: 5]
+    I:Semi-Diameter=5
+
+    # Players and bit tools will initialize with this sculpting shape. (default = Sphere) [default: Sphere]
+    S:"Shape (curved)"=Sphere
+
+    # Players and bit tools will initialize with this sculpting shape. (default = Cube) [default: Cube]
+    S:"Shape (flat/straight)"=Cube
+
+    # Players and bit tools will initialize with this targeting mode (when sculpting in local/global mode either bits are targeted [the shape is centered on the center of the bit looked - the diameter is one (the center bit) plus/minus x number of bits (semi-diameter is x + 1/2 bit)], or vertices of the bit grid are targeted [the shape is centered on the corner (the one closest to the cursor) of the bit looked at (i.e. centered on a vertex of the grid) - the diameter is 2x number of bits (x is a true semi-diameter)]). (default = false) [default: false]
+    B:"Target Bit Grid Vertexes"=false
+
+    # Players and bit tools will initialize with this hollow sculpting shape wall thickness (in bits). (default = 2 bits) [range: 1 ~ 2147483647, default: 2]
+    I:"Wall Thickness"=2
+}
+
+
+"display in chat chiseled armor" {
+    # If set to true, whenever moving part is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of moving part. (default = true) [default: true]
+    B:"Boots Moving Part"=true
+
+    # If set to true, whenever moving part is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of moving part. (default = true) [default: true]
+    B:"Chestplate Moving Part"=true
+
+    # If set to true, whenever moving part is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of moving part. (default = true) [default: true]
+    B:"Helmet Moving Part"=true
+
+    # If set to true, whenever moving part is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of moving part. (default = true) [default: true]
+    B:"Leggings Moving Part"=true
+
+    # If set to true, whenever mode is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of mode. (default = true) [default: true]
+    B:Mode=true
+
+    # If set to true, whenever scale is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of scale. (default = true) [default: true]
+    B:Scale=true
+
+    # If set to true, whenever targeting mode is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of targeting mode. (default = true) [default: true]
+    B:"Target Bits"=true
+}
+
+
+"display in chat modeling tool" {
+    # If set to true, whenever area mode is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of area mode. (default = true) [default: true]
+    B:"Area Mode"=true
+
+    # If set to true, whenever chunk-snap mode is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of chunk-snap mode. (default = true) [default: true]
+    B:"Chunk-Snap Mode"=true
+
+    # If set to true, whenever whether the modeling tool GUI opens upon reading block states is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of whether the modeling tool GUI opens upon reading block states. (default = true) [default: true]
+    B:"Open Gui Upon Read"=true
+}
+
+
+"display in chat sculpting tool" {
+    # If set to true, whenever addition bit type is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of addition bit type. (default = true) [default: true]
+    B:"Bit Type - Addition (spade)"=true
+
+    # If set to true, whenever filtered bit type is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of filtered bit type. (default = true) [default: true]
+    B:"Bit Type - Filter (wire)"=true
+
+    # If set to true, whenever sculpting shape direction is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of sculpting shape direction. (default = true) [default: true]
+    B:Direction=true
+
+    # If set to true, whenever sculpting shape hollowness of sculpting spades is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of sculpting shape hollowness of sculpting spades. (default = true) [default: true]
+    B:"Hollow Shapes (spade)"=true
+
+    # If set to true, whenever sculpting shape hollowness of sculpting wires is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of sculpting shape hollowness of sculpting wires. (default = true) [default: true]
+    B:"Hollow Shapes (wire)"=true
+
+    # If set to true, whenever whether or not sculpting shapes added with spades will be offset for placement is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of whether or not sculpting shapes added with spades will be offset for placement. (default = true) [default: true]
+    B:"Offset Shape for Placement"=true
+
+    # If set to true, whenever hollow sculpting shape open-endedness is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of hollow sculpting shape open-endedness. (default = true) [default: true]
+    B:"Open Ends"=true
+
+    # If set to true, whenever sculpting mode is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of sculpting mode. (default = true) [default: true]
+    B:"Sculpting Mode"=true
+
+    # If set to true, whenever sculpting shape semi-diameter is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of sculpting shape semi-diameter. (default = true) [default: true]
+    B:Semi-Diameter=true
+
+    # If set to true, whenever curved tool sculpting shape is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of curved tool sculpting shape. (default = true) [default: true]
+    B:"Shape (curved)"=true
+
+    # If set to true, whenever flat/straight tool sculpting shape is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of flat/straight tool sculpting shape. (default = true) [default: true]
+    B:"Shape (flat/straight)"=true
+
+    # If set to true, whenever targeting mode is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of targeting mode. (default = true) [default: true]
+    B:"Target Bit Grid Vertexes"=true
+
+    # If set to true, whenever hollow sculpting shape wall thickness is changed, a message will be added to chat indicating the change. This will not fill chat with messages, since any pre-existing messages from this mod will be deleted before adding the next.See 'Default Value' config for a description of hollow sculpting shape wall thickness. (default = true) [default: true]
+    B:"Wall Thickness"=true
+}
+
+
+"insufficient bits" {
+    # If the player has insufficient bits in their inventory for a chiselable blockstate, an attempt will be made to find a replacement bit. First, if this is set to 'true', an attempt will be made to use the bit specified by the 'Default Replacement Bit' config. If this is set to 'false', this step will be skipped [default: true]
+    B:"1st Check: Use Default Replacement Bit"=true
+
+    # If the player has insufficient bits in their inventory for a chiselable blockstate, an attempt will be made to find a replacement bit. Second, if this is set to 'true', any/all bits in the player's inventory will be used, from the most numerous to the least numerous. If this is set to 'false', this step will be skipped [default: true]
+    B:"2nd Check: Use Any Bit As Replacement"=true
+
+    # If the player has insufficient bits in their inventory for a chiselable blockstate, an attempt will be made to find a replacement bit. Third, if this is set to 'true', air bits will be used, i.e. the bits will simply be left empty. If this is set to 'false', this step will be skipped [default: false]
+    B:"3rd Check: Use Air As Replacement"=false
+
+    # If the player has insufficient bits in their inventory for a chiselable blockstate, an attempt will be made to find a replacement bit. If the 'Use Default Replacement Bit' config is also set to 'true', then an attempt will first be made to use the bit version of this block as a replacement. [default: minecraft:redstone_block]
+    S:"Default Replacement Bit"=minecraft:redstone_block
+}
+
+
+"modeling tool settings" {
+    # If set to true, and if the 'per tool' box is checked in a given Modeling Tool (causing mappings to be read/written from/to the NBT tag of the itemstack), manually mapped blocks and block states will be saved to the itemstack's NBT as state IDs (integers - 4 bytes each). If set to false, they will be saved as a registry name (2 strings - 1 byte per char) and metadata (1 byte). Saving states as registry name for blocks and as registry name and metadata for block states takes up several times more space, and if thousands of mappings are manually stored in an item (as unlikely as that is), client or server crashing may occur if that item is sent through a packet network since the maximum payload is 32767 bytes. The benefit is that if the item is transported across worlds, the states will remain consistent. Saving states as integers, however, takes several times less space (meaning that 10k+ mappings would be necessary to cause a crash, which is even less likely), but the state IDs may not remain consistent if the item is transported across worlds. Changing this config will not cause any previously mapped states to be lost; all saved mappings will simply be read and saved in the new format the next time a state is manually mapped or unmapped. [default: false]
+    B:"Save States By ID"=false
+}
+
+
+"per tool or per client chiseled armor" {
+    # If set to true, moving part will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of moving part. (default = true) [default: true]
+    B:"Boots Moving Part"=true
+
+    # If set to true, moving part will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of moving part. (default = true) [default: true]
+    B:"Chestplate Moving Part"=true
+
+    # If set to true, moving part will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of moving part. (default = true) [default: true]
+    B:"Helmet Moving Part"=true
+
+    # If set to true, moving part will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of moving part. (default = true) [default: true]
+    B:"Leggings Moving Part"=true
+
+    # If set to true, mode will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of mode. (default = true) [default: true]
+    B:Mode=true
+
+    # If set to true, scale will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of scale. (default = false) [default: false]
+    B:Scale=false
+
+    # If set to true, targeting mode will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of targeting mode. (default = false) [default: false]
+    B:"Target Bits"=false
+}
+
+
+"per tool or per client modeling tool" {
+    # If set to true, area mode will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of area mode. (default = false) [default: false]
+    B:"Area Mode"=false
+
+    # If set to true, chunk-snap mode will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of chunk-snap mode. (default = false) [default: false]
+    B:"Chunk-Snap Mode"=false
+
+    # If set to true, whether the modeling tool GUI opens upon reading block states will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of whether the modeling tool GUI opens upon reading block states. (default = false) [default: false]
+    B:"Open Gui Upon Read"=false
+}
+
+
+"per tool or per client sculpting tool" {
+    # If set to true, addition bit type will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of addition bit type. (default = true) [default: true]
+    B:"Bit Type - Addition (spade)"=true
+
+    # If set to true, filtered bit type will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of filtered bit type. (default = true) [default: true]
+    B:"Bit Type - Filter (wire)"=true
+
+    # If set to true, sculpting shape direction will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of sculpting shape direction. (default = false) [default: false]
+    B:Direction=false
+
+    # If set to true, sculpting shape hollowness of sculpting spades will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of sculpting shape hollowness of sculpting spades. (default = false) [default: false]
+    B:"Hollow Shapes (spade)"=false
+
+    # If set to true, sculpting shape hollowness of sculpting wires will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of sculpting shape hollowness of sculpting wires. (default = false) [default: false]
+    B:"Hollow Shapes (wire)"=false
+
+    # If set to true, whether or not sculpting shapes added with spades will be offset for placement will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of whether or not sculpting shapes added with spades will be offset for placement. (default = false) [default: false]
+    B:"Offset Shape for Placement"=false
+
+    # If set to true, hollow sculpting shape open-endedness will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of hollow sculpting shape open-endedness. (default = false) [default: false]
+    B:"Open Ends"=false
+
+    # If set to true, sculpting mode will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of sculpting mode. (default = false) [default: false]
+    B:"Sculpting Mode"=false
+
+    # If set to true, sculpting shape semi-diameter will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of sculpting shape semi-diameter. (default = true) [default: true]
+    B:Semi-Diameter=true
+
+    # If set to true, curved tool sculpting shape will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of curved tool sculpting shape. (default = false) [default: false]
+    B:"Shape (curved)"=false
+
+    # If set to true, flat/straight tool sculpting shape will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of flat/straight tool sculpting shape. (default = false) [default: false]
+    B:"Shape (flat/straight)"=false
+
+    # If set to true, targeting mode will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of targeting mode. (default = false) [default: false]
+    B:"Target Bit Grid Vertexes"=false
+
+    # If set to true, hollow sculpting shape wall thickness will be set/stored in each individual sculpting tool and apply only to that tool. If set to false, it will be stored in the client config file called 'modeling_data' and will apply to all tools. Regardless of this setting, the client and tools will still initialize with data, but this setting determines which is considered for use. See 'Default Value' config for a description of hollow sculpting shape wall thickness. (default = false) [default: false]
+    B:"Wall Thickness"=false
+}
+
+
+"sculpting & wrech settings" {
+    # If set to true, sculpting tool display names will indicate the diameter of their bit removal/addition areas. If set to false, they will indicate the radius (default = true) [default: true]
+    B:"Display Name Diameter"=true
+
+    # If set to true, sculpting tool display names will indicate the size of their bit removal/addition areas in meters. If set to false, they will be in bits (default = false) [default: false]
+    B:"Display Name Meter Units"=false
+
+    # the maximum size (in bits) of sculpting shape semi-diameter (i.e. radius if it is a sphere). (default = 5 bits) [range: 1 ~ 2147483647, default: 32]
+    I:"Max Semi-Diameter"=32
+
+    # the maximum size (in bits) of hollow sculpting shapes. (default = 2 bits) [range: 1 ~ 2147483647, default: 32]
+    I:"Max Wall Thickness"=32
+
+    # If set to true, the Bit Wrench will only be able to invert blocks that are comprised of one bit type. If set to false, any block can be inverted and the bit type that empty bits will be filled with is whichever bit is the most prevalent in the block space. (default = false) [default: false]
+    B:"One Bit Type Inversion Requirement"=false
+
+    # Distance (in bits) to add to the semi-diameter of a sculpting tool's bit removal/addition area shape. If set to zero, no padding will be added; spheres, for example, will have single bits protruding from each cardinal direction at any size, since only those bits of those layers will be exactly on the sphere's perimeter. If set to 1, there will effectively be no padding for the same reason, but the radius will be one bit larger than specified. A value between 0 and 1 is suggested. (default = 0.2 bits) [range: 0.0 ~ 1.0, default: 0.2]
+    S:"Semi-Diameter Padding"=0.2
+}
+
+
+"unchiselable block states" {
+    # If an unchiselable blockstate is encountered, an attempt will be made to find a replacement bit. First, if this is set to 'true', an attempt will be made to use the bit specified by the 'Default Replacement Bit' config. If this is set to 'false', this step will be skipped [default: true]
+    B:"1st Check: Use Default Replacement Bit"=true
+
+    # If an unchiselable blockstate is encountered, an attempt will be made to find a replacement bit. Second, if this is set to 'true', any/all bits in the player's inventory will be used, from the most numerous to the least numerous. If this is set to 'false', this step will be skipped [default: true]
+    B:"2nd Check: Use Any Bit As Replacement"=true
+
+    # If an unchiselable blockstate is encountered, an attempt will be made to find a replacement bit. Third, if this is set to 'true', air bits will be used, i.e. the bits will simply be left empty. If this is set to 'false', this step will be skipped [default: false]
+    B:"3rd Check: Use Air As Replacement"=false
+
+    # If an unchiselable blockstate is encountered, an attempt will be made to find a replacement bit. If the 'Use Default Replacement Bit' config is also set to 'true', then an attempt will first be made to use the bit version of this block as a replacement. [default: minecraft:redstone_block]
+    S:"Default Replacement Bit"=minecraft:redstone_block
+}
+
+

src/overrides/config/ExtraBitManipulation/common.cfg

@@ -0,0 +1,77 @@
+# Configuration file
+
+"bit wrench properties" {
+    # The Bit Wrench will have this many uses if it is configured to take damage. (default = 5000) [range: 1 ~ 2147483647, default: 5000]
+    I:"Max Damage"=5000
+
+    # Causes the Bit Wrench to take a point of damage when used. (default = true) [default: true]
+    B:"Takes Damage"=true
+}
+
+
+"curved sculpting spade properties" {
+    # The Curved Sculpting Spade will be able to add/remove this many bits if it is configured to take damage. (default = 2000000) [range: 1 ~ 2147483647, default: 2000000]
+    I:"Max Damage"=2000000
+
+    # Causes the Curved Sculpting Spade to take a point of damage  for every bit added/removed when used. (default = true) [default: true]
+    B:"Takes Damage"=true
+}
+
+
+"curved sculpting wire properties" {
+    # The Curved Sculpting Wire will be able to add/remove this many bits if it is configured to take damage. (default = 2000000) [range: 1 ~ 2147483647, default: 2000000]
+    I:"Max Damage"=2000000
+
+    # Causes the Curved Sculpting Wire to take a point of damage  for every bit added/removed when used. (default = true) [default: true]
+    B:"Takes Damage"=true
+}
+
+
+"flat sculpting spade properties" {
+    # The Flat Sculpting Spade will be able to add/remove this many bits if it is configured to take damage. (default = 2000000) [range: 1 ~ 2147483647, default: 2000000]
+    I:"Max Damage"=2000000
+
+    # Causes the Flat Sculpting Spade to take a point of damage  for every bit added/removed when used. (default = true) [default: true]
+    B:"Takes Damage"=true
+}
+
+
+"modeling tool properties" {
+    # The Modeling Tool will have this many uses if it is configured to take damage. (default = 1000) [range: 1 ~ 2147483647, default: 1000]
+    I:"Max Damage"=1000
+
+    # Causes the Modeling Tool to take a point of damage when used. (default = true) [default: true]
+    B:"Takes Damage"=true
+}
+
+
+"recipe disable" {
+    # Disables the registration of the diamond nugget with the Ore Dictionary. (This will effectively disable the 9 nuggets to 1 diamond recipe, since it is uses the Ore Dictionary) [default: false]
+    B:"Disable Diamond Nugget Ore Dict"=false
+}
+
+
+"straight sculpting wire properties" {
+    # The Straight Sculpting Wire will be able to add/remove this many bits if it is configured to take damage. (default = 2000000) [range: 1 ~ 2147483647, default: 2000000]
+    I:"Max Damage"=2000000
+
+    # Causes the Straight Sculpting Wire to take a point of damage  for every bit added/removed when used. (default = true) [default: true]
+    B:"Takes Damage"=true
+}
+
+
+"thrown bit properties" {
+    # Disables the extinguishing of blocks when bits with water as their material are thrown at them. If disabled, the default behavior of placing, if possible, or dropping as items if not possible will be used. (default = enabled) [default: false]
+    B:"Disable Extinguish Blocks"=false
+
+    # Disables the extinguishing of entities when bits with water as their material are thrown at them. If disabled, the default behavior of striking without damaging and doping as items will be used. (default = enabled) [default: false]
+    B:"Disable Extinguish Entities"=false
+
+    # Disables the igniting of blocks when bits with lava as their material are thrown at them. If disabled, the default behavior of placing, if possible, or dropping as items if not possible will be used. (default = enabled) [default: false]
+    B:"Disable Ignite Blocks"=false
+
+    # Disables the igniting of entities when bits with lava as their material are thrown at them. If disabled, the default behavior of striking without damaging and doping as items will be used. (default = enabled) [default: false]
+    B:"Disable Ignite Entities"=false
+}
+
+

src/overrides/config/ExtraBitManipulation/sculpting_data.cfg

@@ -0,0 +1,44 @@
+# Configuration file
+
+"sculpting tool" {
+    #  [default: minecraft:air]
+    S:"Bit Type - Addition (spade)"=minecraft:air
+
+    #  [default: minecraft:air]
+    S:"Bit Type - Filter (wire)"=minecraft:air
+
+    #  [range: 0 ~ 5, default: 1]
+    I:Direction=1
+
+    #  [default: false]
+    B:"Hollow Shapes (spade)"=false
+
+    #  [default: false]
+    B:"Hollow Shapes (wire)"=false
+
+    #  [default: true]
+    B:"Offset Shape for Placement"=true
+
+    #  [default: false]
+    B:"Open Ends"=false
+
+    #  [range: 0 ~ 2, default: 0]
+    I:"Sculpting Mode"=0
+
+    #  [range: 0 ~ 2147483647, default: 5]
+    I:Semi-Diameter=5
+
+    #  [range: 0 ~ 2, default: 0]
+    I:"Shape (curved)"=0
+
+    #  [range: 0 ~ 1, default: 3]
+    I:"Shape (flat/straight)"=3
+
+    #  [default: false]
+    B:"Target Bit Grid Vertexes"=false
+
+    #  [range: 1 ~ 2147483647, default: 2]
+    I:"Wall Thickness"=2
+}
+
+

src/overrides/config/ExtraBitManipulation/server.cfg

@@ -0,0 +1,56 @@
+# Configuration file
+
+"sculpting & wrech settings" {
+    # Amount in meters to contract the box that removed bits randomly spawn in (assuming they spawn in the block space as per 'Drop Bits In Block Space') If set to 0, there will be no contraction and they will be able to spawn anywhere in the box. If set to 0.5, the box will contract by half in all directions down to a point in the center of the original box and they will always spawn from that central point. The default of 0.25 (which is the default behavior when spawning items with Block.spawnAsEntity) contracts the box to half its original size. (default = 0.25 meters) [range: 0.0 ~ 0.5, default: 0.25]
+    S:"Bit Spawn Box Contraction"=0.25
+
+    # If set to true, full meter cubed blocks of bits that have all their bits removed will drop as full chiseled blocks. If set to false, they will drop normally as item stacks of bits (64 stacks of size 64). (default = false) [default: false]
+    B:"Drop Bits As Full Chiseled Blocks"=false
+
+    # If set to true, when bits removed from blocks with a sculpting tool are spawned in the world, they will be spawned at a random point within the area that intersects the block space and the removal area bounding box (if 'Drop Bits Per Block' is true, they will be spawned in the block they are removed from; otherwise they will be spawned at the block they player right-clicked). If set to false, they will be spawned at the player, in the same way that items are spawned when throwing them on the ground by pressing Q. (default = true) [default: true]
+    B:"Drop Bits In Block Space"=true
+
+    # When bits are removed from blocks with a sculpting tool, all the removed bits of each type are counted and a collection of item stacks are created of each item. For the sake of efficiency, the number of stacks generated is the minimum number necessary for that amount (Ex: 179 bits would become 2 stacks of 64 and 1 stack of 51). If this config is set to true, the counts for each block will be added up and spawned after each block is modified. This means that when removing bits in global mode, the bits have the ability to spawn in the respective block spaces they are removed from. However, it also means that more stacks may be generated than necessary if all bits from all blocks removed were to be pooled. If this config is set to false, the bits will be added up and pooled together as they are removed from each block. Only once all blocks are modified will the entire collection of bits be spawned in the world or given to the player. While this is more efficient, it means that the effect of bits spawning in the block spaces they are removed from is not possible. Rather, the bits will either spawn in the space of the block clicked or spawn at the player as per 'Drop Bits In Block Space'. (default = true) [default: true]
+    B:"Drop Bits Per Block"=true
+
+    # If set to true, when bits are removed from blocks with a sculpting tool, as many of them will be given to the player as is possible. Any bits that cannot fit in the player's inventory will be spawned in the world. If set to false, no attempt will be made to give them to the player; they will always be spawned in the world. (default = true) [default: true]
+    B:"Place Bits In Inventory"=true
+}
+
+
+"thrown bit properties" {
+    # Specifies how bits are selected from a Bit bag to be thrown in the world. The bits will either be selected randomly, sytematically from the first slot to the last, or sytematically from the last slot to the first. [default: Random]
+    S:"Bit Bag Thrown Bit Selection"=Random
+
+    # The amount of damage (1 = half a heart) applied to entities when hit with bits. If this is set to 0, there will be no effect on players, but all non-player entities will still get all the effects of damage (knock-back, color change, etc.), despite not actually taking any damage. If this is set to a very small value, then those same effects will apply to all entities--including players--without doing any appreciable damage. (default = essentially none) [range: 0.0 ~ 3.4028235E38, default: 1.4E-45]
+    S:"Damage Inflicted"=1.4E-45
+
+    # The amount of damage (1 = half a heart) applied to Blazes when hit with water bits. If this is set to 0, they will still get all the effects of damage (knock-back, color change, etc.), despite not actually taking any damage. (default = half a heart) [range: 0.0 ~ 3.4028235E38, default: 1.0]
+    S:"Damage Inflicted On Blazes"=1.0
+
+    # Disables the damaging of Blazes when hit with water bits. See 'Damage Inflicted On Blazes' for explanation of why it may be useful for this to be set to true, despite setting the amount to 0. (default = does damage) [default: false]
+    B:"Disable Inflicted Blaze Damage"=false
+
+    # Disables the damaging of entities when hit with bits. See 'Damage Inflicted' for explanation of why it may be useful for this to be set to true, despite setting the amount to 0. (default = does damage) [default: false]
+    B:"Disable Inflicted Damage"=false
+
+    # Enables the ability to throw bits by pressing its corresponding keybind. (default = enabled) [default: true]
+    B:Enabled=true
+
+    # Number of seconds that an entity will remain on fire for when ignited by a lava bit, if ignite entities is not disabled. (default = 1 second) [range: 0 ~ 2147483647, default: 1]
+    I:"Entity Burn Time"=1
+
+    # A relative value that denote the amount of random deviation a thrown bit will have from the direction the player is looking. (default = 1.) [range: 0.0 ~ 3.4028235E38, default: 1.0]
+    S:Inaccuracy=1.0
+
+    # A relative value that denote the amount of random deviation a thrown bit will have from the direction the player is looking from a Bit Bag. (default = 10.) [range: 0.0 ~ 3.4028235E38, default: 10.0]
+    S:"Inaccuracy From Bit Bag"=10.0
+
+    # The initial velocity in meters per tick that a thrown bit will initially have when thrown. (default = 1. meters per tick bits) [range: 0.0 ~ 3.4028235E38, default: 1.5]
+    S:"Initial Velocity"=1.5
+
+    # The initial velocity in meters per tick that a thrown bit will initially have when thrown from a Bit Bag. (default = 0. meters per tick bits) [range: 0.0 ~ 3.4028235E38, default: 0.5]
+    S:"Initial Velocity From Bit Bag"=0.5
+}
+
+

src/overrides/config/Extreme Reactors/Extreme Reactors.cfg

@@ -0,0 +1,202 @@
+# Configuration file
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# Client-only options
+##########################################################################################################
+
+client {
+    # If true, disables the rendering of fuel inside the fuel rods of a Reactor and the associated animation. Restart needed (Default: false)
+    B:disableReactorFuelRodRender=false
+
+    # If true, disables the fuel rods particle effect. (Default: false)
+    B:disableReactorParticles=false
+
+    # If true, disables the Turbine particle effect. (Default: false)
+    B:disableTurbineParticles=false
+
+    # If true, disables the rendering of the rotor animation of an active Turbine. Restart needed (Default: false)
+    B:disableTurbineRotorRender=false
+}
+
+
+##########################################################################################################
+# compatibility
+#--------------------------------------------------------------------------------------------------------#
+# Define how Big Reactor interact with other mods
+##########################################################################################################
+
+compatibility {
+    # If true, automatically adds all unregistered uranium ingots found as clonesof standard yellorium fuel
+    B:autoAddUranium=true
+
+    # If true, allows Metallurgy's fantasy metals to be used as part of turbine coils. Default: true
+    B:enableMetallurgyFantasyMetalsInTurbines=true
+}
+
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# General options
+##########################################################################################################
+
+general {
+    # If true, allows weird stuff inside reactors, like MFR sewage and pink slime. Default: true
+    B:enableComedy=true
+
+    # A multiplier for balancing fuel consumption. Default: 1.0
+    D:fuelUsageMultiplier=1.0
+
+    # A multiplier for balancing overall power production from Extreme Reactors. Default: 1.0
+    D:powerProductionMultiplier=1.0
+
+    # Number of ticks between updates for redstone/rednet ports
+    I:ticksPerRedstoneUpdate=20
+}
+
+
+##########################################################################################################
+# reactor
+#--------------------------------------------------------------------------------------------------------#
+# Define how Reactors works
+##########################################################################################################
+
+reactor {
+    # The maximum valid size of a reactor in the Y dimension, in blocks. Lower this if your server's players are building ginormous reactors. Bigger Y sizes have far less performance impact than X/Z sizes
+    I:maxReactorHeight=48
+
+    # The maximum valid size of a reactor in the X/Z plane, in blocks. Lower this if your server's players are building ginormous reactors
+    I:maxReactorSize=32
+
+    # A multiplier for balancing reactor power production. Stacks with powerProductionMultiplier. Default: 1.0
+    D:reactorPowerProductionMultiplier=1.0
+}
+
+
+##########################################################################################################
+# recipes
+#--------------------------------------------------------------------------------------------------------#
+# Recipes options
+##########################################################################################################
+
+recipes {
+    # If set, cyanite will be craftable from yellorium ingots and sand
+    B:enableCyaniteFromYelloriumRecipe=true
+
+    # If set, reactor power taps can be crafted, allowing players to use passive-cooled reactors
+    B:enableReactorPowerTapRecipe=true
+
+    # If set, charcoal will be smeltable into graphite bars. Disable this if other mods need to smelt charcoal into their own products. (Default: true)
+    B:registerCharcoalForSmelting=true
+
+    # If set, coal will be smeltable into graphite bars. Disable this if other mods need to smelt coal into their own products. (Default: true)
+    B:registerCoalForSmelting=true
+
+    # Enable creative mod-only multiblock parts. Default: true
+    B:registerCreativeMultiblockParts=true
+
+    # If set, graphite bars can be crafted from 2 gravel, 1 charcoal. Use this if other mods interfere with the smelting recipe. (Default: false)
+    B:registerGraphiteCharcoalCraftingRecipes=false
+
+    # If set, graphite bars can be crafted from 2 gravel, 1 coal. Use this if other mods interfere with the smelting recipe. (Default: false)
+    B:registerGraphiteCoalCraftingRecipes=false
+
+    # If set, yellorite ore will smelt into whichever item is registered as ingotUranium in the ore dictionary. If false, it will smelt into ingotYellorium. (Default: true)
+    B:registerYelloriteSmeltToUranium=true
+
+    # If set, then all Extreme Reactors components will require uranium ingots (ingotUranium) in place of yellorium ingots and plutonium ingots (ingotPlutonium) in place of blutonium ingots. Will be ignored if no other mod registers uranium ingots and/ore plutonium ingots. Default: true
+    B:registerYelloriumAsUranium=true
+
+    # If set, then Extreme Reactors will require hardened or reinforced glass (blockGlassHardened or glassReinforced) instead of plain glass. Will be ignored if no other mod registers those glass types. (default: false)
+    B:requireObsidianGlass=false
+}
+
+
+##########################################################################################################
+# turbine
+#--------------------------------------------------------------------------------------------------------#
+# Define how Turbines works
+##########################################################################################################
+
+turbine {
+    # The maximum valid height of a turbine (Y axis), in blocks. Default: 32
+    I:maxTurbineHeight=32
+
+    # The maximum valid size of a turbine in the X/Z plane, in blocks. Lower this for smaller turbines, which means lower max output. Default: 16
+    I:maxTurbineSize=16
+
+    # A multiplier for balancing rotor sizes. Multiplies the amount of energy lost to aerodynamic drag per tick. Default: 1.0
+    D:turbineAeroDragMultiplier=1.0
+
+    # A multiplier for balancing coil size. Multiplies the amount of energy drawn per coil block per tick. Default: 1.0
+    D:turbineCoilDragMultiplier=1.0
+
+    # A multiplier for balancing coil size. Multiplies the amount of fluid each blade block can process (base of 25 will be multiplied, then rounded down to the nearest integer). Default: 1.0
+    D:turbineFluidPerBladeMultiplier=1.0
+
+    # A multiplier for balancing rotor sizes. Multiplies the amount of energy lost to friction per tick. Default: 1.0
+    D:turbineMassDragMultiplier=1.0
+
+    # A multiplier for balancing turbine power production. Stacks with powerProductionMultiplier. Default: 1.0
+    D:turbinePowerProductionMultiplier=1.0
+}
+
+
+##########################################################################################################
+# worldgen
+#--------------------------------------------------------------------------------------------------------#
+# Define how ores generates in the world
+##########################################################################################################
+
+worldgen {
+    # Enable generation of Anglesite ore
+    B:anglesiteOreEnableWorldGen=true
+
+    # Maximum number of Anglesite clusters per chunk
+    I:anglesiteOreMaxClustersPerChunk=1
+
+    # Maximum number of Anglesite ore to generate in each cluster
+    I:anglesiteOrePerCluster=4
+
+    # Enable generation of Benitoite ore
+    B:benitoiteOreEnableWorldGen=true
+
+    # Maximum number of Benitoite clusters per chunk
+    I:benitoiteOreMaxClustersPerChunk=2
+
+    # Maximum number of Benitoite ore to generate in each cluster
+    I:benitoiteOrePerCluster=5
+
+    # World gen will be performed only in the dimensions listed here
+    I:dimensionWhitelist <
+        0
+     >
+
+    # If false, disables all world gen from Extreme Reactors; all other worldgen settings are automatically overridden
+    B:enableWorldGen=true
+
+    # Run BR World Generation in chunks that have already been generated, but have not been modified by Extreme Reactors before. This is largely useful for worlds that existed before BigReactors was released
+    B:enableWorldRegeneration=false
+
+    # If true, dimensionWhitelist will be used as a black list. (Default: false)
+    B:useBlacklist=false
+
+    # User-set world generation version. Increase this by 1 if you want Extreme Reactors to re-run world generation in your world
+    I:userWorldGenVersion=0
+
+    # Enable generation of yellorite ore
+    B:yelloriteOreEnableWorldGen=true
+
+    # Maximum number of yellorite clusters per chunk
+    I:yelloriteOreMaxClustersPerChunk=2
+
+    # Maximum height (Y coordinate) in the world to generate yellorite ore
+    I:yelloriteOreMaxY=32
+
+    # Maximum number of yellorite ore to generate in each cluster
+    I:yelloriteOrePerCluster=5
+}
+
+

src/overrides/config/IC2.ini

@@ -0,0 +1,321 @@
+; ic2 general config
+; created May 26, 2022 11:52:39 AM
+;---
+
+[worldgen]
+; Enable generation of rubber trees in the world.
+rubberTree = true
+; Comma separated list of dimensions to not generate rubber trees in
+; Does nothing if rubber tree generation is disabled
+rubberTreeBlacklist = 
+; Factor scaling the IC2 ore generation quantity.
+oreDensityFactor = 1.0
+; Factor scaling the IC2 tree generation quantity.
+treeDensityFactor = 1.0
+; Enable scaling the generation y levels and quantities to the sea level according to the formula
+; newValue = configuredValue * sealevel / 64.
+; The ore density (ratio between stone and ores) will be independent on the worlds's sea level if
+; enabled.
+normalizeHeight = true
+; Maximum amount of chunks to check for retrogen viability each tick.
+; Retrogen is the retroactive generation of terrain features, e.g. ores and trees.
+; Set it to 0 to disable retrogen.
+; When enabling this the recommended value is 16
+retrogenCheckLimit = 0
+; Maximum amount of chunks to process for retrogen each tick.
+; Values exceeding retrogenCheckLimit are being truncated.
+retrogenUpdateLimit = 2
+
+; Settings for generating copper ore
+[worldgen / copper]
+; Enable generating this ore
+enabled = true
+; Amount of clusters to generate
+count = 15
+; Cluster size
+size = 10
+; Start height (inclusive)
+minHeight = 0
+; End height (exclusive)
+maxHeight = 68
+; Distribution across the height.
+; Valid options are:
+; - uniform: same probability across all y levels
+; - triangle: maximum in the middle ((minHeight+maxHeight) / 2), linear falloff to the bounds
+; - ramp: maximum at minHeight, linear falloff towards maxHeight
+; - revramp: maximum at maxHeight, linear falloff towards minHeight
+; - smooth: maximum in the middle, maintains high levels over a wide range before falling off
+; smoothly like a normal distribution with a more trapezoidal shape
+distribution = smooth
+
+; Settings for generating lead ore
+[worldgen / lead]
+; Enable generating this ore
+enabled = true
+; Amount of clusters to generate
+count = 8
+; Cluster size
+size = 4
+; Start height (inclusive)
+minHeight = 0
+; End height (exclusive)
+maxHeight = 64
+; Distribution across the height.
+; Valid options are:
+; - uniform: same probability across all y levels
+; - triangle: maximum in the middle ((minHeight+maxHeight) / 2), linear falloff to the bounds
+; - ramp: maximum at minHeight, linear falloff towards maxHeight
+; - revramp: maximum at maxHeight, linear falloff towards minHeight
+; - smooth: maximum in the middle, maintains high levels over a wide range before falling off
+; smoothly like a normal distribution with a more trapezoidal shape
+distribution = uniform
+
+; Settings for generating tin ore
+[worldgen / tin]
+; Enable generating this ore
+enabled = true
+; Amount of clusters to generate
+count = 25
+; Cluster size
+size = 6
+; Start height (inclusive)
+minHeight = 0
+; End height (exclusive)
+maxHeight = 40
+; Distribution across the height.
+; Valid options are:
+; - uniform: same probability across all y levels
+; - triangle: maximum in the middle ((minHeight+maxHeight) / 2), linear falloff to the bounds
+; - ramp: maximum at minHeight, linear falloff towards maxHeight
+; - revramp: maximum at maxHeight, linear falloff towards minHeight
+; - smooth: maximum in the middle, maintains high levels over a wide range before falling off
+; smoothly like a normal distribution with a more trapezoidal shape
+distribution = uniform
+
+; Settings for generating uranium ore
+[worldgen / uranium]
+; Enable generating this ore
+enabled = true
+; Amount of clusters to generate
+count = 20
+; Cluster size
+size = 3
+; Start height (inclusive)
+minHeight = 0
+; End height (exclusive)
+maxHeight = 64
+; Distribution across the height.
+; Valid options are:
+; - uniform: same probability across all y levels
+; - triangle: maximum in the middle ((minHeight+maxHeight) / 2), linear falloff to the bounds
+; - ramp: maximum at minHeight, linear falloff towards maxHeight
+; - revramp: maximum at maxHeight, linear falloff towards minHeight
+; - smooth: maximum in the middle, maintains high levels over a wide range before falling off
+; smoothly like a normal distribution with a more trapezoidal shape
+distribution = uniform
+
+[protection]
+; Enable logging of players when they remove a machine using a wrench.
+wrenchLogging = true
+; Maximum Explosion power of a nuke, where TNT is 4.
+nukeExplosionPowerLimit = 60
+; Maximum explosion power of a nuclear reactor, where TNT is 4.
+reactorExplosionPowerLimit = 45
+; Enable the nuke
+enableNuke = true
+
+[profiles]
+; Pick a profile to use, default options provided by IC2 are Experimental and Classic
+selected = Experimental
+
+[balance]
+; Maximum battery tier usable by the miner.
+; 1 = batteries, 2 = lead batteries, 3 = energy crystals, 4 = lapotron crystals
+minerDischargeTier = 1
+; Increase the energy use by the player's inventory weight when going through a teleporter.
+teleporterUseInventoryWeight = true
+; Ratio of energy retained inside energy storage block Items when wrenched.
+; 0 (nothing) ... 1 (100%), default 0.8 (80 %)
+energyRetainedInStorageBlockDrops = 0.8
+; Power tier of the Mass Fabricator
+massFabricatorTier = 3
+; Power tier of the Matter Fabricator
+matterFabricatorTier = 3
+; Factor to scale the UU-Matter production energy requirement.
+uuEnergyFactor = 1.0
+; Disable the vanilla ender chest, removing existing ones from the world as well.
+disableEnderChest = false
+; Comma separated list of blocks and items which should not be turned into scrap by the recycler.
+; Format: <name>[@metadata], metadata * matches any.
+; Ore dictionary entries can be specified with OreDict:<ore dict name> as the name.
+recyclerBlacklist = minecraft:glass_pane, minecraft:stick, minecraft:snowball, minecraft:snow_layer, minecraft:snow, IC2:scaffold
+; Whitelist for blocks/items allowed to be recycled.
+; The whitelist will be used instead of the blacklist approach if it's non-empty, disallowing everything else.
+; The format is the same as the blacklist.
+recyclerWhitelist = 
+; Allow to pick blocks up using just a pickaxe instead of needing a wrench.
+ignoreWrenchRequirement = false
+; Allow the water slot of water mills to be automated.
+watermillAutomation = false
+; How many EU the Chunkloader uses per chunk it loads.
+euPerChunk = 1.0
+
+; Base energy generation factors - increase for higher energy yield.
+[balance / energy / generator]
+generator = 1.0
+geothermal = 1.0
+water = 1.0
+solar = 1.0
+wind = 1.0
+nuclear = 1.0
+semiFluidOil = 1.0
+semiFluidFuel = 1.0
+semiFluidBiomass = 1.0
+semiFluidBioethanol = 1.0
+semiFluidBiogas = 1.0
+Stirling = 1.0
+Kinetic = 1.0
+radioisotope = 1.0
+
+; Base heat generation factors - increase for higher heat yield.
+[balance / energy / heatgenerator]
+semiFluidOil = 1.0
+semiFluidFuel = 1.0
+semiFluidBiomass = 1.0
+semiFluidBioethanol = 1.0
+semiFluidBiogas = 1.0
+solid = 1.0
+radioisotope = 1.0
+electric = 1.0
+
+; Base kinetic generation factors - increase for higher kinetic energy yield.
+[balance / energy / kineticgenerator]
+water = 1.0
+wind = 1.0
+manual = 1.0
+steam = 1.0
+electric = 1.0
+
+; Basically the amount of hU the conversion of one mB of Liquid takes/gives
+[balance / energy / fluidconversion]
+; Lava -> PahoehoeLava
+heatExchangerLava = 1.0
+; Hot Coolant <-> Cold Coolant
+heatExchangerHotCoolant = 1.0
+; Hot Water <- Water
+heatExchangerWater = 1.0
+
+; Base Coolant conversion rate for FluidReactors.
+[balance / energy / FluidReactor]
+outputModifier = 1.0
+
+; Balace Value for Turbine Livetime in sec. Default 86400sec = 24h
+[balance / SteamKineticGenerator]
+rotorlivetime = 86400
+
+; Balace Values for calcification default 100.000mB Water -> to failure
+[balance / steamgenerator / calcification]
+maxcalcification = 100000
+
+[balance / steamRepressurizer]
+; Amount (in mb) of standard steam per 10mb of IC2 steam
+steamPerSteam = 16
+; Amount (in mb) of standard steam per 10mb of IC2 super-heated steam
+steamPerSuperSteam = 32
+
+; Balance Values for Fermenter
+[balance / fermenter]
+need_amount_biomass_per_run = 20
+output_amount_biogas_per_run = 400
+hU_per_run = 4000
+biomass_per_fertilizier = 500
+
+; Additional initial uu values, a value of 1 equals cobblestone.
+; Recipes may cause the final value be lower than the one specified here.
+; Format: <name>[@metadata] = <value>
+[balance / uu-values / predefined]
+IC2:misc_resource#iridium_ore = 12000
+IC2:misc_resource#iridium_shard = 1333
+
+[recipes]
+; To modify recipes or add custom recipes, copy the corresponding .ini file to
+; "minecraft/config/ic2" and modify it.
+; 
+; Disable IC2 crafting recipes with the specified output, comma separated list.
+; Non-IC2 recipes can be removed via the purge list below.
+; Format: <name>[@metadata], e.g. minecraft:bucket to disable IC2's bucket recipe from tin.
+disable = 
+; Purge all non-IC2 crafting recipes with the specified output, comma separated list.
+; IC2 recipes can be removed via the disable list above.
+; Format: <name>[@metadata], e.g. minecraft:tnt to disable crafting tnt.
+purge = 
+; Blacklist for items which the jetpack attachment plate cannot be used on.
+; The format: <name>, e.g. minecraft:leather_chestplate to disable attaching jetpacks to leather tunics
+jetpackAttachmentBlacklist = 
+; Enable crafting of IC2 coins, otherwise they have to be spawned in and are thus limited.
+allowCoinCrafting = true
+; Allow only IC2 circuits to be used in IC2's recipes.
+requireIc2Circuits = false
+; Adjust smelting recipes to always output IC2 items if available.
+smeltToIc2Items = false
+; Ignore invalid recipes.
+ignoreInvalidRecipes = false
+
+[audio]
+; Enable IC2's custom sound system.
+enabled = true
+; Volume of IC2's sounds, range from 0 (silent) ... 1 (100%)
+volume = 1.0
+; The number of blocks the sounds attenuate over
+fadeDistance = 16
+; Maximum number of active audio sources, only change it if you know what you're doing.
+maxSourceCount = 32
+
+[misc]
+; Enable hiding of secret recipes in CraftGuide/NEI.
+hideSecretRecipes = true
+; Enable activation of the quantum leggings' speed boost when sprinting instead of holding the boost key.
+quantumSpeedOnSprint = true
+; Enable burning of scrap in a generator.
+allowBurningScrap = true
+; Comma separated list with ores the miner should harvest.
+; Format: <name>[@metadata], e.g. minecraft:torch, minecraft:chest
+; The metadata * will match any, e.g. minecraft:log@*.
+; Ore dictionary entries can be specified with OreDict:<ore dict name> as the name.
+additionalValuableOres = 
+; Use the new highly experimental current + voltage energy net model with energy loss.
+; Only set this to true if you know what you are doing.
+useLinearTransferModel = false
+; Configure whether energy loss is rounded down to the nearest whole EU or not
+roundEnetLoss = true
+; If you really really really don't want to have your machines explode if you don't pay attention to voltage, you can disable that here.
+enableEnetExplosions = true
+; Same for cable meltdown
+enableEnetCableMeltdown = true
+
+[debug]
+; Log whenever wrenching didn't produce any drops.
+logEmptyWrenchDrops = true
+; Log incorrect damage applications to items that aren't supposed to ever take damage.
+logIncorrectItemDamaging = false
+; Log problems occuring when processing connectivity updates in the energy network.
+logGridUpdateIssues = true
+; Log EnergyNet API accesses that aren't read-only - use this to debug IC2 addons.
+logEnetApiAccesses = false
+; Log EnergyNet API accesses with stack traces that aren't read-only - use this to debug IC2 addons.
+logEnetApiAccessTraces = false
+; Log all energy net connectivity updates in detail.
+logGridUpdatesVerbose = false
+; Log problems occuring during energy network calculations
+logGridCalculationIssues = true
+
+[agriculture]
+; Comma separated list of crops which should not be loaded.
+; Format: owner:crop
+; for example ic2:ferru, ic2:wheat
+disabledCrops = 
+
+[compat / buildcraft]
+; Allow BuildCraft fuels to be used in the fluid generators
+enableBuildcraftFuels = true
+

src/overrides/config/InvTweaks.cfg

@@ -0,0 +1,22 @@
+#Inventory Tweaks Configuration
+#(Regarding shortcuts, all key names can be found at: http://legacy.lwjgl.org/javadoc/org/lwjgl/input/Keyboard.html)
+#Thu May 26 11:57:27 CEST 2022
+enableMiddleClick=true
+showChestButtons=true
+enableSortingOnPickup=false
+enableAutoRefill=true
+autoRefillBeforeBreak=false
+autoRefillDamageThreshhold=5
+enableSounds=true
+enableShortcuts=true
+enableAutoEquipArmor=false
+enableServerItemSwap=true
+enableConfigLoadedMesssage=false
+invertToolDamageSorting=true
+shortcutKeyAllItems=LCONTROL+LSHIFT, RCONTROL+RSHIFT
+shortcutKeyEverything=SPACE
+shortcutKeyOneItem=LCONTROL, RCONTROL
+shortcutKeyToUpperSection=UP
+shortcutKeyToLowerSection=DOWN
+shortcutKeyDrop=LALT, RALT
+version=1.63+release.109.220f184

src/overrides/config/InvTweaksRules.txt

@@ -0,0 +1,31 @@
+|=================================================================|
+| INVENTORY TWEAKS Mod - https://inventory-tweaks.readthedocs.org |
+| Sorting rules and general configuration                         |
+|=================================================================|
+
+====== [ SETTINGS ] ======
+
+D LOCKED
+
+======== [ GETTING STARTED ] ========
+
+# SORTING RULES
+# Each line you type is a new constraint you add for sorting your inventory.
+# After any change, just press the sorting key to reload the settings. Some examples:
+# * "D1 sword" puts any sword in row D, column 1 (see grid below)
+# * "A edibleFood" fills the A row with food
+# * "1 ironPickaxe" fills the 1 column with an iron pickaxe
+# * "A1-C4 blocks" fills the rectangle with any blocks
+# * "D LOCKED" avoids items from the hotbar to move out of it when sorting
+
+# INVENTORY GRID
+#     1   2   3   4   5   6   7   8   9
+# A [A1][A2][A3][A4][A5][A6][A7][A8][A9]
+# B [B1][B2][B3][B4][B5][B6][B7][B8][B9]
+# C [C1][C2][C3][C4][C5][C6][C7][C8][C9]
+#  
+# D [D1][D2][D3][D4][D5][D6][D7][D8][D9]
+
+# AVAILABLE KEYWORDS
+# Open the 'InvTweaksTree.txt' file for a list of available keywords. If an item
+# is missing from the item tree (for example mod items), you can add it there.

src/overrides/config/LogisticsPipes.cfg

@@ -0,0 +1,74 @@
+# Configuration file
+
+async {
+    # Threshold for running asynchronous code. A lower value will make async calls with small networks where the impact is low. Low values might hurt performance
+    I:threshold=100
+}
+
+
+general {
+    # The max. distance between a player and the HUD that get's shown in blocks.
+    I:HUDRenderDistance=15
+
+    # Render every LP pipe opaque.
+    B:OpaquePipes=false
+
+    # The number of slots in a chassis pipe starting from MK1 to MK5. Because there are 5 tiers, there need to be 5 values (positive integers, zero is allowed).
+    I:chassisSlots <
+        1
+        2
+        3
+        4
+        8
+     >
+
+    # Should LogisticsPipes check for updates?
+    B:checkForUpdates=true
+
+    # The maximum number of buildcraft pipes (including forks) between logistics pipes. This is an indicator of the maximum amount of nodes the recursion algorithm will visit before giving up. As it is possible to fork a pipe connection using standard BC pipes the algorithm will attempt to discover all available destinations through that pipe. Do note that the logistics system will not interfere with the operation of non-logistics pipes. So a forked pipe will usually be sup-optimal, but it is possible. A low value might reduce CPU usage, a high value will be able to handle more complex pipe setups. If you never fork your connection between the logistics pipes this has the same meaning as detectionLength and the lower of the two will be used
+    I:detectionCount=100
+
+    # The maximum shortest length between logistics pipes. This is an indicator on the maxim depth of the recursion algorithm to discover logistics neighbours. A low value might use less CPU, a high value will allow longer pipe sections
+    I:detectionLength=50
+
+    # Set the default configuration for the popup of the Orderer Gui. Should it be used?
+    B:displayPopup=true
+
+    # Do you fancy easter eggs?
+    B:easterEggs=true
+
+    # Whether or not special particles will spawn.
+    B:enableParticleFX=true
+
+    # Number of LPower units the Logistics Crafting Table uses per craft.
+    I:logisticsCraftingTablePowerUsage=250
+
+    # The max. distance between two robots when there is no zone defined.
+    I:maxRobotDistance=64
+
+    # Inverts the the mouse wheel scrolling for remote order number of items
+    B:ordererCountInvertWheel=false
+
+    # Inverts the the mouse wheel scrolling for remote order pages
+    B:ordererPageInvertWheel=false
+
+    # Disable the power usage trough LogisticsPipes
+    B:powerUsageDisabled=false
+
+    # A Multiplyer for the power usage.
+    D:powerUsageMultiplyer=1.0
+
+    # The amount of time that passes between checks to see if it is still connected to its neighbours (Independently from block place detection). A low value will mean that it will correct wrong values faster but use more CPU. A high value means error correction takes longer, but CPU consumption is reduced. A value of 20 will check about every second (default 600 [30 seconds])
+    I:reDetectionFrequency=600
+}
+
+
+multithread {
+    # Number of routing table update Threads, 0 to disable.
+    I:count=4
+
+    # Priority of the multiThread Threads. 10 is highest, 5 normal, 1 lowest
+    I:priority=5
+}
+
+

src/overrides/config/MatterOverdrive/MatterOverdrive.cfg

@@ -0,0 +1,627 @@
+# Configuration file
+
+~CONFIG_VERSION: 1.0
+
+##########################################################################################################
+# abilities
+#--------------------------------------------------------------------------------------------------------#
+# Android Player Abilities
+##########################################################################################################
+
+abilities {
+    # The energy cost of the Cloak
+    I:cloak_energy_per_tick=128
+
+    # The energy cost of each heal by the Nanobots ability
+    I:heal_energy_per_regen=32
+
+    # The energy cost of each High Jump
+    I:high_jump_energy=1024
+
+    # The energy cost of the Nightvision
+    I:nighvision_energy_per_tick=16
+
+    # The energy cost of each hit to the shield
+    I:shield_energy_per_damage=256
+
+    # The energy cost of the shield per tick
+    I:shield_energy_per_tick=64
+
+    # The Unlocalized names of the blacklist blocks that the player can't teleport to [default: [hellsand], [barrier], [bedrock]]
+    S:teleport_blacklist <
+        hellsand
+        barrier
+        bedrock
+     >
+
+    # The Energy cost of each Teleportation
+    I:teleport_energy_cost=4096
+
+    # The maximum distance in blocks, the player can teleport to
+    I:teleport_max_distance=32
+
+    # The max height amount that the teleport ability checks if there is no 2 blocks air space
+    I:teleport_max_height_check=8
+}
+
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# Options for the Matter overdrive client
+##########################################################################################################
+
+client {
+    # Use the custom holo shader for holographic items [default: true]
+    B:"use holo shader"=true
+
+    # Should Matter Overdrive check for newer versions, every time the world starts
+    B:version_check=true
+
+    ##########################################################################################################
+    # android_hud
+    #--------------------------------------------------------------------------------------------------------#
+    # Positioning and colors of Android HUD elements
+    ##########################################################################################################
+
+    android_hud {
+        I:android_biotic_stats.position=2
+        I:android_minimap.position=6
+        I:android_stats.position=0
+
+        # Should the health bar and food bar be hidden
+        B:hide_vanilla_hud_elements=true
+
+        # The opacity of the black background for each HUD element
+        D:hud_background_opacity=0.0
+        S:hud_color=ffa9e2fb
+
+        # Should the Android HUD move when the player turns his head.
+        B:hud_movement=true
+
+        # The Opacity of the HUD in %
+        D:hud_opacity=0.5
+    }
+
+}
+
+
+##########################################################################################################
+# compatibility
+#--------------------------------------------------------------------------------------------------------#
+# Option for other mods
+##########################################################################################################
+
+compatibility {
+}
+
+
+##########################################################################################################
+# debug
+#--------------------------------------------------------------------------------------------------------#
+# Debug Options. Such as Debug Log for Matter Recipe Calculation
+##########################################################################################################
+
+debug {
+    B:"matter calculation"=false
+    B:"matter registration"=false
+}
+
+
+##########################################################################################################
+# entities
+#--------------------------------------------------------------------------------------------------------#
+# Options for Matter Overdrive Entities. Such as their Entity IDs.
+##########################################################################################################
+
+entities {
+
+    android_player {
+        B:disable_android_fov=true
+        B:hurt_glitching=true
+        S:potion_removal_blacklist <
+         >
+        I:recharge_amount_on_respawn=64000
+        B:remove_potion_effects=true
+        B:transformation_death=true
+    }
+
+    failed_pig {
+        B:enable=true
+    }
+
+    failed_cow {
+        B:enable=true
+    }
+
+    failed_chicken {
+        B:enable=true
+    }
+
+    failed_sheep {
+        B:enable=true
+    }
+
+    mad_scientist {
+        B:enable=true
+    }
+
+    mutant_scientist {
+        B:enable=true
+    }
+
+    rogue_android {
+        # Rogue Android biome blacklist [default: [Hell], [Sky], [MushroomIsland], [MushroomIslandShore]]
+        S:biome.blacklist <
+            Hell
+            Sky
+            MushroomIsland
+            MushroomIslandShore
+         >
+
+        # Rogue Android biome whitelist [default: ]
+        S:biome.whitelist <
+         >
+
+        # Rogue Android Dimension ID blacklist
+        I:dimension.blacklist <
+            1
+         >
+
+        # Rogue Android Dimension ID whitelist
+        I:dimension.whitelist <
+         >
+
+        # Should the Rouge Androids drop any items [default: true]
+        B:do_drops=true
+
+        # Should Legendary rogue androids drop Legendary weapons [default: true]
+        B:drop_legendary_weapons=true
+
+        # Should normal Rogue Androids drop their weapons? If set to false they will never drop their weapons, but if set to true there is a small chance they will drop them. [default: true]
+        B:drop_weapons=true
+        B:enable=true
+
+        # The chance in percent, of rogue androids becoming legendary. This is the base value. This value is multiplied by the android's level [range: 0.0 ~ 1.0, default: 0.03]
+        S:legendary_spawn_chance_percent=0.03
+
+        # The max amount of Rogue Android that can spawn in a given chunk
+        I:max_android_per_chunk=4
+
+        # The spawn chance of rogue androids. How likely are they to spawn once chosen to spawn. [range: 0.0 ~ 1.0, default: 0.1]
+        S:spawn_chance_percent=0.1
+
+        # The spawn weight of Androids. This controls how likely are to be chosen to spawn next. [range: 0 ~ 100, default: 25]
+        I:spawn_weight=25
+
+        # Do Ranged Rogue Androids have unlimited weapon energy in their weapons [default: true]
+        B:unlimited_weapon_energy=true
+    }
+
+    ranged_rogue_android {
+        B:enable=true
+    }
+
+    drone {
+        B:enable=true
+    }
+
+}
+
+
+##########################################################################################################
+# machine options
+#--------------------------------------------------------------------------------------------------------#
+# Machine Options.
+##########################################################################################################
+
+"machine options" {
+    # The range of the Charge Station
+    I:"charge station range"=8
+
+    tritanium_crate_brown {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_black {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_light_blue {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_blue {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    matter_analyzer {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    fusion_reactor_io {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    decomposer {
+        # Decomposing cost per matter
+        I:cost.decompose=6000
+
+        # The speed in ticks, of decomposing. (per matter)
+        I:speed.decompose=80
+
+        # How much energy can the Matter Decomposer hold
+        I:storage.energy=512000
+
+        # How much matter can the Matter Decomposer hold
+        I:storage.matter=1024
+
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_cyan {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    replicator {
+        # The total replication cost of each matter value. The energy cost is calculated like so: (matterAmount*EnergyCost)
+        I:cost.replication.energy=16000
+
+        # Should vent particles be displayed
+        B:particles.vent=true
+
+        # The replication speed in ticks per matter value
+        I:speed.replication=120
+
+        # How much energy can the replicator hold
+        I:storage.energy=512000
+
+        # How much matter can the replicator hold
+        I:storage.matter=1024
+
+        # The volume of the Machine
+        D:volume=1.0
+
+        # The volume of the replication animation
+        D:volume.replicate=1.0
+    }
+
+    network_switch {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    spacetime_accelerator {
+        # The volume of the Machine
+        D:volume=1.0
+
+        # Show the wave particle when the machine is active
+        B:wave_particle=true
+    }
+
+    tritanium_crate_white {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_silver {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_gray {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_orange {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    android_spawner {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    inscriber {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_purple {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    pattern_storage {
+        # Should vent particles be displayed
+        B:particles.vent=true
+
+        # How much energy can the Pattern Storage hold
+        I:storage.energy=64000
+
+        # The Transfer speed of the Pattern Storage
+        I:transfer.energy=128
+
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    pattern_monitor {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    network_router {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    solar_panel {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    holo_sign {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_yellow {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    weapon_station {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    transporter {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    gravitational_stabilizer {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_lime {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_red {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    charging_station {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    star_map {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    matter_recycler {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    contract_market {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    fusion_reactor_controller {
+        # The time delay between each structure check
+        I:check.delay=40
+
+        # The maximum distance of the anomaly
+        I:distance.anomaly=3
+
+        # How much matter is drained per tick. Dependant on the size of the anomaly as well
+        D:drain.matter=0.0125
+
+        # The Energy Output per tick. Dependant on the size of the anomaly as well
+        I:output.energy=2048
+
+        # How much energy can the Fusion Reactor Controller hold
+        I:storage.energy=100000000
+
+        # How much matter can the Fusion Reactor Controller hold
+        I:storage.matter=2048
+
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_green {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_pink {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    tritanium_crate_magenta {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+    android_station {
+        # The volume of the Machine
+        D:volume=1.0
+    }
+
+}
+
+
+##########################################################################################################
+# matter network
+#--------------------------------------------------------------------------------------------------------#
+# Matter Network Options.
+##########################################################################################################
+
+"matter network" {
+    # The maximum amount of network packet broadcasts per tick.
+    I:"max broadcasts per tick"=128
+}
+
+
+##########################################################################################################
+# matter registry
+#--------------------------------------------------------------------------------------------------------#
+# Configuration for the Matter 
+##########################################################################################################
+
+"matter registry" {
+    B:"automatic matter calculation from furnace"=true
+    B:"automatic matter calculation from inscriber"=true
+    B:"automatic matter calculation from recipe"=true
+    B:automatic_calculation=true
+    S:blacklist <
+     >
+    S:mod_blacklist <
+     >
+
+    ##########################################################################################################
+    # add matter
+    #--------------------------------------------------------------------------------------------------------#
+    # Registration of new items and the amount of matter they contain. Add them like so: I:[registered name or ore Dictionary name](meta)=[matter amount]. () - optional parameter. Example I:dye2=10 I:egg=29
+    ##########################################################################################################
+
+    "add matter" {
+    }
+
+}
+
+
+##########################################################################################################
+# server
+#--------------------------------------------------------------------------------------------------------#
+# Options form the Matter Overdrive server
+##########################################################################################################
+
+server {
+
+    gravitational_anomaly {
+        # Should the gravitational anomaly destroy blocks [default: true]
+        B:"block destruction"=true
+
+        # Should the blocks drop entities or be directly consumed when destroyed by the gravitational anomaly [default: true]
+        B:"gravitational anomaly block entities"=true
+
+        # Should blocks be turned into falling blocks when broken [default: true]
+        B:"gravitational anomaly falling blocks"=true
+
+        # Should other mod fluid blocks be consumed by the anomaly [default: true]
+        B:"gravitational anomaly forge fluids"=true
+
+        # Should vanilla fluid block such as water and lava be consumed by the anomaly [default: true]
+        B:"gravitational anomaly vanilla fluids"=true
+
+        # Should the gravitational entity pull entities towards it [default: true]
+        B:"gravitational pull"=true
+    }
+
+}
+
+
+starmap {
+    # The multiplier for the building and ship building times [range: 0.0 ~ 10.0, default: 1.0]
+    S:"galaxy build time multiply"=1.0
+
+    # The multiplier for the ship travel times [range: 0.0 ~ 10.0, default: 1.0]
+    S:"galaxy travel time multiply"=1.0
+
+    # The maximum amount of planets pre star system [range: 0 ~ 8, default: 4]
+    I:max_planet_count=4
+
+    # The maximum amount of stars in a galaxy [range: 0 ~ 512000, default: 2304]
+    I:max_star_count=2304
+
+    # The minimum amount of planets per star system [range: 0 ~ 8, default: 1]
+    I:min_planet_count=1
+
+    # The minimum amount of stars in a galaxy [range: 0 ~ 512000, default: 2048]
+    I:min_star_count=2048
+
+    # The chance of adding a prefix to a Star System's name [range: 0.0 ~ 1.0, default: 1.0]
+    S:name_prefix_chance=1.0
+
+    # The chance of adding a suffix to a Star System's name [range: 0.0 ~ 1.0, default: 0.8]
+    S:name_suffix_chance=0.8
+
+    # The amount of quadrants the galaxy should be divided into. The amount is cubed. x ^ 3. For example 3 ^ 3 = 27 quadrants. [range: 1 ~ 6, default: 3]
+    I:quadrant_count=3
+}
+
+
+##########################################################################################################
+# world gen
+#--------------------------------------------------------------------------------------------------------#
+# World Generation options.
+##########################################################################################################
+
+"world gen" {
+    # Should Matter Overdrive Buildings Generate aka ImageGen [default: true]
+    B:"generate buildings"=true
+
+    # A blacklist of all the Dimensions ores shouldn't spawn in
+    I:ore_gen_blacklist <
+        -1
+        2
+     >
+
+    # Should Matter Overdrive Ore Blocks be Generated ?
+    B:"spawn ores"=true
+
+    # Should other Matter Overdrive World Blocks be Generated?
+    B:"spawn other"=true
+    B:spawn.tile.dilithium_ore=true
+    B:spawn.tile.gravitational_anomaly=true
+    B:spawn.tile.tritanium_ore=true
+
+    gravitational_anomaly {
+        # Gravitational Anomaly Dimension ID blacklist
+        I:blacklist <
+         >
+
+        # Spawn Chance of Gravity Anomaly pre chunk [range: 0.0 ~ 1.0, default: 0.05]
+        S:"gravitational anomaly spawn chance"=0.05
+
+        # Spawn Y level of the Gravity Anomaly [default: ]
+        S:"gravitational anomaly spawn y level" <
+         >
+
+        # Gravitational Anomaly Dimension ID whitelist
+        I:whitelist <
+            -1
+            0
+         >
+    }
+
+}
+
+

src/overrides/config/MatterOverdrive/recipes/inscriber.xml

@@ -0,0 +1,22 @@
+<recipes>
+    <!-- Isolinear Circuit Mark 1 + Gold = Isolinear Circuit Mark 2 -->
+    <recipe energy="64000" time="300">
+        <primary modid="matteroverdrive" name="isolinear_circuit" meta="0" count="1"/>
+        <secondary modid="minecraft" name="gold_ingot" meta="0" count="1"/>
+        <output modid="matteroverdrive" name="isolinear_circuit" meta="1" count="1"/>
+    </recipe>
+
+    <!-- Isolinear Circuit Mark 2 + Diamond = Isolinear Circuit Mark 3 -->
+    <recipe energy="88000" time="600">
+        <primary modid="matteroverdrive" name="isolinear_circuit" meta="1" count="1"/>
+        <secondary modid="minecraft" name="diamond" meta="0" count="1"/>
+        <output modid="matteroverdrive" name="isolinear_circuit" meta="2" count="1"/>
+    </recipe>
+
+    <!-- Isolinear Circuit Mark 3 + Emerald = Isolinear Circuit Mark 4 -->
+    <recipe energy="114000" time="1200">
+        <primary modid="matteroverdrive" name="isolinear_circuit" meta="2" count="1"/>
+        <secondary modid="minecraft" name="emerald" meta="0" count="1"/>
+        <output modid="matteroverdrive" name="isolinear_circuit" meta="3" count="1"/>
+    </recipe>
+</recipes>

src/overrides/config/MrTJPCore.cfg

@@ -0,0 +1,32 @@
+# Configuration file
+
+##########################################################################################################
+# general
+#--------------------------------------------------------------------------------------------------------#
+# General settings for MrTJPCore
+##########################################################################################################
+
+general {
+    # Flag to set if the update checker should consider unstable builds as a new version.
+    B:"Include Unstable"=false
+
+    # Flag to enable or disable the update checker.
+    B:"Version Checking"=true
+}
+
+
+##########################################################################################################
+# world gen
+#--------------------------------------------------------------------------------------------------------#
+# Settings related to world generation
+##########################################################################################################
+
+"world gen" {
+    # The database ID that is used to store which chunks have been generated already. Changing this will cause generation to run again on the same chunk.
+    S:"RetroGen ID"=mrtjp_gen
+
+    # Toggle to enable retrogeneration, a feature that would allow ores to be generated after the world has been created.
+    B:"Retroactive World Generation"=false
+}
+
+

src/overrides/config/OpenModsLibCore.json

@@ -0,0 +1,52 @@
+{
+  "hook_pre_world_rendering": {
+    "version": 0,
+    "value": "true",
+    "comment": [
+      "Purpose: hook in world rendering, triggered between sky and terrain",
+      "Modified class: net.minecraft.client.renderer.EntityRenderer",
+      "Known users: Sky block",
+      "When disabled: Sky block will not render properly"
+    ]
+  },
+  "llama_null_fix": {
+    "version": 0,
+    "value": "true",
+    "comment": [
+      "Purpose: prevent NPE when creating llama without world",
+      "Modified class: net.minecraft.entity.passive.EntityLlama",
+      "Known users: Trophy",
+      "When disabled: Llama trophy cannot be rendered"
+    ]
+  },
+  "activate_player_render_hook": {
+    "version": 0,
+    "value": "true",
+    "comment": [
+      "Purpose: add hook to player rendering code",
+      "Modified class: net.minecraft.client.renderer.entity.RenderPlayer",
+      "Known users: OpenBlocks hangglider",
+      "When disabled: code may fallback to less compatible mechanism (like replacing renderer)"
+    ]
+  },
+  "horse_base_null_fix": {
+    "version": 0,
+    "value": "true",
+    "comment": [
+      "Purpose: prevent NPE when creating horse without world",
+      "Modified class: net.minecraft.entity.passive.AbstractHorse",
+      "Known users: Trophy",
+      "When disabled: Trophy for any horse variant cannot be rendered"
+    ]
+  },
+  "horse_null_fix": {
+    "version": 0,
+    "value": "true",
+    "comment": [
+      "Purpose: prevent NPE when creating horse without world",
+      "Modified class: net.minecraft.entity.passive.EntityHorse",
+      "Known users: Trophy",
+      "When disabled: Horse trophy cannot be rendered"
+    ]
+  }
+}

src/overrides/config/Practical-Logistics/Main-Config.cfg

@@ -0,0 +1,44 @@
+# Configuration file
+
+sapphire_ore {
+    # the chance of a sapphire ore spawning [range: 1 ~ 500, default: 15]
+    I:Chance=15
+
+    # Should Sapphire Ore be spawned in the world. [default: true]
+    B:"Generate Ore"=true
+
+    # the largest amount of sapphire found in one vein [range: 1 ~ 500, default: 8]
+    I:"Max Vein Size"=8
+
+    # the maximum Y coord where this will spawn [range: 1 ~ 500, default: 16]
+    I:"Max Y"=16
+
+    # the smallest amount of sapphire found in one vein [range: 1 ~ 500, default: 2]
+    I:"Min Vein Size"=2
+
+    # the minimum Y coord where this will spawn [range: 1 ~ 500, default: 2]
+    I:"Min Y"=2
+}
+
+
+settings {
+    # how frequently to update energy, increase if server is lagging [range: 0 ~ 100, default: 10]
+    I:"Energy Reader Rate"=10
+
+    # how frequently to update fluids, increase if server is lagging [range: 0 ~ 100, default: 10]
+    I:"Fluid Reader Rate"=10
+
+    # how frequently to update info, increase if server is lagging [range: 0 ~ 100, default: 20]
+    I:"Info Reader Rate"=20
+
+    # how frequently to update inventories, increase if server is lagging [range: 0 ~ 100, default: 20]
+    I:"Inventory Reader Rate"=20
+
+    # logs when anything is connected to and from a networks, good for debugging [default: false]
+    B:"Log Connection Events"=false
+
+    # how frequently to update each Transfer Node, increase if server is lagging [range: 0 ~ 100, default: 20]
+    I:"Transfer Network Rate"=20
+}
+
+

src/overrides/config/ProjectE/ProjectE.cfg

@@ -0,0 +1,163 @@
+# Configuration file
+
+general {
+
+    difficulty {
+        # Adjusting this ratio changes how much EMC is received when burning a item. For example setting this to 0.5 will return half of the EMC cost.
+        # Min: 0.1
+        # Max: 1.0
+        D:covalenceLoss=1.0
+
+        # How rounding occurs when Covalence Loss results in a burn value less than 1 EMC. If true the value will be rounded up to 1. If false the value will be rounded down to 0.
+        B:covalenceLossRounding=true
+
+        # The Tome of Knowledge can be crafted.
+        B:craftableTome=false
+
+        # Amount of damage Katar 'C' key deals
+        # Min: 0.0
+        # Max: 2.147483647E9
+        D:katarDeathAura=1000.0
+
+        # Set to false to disable Gem Armor offensive abilities (helmet zap and chestplate explosion)
+        B:offensiveAbilities=true
+    }
+
+    items {
+        # If set to true, disables all radius-based mining functionaliy (right click of tools)
+        B:disableAllRadiusMining=false
+
+        # Enable Watch of Flowing Time
+        B:enableTimeWatch=true
+
+        # Allows the Harvest Goddess Band to passively grow tall grass, flowers, etc, on top of grass blocks.
+        B:harvBandGrass=false
+
+        # Instead of vein mining the ore you right click with your Dark/Red Matter Pick/Star it vein mines all ores in an AOE around you like it did in ProjectE before version 1.4.4.
+        B:pickaxeAoeVeinMining=false
+    }
+
+    effects {
+        # If true the Interdiction Torch only affects hostile mobs. If false it affects all non blacklisted living entities.
+        B:interdictionMode=true
+
+        # Bonus ticks given by the Watch of Flowing Time while in the pedestal. 0 = effectively no bonus.
+        # Min: 0
+        # Max: 256
+        I:timePedBonus=18
+
+        # Factor the Watch of Flowing Time slows down mobs by while in the pedestal. Set to 1.0 for no slowdown.
+        # Min: 0.0
+        # Max: 1.0
+        D:timePedMobSlowness=0.10000000149011612
+
+        # Block ID's that the Watch of Flowing Time should not give extra random ticks to
+        S:timeWatchBlockBlacklist <
+         >
+
+        # Tile entity ID's that the Watch of Flowing Time should not give extra ticks to.
+        S:timeWatchTEBlacklist <
+            projecte:dm_pedestal
+         >
+    }
+
+    misc {
+        # Enable a more verbose debug logging
+        B:debugLogging=false
+
+        # Show the EMC value as a tooltip on items and blocks
+        B:emcToolTips=true
+
+        # A cooldown (in ticks) for Gem Chestplate explosion
+        # Min: 0
+        # Max: 2147483647
+        I:gemChestCooldown=0
+
+        # Show item Ore Dictionary names in tooltips (useful for custom EMC registration)
+        B:odToolTips=false
+
+        # Show DM pedestal functions in item tooltips
+        B:pedestalToolTips=true
+
+        # A cooldown (in ticks) for firing projectiles
+        # Min: 0
+        # Max: 2147483647
+        I:projectileCooldown=0
+
+        # The Philosopher's Stone overlay softly pulsates
+        B:pulsatingOverlay=false
+
+        # Show stats as tooltips for various ProjectE blocks
+        B:statToolTips=true
+
+        # False requires your hand be empty for Gem Armor Offensive Abilities to be readied or triggered
+        B:unsafeKeyBinds=false
+    }
+
+    ##########################################################################################################
+    # pedestalcooldown
+    #--------------------------------------------------------------------------------------------------------#
+    # Cooldown for various items within the pedestal. A cooldown of -1 will disable the functionality.
+    # A cooldown of 0 will cause the actions to happen every tick. Use caution as a very low value could cause TPS issues.
+    ##########################################################################################################
+
+    pedestalcooldown {
+        # Delay between Archangel Smite shooting arrows while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:archangelPedCooldown=40
+
+        # Delay between Body Stone healing 0.5 shanks while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:bodyPedCooldown=10
+
+        # Delay between Evertide Amulet trying to start rain while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:evertidePedCooldown=20
+
+        # Delay between Harvest Goddess trying to grow and harvest while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:harvestPedCooldown=10
+
+        # Delay between Ignition Ring trying to light entities on fire while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:ignitePedCooldown=40
+
+        # Delay between Life Stone healing both food and hunger by 0.5 shank/heart while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:lifePedCooldown=5
+
+        # Delay between Talisman of Repair trying to repair player items while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:repairPedCooldown=20
+
+        # Delay between Soul Stone healing 0.5 hearts while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:soulPedCooldown=10
+
+        # Delay between SWRG trying to smite mobs while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:swrgPedCooldown=70
+
+        # Delay between Volcanite Amulet trying to stop rain while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:volcanitePedCooldown=20
+
+        # Delay between Zero Ring trying to extinguish entities and freezing ground while in the pedestal.
+        # Min: -1
+        # Max: 2147483647
+        I:zeroPedCooldown=40
+    }
+
+}
+
+

src/overrides/config/ProjectE/customConversions/ODdefaults.json

@@ -0,0 +1,55 @@
+{
+  "comment": "Various default values for OreDictionary names, from vanilla and other mods",
+  "comment_1": "This file is only shown as an example, it will be regenerated every time mapping occurs in order to let us",
+  "comment_2": "change default values. To specify your own custom values use a separate JSON or the /projecte commands ingame",
+  "values": {
+    "before": {
+      "OD|logWood": 32,
+      "OD|plankWood": 8,
+      "OD|treeSapling": 32,
+      "OD|stickWood": 4,
+      "OD|treeLeaves": 1,
+
+      "OD|blockGlass": 1,
+      "OD|blockCloth": 48,
+
+      "OD|stone": 1,
+      "OD|cobblestone": 1,
+
+      "OD|gemDiamond": 8192,
+      "OD|dustRedstone": 64,
+      "OD|dustGlowstone": 384,
+      "OD|dustCoal": 64,
+      "OD|dustCharcoal": 16,
+      "OD|dustSulfur": 32,
+
+      "OD|ingotThaumium": 2048,
+      "OD|itemSilicon": 32,
+      "OD|ingotOsmium": 512,
+
+      "OD|crystalCertusQuartz": 64,
+      "OD|crystalFluix": 256,
+      "OD|dustCertusQuartz": 32,
+      "OD|dustFluix": 128,
+
+      "OD|gemRuby": 2048,
+      "OD|gemSapphire": 2048,
+      "OD|gemPeridot": 2048,
+      "OD|blockMarble": 4,
+
+      "OD|blockGlassHardened": 192,
+
+      "OD|itemRubber": 32,
+      "OD|ingotUranium": 4096,
+      "OD|ingotCyanite": 1024,
+
+      "OD|shardAir": 64,
+      "OD|shardFire": 64,
+      "OD|shardWater": 64,
+      "OD|shardEarth": 64,
+      "OD|shardOrder": 64,
+      "OD|shardEntropy": 64,
+      "OD|shardNether": 64
+    }
+  }
+}

src/overrides/config/ProjectE/customConversions/defaults.json

@@ -0,0 +1,260 @@
+{
+  "comment": "Default values for non-OreDictionary vanilla items",
+  "comment_1": "This file is only shown as an example, it will be regenerated every time mapping occurs in order to let us",
+  "comment_2": "change default values. To specify your own custom values use a separate JSON or the /projecte commands ingame",
+  "groups": {
+    "default": {
+      "comment": "Default conversion group",
+      "conversions": [
+        {
+          "output": "minecraft:grass|0",
+          "ingredients": {
+            "minecraft:dirt|0": 2
+          }
+        },
+        {
+          "output": "minecraft:dirt|2",
+          "ingredients": {
+            "minecraft:dirt|0": 2
+          }
+        },
+        {
+          "output": "minecraft:mycelium|0",
+          "ingredients": {
+            "minecraft:dirt|0": 2
+          }
+        },
+        {
+          "output": "minecraft:grass_path|0",
+          "ingredients": [ "minecraft:grass|0" ]
+        },
+        {
+          "output": "minecraft:iron_horse_armor|0",
+          "ingredients": {
+            "minecraft:iron_ingot|0": 8
+          }
+        },
+        {
+          "output": "minecraft:golden_horse_armor|0",
+          "ingredients": {
+            "minecraft:gold_ingot|0": 8
+          }
+        },
+        {
+          "output": "minecraft:diamond_horse_armor|0",
+          "ingredients": {
+            "minecraft:diamond|0": 8
+          }
+        }
+      ]
+    },
+    "concrete_powder_to_block": {
+      "comment": "Propagate concrete powder values to concrete blocks",
+      "conversions": [
+        {
+          "output": "minecraft:concrete|0",
+          "ingredients": [ "minecraft:concrete_powder|0" ]
+        },
+        {
+          "output": "minecraft:concrete|1",
+          "ingredients": [ "minecraft:concrete_powder|1" ]
+        },
+        {
+          "output": "minecraft:concrete|2",
+          "ingredients": [ "minecraft:concrete_powder|2" ]
+        },
+        {
+          "output": "minecraft:concrete|3",
+          "ingredients": [ "minecraft:concrete_powder|3" ]
+        },
+        {
+          "output": "minecraft:concrete|4",
+          "ingredients": [ "minecraft:concrete_powder|4" ]
+        },
+        {
+          "output": "minecraft:concrete|5",
+          "ingredients": [ "minecraft:concrete_powder|5" ]
+        },
+        {
+          "output": "minecraft:concrete|6",
+          "ingredients": [ "minecraft:concrete_powder|6" ]
+        },
+        {
+          "output": "minecraft:concrete|7",
+          "ingredients": [ "minecraft:concrete_powder|7" ]
+        },
+        {
+          "output": "minecraft:concrete|8",
+          "ingredients": [ "minecraft:concrete_powder|8" ]
+        },
+        {
+          "output": "minecraft:concrete|9",
+          "ingredients": [ "minecraft:concrete_powder|9" ]
+        },
+        {
+          "output": "minecraft:concrete|10",
+          "ingredients": [ "minecraft:concrete_powder|10" ]
+        },
+        {
+          "output": "minecraft:concrete|11",
+          "ingredients": [ "minecraft:concrete_powder|11" ]
+        },
+        {
+          "output": "minecraft:concrete|12",
+          "ingredients": [ "minecraft:concrete_powder|12" ]
+        },
+        {
+          "output": "minecraft:concrete|13",
+          "ingredients": [ "minecraft:concrete_powder|13" ]
+        },
+        {
+          "output": "minecraft:concrete|14",
+          "ingredients": [ "minecraft:concrete_powder|14" ]
+        },
+        {
+          "output": "minecraft:concrete|15",
+          "ingredients": [ "minecraft:concrete_powder|15" ]
+        }
+      ]
+    },
+    "notch_apple": {
+      "comment": "Give Notch apple a value based on its old recipe",
+      "conversions": [
+        {
+          "output": "minecraft:golden_apple|1",
+          "ingredients": {
+            "minecraft:apple|0": 1,
+            "minecraft:gold_block|0": 8
+          }
+        }
+      ]
+    }
+  },
+  "values": {
+    "before": {
+      "minecraft:cobblestone|0": 1,
+      "minecraft:stone|0": 1,
+      "minecraft:stone|1": 16,
+      "minecraft:stone|3": 16,
+      "minecraft:stone|5": 16,
+      "minecraft:stonebrick|2": 1,
+      "minecraft:stonebrick|3": 1,
+      "minecraft:end_stone|0": 1,
+      "minecraft:netherrack|0": 1,
+      "minecraft:dirt|0": 1,
+      "minecraft:sand|0": 1,
+      "minecraft:sand|1": 1,
+      "minecraft:snow|0": 1,
+      "minecraft:ice|0": 1,
+      "minecraft:deadbush|0": 1,
+      "minecraft:gravel|0": 4,
+      "minecraft:cactus|0": 8,
+      "minecraft:vine|0": 8,
+      "minecraft:web|0": 12,
+      "minecraft:waterlily|0": 16,
+      "minecraft:red_flower|0": 16,
+      "minecraft:red_flower|1": 16,
+      "minecraft:red_flower|2": 16,
+      "minecraft:red_flower|3": 16,
+      "minecraft:red_flower|4": 16,
+      "minecraft:red_flower|5": 16,
+      "minecraft:red_flower|6": 16,
+      "minecraft:red_flower|7": 16,
+      "minecraft:red_flower|8": 16,
+      "minecraft:double_plant|0": 32,
+      "minecraft:double_plant|1": 32,
+      "minecraft:double_plant|4": 32,
+      "minecraft:double_plant|5": 32,
+      "minecraft:yellow_flower|0": 16,
+      "minecraft:red_mushroom|0": 32,
+      "minecraft:brown_mushroom|0": 32,
+      "minecraft:reeds|0": 32,
+      "minecraft:soul_sand|0": 49,
+      "minecraft:obsidian|0": 64,
+      "minecraft:stained_hardened_clay|*": 64,
+      "minecraft:sponge|0": 128,
+      "minecraft:sponge|1": 128,
+      "minecraft:tallgrass|0": 1,
+      "minecraft:tallgrass|1": 1,
+      "minecraft:tallgrass|2": 1,
+      "minecraft:double_plant|2": 1,
+      "minecraft:double_plant|3": 1,
+      "minecraft:packed_ice|0": 4,
+      "minecraft:magma|0": 128,
+
+      "minecraft:chorus_plant|0": 64,
+      "minecraft:chorus_flower|0": 96,
+      "minecraft:wheat_seeds|0": 16,
+      "minecraft:beetroot_seeds|0": 16,
+      "minecraft:melon|0": 16,
+      "minecraft:wheat|0": 24,
+      "minecraft:nether_wart|0": 24,
+      "minecraft:apple|0": 128,
+      "minecraft:pumpkin|0": 144,
+      "minecraft:porkchop|0": 64,
+      "minecraft:beef|0": 64,
+      "minecraft:chicken|0": 64,
+      "minecraft:rabbit|0": 64,
+      "minecraft:mutton|0": 64,
+      "minecraft:fish|0": 64,
+      "minecraft:fish|1": 64,
+      "minecraft:fish|2": 64,
+      "minecraft:fish|3": 64,
+      "minecraft:carrot|0": 64,
+      "minecraft:beetroot|0": 64,
+      "minecraft:potato|0": 64,
+      "minecraft:poisonous_potato|0": 64,
+      "minecraft:chorus_fruit|0": 192,
+
+      "minecraft:string|0": 12,
+      "minecraft:rotten_flesh|0": 32,
+      "minecraft:slime_ball|0": 32,
+      "minecraft:egg|0": 32,
+      "minecraft:feather|0": 48,
+      "minecraft:rabbit_hide|0": 16,
+      "minecraft:rabbit_foot|0": 128,
+      "minecraft:spider_eye|0": 128,
+      "minecraft:gunpowder|0": 192,
+      "minecraft:ender_pearl|0": 1024,
+      "minecraft:blaze_rod|0": 1536,
+      "minecraft:shulker_shell|0": 2048,
+      "minecraft:ghast_tear|0": 4096,
+      "minecraft:dragon_egg|0": 262144,
+      "minecraft:potion|0": 0,
+
+      "minecraft:saddle|0": 192,
+      "minecraft:name_tag|0": 192,
+      "minecraft:record_11|0": 2048,
+      "minecraft:record_13|0": 2048,
+      "minecraft:record_blocks|0": 2048,
+      "minecraft:record_cat|0": 2048,
+      "minecraft:record_chirp|0": 2048,
+      "minecraft:record_far|0": 2048,
+      "minecraft:record_mall|0": 2048,
+      "minecraft:record_mellohi|0": 2048,
+      "minecraft:record_stal|0": 2048,
+      "minecraft:record_strad|0": 2048,
+      "minecraft:record_wait|0": 2048,
+      "minecraft:record_ward|0": 2048,
+
+      "minecraft:diamond|0": 8192,
+      "minecraft:flint|0": 4,
+      "minecraft:coal|0": 128,
+      "minecraft:redstone|0": 64,
+      "minecraft:glowstone_dust|0": 384,
+      "minecraft:quartz|0": 256,
+      "minecraft:prismarine_shard|0": 256,
+      "minecraft:prismarine_crystals|0": 512,
+      "minecraft:dye|0": 16,
+      "minecraft:dye|3": 128,
+      "minecraft:dye|4": 864,
+      "minecraft:enchanted_book|0": 2048,
+      "minecraft:emerald|0": 16384,
+      "minecraft:nether_star|0": 139264,
+      "minecraft:clay_ball|0": 16,
+      "minecraft:bone|0": 144,
+      "minecraft:snowball|0": 1,
+      "minecraft:filled_map|0": 1472
+    }
+  }
+}

src/overrides/config/ProjectE/customConversions/example.json

@@ -0,0 +1,86 @@
+/*
+  NOTE: This file is an example. It will be regenerated each time mapping occurs, and is not actually parsed.
+  Files in this folder can be used to add Conversions and values to the EMC Calculation.
+  All files in this folder that end with .json will be loaded and can be enabled/disabled in the mapping.cfg.
+  A grammar is available at: https://gist.github.com/williewillus/9ebb0d04329526e31564
+*/
+
+{
+  "comment": "An example for the custom conversion JSONs",
+  "groups": {
+    "boring_conversions": {
+      "comment": "Some normal conversions, different syntaxes are listed",
+      "conversions": [
+        // These work like AE2 autocrafting: You specify what goes in, and what comes out. PE does the rest.
+
+        {
+          "output": "minecraft:furnace|0",
+          "count": 1, // Can be omitted if it's 1
+          "ingredients": {
+            "minecraft:cobblestone|0": 8
+          }
+        },
+
+        {
+          "out": "minecraft:iron_boots",
+          "ingr": [ "minecraft:iron_ingot", "minecraft:iron_ingot", "minecraft:iron_ingot", "minecraft:iron_ingot" ]
+          // Every occurrence counts once ^
+        },
+
+        // These make a "item group" that you can use in other conversions
+        // to represent the whole group at once (see the next conversion down)
+        { "o": "FAKE|AllSeeds", "i": [ "minecraft:pumpkin_seeds" ] },
+        { "o": "FAKE|AllSeeds", "i": [ "minecraft:wheat_seeds" ] },
+        { "o": "FAKE|AllSeeds", "i": [ "minecraft:melon_seeds" ] },
+        { "o": "FAKE|AllSeeds", "i": [ "minecraft:wheat_seeds" ] },
+
+        {
+          "o": "minecraft:grass|0",
+          "i": [ "FAKE|AllSeeds", "minecraft:dirt|0" ]
+        },
+
+        {
+          "o": "minecraft:bed|0",
+          "i": {
+            "minecraft:planks|*": 3, // * means all metas
+            "minecraft:wool|*": 3
+          }
+        },
+
+        {
+          "o": "OD|gemDiamond",
+          "i": [ "OD|stone" ] // Ore Dictionary
+        },
+
+        {
+          "o": "FLUID|fluidDiamond",
+          "i": [ "minecraft:diamond|0" ] // Fluids too
+        }
+      ]
+    }
+  },
+  "values": {
+    "before": {
+      // Set values that'll be used to derive other values. You want most of your values here.
+      // "FREE" means the item will not contribute anything to the value of any other item it crafts into
+      // All the various item forms (normal, fake, OD, fluid) supported here
+      "minecraft:sponge": 1,
+      "OD|gemDiamond": "FREE"
+    },
+    "after": {
+      // Just like before, but happens after main calculation and won't be used to derive other values
+      // Used to "peg" an item at a certain value
+    },
+    "conversion": [
+      // These are like the group conversions above but are a bit special
+      // They are applied after main calculation and won't be used to derive other values
+      // Used to "peg" an item at a certain value relative to another item
+
+      {
+        "o": "OD|ingotGold",
+        "i": [ "minecraft:steak|0" ],
+        "evalOD": true // Peg this value for ALL ingotGold's
+      }
+    ]
+  }
+}

src/overrides/config/ProjectE/customConversions/metals.json

@@ -0,0 +1,49 @@
+{
+  "comment": "Sets default conversions for various metals from other mods",
+  "comment_1": "This file is only shown as an example, it will be regenerated every time mapping occurs in order to let us",
+  "comment_2": "change default values. To specify your own custom values use a separate JSON or the /projecte commands ingame",
+  "groups": {},
+  "values": {
+    "before": {
+      "OD|ingotIron":256
+    },
+    "conversion": [
+      {"evalOD": true, "o": "OD|ingotObsidian", "c": 2, "i": {"minecraft:obsidian|0": 1}},
+      {"evalOD": true, "o": "OD|ingotGold", "c": 1, "i": {"OD|ingotIron":8}},
+      {"evalOD": true, "o": "OD|ingotCopper", "c": 2, "i": {"OD|ingotIron":1}},
+      {"evalOD": true, "o": "OD|ingotTin", "c": 1, "i": {"OD|ingotIron":1}},
+      {"evalOD": true, "o": "OD|ingotBronze", "c": 4, "i": {"OD|ingotCopper": 3, "OD|ingotTin": 1}},
+      {"evalOD": true, "o": "OD|ingotSilver", "c": 1, "i": {"OD|ingotIron":2}},
+      {"evalOD": true, "o": "OD|ingotLead", "c": 1, "i": {"OD|ingotIron":2}},
+      {"evalOD": true, "o": "OD|ingotNickel", "c": 1, "i": {"OD|ingotIron":4}},
+      {"evalOD": true, "o": "OD|ingotAluminum", "c": 2, "i": {"OD|ingotIron":1}},
+      {"evalOD": true, "o": "OD|ingotArdite", "c": 1, "i": {"OD|ingotIron":4}},
+      {"evalOD": true, "o": "OD|ingotCobalt", "c": 1, "i": {"OD|ingotIron":4}},
+      {"evalOD": true, "o": "OD|ingotAluminumBrass", "c": 64, "i": {"OD|ingotAluminum": 48, "OD|ingotCopper": 16}},
+      {"evalOD": true, "o": "OD|ingotManyullyn", "c": 1, "i": {"OD|ingotCobalt": 1, "OD|ingotArdite": 1}},
+      {"evalOD": true, "o": "OD|ingotAlumite", "c": 48, "i": {"OD|ingotAluminum": 80, "OD|ingotIron": 32, "OD|ingotObsidian": 32}},
+      {"evalOD": true, "o": "OD|ingotPlatinum", "c": 1, "i": {"OD|ingotIron":16}},
+
+      {"evalOD": true, "o": "OD|ingotElectrum", "c": 2, "i": ["OD|ingotGold", "OD|ingotSilver"]},
+      {"evalOD": true, "o": "OD|ingotInvar", "c": 3, "i": ["OD|ingotNickel", "OD|ingotIron", "OD|ingotIron"]},
+      {"evalOD": true, "o": "OD|ingotSignalum", "c": 4, "i": {"OD|ingotCopper": 3, "OD|ingotSilver":1 , "OD|dustRedstone":10}},
+      {"evalOD": true, "o": "OD|ingotLumium", "c": 4, "i": {"OD|ingotTin": 3, "OD|ingotSilver":1 , "OD|dustGlowstone":4}},
+      {"evalOD": true, "o": "OD|ingotEnderium", "c": 4, "i": {
+        "OD|ingotTin": 2, "OD|ingotSilver":1 , "OD|ingotPlatinum":1,
+        "minecraft:coal|1": 1, "OD|dustRedstone": 1, "minecraft:blaze_powder|0":1, "OD|dustSulfur": 1,
+        "minecraft:ender_pearl|0":4}
+      },
+
+      {"evalOD": true, "o": "OD|ingotElectricalSteel", "c": 1, "i": ["OD|ingotIron", "minecraft:coal|1", "OD|itemSilicon"]},
+      {"evalOD": true, "o": "OD|ingotEnergeticAlloy", "c": 1, "i": ["OD|dustRedstone", "OD|ingotGold", "OD|dustGlowstone"]},
+      {"evalOD": true, "o": "OD|ingotVibrantAlloy", "c": 1, "i": ["OD|ingotEnergeticAlloy", "minecraft:ender_pearl|0"]},
+      {"evalOD": true, "o": "OD|ingotRedstoneAlloy", "c": 1, "i": ["OD|dustRedstone", "OD|itemSilicon"]},
+      {"evalOD": true, "o": "OD|ingotConductiveIron", "c": 1, "i": ["OD|dustRedstone", "OD|ingotIron"]},
+      {"evalOD": true, "o": "OD|ingotPulsatingIron", "c": 1, "i": ["OD|ingotIron", "minecraft:ender_pearl|0"]},
+      {"evalOD": true, "o": "OD|ingotDarkSteel", "c": 1, "i": ["OD|ingotIron", "minecraft:coal|1", "minecraft:obsidian|0"]},
+      {"evalOD": true, "o": "OD|ingotSoularium", "c": 1, "i": ["OD|ingotGold", "minecraft:soul_sand|0"]},
+      {"evalOD": true, "o": "OD|ingotEnderiumBase", "c": 4, "i": {"OD|ingotTin": 2, "OD|ingotSilver":1 , "OD|ingotPlatinum":1}}
+    ]
+  }
+}
+

src/overrides/config/ProjectE/custom_emc.json

@@ -0,0 +1,108 @@
+{
+  "entries": [
+    {
+      "item": "projecte:item.pe_philosophers_stone|0",
+      "emc": 147712
+    },
+    {
+      "item": "extrautils2:ingredients|4",
+      "emc": 48
+    },
+    {
+      "item": "minecraft:blaze_powder|0",
+      "emc": 768
+    },
+    {
+      "item": "minecraft:dragon_breath|0",
+      "emc": 139264
+    },
+    {
+      "item": "projecte:collector_mk1|0",
+      "emc": 213441
+    },
+    {
+      "item": "equivalentintegrations:soulbound_talisman|0",
+      "emc": 155656
+    },
+    {
+      "item": "extendedcrafting:material|40",
+      "emc": 146432
+    },
+    {
+      "item": "extendedcrafting:material|48",
+      "emc": 37886
+    },
+    {
+      "item": "projecte:condenser_mk1|0",
+      "emc": 2458494
+    },
+    {
+      "item": "projecte:transmutation_table|0",
+      "emc": 17675358
+    },
+    {
+      "item": "projectex:personal_link|0",
+      "emc": 22417337
+    },
+    {
+      "item": "appliedenergistics2:material|47",
+      "emc": 256000
+    },
+    {
+      "item": "appliedenergistics2:material|20",
+      "emc": 32
+    },
+    {
+      "item": "appliedenergistics2:material|18",
+      "emc": 2048
+    },
+    {
+      "item": "appliedenergistics2:material|17",
+      "emc": 8192
+    },
+    {
+      "item": "appliedenergistics2:material|16",
+      "emc": 32
+    },
+    {
+      "item": "appliedenergistics2:material|22",
+      "emc": 2144
+    },
+    {
+      "item": "appliedenergistics2:material|24",
+      "emc": 8288
+    },
+    {
+      "item": "appliedenergistics2:material|23",
+      "emc": 128
+    },
+    {
+      "item": "equivalentintegrations:alchemical_algorithms|0",
+      "emc": 23405
+    },
+    {
+      "item": "projectex:knowledge_sharing_book|0",
+      "emc": 1629045
+    },
+    {
+      "item": "projecte:item.pe_tome|0",
+      "emc": 206184954737
+    },
+    {
+      "item": "extendedcrafting:material|24",
+      "emc": 141188
+    },
+    {
+      "item": "equivadditions:emc_proxy|0",
+      "emc": 22539645
+    },
+    {
+      "item": "equivalentintegrations:transmutation_generator|0",
+      "emc": 22438495
+    },
+    {
+      "item": "equivalentintegrations:transmutation_chamber|0",
+      "emc": 22704903
+    }
+  ]
+}

src/overrides/config/ProjectE/mapping.cfg

@@ -0,0 +1,187 @@
+# Configuration file
+
+enabledmappers {
+    # Allows other Mods to add Recipes to the EMC Calculation. [default: true]
+    B:APICustomConversionMapper=true
+
+    # Allows other mods to set EMC values using the ProjectEAPI [default: true]
+    B:APICustomEMCMapper=true
+
+    # Add Conversions for Crafting Recipes gathered from net.minecraft.item.crafting.CraftingManager [default: true]
+    B:CraftingMapper=true
+
+    # Uses json files within config/ProjectE/customConversions/ to add values and conversions [default: true]
+    B:CustomConversionMapper=true
+
+    # Uses the `custom_emc.json` File to add EMC values. [default: true]
+    B:CustomEMCMapper=true
+
+    # Adds Conversions for fluid container items and fluids. [default: true]
+    B:FluidMapper=true
+
+    # Blacklist some OreDictionary names from getting an EMC value [default: true]
+    B:OreDictionaryMapper=true
+
+    # Add Conversions for `FurnaceRecipes` [default: true]
+    B:SmeltingMapper=true
+}
+
+
+general {
+    # Want to take a look at the internals of EMC Calculation? Enable this to write all the conversions and setValue-Commands to config/ProjectE/mappingdump.json [default: false]
+    B:dumpEverythingToFile=false
+
+    # Log known EMC Exploits. This can not and will not find all possible exploits. This will only find exploits that result in fixed/custom emc values that the algorithm did not overwrite. Exploits that derive from conversions that are unknown to ProjectE will not be found. [default: true]
+    B:logEMCExploits=true
+
+    # When the next EMC mapping occurs write the results to config/ProjectE/pregenerated_emc.json and only ever run the mapping again when that file does not exist, this setting is set to false, or an error occurred parsing that file. [default: false]
+    B:pregenerate=false
+}
+
+
+mapperconfigurations {
+
+    oredictionarymapper {
+        # Set EMC=0 for everything that has an OD Name that starts with `ore`, `dust` or `crushed` besides `dustPlastic` [default: true]
+        B:blacklistOresAndDusts=true
+    }
+
+    customconversionmapper {
+        # Read file: ODdefaults.json? [default: true]
+        B:ODdefaults=true
+
+        # Read file: defaults.json? [default: true]
+        B:defaults=true
+
+        # Read file: metals.json? [default: true]
+        B:metals=true
+    }
+
+    craftingmapper {
+
+        irecipeimplementations {
+            # Maps `IRecipe` CraftTweaker crafting recipes that extend `MCRecipeShaped` or `MCRecipeShapeless [default: true]
+            B:enableCraftTweakerRecipeMapper=true
+
+            # Maps custom IRecipe's from ProjectE [default: true]
+            B:enablePECustomRecipeMapper=true
+
+            # Maps `RecipeStage` implementation of `IRecipe` from Recipe Stages [default: true]
+            B:enableRecipeStagesRecipeMapper=true
+
+            # Maps `IRecipe` crafting recipes that extend `ShapedRecipes` or `ShapelessRecipes`, and their oredict equivalents [default: true]
+            B:enableVanillaRecipeMapper=true
+        }
+
+    }
+
+    smeltingmapper {
+        # If X has a value and is smelted from Y, Y will get a value too. This is an experimental thing and might result in Mappings you did not expect/want to happen. [default: false]
+        B:doBackwardsMapping=false
+    }
+
+    apicustomemcmapper {
+
+        customemcpriorities {
+            # Priority for Mod with ModId = equivalentenergistics. Values: 5 [range: 0 ~ 512, default: 1]
+            I:equivalentenergisticspriority=1
+
+            # Priority for Mod with ModId = nuclearcraft. Values: 461 [range: 0 ~ 512, default: 1]
+            I:nuclearcraftpriority=1
+        }
+
+        permissions {
+
+            equivalentenergistics {
+                # Allow 'equivalentenergistics' to set and or remove values for 'equivalentenergistics'. Options: [both, set, remove, none] [default: both]
+                S:equivalentenergistics=both
+            }
+
+            nuclearcraft {
+                # Allow 'nuclearcraft' to set and or remove values for 'actuallyadditions'. Options: [both, set, remove, none] [default: both]
+                S:actuallyadditions=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'alchemistry'. Options: [both, set, remove, none] [default: both]
+                S:alchemistry=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'appliedenergistics2'. Options: [both, set, remove, none] [default: both]
+                S:appliedenergistics2=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'bigreactors'. Options: [both, set, remove, none] [default: both]
+                S:bigreactors=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'careerbees'. Options: [both, set, remove, none] [default: both]
+                S:careerbees=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'chisel'. Options: [both, set, remove, none] [default: both]
+                S:chisel=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'enderio'. Options: [both, set, remove, none] [default: both]
+                S:enderio=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'forestry'. Options: [both, set, remove, none] [default: both]
+                S:forestry=both
+                S:gregtech=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'ic2'. Options: [both, set, remove, none] [default: both]
+                S:ic2=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'immersiveengineering'. Options: [both, set, remove, none] [default: both]
+                S:immersiveengineering=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'industrialrenewal'. Options: [both, set, remove, none] [default: both]
+                S:industrialrenewal=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'libvulpes'. Options: [both, set, remove, none] [default: both]
+                S:libvulpes=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'lucraftcore'. Options: [both, set, remove, none] [default: both]
+                S:lucraftcore=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'magneticraft'. Options: [both, set, remove, none] [default: both]
+                S:magneticraft=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'mekanism'. Options: [both, set, remove, none] [default: both]
+                S:mekanism=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'minecraft'. Options: [both, set, remove, none] [default: both]
+                S:minecraft=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'nuclearcraft'. Options: [both, set, remove, none] [default: both]
+                S:nuclearcraft=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'projectred-core'. Options: [both, set, remove, none] [default: both]
+                S:projectred-core=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'projectred-exploration'. Options: [both, set, remove, none] [default: both]
+                S:projectred-exploration=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'railcraft'. Options: [both, set, remove, none] [default: both]
+                S:railcraft=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'refinedstorage'. Options: [both, set, remove, none] [default: both]
+                S:refinedstorage=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'rockhounding_chemistry'. Options: [both, set, remove, none] [default: both]
+                S:rockhounding_chemistry=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'techguns'. Options: [both, set, remove, none] [default: both]
+                S:techguns=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'techreborn'. Options: [both, set, remove, none] [default: both]
+                S:techreborn=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'thermalfoundation'. Options: [both, set, remove, none] [default: both]
+                S:thermalfoundation=both
+
+                # Allow 'nuclearcraft' to set and or remove values for 'variedcommodities'. Options: [both, set, remove, none] [default: both]
+                S:variedcommodities=both
+            }
+
+        }
+
+    }
+
+}
+
+

src/overrides/config/ProjectE/nbt_whitelist.json

@@ -0,0 +1,6 @@
+{
+  "items": [
+    "tconstruct:pickaxe"
+  ],
+  "__comment": "To add items to NBT Whitelist, simply add its registry name as a String to the above array"
+}

src/overrides/config/ProjectRed.cfg

@@ -0,0 +1,126 @@
+# Configuration file
+
+##########################################################################################################
+# compatibility
+#--------------------------------------------------------------------------------------------------------#
+# Control the loading of various compatibility hooks. These settings are ignored unless the Compatibility module is installed.
+##########################################################################################################
+
+compatibility {
+    # Registers ProjectRed decorative blocks with Chisel.
+    B:"Chisel: Decorative Blocks"=true
+
+    # This allows computers to connect to bundled cables with the RS API.
+    B:"ComputerCraft: Bundled Cables"=true
+
+    # This allows gem axes to work with treecapitator.
+    B:"Treecapitator: Gem Axe"=true
+}
+
+
+##########################################################################################################
+# general settings
+#--------------------------------------------------------------------------------------------------------#
+# Contains basic settings for the mod.
+##########################################################################################################
+
+"general settings" {
+    # If set to false, logic gates will not make sounds.
+    B:"Logic Sounds"=true
+
+    # Minimum amount of ticks the timer gates can be set to. Cannot be lower than 4.
+    I:"Minimum Timer Ticks"=4
+
+    # Ticks between router searches.
+    I:"Routed Pipes: Detection Frequency"=40
+
+    # Max number of pipes to explore when connecting to other routers.
+    I:"Routed Pipes: Max Detection Count"=100
+
+    # Maximum distance an item may aimlessly wander in a pipe before being erased. 0 for unlimited.
+    I:"Routed Pipes: Max Wander Distance"=0
+
+    # Number of active route table update threads.
+    I:"Routed Pipes: Update Threads"=4
+
+    # If set to true, sticks will be used instead of wood strips in framed wire recipes.
+    B:"Simple Framed Wire Recipe"=false
+
+    # If set to true, the basic screwdriver will not take damage.
+    B:"Unbreakable Screwdriver"=false
+}
+
+
+##########################################################################################################
+# machine settings
+#--------------------------------------------------------------------------------------------------------#
+# Contains settings related to machines and devices.
+##########################################################################################################
+
+"machine settings" {
+    # Allow the Diamond Block Breaker to be crafted.
+    B:"Enable the Diamond Block Breaker"=false
+}
+
+
+##########################################################################################################
+# render settings
+#--------------------------------------------------------------------------------------------------------#
+# Contains settings related to how things render in-game.
+##########################################################################################################
+
+"render settings" {
+    # If set to false, flat wire textures will be used for logic gates. Significant performance improvement.
+    B:"3D Logic Wires"=true
+
+    # Number of lights to render, -1 for unlimited
+    I:"Light Halo Render Count"=-1
+
+    # If set to false, routed pipes will not render routing fx such as bubbles and lasers.
+    B:"Routed Pipe FX"=true
+
+    # If set to false, gates will be rendered in the TESR rather than the WorldRenderer.
+    B:"Static Gates"=true
+
+    # If set to false, wires will be rendered in the TESR rather than the WorldRenderer.
+    B:"Static Wires"=true
+}
+
+
+##########################################################################################################
+# world gen
+#--------------------------------------------------------------------------------------------------------#
+# Contains settings related to world gen. You can enable/disable each ore or strucure, change retro generation settings, and increase how rare something is by increasing the resistance value.
+##########################################################################################################
+
+"world gen" {
+    B:"Copper Ore"=true
+    I:"Copper Ore resistance"=0
+    B:"Copper Ore retrogen"=false
+    B:"Electrotine Ore"=true
+    I:"Electrotine Ore resistance"=0
+    B:"Electrotine Ore retrogen"=false
+    B:"Marble Caves"=true
+    I:"Marble Caves resistance"=0
+    B:"Marble Caves retrogen"=false
+    B:"Peridot Ore"=true
+    I:"Peridot Ore resistance"=0
+    B:"Peridot Ore retrogen"=false
+    B:"Ruby Ore"=true
+    I:"Ruby Ore resistance"=0
+    B:"Ruby Ore retrogen"=false
+    B:"Sapphire Ore"=true
+    I:"Sapphire Ore resistance"=0
+    B:"Sapphire Ore retrogen"=false
+    B:"Silver Ore"=true
+    I:"Silver Ore resistance"=0
+    B:"Silver Ore retrogen"=false
+    B:"Tin Ore"=true
+    I:"Tin Ore resistance"=0
+    B:"Tin Ore retrogen"=false
+    I:"Volcano resistance"=0
+    B:"Volcano retrogen"=false
+    B:Volcanos=true
+}
+
+

src/overrides/config/SGCraft/general.yml

@@ -0,0 +1 @@
+null

src/overrides/config/SGCraft/generator.yml

@@ -0,0 +1 @@
+null

src/overrides/config/SGCraft/pdd.yml

@@ -0,0 +1,4 @@
+addresses:
+    ABCD-EFG-HI:
+        name: Descriptive Name Here
+        locked: false

src/overrides/config/SGCraft/tokra.yml

@@ -0,0 +1,3 @@
+worlds:
+    world: true
+    world_2: false

src/overrides/config/SGCraft/zpm.yml

@@ -0,0 +1,4 @@
+worlds:
+    world:
+        DIM-1: 0
+        DIM1: 1

src/overrides/config/TinkerModules.cfg

@@ -0,0 +1,28 @@
+# Configuration file
+
+~CONFIG_VERSION: 1
+
+modules {
+    # Debug utilities
+    B:TinkerDebug=false
+
+    # All the fun toys
+    B:TinkerGadgets=true
+
+    # The smeltery and items needed for it
+    B:TinkerSmeltery=true
+
+    # All the tools and everything related to it.
+    B:TinkerTools=true
+
+    # Everything that's found in the world and worldgen
+    B:TinkerWorld=true
+    B:chiselIntegration=true
+    B:chiselsandbitsIntegration=true
+    B:craftingtweaksIntegration=true
+    B:quarkIntegration=true
+    B:theoneprobeIntegration=true
+    B:wailaIntegration=true
+}
+
+

src/overrides/config/VariedCommodities.cfg

@@ -0,0 +1,6 @@
+#Disables all Varied Commodities recipes
+DisableRecipes=false
+
+#Disables all Varied Commodities enchantments
+DisableEnchantments=false
+

src/overrides/config/Waystones.cfg

@@ -0,0 +1,132 @@
+# Configuration file
+
+client {
+    # If enabled, activated waystones will not emit particles.
+    B:"Disable Particles"=false
+
+    # If enabled, the text overlay on waystones will no longer always render at full brightness.
+    B:"Disable Text Glow"=false
+
+    # If enabled, waystones spawned using the legacy spawn-just-anywhere mode will look mossy ingame.
+    B:"Mossy Look for World Gen Waystones"=true
+
+    # The volume of the sound played when teleporting.
+    # Min: 0.0
+    # Max: 1.0
+    D:"Sound Volume"=0.5
+
+    # The x position of the warp button in the inventory.
+    I:"Teleport Button GUI X"=58
+
+    # The y position of the warp button in the inventory.
+    I:"Teleport Button GUI Y"=60
+}
+
+
+compat {
+    # If this is true, activating a waystone will cause a JourneyMap waypoint to be created at its position.
+    B:"Create JourneyMap Waypoint"=false
+}
+
+
+general {
+    # If enabled, everyone can create global waystones, not just players in creative mode.
+    B:"Allow Global Waystones for Everyone"=false
+
+    # The amount of blocks per xp level requirement.
+    I:"Blocks per XP Level"=500
+
+    # If enabled, waystones can only be placed in creative mode.
+    B:"Creative Mode Only"=false
+
+    # The amount of xp levels to use for dimensional warp.
+    I:"Dimensional Warp XP Cost"=3
+
+    # Whether generated waystones should not be breakable by players.
+    B:"Disallow Breaking Generated"=false
+
+    # Whether generated waystones drop their item form when broken by players.
+    B:"Drop Item From Generated"=true
+
+    # Set to false to make all global waystones not cost any experience, regardless of method used.
+    B:"Global Waystones Cost XP"=true
+
+    # If enabled, all waystones work inter-dimensionally.
+    B:"Interdimensional Teleport"=true
+
+    # If enabled, waystones marked as global work inter-dimensionally.
+    B:"Interdimensional Teleport on Global Waystones"=true
+
+    # If enabled, the inventory button cost experience when used, based on the distance travelled.
+    B:"Inventory Button Costs XP"=false
+
+    # The maximum xp cost when Blocks per XP Level is enabled.
+    # Min: 1
+    # Max: 2147483647
+    I:"Maximum XP Cost"=3
+
+    # If enabled, waystones marked as global have no cooldown.
+    B:"No Cooldown on Global Waystones"=true
+
+    # Whether the use of a warp stone or warp scroll should be interrupted by damage. Not supported when playing with Vivecraft!
+    B:"Reset Use On Damage"=false
+
+    # If enabled, only the owner of a waystone can rename it.
+    B:"Restrict Rename to Owner"=false
+
+    # If enabled, the player's spawnpoint will be set to the last activated waystone.
+    B:"Set Spawnpoint on Activation"=false
+
+    # If set to true, XP cost by distance travelled will only start beyond the distance-per-level distance, and shorter travel will be free.
+    B:"Short Travel is Free"=true
+
+    # The cooldown between usages of the teleport button in seconds.
+    I:"Teleport Button Cooldown"=300
+
+    # If enabled, the teleport button will only let you return to the last activated waystone, instead of allowing to choose.
+    B:"Teleport Button Return Only"=true
+
+    # Set this to a global waystone name to lock the inventory button to that specific waystone. Leave empty for default behaviour.
+    S:"Teleport Button Target"=
+
+    # Should there be a button in the inventory to access the waystone menu?
+    B:"Teleport Button in GUI"=false
+
+    # The time it takes to use a warp scroll in ticks. This is the charge-up time when holding right-click.
+    # Min: 1
+    # Max: 127
+    I:"Warp Scroll Use Time"=32
+
+    # The cooldown between usages of the warp stone in seconds.
+    I:"Warp Stone Cooldown"=300
+
+    # If enabled, the warp stone costs experience when used, based on the distance travelled.
+    B:"Warp Stone Costs XP"=false
+
+    # The time it takes to use a warp stone in ticks. This is the charge-up time when holding right-click.
+    # Min: 1
+    # Max: 127
+    I:"Warp Stone Use Time"=32
+
+    # If enabled, waystones cost experience when used, based on the distance travelled.
+    B:"Waystone Costs XP"=true
+}
+
+
+worldgen {
+    # The chance for a waystone to generate just anywhere (without a structure), scaled by 1/10000.
+    # Min: 0.0
+    # Max: 10000.0
+    D:"Change to generate just anywhere"=0.0
+
+    # The Name Generator will pick from these names until they have all been used, then it will generate random ones again.
+    S:"Custom Names" <
+     >
+
+    # The chance for a waystone to generate in a village. Set to 1 to always generate one in villages, set to 0 to disable.
+    # Min: 0.0
+    # Max: 1.0
+    D:"Generate in Villages"=1.0
+}
+
+

src/overrides/config/academy-craft-data.conf

@@ -0,0 +1,163 @@
+# This is the default data config file for AcademyCraft.
+# It is automatically copied to ".minecraft/config" folder for customization reference.
+
+ac.ability {
+
+  # Global ability-related data.
+  data {
+    cp_recover_cooldown: 15
+    cp_recover_speed: 1.0
+
+    overload_recover_cooldown: 32
+    overload_recover_speed: 1.0
+
+    maxcp_incr_rate: 0.0025 # The max cp increase rate (multiplied by CP consumption)
+    maxo_incr_rate: 0.0058 # The max overload increase rate (multiplied by Overload consumption)
+    prog_incr_rate: 1.0 # The level progress increate rate.
+
+    init_cp: [1800, 1800, 2800, 4000, 5800, 8000]
+    add_cp: [0, 900, 1000, 1500, 1700, 12000] # The additional cp that can be achieved by using skills.
+    init_overload: [100, 100, 150, 240, 350, 500]
+    add_overload: [0, 40, 70, 80, 100, 500] # The additional overload that can be achieved by using skills.
+  }
+
+  # Global skill calculation interferers.
+  calc_global {
+    # Global damage scale.
+    damage_scale: 1.0
+  }
+
+  category {
+    #
+    # Skill data explained:
+    # Per-skill configuration can be found in <category>.<skill_name> path.
+    #  There are some common properties that are shared, listed below:
+    #
+    # Property                         | Description                                | Default value
+    # ---------------------------------|--------------------------------------------|----------------
+    #  enabled (boolean)               | Whether the skill can be learned or not.   | true
+    #  damage_scale (float)            | A scale of skill-to-entity damage.         | 1.0
+    #  cp_consume_speed (float)        | How fast this skill consumes CP.           | 1.0
+    #  overload_consume_speed (float)  | How fast this skill overloads.             | 1.0
+    #  exp_incr_speed (float)          | How fast this skill's experience increases.| 1.0
+    # *destroy_blocks (boolean)        | Whether this skill destroys blocks.        | true
+    # -----------------------------------------------------------------------------------------------
+    # *: This property is only applicable on skills that have associated effects.
+    # There is an example in electromaster/arc_gen skill.
+    #
+
+    generic {
+      skills {
+        brain_course {}
+        brain_course_advanced {}
+        mind_course {}
+      }
+    }
+    electromaster {
+      common {
+        prog_incr_rate: 1.0
+      }
+      skills {
+        arc_gen {
+          # An example for common properties.
+          enabled: true,
+          damage_scale: 1.0,
+          cp_consume_speed: 1.0,
+          overload_consume_speed: 1.0,
+          exp_incr_speed: 1.0
+        }
+        charging {
+        }
+        body_intensify {
+        }
+        mine_detect {
+        }
+        mag_movement {
+        }
+        thunder_bolt {
+        }
+        railgun {
+        }
+        thunder_clap {
+        }
+        mag_manip {
+        }
+      }
+    }
+    meltdowner {
+      common {
+        prog_incr_rate: 1.0
+      }
+      skills {
+        electron_bomb {}
+        rad_intensify {}
+        scatter_bomb {}
+        light_shield {}
+        meltdowner {}
+        mine_ray_basic {}
+        ray_barrage {}
+        jet_engine {}
+        mine_ray_expert {}
+        mine_ray_luck {}
+        electron_missile {}
+      }
+    }
+    teleporter {
+      common {
+        prog_incr_rate: 1.0
+      }
+      skills {
+        threatening_teleport {}
+        dim_folding_theorem {}
+        penetrate_teleport {}
+        mark_teleport {}
+        flesh_ripping {}
+        location_teleport {}
+        shift_tp {}
+        space_fluct {}
+        flashing {}
+      }
+    }
+    vecmanip {
+      common {
+        prog_incr_rate: 1.0
+        affected_entities { # Configuration for VecManip/VecDeviation affected entities.
+          # Assign difficulties to entity names. The difficulty is proportion to cp/overload consumed when an
+          # entity is deflected.
+          #
+          # If not specified here, default difficulty is 1.0.
+          difficulties: [
+            {
+              name: "minecraft:arrow",
+              difficulty: 1.0
+            },
+            {
+              name: "minecraft:potion",
+              difficulty: 1.4
+            },
+            {
+              name: "minecraft:snowball",
+              difficulty: 0.1
+            }
+          ]
+
+          # Excluded entity names. Entities with name in this list will not be affected.
+          excluded: [
+            "item", "xp_bottle", "living", "mob"
+          ]
+        }
+      }
+      skills {
+        dir_shock {}
+        ground_shock {}
+        vec_accel {}
+        vec_deviation {}
+        dir_blast {}
+        storm_wing {}
+        blood_retro {}
+        vec_reflection {}
+        plasma_cannon {}
+      }
+    }
+  }
+}

src/overrides/config/academy.cfg

@@ -0,0 +1,121 @@
+# Configuration file
+
+ability {
+    # Supported Metal Entities of Electro Master. The entity name can be used. [default: [minecart], [chest_minecart], [furnace_minecart], [tnt_minecart], [hopper_minecart], [spawner_minecart], [commandblock_minecart], [academy:EntityMagHook], [villager_golem]]
+    S:metalEntities <
+        minecart
+        chest_minecart
+        furnace_minecart
+        tnt_minecart
+        hopper_minecart
+        spawner_minecart
+        commandblock_minecart
+        academy:EntityMagHook
+        villager_golem
+     >
+
+    # Supported Normal Metal Blocks of Electro Master. The block name and ore dictionary name can be used. [default: [rail], [iron_bars], [iron_block], [activator_rail], [detector_rail], [golden_rail], [sticky_piston], [piston]]
+    S:normalMetalBlocks <
+        rail
+        iron_bars
+        iron_block
+        activator_rail
+        detector_rail
+        golden_rail
+        sticky_piston
+        piston
+     >
+
+    # Supported Weak Metal Blocks of Electro Master. The block name and ore dictionary name can be used. [default: [dispenser], [hopper], [iron_ore]]
+    S:weakMetalBlocks <
+        dispenser
+        hopper
+        iron_ore
+     >
+}
+
+
+generic {
+    # switch for analytic system [default: true]
+    B:analysis=true
+
+    # Whether the skills are effective on players.
+    B:attackPlayer=true
+
+    # Whether the skills will destroy blocks in the world.
+    B:destroyBlocks=true
+
+    # Whether the ores will be generated in overworld. [default: true]
+    B:genOres=true
+
+    # Whether phase liquid will be generated in overworld. [default: true]
+    B:genPhaseLiquid=true
+
+    # Whether the player will be given MisakaCloud Terminal on first spawn. [default: true]
+    B:giveCloudTerminal=true
+
+    # Show heads or tails after throwing a coin. [default: false]
+    B:headsOrTails=false
+
+    # Whether teleporter can use mouse wheel to control the destination.
+    B:useMouseWheel=false
+
+    # The worlds which whitelisted destroying blocks. World IDs, sub folder names and world names are all supported.
+    S:worldsWhitelistedDestroyingBlocks <
+     >
+}
+
+
+gui {
+    D:cpbar <
+        -12.0
+        12.0
+     >
+
+    # The font to be used. If not found in the system, default fonts will be used. [default: Microsoft YaHei]
+    S:font=Microsoft YaHei
+    D:keyhint <
+        0.0
+        30.0
+     >
+    D:media <
+        -6.0
+        -6.0
+     >
+    D:notification <
+        0.0
+        15.0
+     >
+}
+
+
+keys {
+    # Ability control key #0 [range: -1000 ~ 1000, default: -100]
+    I:ability_0=-100
+
+    # Ability control key #1 [range: -1000 ~ 1000, default: -99]
+    I:ability_1=-99
+
+    # Ability control key #2 [range: -1000 ~ 1000, default: 19]
+    I:ability_2=19
+
+    # Ability control key #3 [range: -1000 ~ 1000, default: 33]
+    I:ability_3=33
+
+    #  [range: -1000 ~ 1000, default: 47]
+    I:ability_activation=47
+
+    #  [range: -1000 ~ 1000, default: 62]
+    I:debug_console=62
+
+    #  [range: -1000 ~ 1000, default: 49]
+    I:edit_preset=49
+
+    #  [range: -1000 ~ 1000, default: 56]
+    I:open_data_terminal=56
+
+    #  [range: -1000 ~ 1000, default: 46]
+    I:switch_preset=46
+}
+
+

src/overrides/config/actuallyadditions.cfg

@@ -0,0 +1,577 @@
+# Configuration file
+
+"machine values" {
+    # The amount of power the atomic reconstructor can store.
+    I:"Atomic Reconstructor Power"=300000
+
+    # The Coal Generator's Energy Production in CF/tick while burning.
+    I:"Coal Generator Energy Production"=30
+
+    # The size of the farmer's farming area.  Default is 9x9, must be an odd number.
+    I:"Farmer Area"=9
+
+    # By default, the Item Repairer only repairs items which are repairable in an anvil. Add an item's REGISTRY NAME here if you want it to be repairable.
+    S:"Item Repairer Extra Whitelist" <
+        tconstruct:pickaxe
+        tconstruct:shovel
+        tconstruct:hatchet
+        tconstruct:mattock
+        tconstruct:broadsword
+        tconstruct:longsword
+        tconstruct:frypan
+        tconstruct:battlesign
+        tconstruct:hammer
+        tconstruct:excavator
+        tconstruct:lumberaxe
+        tconstruct:cleaver
+        tconstruct:rapier
+     >
+
+    # If Energy Laser Relays should have energy loss
+    B:"Laser Relay Energy Loss"=true
+
+    # The size of the Leaf Generator's harvesting area.  Default is 7x7x7, must be an odd number.
+    I:"Leaf Generator Area"=7
+
+    # The cooldown between two generation cycles of the Leaf Generator, in ticks
+    I:"Leaf Generator Cooldown"=5
+
+    # The Leaf Generator's Energy Production in CF/Leaf
+    I:"Leaf Generator Energy Production"=300
+
+    # The energy use of the Atomic Reconstructor's Mining Lens.
+    I:"Mining Lens Energy"=60000
+
+    # If true, the mining lens uses some weird math to calculate energy costs.
+    B:"Mining Lens Math"=true
+
+    # The amount of power that the 4 tiers of oils generate in CF/t.  Ordered.
+    I:"Oil Gen: Power Values" <
+        40
+        80
+        100
+        120
+     >
+
+    # The amount of time that the 4 tiers of oils work for in seconds.  Ordered.
+    I:"Oil Gen: Time Values" <
+        100
+        120
+        280
+        400
+     >
+
+    # By default, the Vertical Digger mines everything that starts with 'ore' in the OreDictionary. If there is one that it can mine, but shouldn't be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command. This Config Option will apply in both modes.
+    S:"Vertical Digger Blacklist" <
+     >
+
+    # By default, the Vertical Digger mines everything that starts with 'ore' in the OreDictionary. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command. This Config Option only applies if the miner is in Ores Only Mode.
+    S:"Vertical Digger Extra Whitelist" <
+     >
+}
+
+
+"mob drops" {
+    # Should Bat wings drop from Bats?
+    B:"Bat Wing Drop"=true
+
+    # If true, Mobs will randomly drop solidified XP occasionally.
+    B:"Solidified XP Drop"=true
+
+    # Should Cobwebs drop from spiders?
+    B:"Spider Cobweb Drop"=true
+}
+
+
+other {
+    # Show Advanced Item Info when holding Control on every Item.
+    B:"Advanced Info"=true
+
+    # The maximum amount of characters that is displayed by the NBT view of the CTRL Advanced Info. Set to a zero to have no limit
+    I:"Advanced Info NBT Character Limit"=1000
+
+    # Show the 'Press Control for more Info'-Text on Item Tooltips
+    B:"Advanced Info Tooltips"=true
+
+    # The size of the booklet's large font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Large Font Size"=0
+
+    # The size of the booklet's medium font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Medium Font Size"=0
+
+    # The size of the booklet's small font in percent. Set to 0 to use defaults from the lang file.
+    I:"Booklet Small Font Size"=0
+
+    # If true, the Lens of Color will attempt to pull from the oredict instead of only using vanilla dyes.
+    B:"Color Lens Oredict"=false
+
+    # The non-Actually Additions items that are used to configure blocks from the mod. The first one is the Redstone Torch used to configure the Redstone Mode, and the second one is the Compass used to configure Laser Relays. If another mod overrides usage of either one of these items, you can change the registry name of the used items (using blocks is not possible) here.
+    S:"Configuration Items" <
+        minecraft:redstone_torch
+        minecraft:compass
+     >
+
+    # The items that aren't allowed as outputs from OreDict Crusher recipes. Use this in case a mod, for example, adds a dust variant that can't be smelted into an ingot. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_item@3
+    S:"Crusher Output Blacklist" <
+     >
+
+    # Ingots, Dusts and Ores that will be blacklisted from being auto-registered to be crushed by the Crusher. This list uses OreDictionary Names of the Inputs only.
+    S:"Crusher Recipe Exceptions" <
+        ingotBrick
+        ingotBrickNether
+     >
+
+    # If true, Cats drop Hairy Balls Occasionally.
+    B:"Do Cat Drops"=true
+
+    # If true, Actually Additions Checks for updates on World Load.
+    B:"Do Update Check"=true
+
+    # The 1/n drop chance, per tick, for a fur ball to be dropped.
+    I:"Fur Drop Chance"=5000
+
+    # If true, the booklet should be given to the player when he first crafts something from the Mod
+    B:"Give Booklet on First Craft"=true
+
+    # The ItemFood, IGrowable and IPlantable Items that can not be used to craft Mashed Food. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"Mashed Food Crafting Exceptions" <
+        actuallyadditions:item_coffee
+     >
+
+    # The items that aren't allowed as being generated by the Lens of the Miner. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Mining Lens Blacklist" <
+     >
+
+    # By default, the mining lens has a set number of ores it can generate. If there is an ore that it should be able to generate, add its OreDictionary name followed by an @ and the weight that it should have (the higher, the more often it will generate), followed by another @ and then an s for it to generate in stone and an n for it to generate in netherrack. For instance: oreCheese@100@s would add cheese ore with a weight of 100 that generates in stone.
+    S:"Mining lens Extra Whitelist" <
+     >
+
+    # If you want to be really boring and lame, you can turn on this setting to disable colored names on Actually Additions items. Because why would you want things to look pretty anyways, right?
+    B:"No Colored Item Names"=false
+
+    # The items that aren't allowed to be put in the Repairer. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Repair Blacklist" <
+     >
+
+    # The items that aren't allowed to be put in the Traveller's Sack. Use REGISTRY NAMES, and if metadata is needed, add it like so: somemod:some_block@3
+    S:"Sack Blacklist" <
+     >
+
+    # If true, Solidified Experience will always spawn orbs, even for regular players.
+    B:"Solid XP Orbs"=false
+
+    # By default, the Spawner Changer allows every living entity to be put into a spawner. If there is one that shouldn't be able to, put its MAPPING NAME here.
+    S:"Spawner Changer Blacklist" <
+        minecraft:villager_golem
+     >
+
+    # Turn this on to make recipes for items from the mod really hard. (This is a joke feature poking fun at the whole FTB Infinity Expert Mode style of playing. You shouldn't really turn this on as it makes the mod completely unplayable.)
+    B:"Super Duper Hard Recipes"=false
+
+    # The amount of ticks waited before a TileEntity sends an additional Update to the Client
+    I:"Tile Entities: Update Interval"=5
+
+    # Should Tiny Coal and Tiny Charcoal be craftable
+    B:"Tiny Coal"=true
+
+    # If true, Actually Additions' Update Checker searches for updates for the Minecraft Version you currently play on.
+    B:"Version Specific Update Checker"=true
+
+    # Should Actually Additions Loot generate in dungeons?
+    B:"Village and Dungeon Loot"=true
+
+    # Should right-clicking a bowl on water blocks create a water bowl?
+    B:"Water Bowl"=true
+
+    # Should the water bowl spill if you don't sneak while using it?
+    B:"Water Bowl Spilling"=true
+
+    # 11?
+    I:"What is 11"=11
+
+    # The amount of ticks it takes for a worm to die. When at 0 ticks, it will not die.
+    I:"Worm Death Time"=0
+
+    # If true, worms will drop from tilling the soil.
+    B:Worms=true
+}
+
+
+"tool control" {
+    # This will disable the Black Quartz AIOT. It will not be registered. [default: false]
+    B:"Disable: Black Quartz AIOT"=false
+
+    # This will disable the Black Quartz Axe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Axe"=false
+
+    # This will disable the Black Quartz Boots. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Boots"=false
+
+    # This will disable the Black Quartz Chestplate. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Chestplate"=false
+
+    # This will disable the Black Quartz Helmet. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Helmet"=false
+
+    # This will disable the Black Quartz Hoe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Hoe"=false
+
+    # This will disable the Black Quartz Pants. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Pants"=false
+
+    # This will disable the Black Quartz Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Pickaxe"=false
+
+    # This will disable the Black Quartz Shovel. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Shovel"=false
+
+    # This will disable the Black Quartz Sword. It will not be registered. [default: false]
+    B:"Disable: Black Quartz Sword"=false
+
+    # This will disable the Diamatine Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal AIOT"=false
+
+    # This will disable the Diamatine Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Axe"=false
+
+    # This will disable the Diamatine Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Boots"=false
+
+    # This will disable the Diamatine Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Chestplate"=false
+
+    # This will disable the Diamatine Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Helmet"=false
+
+    # This will disable the Diamatine Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Hoe"=false
+
+    # This will disable the Diamatine Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Pants"=false
+
+    # This will disable the Diamatine Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Pickaxe"=false
+
+    # This will disable the Diamatine Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Shovel"=false
+
+    # This will disable the Diamatine Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Diamatine Crystal Sword"=false
+
+    # This will disable the Diamond AIOT. It will not be registered. [default: false]
+    B:"Disable: Diamond AIOT"=false
+
+    # This will disable the Emeradic Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal AIOT"=false
+
+    # This will disable the Emeradic Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Axe"=false
+
+    # This will disable the Emeradic Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Boots"=false
+
+    # This will disable the Emeradic Crystal Chest. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Chest"=false
+
+    # This will disable the Emeradic Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Helmet"=false
+
+    # This will disable the Emeradic Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Hoe"=false
+
+    # This will disable the Emeradic Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Pants"=false
+
+    # This will disable the Emeradic Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Pickaxe"=false
+
+    # This will disable the Emeradic Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Shovel"=false
+
+    # This will disable the Emeradic Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Emeradic Crystal Sword"=false
+
+    # This will disable the Emerald AIOT. It will not be registered. [default: false]
+    B:"Disable: Emerald AIOT"=false
+
+    # This will disable the Emerald Axe. It will not be registered. [default: false]
+    B:"Disable: Emerald Axe"=false
+
+    # This will disable the Emerald Boots. It will not be registered. [default: false]
+    B:"Disable: Emerald Boots"=false
+
+    # This will disable the Emerald Chestplate. It will not be registered. [default: false]
+    B:"Disable: Emerald Chestplate"=false
+
+    # This will disable the Emerald Helmet. It will not be registered. [default: false]
+    B:"Disable: Emerald Helmet"=false
+
+    # This will disable the Emerald Hoe. It will not be registered. [default: false]
+    B:"Disable: Emerald Hoe"=false
+
+    # This will disable the Emerald Pants. It will not be registered. [default: false]
+    B:"Disable: Emerald Pants"=false
+
+    # This will disable the Emerald Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Emerald Pickaxe"=false
+
+    # This will disable the Emerald Shovel. It will not be registered. [default: false]
+    B:"Disable: Emerald Shovel"=false
+
+    # This will disable the Emerald Sword. It will not be registered. [default: false]
+    B:"Disable: Emerald Sword"=false
+
+    # This will disable the Engineer's Goggles. It will not be registered. [default: false]
+    B:"Disable: Engineer's Goggles"=false
+
+    # This will disable the Engineer's Infrared Goggles. It will not be registered. [default: false]
+    B:"Disable: Engineer's Infrared Goggles"=false
+
+    # This will disable the Enori Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal AIOT"=false
+
+    # This will disable the Enori Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Axe"=false
+
+    # This will disable the Enori Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Boots"=false
+
+    # This will disable the Enori Crystal Chest. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Chest"=false
+
+    # This will disable the Enori Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Helmet"=false
+
+    # This will disable the Enori Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Hoe"=false
+
+    # This will disable the Enori Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Pants"=false
+
+    # This will disable the Enori Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Pickaxe"=false
+
+    # This will disable the Enori Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Shovel"=false
+
+    # This will disable the Enori Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Enori Crystal Sword"=false
+
+    # This will disable the Golden AIOT. It will not be registered. [default: false]
+    B:"Disable: Golden AIOT"=false
+
+    # This will disable the Iron AIOT. It will not be registered. [default: false]
+    B:"Disable: Iron AIOT"=false
+
+    # This will disable the Obsidian AIOT. It will not be registered. [default: false]
+    B:"Disable: Obsidian AIOT"=false
+
+    # This will disable the Obsidian Axe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Axe"=false
+
+    # This will disable the Obsidian Boots. It will not be registered. [default: false]
+    B:"Disable: Obsidian Boots"=false
+
+    # This will disable the Obsidian Chestplate. It will not be registered. [default: false]
+    B:"Disable: Obsidian Chestplate"=false
+
+    # This will disable the Obsidian Helmet. It will not be registered. [default: false]
+    B:"Disable: Obsidian Helmet"=false
+
+    # This will disable the Obsidian Hoe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Hoe"=false
+
+    # This will disable the Obsidian Pants. It will not be registered. [default: false]
+    B:"Disable: Obsidian Pants"=false
+
+    # This will disable the Obsidian Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Obsidian Pickaxe"=false
+
+    # This will disable the Obsidian Shovel. It will not be registered. [default: false]
+    B:"Disable: Obsidian Shovel"=false
+
+    # This will disable the Obsidian Sword. It will not be registered. [default: false]
+    B:"Disable: Obsidian Sword"=false
+
+    # This will disable the Palis Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal AIOT"=false
+
+    # This will disable the Palis Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Axe"=false
+
+    # This will disable the Palis Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Boots"=false
+
+    # This will disable the Palis Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Chestplate"=false
+
+    # This will disable the Palis Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Helmet"=false
+
+    # This will disable the Palis Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Hoe"=false
+
+    # This will disable the Palis Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Pants"=false
+
+    # This will disable the Palis Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Pickaxe"=false
+
+    # This will disable the Palis Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Shovel"=false
+
+    # This will disable the Palis Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Palis Crystal Sword"=false
+
+    # This will disable the Restonia Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal AIOT"=false
+
+    # This will disable the Restonia Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Axe"=false
+
+    # This will disable the Restonia Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Boots"=false
+
+    # This will disable the Restonia Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Chestplate"=false
+
+    # This will disable the Restonia Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Helmet"=false
+
+    # This will disable the Restonia Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Hoe"=false
+
+    # This will disable the Restonia Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Pants"=false
+
+    # This will disable the Restonia Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Pickaxe"=false
+
+    # This will disable the Restonia Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Shovel"=false
+
+    # This will disable the Restonia Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Restonia Crystal Sword"=false
+
+    # This will disable the Stone AIOT. It will not be registered. [default: false]
+    B:"Disable: Stone AIOT"=false
+
+    # This will disable the Void Crystal AIOT. It will not be registered. [default: false]
+    B:"Disable: Void Crystal AIOT"=false
+
+    # This will disable the Void Crystal Axe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Axe"=false
+
+    # This will disable the Void Crystal Boots. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Boots"=false
+
+    # This will disable the Void Crystal Chestplate. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Chestplate"=false
+
+    # This will disable the Void Crystal Helmet. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Helmet"=false
+
+    # This will disable the Void Crystal Hoe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Hoe"=false
+
+    # This will disable the Void Crystal Pants. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Pants"=false
+
+    # This will disable the Void Crystal Pickaxe. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Pickaxe"=false
+
+    # This will disable the Void Crystal Shovel. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Shovel"=false
+
+    # This will disable the Void Crystal Sword. It will not be registered. [default: false]
+    B:"Disable: Void Crystal Sword"=false
+
+    # This will disable the Wooden AIOT. It will not be registered. [default: false]
+    B:"Disable: Wooden AIOT"=false
+}
+
+
+"tool values" {
+    # By default, the AIOT can mine certain blocks. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"AIOT Extra Whitelist" <
+        TConstruct:GravelOre
+     >
+
+    # If true,'Press key for more information' text should show when the item has a page in the booklet
+    B:"Booklet Quick Opening Info"=true
+
+    # By default, the Drill can mine certain blocks. If there is one that it can't mine, but should be able to, put its REGISTRY NAME here. These are the actual registered Item Names, the ones you use, for example, when using the /give Command.
+    S:"Drill Extra Whitelist" <
+        TConstruct:GravelOre
+     >
+}
+
+
+"world gen" {
+    # Should Black Lotus generate in the World?
+    B:"Black Lotus Gen"=true
+
+    # The Amount of Black Lotus generating
+    I:"Black Lotus: Amount"=14
+
+    # Shold Black Quartz generate in the world?
+    B:"Black Quartz"=true
+
+    # Should Canola generate in the World?
+    B:"Canola Gen"=true
+
+    # The Amount of Canola generating
+    I:"Canola: Amount"=10
+
+    # Should Coffee Plants generate in the World?
+    B:"Coffee Gen"=true
+
+    # The Amount of Coffee generating
+    I:"Coffee: Amount"=6
+
+    # Should Custom Crop Fields exist?
+    B:"Crop Field: Existence"=true
+
+    # If Crystal Clusters should generate in Lush Caves
+    B:"Crystal Clusters in Lush Caves"=true
+
+    # Should the Engineer Villager and his House generate in the worl?
+    B:"Engineer Villager: Existence"=true
+
+    # Should Flax generate in the World?
+    B:"Flax Gen"=true
+
+    # The Amount of Flax generating
+    I:"Flax: Amount"=8
+
+    # Should caves with trees and grass randomly generate underground?
+    B:"Generate Lush Caves"=true
+
+    # Should the Jam Villager and his House generate in the world?
+    B:"Jam Villager: Existence"=true
+
+    # The chances for lush caves to generate. The lower the number, the higher the chances.
+    I:"Lush Caves: Chance"=20
+
+    # If true, the ore gen dimension blacklist will be treated as a whitelist.
+    B:"Ore Gen Whitelist"=false
+
+    # The list of IDs that Actually Additions OreGen (Ex: Black Quartz) is banned in. This also applies for other world gen like lush caves.
+    I:"OreGen Dimension Blacklist" <
+     >
+
+    # The list of IDs of the dimensions that Actually Additions Plants (Rice for example) are banned in.
+    I:"Plant Blacklist" <
+     >
+
+    # Should Rice generate in the World?
+    B:"Rice Gen"=true
+
+    # The Amount of Rice generating
+    I:"Rice: Amount"=15
+
+    # Should Treasure Chests generate in the World?
+    B:"Treasure Chest Gen"=true
+}
+
+

src/overrides/config/advRocketry/ChemicalReactor.xml

@@ -0,0 +1,51 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="40" power ="20">
+		<input>
+			<itemStack>advancedrocketry:carbonscrubbercartridge 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:carbonscrubbercartridge</itemStack>
+			<itemStack>minecraft:coal 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="10">
+		<input>
+			<fluidStack>oxygen 10</fluidStack>
+			<fluidStack>hydrogen 10</fluidStack>
+		</input>
+		<output>
+			<fluidStack>rocketfuel 20</fluidStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>minecraft:bone</itemStack>
+			<fluidStack>nitrogen 10</fluidStack>
+		</input>
+		<output>
+			<itemStack>minecraft:dye 8 15</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/Crystallizer.xml

@@ -0,0 +1,41 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>dustDilithium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productcrystal</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSilicon</oreDict>
+			<oreDict>nuggetSilicon</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productboule 1 3</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/CuttingMachine.xml

@@ -0,0 +1,104 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>advancedrocketry:alienwood</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:planks 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="100">
+		<input>
+			<itemStack>advancedrocketry:itemcircuitplate 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 4 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="100">
+		<input>
+			<itemStack>advancedrocketry:itemcircuitplate</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="100">
+		<input>
+			<itemStack>libvulpes:productboule 1 3</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:wafer 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log 1 2</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log 1 3</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log2</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="80" power ="10">
+		<input>
+			<itemStack>minecraft:log2 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>minecraft:planks 6 5</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/ElectricArcFurnace.xml

@@ -0,0 +1,72 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="9000" power ="20">
+		<input>
+			<itemStack>thermalfoundation:material 7 132</itemStack>
+			<itemStack>techreborn:ingot 3 14</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productingot 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="6000" power ="1">
+		<input>
+			<itemStack>minecraft:coal 1 1</itemStack>
+			<itemStack>minecraft:iron_ingot</itemStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 160</itemStack>
+			<itemStack>techreborn:ingot 1 12</itemStack>
+			<itemStack>libvulpes:productingot 1 6</itemStack>
+			<itemStack>mekanism:ingot 1 4</itemStack>
+			<itemStack>bigreactors:ingotmetals 1 5</itemStack>
+			<itemStack>immersiveengineering:metal 1 8</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="12000" power ="1">
+		<input>
+			<itemStack>minecraft:sand</itemStack>
+		</input>
+		<output>
+			<itemStack>libvulpes:productingot 1 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="3000" power ="20">
+		<input>
+			<itemStack>thermalfoundation:material 1 135</itemStack>
+			<itemStack>techreborn:ingot 1 14</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productingot 2 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="10">
+		<input>
+			<oreDict>oreRutile</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productingot 1 7</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/Electrolyser.xml

@@ -0,0 +1,33 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="100" power ="20">
+		<input>
+			<fluidStack>water 10</fluidStack>
+		</input>
+		<output>
+			<fluidStack>hydrogen 100</fluidStack>
+			<fluidStack>oxygen 100</fluidStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/Lathe.xml

@@ -0,0 +1,88 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitaniumAluminide</oreDict>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productrod 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotAluminum</oreDict>
+		</input>
+		<output>
+			<itemStack>immersiveengineering:material 2 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIron</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitanium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 7</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 10</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotCopper</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productrod 2 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitaniumIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productrod 2 1</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/PrecisionAssembler.xml

@@ -0,0 +1,210 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="1000" power ="1">
+		<input>
+			<itemStack>libvulpes:battery</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:misc</itemStack>
+			<itemStack>advancedrocketry:lens</itemStack>
+			<itemStack>thermalfoundation:material 1 321</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:atmanalyser</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>libvulpes:battery</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+			<itemStack>advancedrocketry:lens</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade 1 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade 1 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="10">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>thermalfoundation:material 1 320</itemStack>
+			<itemStack>thermalfoundation:material 1 352</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="500" power ="60">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>minecraft:emerald</itemStack>
+			<itemStack>advancedrocketry:ic</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:dataunit</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="10">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>thermalfoundation:material 1 33</itemStack>
+			<itemStack>thermalfoundation:material 1 352</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 1 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="900" power ="100">
+		<input>
+			<itemStack>minecraft:gold_ingot</itemStack>
+			<itemStack>minecraft:redstone_block</itemStack>
+			<itemStack>advancedrocketry:wafer</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemcircuitplate 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="900" power ="100">
+		<input>
+			<itemStack>minecraft:gold_ingot</itemStack>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>advancedrocketry:wafer</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemcircuitplate</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>minecraft:feather</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+			<itemStack>minecraft:leather_boots</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade 1 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>minecraft:diamond</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+			<itemStack>minecraft:fire_charge</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="1">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>advancedrocketry:ic</itemStack>
+			<itemStack>advancedrocketry:ic 1 3</itemStack>
+			<itemStack>minecraft:redstone_torch</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:itemupgrade</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="1000" power ="1">
+		<input>
+			<itemStack>libvulpes:battery</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:misc</itemStack>
+			<itemStack>advancedrocketry:ic 1 1</itemStack>
+			<itemStack>thermalfoundation:material 1 321</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:biomechanger</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>advancedrocketry:ic 1 1</itemStack>
+			<itemStack>advancedrocketry:itemupgrade 1 4</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:beaconfinder</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>advancedrocketry:spacestationchip</itemStack>
+			<itemStack>advancedrocketry:ic 1 1</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:elevatorchip</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="900" power ="50">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>minecraft:ender_eye</itemStack>
+			<itemStack>advancedrocketry:itemcircuitplate</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="1000" power ="1">
+		<input>
+			<itemStack>libvulpes:productrod 2 4</itemStack>
+			<itemStack>libvulpes:productrod 1 7</itemStack>
+			<itemStack>advancedrocketry:ic 1 2</itemStack>
+			<itemStack>advancedrocketry:wafer 2</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:satelliteprimaryfunction 1 5</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="200" power ="10">
+		<input>
+			<itemStack>minecraft:redstone</itemStack>
+			<itemStack>minecraft:dye 1 4</itemStack>
+			<itemStack>thermalfoundation:material 1 352</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:ic 1 5</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>libvulpes:productrod 1 1</itemStack>
+			<itemStack>advancedrocketry:lens 3</itemStack>
+			<itemStack>minecraft:glass 3</itemStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:blocklens</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/RollingMachine.xml

@@ -0,0 +1,492 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="100" power ="2">
+		<input>
+			<itemStack>libvulpes:productsheet 2 6</itemStack>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:pressuretank 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="4">
+		<input>
+			<itemStack>libvulpes:productsheet 2 9</itemStack>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:pressuretank 1 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="400" power ="8">
+		<input>
+			<itemStack>libvulpes:productsheet 2 7</itemStack>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:pressuretank 1 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="100" power ="1">
+		<input>
+			<itemStack>libvulpes:productsheet 2 1</itemStack>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:pressuretank</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="200">
+		<input>
+			<oreDict>plateIron</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>libvulpes:productsheet 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="200">
+		<input>
+			<oreDict>plateCopper</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>libvulpes:productsheet 1 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="200">
+		<input>
+			<oreDict>plateSteel</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>libvulpes:productsheet 1 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="200">
+		<input>
+			<oreDict>plateTitanium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>libvulpes:productsheet 1 7</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="200">
+		<input>
+			<oreDict>plateAluminum</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>libvulpes:productsheet 1 9</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="200">
+		<input>
+			<oreDict>plateTitaniumAluminide</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productsheet</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="200">
+		<input>
+			<oreDict>plateTitaniumIridium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productsheet 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotAluminum</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 324</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotDwarfStarAlloy</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>lucraftcore:plate_dwarf_star_alloy</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotLumium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 358</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotAdvancedAlloy</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 35</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSignalum</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 357</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitanium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 30</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotRefinedIron</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 34</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIridiumAlloy</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 37</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotCopper</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 320</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotEnderium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 359</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBronze</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 355</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotGold</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 33</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPalladium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>lucraftcore:plate_palladium</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSilver</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 322</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIridium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 327</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTungstensteel</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 32</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotBrass</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 17</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIron</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 32</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotUranium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>immersiveengineering:metal 1 35</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotGoldTitaniumAlloy</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>lucraftcore:plate_gold_titanium_alloy</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotPlatinum</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 326</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTungsten</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 31</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotLead</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 323</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotChrome</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 19</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotUru</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>lucraftcore:plate_uru</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSilicon</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 1 3</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitaniumAluminide</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productplate</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotMithril</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 328</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotIntertium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>lucraftcore:plate_intertium</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotSteel</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 352</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotCarbon</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotAdamantium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>lucraftcore:plate_adamantium</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotElectrum</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 353</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotZinc</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>techreborn:plates 1 33</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotOsmium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>lucraftcore:plate_osmium</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTin</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 321</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotNickel</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 325</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotInvar</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 354</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotConstantan</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>thermalfoundation:material 1 356</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotTitaniumIridium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productplate 1 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="300" power ="20">
+		<input>
+			<oreDict>ingotVibranium</oreDict>
+			<fluidStack>water 100</fluidStack>
+		</input>
+		<output>
+			<itemStack>lucraftcore:plate_vibranium</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/SmallPlatePress.xml

@@ -0,0 +1,160 @@
+<!-->
+	<Recipe timeRequired="NUMBER" power="NUMBER">
+		<input>
+			<fluidStack>FLUID NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+        </input>
+		<output>
+			<fluidStack>FLUID_NAME SIZE</fluidStack>
+			<itemStack>ITEM_NAME SIZE META</itemStack>
+			<oreDict>OREDICT_NAME SIZE</oreDict>
+		</output>
+	</Recipe>
+	
+	Can have Multiple In/Outputs
+	Some Machines can only Accept either Fluids or Items
+	
+	timeRequired="NUMBER"	how long a Recipe takes, Unit is in Ticks.
+	power="NUMBER" how much Power the Recipes takes per Tick. Unit is in RF.
+	
+	The "useDefault" attribute will prevent loading of recipes if set to "false"
+<!-->
+<Recipes useDefault="true">
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreDilithium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockIron</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreIron</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 1</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockGold</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreGold</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 2</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockCopper</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreCopper</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockTin</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 5</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreTin</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 5</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockSteel</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 6</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockTitanium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 7</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockAluminum</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 9</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreAluminum</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 9</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productplate 4 10</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>oreIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>libvulpes:productdust 2 10</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockTitaniumAluminide</oreDict>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productplate 4</itemStack>
+		</output>
+	</Recipe>
+	<Recipe timeRequired="0" power ="0">
+		<input>
+			<oreDict>blockTitaniumIridium</oreDict>
+		</input>
+		<output>
+			<itemStack>advancedrocketry:productplate 4 1</itemStack>
+		</output>
+	</Recipe>
+</Recipes>

src/overrides/config/advRocketry/advancedRocketry.cfg

@@ -0,0 +1,351 @@
+# Configuration file
+
+asteroid {
+    # Multiplier changing how long a mining mission takes
+    D:miningMissionTmeMultiplier=1.0
+
+    # List of oredictionary names of ores allowed to spawn in asteriods
+    S:standardOres <
+        oreIron
+        oreGold
+        oreCopper
+        oreTin
+        oreRedstone
+     >
+}
+
+
+black_hole_generator {
+    # List of blocks and the amount of ticks they can power the black hole generator format: 'modname:block:meta;number_of_ticks'
+    S:blackHoleTimings <
+        minecraft:stone;1
+        minecraft:dirt;1
+        minecraft:netherrack;1
+        minecraft:cobblestone;1
+     >
+
+    # List of blocks and the amount of ticks they can power the black hole generator format: 'modname:block:meta;number_of_ticks'
+    I:defaultBurnTime=500
+}
+
+
+##########################################################################################################
+# client
+#--------------------------------------------------------------------------------------------------------#
+# UI locations can by set by clicking and dragging the middle mouse button ingame
+##########################################################################################################
+
+client {
+    # If true, AR will use a custom skybox on planets
+    B:PlanetSkyOverride=false
+
+    # If true, AR will use a custom skybox on space stations
+    B:StationSkyOverride=false
+    I:atmBarModeX=-1
+    I:atmBarModeY=1
+    I:atmBarX=8
+    I:atmBarY=27
+    I:hydrogenBarModeX=0
+    I:hydrogenBarModeY=1
+    I:hydrogenBarX=-8
+    I:hydrogenBarY=74
+
+    # If UI is not locked, the middle mouse can be used to drag certain AR UIs around the screen, positions are saved on hitting quit in the menu
+    B:lockUI=true
+    B:overworldSkyOverride=false
+    I:oxygenBarModeX=0
+    I:oxygenBarModeY=1
+    I:oxygenBarX=-8
+    I:oxygenBarY=57
+    I:suitPanelModeX=-1
+    I:suitPanelModeY=-1
+    I:suitPanelX=8
+    I:suitPanelY=8
+}
+
+
+gasmining {
+    # Multiplier for the amount of time gas collection missions take
+    D:gasMissionMultiplier=1.0
+
+    # list of fluid names that can be harvested as Gas [default: ]
+    S:harvestableGasses <
+     >
+}
+
+
+general {
+    # If true, allows players being hurt due to lack of oxygen and allows effects from non-standard atmosphere types
+    B:EnableAtmosphericEffects=true
+
+    # Enables the laser drill machine
+    B:EnableLaserDrill=true
+
+    # Enables terraforming items and blocks
+    B:EnableTerraforming=true
+
+    # Power multiplier for the laser drill machine
+    D:LaserDrillPowerMultiplier=1.0
+
+    # Multiplier for the amount of energy produced by the microwave reciever
+    D:MicrowaveRecieverMultiplier=1.0
+
+    # Power consumption multiplier for the oxygen vent
+    D:OxygenVentPowerMultiplier=1.0
+
+    # setting this to false will will prevent resetPlanetsFromXML from being set to false upon world reload.  Recommended for those who want to force ALL saves to ALWAYS use the planetDefs XML in the /config folder.  Essentially that 'Are you sure you're sure' option.  If resetPlanetsFromXML is false, this option does nothing. [default: true]
+    B:ResetOnlyOnce=true
+
+    # The largest size a space station can be.  Should also be a power of 2 (512, 1024, 2048, 4096, ...).  CAUTION: CHANGING THIS OPTION WILL DAMAGE EXISTING STATIONS!!!
+    I:SpaceStationBuildRadius=1024
+
+    # how many millibuckets/t are required to keep the terraformer running
+    I:TerraformerFluidConsumeRate=40
+    B:TerraformerRequiresFluids=true
+
+    # If true players will respawn near beds on planets IF the spawn location is in a breathable atmosphere
+    B:allowPlanetRespawn=false
+
+    # EXPERIMENTAL: If set to true allows contruction and usage of the terraformer.  This is known to cause strange world generation after successful terraform
+    B:allowTerraforming=false
+
+    # If true dimensions not added by AR can be terraformed, including the overworld
+    B:allowTerraformingNonARWorlds=false
+
+    # If true players will be able to completely disable gravity on spacestation.  It's possible to get stuck and require a teleport, you have been warned!
+    B:allowZeroGSpacestations=false
+
+    # How many blocks have the biome changed per tick.  Large numbers can slow the server down
+    I:biomeUpdateSpeed=1
+
+    # Multiplier for the amount of power per tick the black hole generator should produce
+    I:blackHoleGeneratorMultiplier=1
+
+    # Multiplier for the build speed of the Rocket Builder (0.5 is twice as fast 2 is half as fast
+    D:buildSpeedMultiplier=1.0
+
+    # If true, breaking an extinguished torch will drop an extinguished torch instead of a vanilla torch
+    B:dropExtinguishedTorches=false
+
+    # Should Electric Mushrooms be able to spawn lightning
+    B:electricPlantsSpawnLightning=true
+
+    # If false the gravity controller cannot be built or used
+    B:enableGravityMachine=true
+
+    # list entities which should not be affected by atmosphere properties [default: ]
+    S:entityAtmBypass <
+     >
+
+    # If true players will respawn near beds on planets REGARDLESS of the spawn location being in a non-breathable atmosphere. Requires 'allowPlanetRespawn' being true.
+    B:forcePlanetRespawn=false
+
+    # If true planets with higher gravity require more fuel and lower gravity would require less
+    B:gravityAffectsFuels=true
+
+    # Amount of force the jetpack provides with respect to gravity, 1 is the same acceleration as caused by Earth's gravity, 2 is 2x the acceleration caused by Earth's gravity, etc.  To make jetpack only work on low gravity planets, simply set it to a value less than 1
+    D:jetPackForce=1.3
+
+    # List of oredictionary names of ores allowed to be mined by the laser drill if surface drilling is disabled.  Ores can be specified by just the oreName:<size> or by <modname>:<blockname>:<meta>:<size> where size is optional
+    S:laserDrillOres <
+        oreIron
+        oreGold
+        oreCopper
+        oreTin
+        oreRedstone
+        oreDiamond
+     >
+
+    # True if the ores in laserDrillOres should be a blacklist, false for whitelist
+    B:laserDrillOres_blacklist=false
+
+    # If true the orbital laser will actually mine blocks on the planet below
+    B:laserDrillPlanet=false
+
+    # If true the boots only protect the player on planets with low gravity
+    B:lowGravityBoots=false
+
+    # If true the machines from AdvancedRocketry will produce things like plates/rods for other mods even if Advanced Rocketry itself does not use the material (This can increase load time)
+    B:makeMaterialsForOtherMods=true
+
+    # Maximum unique biomes per planet, -1 to disable
+    I:maxBiomesPerPlanet=5
+
+    # Multiplier on how much O2 an oxygen vent consumes per tick
+    D:oxygenVentConsumptionMultiplier=1.0
+
+    # If true planets must be discovered in the warp controller before being visible
+    B:planetsMustBeDiscovered=false
+
+    # How many units of fuel should each Dilithium Crystal give to warp ships
+    I:pointsPerDilithium=500
+    B:resetPlanetsFromXML=false
+
+    # Mod:Blockname  for example "minecraft:chest" [default: ]
+    S:rocketBlockBlackList <
+     >
+
+    # Should the cutting machine be able to cut vanilla wood into planks
+    B:sawMillCutVanillaWood=true
+
+    # If true the Oxygen scrubbers require a consumable carbon collection cartridge
+    B:scrubberRequiresCartrige=true
+
+    # Amount of power per tick the solar generator should produce
+    I:solarGeneratorMultiplier=1
+
+    # Laser drill will not mine these dimension [default: ]
+    S:spaceLaserDimIdBlackList <
+     >
+
+    # Dimension ID to use for space stations
+    I:spaceStationId=-2
+
+    # Maximum time in minutes that the spacesuit's internal buffer can store O2 for
+    I:spaceSuitO2Buffer=30
+
+    # Max number of blocks allowed to be changed per tick
+    I:terraformBlockPerTick=1
+
+    # Multplier for atmosphere change speed
+    D:terraformMult=1.0
+
+    # Mod:Blockname  for example "minecraft:chest" [default: ]
+    S:torchBlocks <
+     >
+
+    # Amount of damage taken every second in a vacuum
+    I:vacuumDamage=1
+
+    # Multiplier for warp travel time
+    D:warpTravelTime=1.0
+}
+
+
+"mod interaction" {
+    # If true Galacticcraft's air will be disabled entirely requiring use of Advanced Rocketry's Oxygen system on GC planets
+    B:OverrideGCAir=true
+}
+
+
+"ore generation" {
+    I:AluminumPerChunk=1
+    I:AluminumPerClump=16
+    I:CopperPerChunk=10
+    I:CopperPerClump=6
+    I:DilithiumPerChunk=1
+    I:DilithiumPerChunkLuna=10
+    I:DilithiumPerClump=16
+    B:GenerateCopper=true
+    B:GenerateRutile=true
+    B:GenerateTin=true
+    I:IridiumPerChunk=1
+    I:IridiumPerClump=16
+    I:RutilePerChunk=6
+    I:RutilePerClump=6
+    I:TinPerChunk=10
+    I:TinPerClump=6
+    B:generateAluminum=true
+    B:generateDilithium=true
+
+    # If true then ore-containing geodes are generated on high pressure planets
+    B:generateGeodes=true
+    B:generateIridium=false
+
+    # average size of the geodes
+    I:geodeBaseSize=36
+
+    # List of oredictionary names of ores allowed to spawn in geodes
+    S:geodeOres <
+        oreIron
+        oreGold
+        oreCopper
+        oreTin
+        oreRedstone
+     >
+
+    # True if the ores in geodeOres should be a blacklist, false for whitelist
+    B:geodeOres_blacklist=false
+
+    # variation in geode size
+    I:geodeVariation=24
+}
+
+
+performance {
+    # Advanced visual effects
+    B:advancedVFX=true
+
+    # BitMask: 0: no threading, radius based; 1: threading, radius based (EXP); 2: no threading volume based; 3: threading volume based (EXP)
+    I:atmosphereCalculationMethod=3
+
+    # Radius of the O2 vent.  if atmosphereCalculationMethod is 2 or 3 then max volume is calculated from this radius.  WARNING: larger numbers can lead to lag
+    I:oxygenVentSize=32
+}
+
+
+planet {
+    # List of Biomes to be blacklisted from spawning as BiomeIds, default is: river, sky, hell, void, alienForest [default: [7], [8], [9], [127], [44]]
+    S:BlacklistedBiomes <
+        7
+        8
+        9
+        127
+        42
+     >
+
+    # Biomes that only spawn on worlds with pressures over 125, will override blacklist.  Defaults: StormLands, DeepSwamp [default: [49], [47]]
+    S:HighPressureBiomes <
+        47
+        45
+     >
+
+    # Some worlds have a chance of spawning single biomes contained in this list.  Defaults: deepSwamp, crystalChasms, alienForest, desert hills, mushroom island, extreme hills, ice plains [default: [49], [48], [44], [17], [14], [3], [12]]
+    S:SingleBiomes <
+        47
+        46
+        42
+        17
+        14
+        3
+        12
+     >
+
+    # Prevents any vanilla biomes from spawning on planets [default: false]
+    B:blackListVanillaBiomes=false
+
+    # Dimensions including and after this number are allowed to be made into planets [range: -127 ~ 8000, default: 2]
+    I:minDimension=2
+
+    # Chance of planet discovery in the warp ship monitor is not all planets are initially discoved, chance is 1/n
+    I:planetDiscoveryChance=5
+}
+
+
+rockets {
+    # Setting to false will disable the retrorockets that fire automatically on reentry on both player and automated rockets
+    B:autoRetroRockets=true
+
+    # Multiplier for per-tank capacity
+    D:fuelCapacityMultiplier=1.0
+
+    # List of fluid names for fluids that can be used as rocket fuel
+    S:rocketFuels <
+        rocketfuel
+     >
+
+    # Set to false if rockets should not require fuel to fly
+    B:rocketsRequireFuel=true
+
+    # Multiplier for per-engine thrust
+    D:thrustMultiplier=1.0
+}
+
+
+sealableblockwhitelist {
+    # Mod:Blockname  for example "minecraft:chest" [default: ]
+    S:general <
+     >
+}
+
+

src/overrides/config/advRocketry/asteroidConfig.xml

@@ -0,0 +1,11 @@
+<Asteroids>
+	<asteroid name="Small Asteroid" distance="10" mass="100" massVariability="0.5" minLevel="0" probability="10" richness="0.2" richnessVariability="0.5">
+		<ore itemStack="minecraft:iron_ore" chance="15" />
+		<ore itemStack="minecraft:gold_ore" chance="10" />
+		<ore itemStack="minecraft:redstone_ore" chance="10" />
+	</asteroid>
+	<asteroid name="Iridium Enriched asteroid" distance="100" mass="25" massVariability="0.5" minLevel="0" probability="0.75" richness="0.2" richnessVariability="0.3">
+		<ore itemStack="minecraft:iron_ore" chance="25" />
+		<ore itemStack="libvulpes:ore0 10" chance="5" />
+	</asteroid>
+</Asteroids>

src/overrides/config/advRocketry/oreConfig.xml

@@ -0,0 +1,2 @@
+<OreConfig>
+</OreConfig>

src/overrides/config/aether-dimension/biomes.txt

@@ -0,0 +1,2 @@
+#Format is modId:biomeRegistryName=biomeWeight
+#Example being minecraft:forest=100

src/overrides/config/aether/AetherI.cfg

@@ -0,0 +1,30 @@
+# Configuration file
+
+"aether world generation" {
+    B:"Christmas Content"=false
+    B:"Enable Tall Grass"=false
+}
+
+
+gameplay {
+    I:"Max Life Shards"=10
+}
+
+
+misc {
+    B:"Activate portal with only Skyroot bucket"=false
+    B:"Enable Legacy Visuals"=false
+}
+
+
+trivia {
+    B:"Disable random trivia"=false
+}
+
+
+"world identification" {
+    I:"Aether Biome ID"=127
+    I:"Aether Dimension ID"=4
+}
+
+

src/overrides/config/aether_legacy.cfg

@@ -0,0 +1,154 @@
+# Configuration file
+
+general {
+
+    dimension {
+        # Set the Dimension ID for the Aether.
+        # Min: 2
+        # Max: 256
+        I:aether_dimension_id=4
+    }
+
+    world_gen {
+        # Enables natural christmas decor all the time
+        B:christmas_time=false
+
+        # Enables natural Pink Aercloud generation
+        B:pink_aerclouds=false
+
+        # Enables natural christmas decor automatically during December and January. If christmas_time is enabled it'll override this.
+        B:seasonal_christmas=true
+
+        # Enables naturally generating tallgrass
+        B:tallgrass_enabled=false
+    }
+
+    visual_options {
+        # Determines whether the Aether b1.7.3 resource pack should be generated.
+        B:install_resourcepack=true
+
+        # Changes whether the Altar should be named Enchanter or not.
+        B:legacy_altar_name=false
+
+        # Changes Aether mobs to use their old models, if applicable
+        B:legacy_models=false
+
+        # Enables the Aether Menu toggle button
+        B:menu_button=true
+
+        # Enables the Aether Menu
+        B:menu_enabled=false
+
+        # Disables the random trivia/tips you see during loading screens
+        B:trivia_disabled=false
+
+        # Aerclouds will use their more saturated colors from later updates
+        B:updated_aercloud_colors=false
+    }
+
+    gameplay_changes {
+        # Determines if the player will get an Aether Portal Frame item when first joining the world.
+        B:aether_start=false
+
+        # Makes it so you have to eat Ambrosium, instead of just right clicking to heal
+        B:ambro_is_edible=false
+
+        # Disables eternal day making time cycle in the Aether without having to kill the Sun Spirit. This is mainly intended for use in modpacks.
+        B:disable_eternal_day=false
+
+        # Disables spawn of the Aether portal for use with portal being provided by another mod.
+        B:disable_portal=false
+
+        # Disables startup loot when entering the Aether
+        B:disable_startup_loot=false
+
+        # Enables the Golden Feather in dungeon loot
+        B:golden_feather=false
+
+        # The max amount of life shards that can be used per player
+        I:max_life_shards=10
+
+        # If disabed, the Sun Spirit's dialog will only show once per world.
+        B:repeat_sun_spirit_dialog=true
+
+        # If enabled, Aether Portals can only be lit by Skyroot Buckets
+        B:skyroot_bucket_only=false
+
+        # Removes the requirement for a player to be an operator to use the Sun Altar in multiplayer.
+        B:sun_altar_multiplayer=false
+
+        # Enables the Valkyrie Cape in dungeon loot
+        B:valkyrie_cape=false
+    }
+
+    audio_options {
+        # Enables dimensional music
+        B:game_music=true
+
+        # Enables menu music
+        B:menu_music=true
+
+        # Pauses the music when a record is playing
+        B:pause_on_record=true
+    }
+
+    spawnrates {
+        # Adjusts spawnrate for the Aechor Plant. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:aechorplant_spawnrate=55
+
+        # Adjusts spawnrate for the Aerbunny. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:aerbunny_spawnrate=1
+
+        # Adjusts spawnrate for the Aerwhale. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:aerwhale_spawnrate=1
+
+        # Adjusts spawnrate for the Cockatrice. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:cockatrice_spawnrate=45
+
+        # Adjusts spawnrate for the Flying Cow. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:flyingcow_spawnrate=1
+
+        # Adjusts spawnrate for the Moa. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:moa_spawnrate=1
+
+        # Adjusts spawnrate for the Phyg. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:phyg_spawnrate=1
+
+        # Adjusts spawnrate for the Sheepuff. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:sheepuff_spawnrate=1
+
+        # Adjusts spawnrate for the Swet. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:swet_spawnrate=40
+
+        # Adjusts spawnrate for the Whirlwind. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:whirlwind_spawnrate=55
+
+        # Adjusts spawnrate for the Zephyr. 1 is always, anything above that lessens the chances.
+        # Min: 1
+        # Max: 10000
+        I:zephyr_spawnrate=65
+    }
+
+}
+
+

src/overrides/config/alchemistry.cfg

@@ -0,0 +1,88 @@
+# Configuration file
+
+fission {
+    # Max energy capacity of the Fission Multiblock [range: 1 ~ 2147483647, default: 50000]
+    I:fissionEnergyCapacity=50000
+
+    # Max energy capacity of the Fission Multiblock [range: 1 ~ 2147483647, default: 300]
+    I:fissionEnergyperTick=300
+
+    # Max energy capacity of the Fission Multiblock [range: 1 ~ 2147483647, default: 40]
+    I:fissionProcessingTicks=40
+}
+
+
+fusion {
+    # Max energy capacity of the fusion Multiblock [range: 1 ~ 2147483647, default: 50000]
+    I:fusionEnergyCapacity=50000
+
+    # Max energy capacity of the fusion Multiblock [range: 1 ~ 2147483647, default: 300]
+    I:fusionEnergyperTick=300
+
+    # Max energy capacity of the fusion Multiblock [range: 1 ~ 2147483647, default: 40]
+    I:fusionProcessingTicks=40
+}
+
+
+general {
+    # Enables item automation with hoppers, pipes, etc [default: true]
+    B:enableAutomation=true
+
+    # Illegal drug compounds will have their names replaced with more family-friendly versions [default: false]
+    B:familyFriendlyMode=false
+}
+
+
+machines {
+    # Max energy capacity of the Atomizer [range: 1 ~ 2147483647, default: 10000]
+    I:atomizerEnergyCapacity=10000
+
+    # Set the energy consumption rate per tick for the Atomizer [range: 0 ~ 2147483647, default: 50]
+    I:atomizerEnergyPerTick=50
+
+    # Number of ticks per Atomizer operation [range: 1 ~ 2147483647, default: 100]
+    I:atomizerProcessingTicks=100
+
+    # Max energy capacity of the Combiner [range: 1 ~ 2147483647, default: 10000]
+    I:combinerEnergyCapacity=10000
+
+    # Set the energy consumption rate per tick for the Chemical Combiner [range: 0 ~ 2147483647, default: 200]
+    I:combinerEnergyPerTick=200
+
+    # Set the number of ticks per operation for the Chemical Combiner [range: 1 ~ 2147483647, default: 5]
+    I:combinerProcessingTicks=10
+
+    # Max energy capacity of the Dissolver [range: 1 ~ 2147483647, default: 10000]
+    I:dissolverEnergyCapacity=10000
+
+    # Set the energy consumption rate per tick for the Chemical Dissolver [range: 0 ~ 2147483647, default: 100]
+    I:dissolverEnergyPerTick=100
+
+    # The max amount of items that the Dissolver will output each tick. Please note: only one element will be outputted per tick, 
+    # and only the elements from one input are eligible at a time. For example: Cellulose (C6 H10 O5) with speed 4 would be outputted like so, 
+    # with each comma-seperated value representing 1 tick [4xC,2xC,4xH,4xH,2xH,4xO,1xO] [range: 1 ~ 64, default: 8]
+    I:dissolverSpeed=2
+
+    # Number of ticks per electrolyzer operation [range: 1 ~ 2147483647, default: 10]
+    I:elctrolyzerProcessingTicks=10
+
+    # Max energy capacity of the Electrolyzer [range: 1 ~ 2147483647, default: 10000]
+    I:electrolyzerEnergyCapacity=10000
+
+    # Set the energy consumption rate per tick for the Electrolyzer [range: 0 ~ 2147483647, default: 100]
+    I:electrolyzerEnergyPerTick=100
+
+    # The best possible processing time for the evaporator. In practice it will be increased by biome, time of day, etc [range: 1 ~ 2147483647, default: 160]
+    I:evaporatorProcessingTicks=160
+
+    # Max energy capacity of the Liquifier [range: 1 ~ 2147483647, default: 10000]
+    I:liquifierEnergyCapacity=10000
+
+    # Set the energy consumption rate per tick for the Liquifier [range: 0 ~ 2147483647, default: 50]
+    I:liquifierEnergyPerTick=50
+
+    # Number of ticks per Liquifier operation [range: 1 ~ 2147483647, default: 100]
+    I:liquifierProcessingTicks=100
+}
+
+

src/overrides/config/alchemistry/custom.xml

@@ -0,0 +1,3 @@
+<!--Read the wiki for more info on using custom recipes https://github.com/al132mc/alchemistry/wiki -->
+<recipes>
+</recipes>

src/overrides/config/alib.cfg

@@ -0,0 +1,14 @@
+# Configuration file
+
+announcement {
+    # An announcement to be periodically displayed to every player, disabled with an empty string [default: ]
+    S:announcement=
+
+    # How frequently the announcement will be shown to all players, 4 hours by default (at 20 tps) [range: 20 ~ 2147483647, default: 288000]
+    I:announcementInterval=288000
+
+    # URL to be displayed after the announcement, disabled with an empty string [default: ]
+    S:url=
+}
+
+

src/overrides/config/avaritia.cfg

@@ -0,0 +1,65 @@
+~1.0
+
+#General configuration of Avaritia components.
+"general" {
+	#Disable to remove end stone out of some of Avaritia's recipes.
+	B:"use_end_stone"=true
+
+	#Disable if you don't want the World Breaker to break unbreakable blocks.
+	B:"break_bedrock"=true
+
+	#Enable to keep the Ultimate Stew and Cosmic Meatballs from grabbing more ingredients.
+	B:"boring_food"=true
+
+	#Enable if you don't have RotaryCraft installed and want some buggy fractured ores.
+	B:"fractured_ores"=false
+
+	#These are the OreDictionary ID's for default trashed items. These are synced from the server to the client. And will appear as defaults on the client also. Clients can override these, They are defaults not Musts.
+	S:"aoe_trash_defaults" <
+		dirt
+		sand
+		gravel
+		cobblestone
+		netherrack
+		stoneGranite
+		stoneDiorite
+		stoneAndesite
+	>
+
+	#Enables verbose logging of actions taken on avaritia by CraftTweaker scripts. Only effects CraftTweakers script log file.
+	B:"verbose_craft_tweaker_logging"=false
+}
+
+#Disable to stop using that material in recipes. Useful if a mod adds unobtainable placeholder ores.
+"materials" {
+	B:"copper"=true
+
+	B:"tin"=true
+
+	B:"silver"=true
+
+	B:"lead"=true
+
+	B:"nickel"=true
+
+	B:"steel"=true
+
+	B:"fluxed"=true
+
+	B:"enderium"=true
+
+	B:"dark_steel"=true
+
+	B:"platinum"=false
+
+	B:"iridium"=false
+}
+
+#Balance modifications for the Compressor.
+"balance" {
+	#Added to the existing modifier to make prices more expensive or cheaper. Can be negative.
+	I:"cost_modifier"=0
+
+	#Added to the existing multiplier to make prices more expensive or cheaper. Can be negative.
+	I:"cost_multiplier"=0
+}

src/overrides/config/baubles.cfg

@@ -0,0 +1,8 @@
+# Configuration file
+
+client {
+    # Set this to false to disable rendering of baubles in the player. [default: true]
+    B:baubleRender.enabled=true
+}
+
+

src/overrides/config/betterbuilderswands.cfg

@@ -0,0 +1,45 @@
+# Configuration file
+
+##########################################################################################################
+# balance
+#--------------------------------------------------------------------------------------------------------#
+# For those wanting to change balance.
+# Note: The 'blocks-at-a-time' for the unbreakable wand is 2^n where n is the damage value. Recipe modification can be done with another mod.
+##########################################################################################################
+
+balance {
+    # How many blocks the diamond wand can place at a time. Use -1 for default
+    I:diamond_wand_limit=-1
+}
+
+
+general {
+    # Blocks that won't work at all with the wands. E.g. 'minecraft:bedrock/0'
+    S:blacklisted_blocks <
+     >
+
+    # Enable recipe for diamond builder's wand
+    B:enable_diamond_wand=true
+
+    # Enable recipe for iron builder's wand
+    B:enable_iron_wand=true
+
+    # Enable recipe for stone builder's wand
+    B:enable_stone_wand=true
+
+    # Specify forced mappings for what to build from certain blocks.
+    # (what you are looking at)=>(number required)*(item required)=>(block to build)
+    S:forced_blocks=minecraft:lapis_ore/0=>1*minecraft:lapis_ore/4=>minecraft:lapis_ore/0,minecraft:lit_redstone_ore/0=>1*minecraft:redstone_ore/0=>minecraft:lit_redstone_ore/0,minecraft:grass/0=>1*minecraft:grass/0=>minecraft:grass/0,minecraft:grass/0=>1*minecraft:dirt/0=>minecraft:dirt/0,minecraft:dirt/1=>1*minecraft:dirt/1=>minecraft:dirt/1,minecraft:dirt/1=>1*minecraft:dirt/0=>minecraft:dirt/0,minecraft:dirt/2=>1*minecraft:dirt/2=>minecraft:dirt/2,minecraft:dirt/2=>1*minecraft:dirt/0=>minecraft:dirt/0
+
+    # Blocks that break assumptions. When the placed block is not what you expect. E.g. 'minecraft:bedrock/0'
+    S:no_assumption_blocks <
+     >
+}
+
+
+why_not {
+    # For those that don't like Extra Utils progression. [default: false]
+    B:straymav_ultimate_wand=false
+}
+
+

src/overrides/config/betterfoliage.cfg

@@ -0,0 +1,332 @@
+# Configuration file
+
+algae {
+    B:enabled=true
+    D:hOffset=0.1
+    D:size=1.0
+    D:heightMin=0.5
+    D:heightMax=1.0
+    I:population=48
+    I:biomes <
+        0
+        7
+        10
+        11
+        24
+     >
+    B:shaderWind=true
+    I:distance=1000
+}
+
+
+blocks {
+    S:leavesClassesWhitelist <
+        net.minecraft.block.BlockLeaves
+        biomesoplenty.common.block.BlockBOPLeaves
+        com.gildedgames.aether.common.blocks.natural.BlockAetherLeaves
+     >
+    S:leavesClassesBlacklist <
+     >
+    S:leavesModels <
+        minecraft:block/leaves,all
+        minecraft:block/cube_all,all
+        biomesoplenty:block/leaves_overlay,under
+     >
+    S:grassClassesWhitelist <
+        net.minecraft.block.BlockGrass
+        biomesoplenty.common.block.BlockBOPGrass
+        tconstruct.blocks.slime.SlimeGrass
+        enhancedbiomes.blocks.BlockGrassEB
+        com.bioxx.tfc.Blocks.Terrain.BlockGrass
+        com.shinoow.abyssalcraft.common.blocks.BlockDreadGrass
+        com.shinoow.abyssalcraft.common.blocks.BlockDarklandsgrass
+     >
+    S:grassClassesBlacklist <
+     >
+    S:grassModels <
+        block/grass,top
+        block/cube_bottom_top,top
+        block/soil/grass_master,top
+     >
+    S:myceliumWhitelist <
+        net.minecraft.block.BlockMycelium
+        nex.block.BlockMycelium
+     >
+    S:myceliumBlacklist <
+     >
+    S:dirtWhitelist <
+        net.minecraft.block.BlockDirt
+        biomesoplenty.common.block.BlockBOPDirt
+        enhancedbiomes.blocks.BlockSoilEB
+        com.bioxx.tfc.Blocks.Terrain.BlockDirt
+        net.aetherteam.aether.blocks.natural.BlockAetherDirt
+        com.gildedgames.aether.common.blocks.natural.BlockAetherDirt
+        slimeknights.tconstruct.world.block.BlockSlimeDirt
+     >
+    S:dirtBlacklist <
+     >
+    S:cropsWhitelist <
+        net.minecraft.block.BlockTallGrass
+        net.minecraft.block.BlockCrops
+        biomesoplenty.common.block.BlockBOPFlower
+        biomesoplenty.common.block.BlockBOPTurnip
+        biomesoplenty.common.block.BlockBOPPlant
+        tconstruct.blocks.slime.SlimeTallGrass
+        plantmegapack.block.PMPBlockBerrybush
+        plantmegapack.block.PMPBlockCrops
+        plantmegapack.block.PMPBlockDesert
+        plantmegapack.block.PMPBlockFern
+        plantmegapack.block.PMPBlockFlowerMulti
+        plantmegapack.block.PMPBlockFlowerSingle
+        plantmegapack.block.PMPBlockForest
+        plantmegapack.block.PMPBlockGrass
+        plantmegapack.block.PMPBlockJungle
+        plantmegapack.block.PMPBlockMountain
+        plantmegapack.block.PMPBlockSavanna
+        plantmegapack.block.PMPBlockShrub
+        plantmegapack.block.PMPBlockWetlands
+        com.pam.harvestcraft.BlockPamCrop
+        com.pam.harvestcraft.BlockPamDesertGarden
+        com.pam.harvestcraft.BlockPamNormalGarden
+        com.pam.harvestcraft.BlockPamWaterGarden
+     >
+    S:cropsBlacklist <
+        net.minecraft.block.BlockReed
+        net.minecraft.block.BlockDoublePlant
+        net.minecraft.block.BlockCarrot
+        net.minecraft.block.BlockPotato
+     >
+    S:logClassesWhitelist <
+        net.minecraft.block.BlockLog
+        biomesoplenty.common.block.BlockBOPLog
+        com.progwml6.natura.common.block.BlockEnumLog
+        thaumcraft.common.blocks.world.plants.BlockLogsTC
+        forestry.arboriculture.gadgets.BlockLog
+        com.bioxx.tfc.Blocks.Flora.BlockLogVert
+        com.bioxx.tfc.Blocks.Flora.BlockLogNatural
+        CookingPlus.blocks.CookingPlusPalmLog
+        CookingPlus.blocks.CookingPlusTangleLog
+        CookingPlus.blocks.CookingPlusTangleHeart
+        ic2.core.block.BlockRubWood
+        techreborn.blocks.BlockRubberLog
+        betterwithmods.blocks.BlockStump
+     >
+    S:logClassesBlacklist <
+        extrabiomes.blocks.BlockMiniLog
+     >
+    S:logModels <
+        block/column_side,end,end,side
+        block/cube_column,end,end,side
+        block/cube_all,all,all,all
+        agriculturalrevolution:block/palmlog,top,top,texture
+        block/column_top,end,end,side_a,side_b
+        block/column_side_x,end,end,side_a,side_b
+        block/column_side_z,end,end,side_a,side_b
+     >
+    S:sandWhitelist <
+        net.minecraft.block.BlockSand
+        com.bioxx.tfc.Blocks.Terrain.BlockSand
+     >
+    S:sandBlacklist <
+     >
+    S:lilypadWhitelist <
+        net.minecraft.block.BlockLilyPad
+        biomesoplenty.common.block.BlockBOPLilypad
+        com.bioxx.tfc.Blocks.Vanilla.BlockCustomLilyPad
+     >
+    S:lilypadBlacklist <
+     >
+    S:cactusWhitelist <
+        net.minecraft.block.BlockCactus
+        com.bioxx.tfc.Blocks.Vanilla.BlockCustomCactus
+     >
+    S:cactusBlacklist <
+     >
+    S:netherrackWhitelist <
+        net.minecraft.block.BlockNetherrack
+        nex.block.BlockNetherrack
+     >
+    S:netherrackBlacklist <
+     >
+}
+
+
+cactus {
+    B:enabled=true
+    D:size=0.8
+    D:sizeVariation=0.1
+    D:hOffset=0.1
+    I:distance=1000
+}
+
+
+connectedGrass {
+    B:enabled=true
+    B:snowEnabled=false
+}
+
+
+coral {
+    B:enabled=true
+    B:shallowWater=false
+    D:hOffset=0.2
+    D:vOffset=0.1
+    D:size=0.7
+    D:crustSize=1.4
+    I:chance=32
+    I:population=48
+    I:biomes <
+        0
+        7
+        10
+        11
+        16
+        24
+        25
+        26
+     >
+    I:distance=1000
+}
+
+
+fallingLeaves {
+    B:enabled=true
+    D:speed=0.05
+    D:windStrength=0.5
+    D:stormStrength=0.8
+    D:size=0.75
+    D:chance=0.05
+    D:perturb=0.25
+    D:lifetime=5.0
+    B:opacityHack=true
+    B:fadeOut=true
+}
+
+
+global {
+    B:enabled=true
+    B:nVidia=true
+}
+
+
+leaves {
+    B:enabled=true
+    B:snowEnabled=true
+    D:hOffset=0.2
+    D:vOffset=0.1
+    D:size=1.4
+    B:dense=false
+    B:hideInternal=true
+    I:distance=1000
+}
+
+
+lilypad {
+    B:enabled=true
+    D:hOffset=0.1
+    I:flowerChance=16
+    I:distance=1000
+}
+
+
+netherrack {
+    B:enabled=true
+    D:hOffset=0.2
+    D:heightMin=0.6
+    D:heightMax=0.8
+    D:size=1.0
+    I:distance=1000
+}
+
+
+reed {
+    B:enabled=true
+    D:hOffset=0.2
+    D:heightMin=1.7
+    D:heightMax=2.2
+    I:population=32
+    I:biomes <
+        0
+        1
+        4
+        6
+        7
+        9
+        14
+        15
+        16
+        18
+        21
+        22
+        23
+        24
+        27
+        28
+        29
+        127
+        129
+        132
+        134
+        149
+        151
+        155
+        156
+        157
+     >
+    B:shaderWind=true
+    I:distance=1000
+}
+
+
+risingSoul {
+    B:enabled=true
+    D:chance=0.02
+    D:perturb=0.05
+    D:headSize=1.0
+    D:trailSize=0.75
+    D:opacity=0.5
+    D:sizeDecay=0.97
+    D:opacityDecay=0.97
+    D:lifetime=4.0
+    I:trailLength=48
+    I:trailDensity=3
+}
+
+
+roundLogs {
+    B:enabled=true
+    D:radiusSmall=0.25
+    D:radiusLarge=0.44
+    D:dimming=0.7
+    B:connectSolids=false
+    B:lenientConnect=true
+    B:connectPerpendicular=true
+    B:connectGrass=true
+    B:defaultY=false
+    D:zProtection=0.99
+    I:distance=1000
+}
+
+
+shaders {
+    I:leavesId=18
+    I:grassId=31
+}
+
+
+shortGrass {
+    B:grassEnabled=true
+    B:myceliumEnabled=true
+    B:snowEnabled=true
+    D:hOffset=0.2
+    D:heightMin=0.6
+    D:heightMax=0.8
+    D:size=1.0
+    I:population=64
+    B:useGenerated=false
+    B:shaderWind=true
+    D:saturationThreshold=0.1
+    I:distance=1000
+}
+
+

src/overrides/config/bibliocraft.cfg

@@ -0,0 +1,129 @@
+# Configuration file
+
+##########################################################################################################
+# blocks enabled
+#--------------------------------------------------------------------------------------------------------#
+# Here you can disable or re-enable any blocks or items you choose. Change value to false to disable selected block or item.
+##########################################################################################################
+
+"blocks enabled" {
+    B:Armorstand=true
+    B:AtlasBook=true
+    B:AtlasEternalCompass=true
+    B:BigBook=true
+    B:Bookcase=true
+    B:Clipboard=true
+    B:Clock=true
+    B:CookieJar=true
+    B:DeskBell=true
+    B:DinnerPlate=true
+    B:DiscRack=true
+    B:FancySign=true
+    B:FancyWorkbench=true
+    B:FramedChest=true
+    B:FurniturePaneler=true
+    B:HandDrill=true
+    B:Lamp=true
+    B:Lantern=true
+    B:Lock=true
+    B:MapFrame=true
+    B:PaintingFrames=true
+    B:PlumbLine=true
+    B:Potionshelf=true
+    B:PrintpressTypeMachine=true
+    B:Readingglasses=true
+    B:Redstonebook=true
+    B:ScrewGun=true
+    B:Seat=true
+    B:Shelf=true
+    B:SlottedBook=true
+    B:StockroomCatalog=true
+    B:SwordPedestal=true
+    B:Table=true
+    B:Tapemeasure=true
+    B:TesterItem=true
+    B:Toolrack=true
+    B:Typewriter=true
+    B:WaypointCompass=true
+    B:Weaponcase=true
+    B:WoodDesk=true
+    B:WoodLabel=true
+}
+
+
+defaultbigbooktextscale {
+    # This value will set the default text scale of text in the Big Book. Choose a positive integer between 0 and 7. 0 is the smallest scale and 7 is the largest scale. [range: 0 ~ 7, default: 0]
+    I:general=0
+}
+
+
+"force fast render" {
+    B:Case=false
+    B:DinnerPlate=false
+    B:DiscRack=false
+    B:FancySign=true
+    B:Label=true
+    B:PotionShelf=true
+    B:Shelf=false
+    B:Table=false
+    B:ToolRack=false
+}
+
+
+general {
+    # These are keywords that add additional support for more types of discs and items that are allowed to be placed on the disc rack. Add more keywords if you wish to allow more types of items to be displayed
+    S:AdditionalDiscs=disc, disk
+
+    # These are keywords that add additional support for more types of potions and items. Add more keyworks if you wish to allow more types of items to be displayed.
+    S:AdditionalPotions=essence, mead, bottle, test, element, molecule, can, capsule, cell, catalyst, ambrosia, honey pot, dissipation, vial, juice
+
+    # These are the names of additional tools that can be added to the Tool Rack. Added keywords will allow additional items to be placed on this block.
+    S:AdditionalTools=sprayer, wand, rod, scepter, wrench, screwdriver, meter, handsaw, gun, cutter, scoop, soldering, painter, reader, shovel, grafter, pickaxe, pipette, magnifying, sword, axe, hammer
+
+    # These are the keywords that are compared against the item names to determine if the item can be placed on a Bookcase. Add more keywords if needed.
+    S:AllowedBooks=book, map, journal, plan, thaumonomicon, necronomicon, lexicon, print, notes, spell, library, tome, encyclopedia
+
+    # Setting this to false will deactivate the redstone signal output from seats when a player is sitting
+    B:ChairRedstone=true
+
+    # Setting this to false will permanently disable update checking
+    B:CheckForUpdates=true
+
+    # Setting this to true will disable all renderers. This will allow a world to be loaded and a problem item removed from a BiblioCraft block in case of a rendering related crash.
+    B:DisableRenderers=false
+
+    # This option enables crafting to be done inside a recipe book with no workbench.
+    B:EnableCraftingWithRecipieBooks=true
+
+    # Setting this to false will disable light emission from the Shelf, Label, Display Case and Table when a block that gives off light is placed on them.
+    B:EnableLightEmission=true
+    B:EnableLockAndKeyRecipe=false
+
+    # This option forces all new books added to the typesetting table to be public
+    B:EnablePublicTypesettingBooks=false
+
+    # This will multiply the cost of copying enchanted books on the typesetting table. Please enter a positive integer value. Default is 10. Setting this to 1 would make the enchatment cost 1/10 the level default cost.
+    I:EnchantmentCostMultiplyer=10
+
+    # Default is 1 update per 10 ticks, just like Item Frames. The number indicates how many ticks before an update packet is sent to clients. Lower numbers means more, faster updates.
+    I:MapUpdateRate=10
+
+    # This will set the max number of uses an Enchanted Plate has before breaking. Default is 3.
+    I:MaxEnchantedPlateUses=3
+
+    # This will adjust the maximium render distance at which paintings can be seen. The default is 64.0 blocks.
+    D:PaintingRenderDistance=64.0
+}
+
+
+##########################################################################################################
+# stored variables
+#--------------------------------------------------------------------------------------------------------#
+# These are the variables used by BiblioCraft to track if the player has already recieved an update message for a new version. These should not need to be edited.
+##########################################################################################################
+
+"stored variables" {
+    S:lastVersionChecked=2.4.5
+}
+
+

src/overrides/config/bookshelf.cfg

@@ -0,0 +1,41 @@
+# Configuration file
+
+##########################################################################################################
+# oredict
+#--------------------------------------------------------------------------------------------------------#
+# WARNIG: Changing these config options may break recipes in mods that use Bookshelf.
+##########################################################################################################
+
+oredict {
+    # Should vanilla arrows be ore dicted? [default: true]
+    B:arrows=true
+
+    # Should vanilla fences and fence gates be ore dicted? [default: true]
+    B:fence=true
+
+    # Should misc blocks like magma blocks and bone blocks be put in the ore dict? [default: true]
+    B:misc=true
+
+    # Should vanilla rails be ore dicted? [default: true]
+    B:rails=true
+
+    # Should vanilla seeds be ore dicted? [default: true]
+    B:seeds=true
+
+    # Should vanilla shulker boxes be ore dicted? [default: true]
+    B:shulker=true
+}
+
+
+##########################################################################################################
+# translations
+#--------------------------------------------------------------------------------------------------------#
+# Adds support for additional levels. Lowering this can improve memory.
+##########################################################################################################
+
+translations {
+    # The amount of enchantment levels to translate. 10 or less will disable this. [range: 0 ~ 32767, default: 256]
+    I:enchantmentCount=256
+}
+
+

src/overrides/config/botania.cfg

@@ -0,0 +1,164 @@
+# Configuration file
+
+general {
+    # Set this to false to disable the Adaptative Config. Adaptative Config changes any default config values from old versions to the new defaults to make sure you aren't missing out on changes because of old configs. It will not touch any values that were changed manually.
+    B:adaptativeConfig.enabled=true
+
+    # Set this to false to disable Albedo compat for moving colored lights on some Botania entities
+    B:albedoLights.enabled=true
+
+    # Set this to false to disable custom armor models.
+    B:armorModels.enable=true
+
+    # Set this to false to disable rendering of baubles in the player.
+    B:baubleRender.enabled=true
+
+    # Set this to false to remove the block breaking particles from the flowers and other items in the mod.
+    B:blockBreakingParticles.enabled=true
+
+    # Set this to false to remove the block breaking particles from the Mana Shatterer, as there can be a good amount in higher levels.
+    B:blockBreakingParticlesTool.enabled=true
+
+    # Set this to false to disable the wireframe when looking a block bound to something (spreaders, flowers, etc).
+    B:boundBlock.wireframe.enabled=true
+
+    # Set this to false to disable the animation when an item is charging on top of a mana pool.
+    B:chargeAnimation.enabled=true
+
+    # Set this to false to disable the Smokey Quartz blocks. This config option is here for those using Thaumic Tinkerer
+    B:darkQuartz.enabled=true
+
+    # Set to false to disable Botania's messages in the F3 debug screen
+    B:debugInfo.enabled=true
+
+    # Set this to false to disable the particles in the elven portal.
+    B:elfPortal.particles.enabled=true
+
+    # Set to false to disable the ability for the Hand of Ender to pickpocket other players' ender chests.
+    B:enderPickpocket.enabled=true
+
+    # Set this to false to disable the Fallen Kanade flower (gives Regeneration). This config option is here for those using Blood Magic. Note: Turning this off will not remove ones already in the world, it'll simply prevent the crafting.
+    B:fallenKanade.enabled=true
+
+    # Set this to false to disable the fancy skybox in Garden of Glass.
+    B:fancySkybox.enable=true
+
+    # Set this to true to enable the fancy skybox in non Garden of Glass worlds. (Does not require Garden of Glass loaded to use, needs 'fancySkybox.enable' to be true as well)
+    B:fancySkybox.normalWorlds=false
+
+    # The height of the Flugel Tiara flight bar. You can change this if you have a mod that adds a bar in that spot.
+    I:flightBar.height=49
+
+    # The height of the Flugel Tiara flight bar if your breath bar is shown. You can change this if you have a mod that adds a bar in that spot.
+    I:flightBarBreath.height=59
+
+    # Turn this off ONLY IF you're on an extremely large world with an exaggerated count of Mana Spreaders/Mana Pools and are experiencing TPS lag. This toggles whether flowers are strict with their checking for connecting to pools/spreaders or just check whenever possible.
+    B:flower.forceCheck=true
+
+    # The frequency in which particles spawn from normal (worldgen) mystical flowers
+    D:flowerParticles.frequency=0.75
+
+    # The harvest level of the Mana Lens: Bore. 3 is diamond level. Defaults to 3
+    I:harvestLevel.boreLens=3
+
+    # The harvest level of the Mana Lens: Weight. 3 is diamond level. Defaults to 2 (iron level)
+    I:harvestLevel.weightLens=2
+
+    # Set this to true to enable justified text in the Lexica Botania's text pages.
+    B:lexicon.enable.justifiedText=false
+
+    # Set this to false to disable the rotating items in the petal and rune entries in the Lexica Botania.
+    B:lexicon.enable.rotatingItems=true
+
+    # Set this to false to disable the animated 3D render for the Lexica Botania.
+    B:lexicon.render.3D=true
+
+    # Set this to true to invert the Ring of Magnetization's controls (from shift to stop to shift to work)
+    B:magnetRing.invert=false
+
+    # The height of the mana display bar in above the XP bar. You can change this if you have a mod that changes where the XP bar is.
+    I:manaBar.height=29
+
+    # Set this to false to disable the Mana Enchanter. Since some people find it OP or something. This only disables the entry and creation. Old ones that are already in the world will stay.
+    B:manaEnchanter.enabled=true
+
+    # Set this to false to disable the Mana Fluxfield (generates RF from mana). This only disables the entry and creation. Old ones that are already in the world will stay.
+    B:manaFluxfield.enabled=true
+
+    # Set this to true to disable the mana spreader shooting sound.
+    B:manaSpreaders.silent=false
+
+    # Set this to true if you are the chosen one. For lovers of glitch art and just general mad people.
+    B:matrixMode.enabled=false
+
+    # Set this to true to set the power system's particles to be a lot more subtle. Good for low-end systems, if the particles are causing lag.
+    B:powerSystem.subtle=false
+
+    # Set this to true to disable the wiki lookup feature of the lexica, for offline usage.
+    B:quickLookup.lexicaOfflineMode=false
+
+    # Set this to true to use Shift instead of Ctrl for the inventory lexica botania quick lookup feature.
+    B:quickLookup.useShift=false
+
+    # Set this to false to disable the references in the flower tooltips. (You monster D:)
+    B:references.enabled=true
+
+    # Set this to false to disable the Relic System. This only disables the entries, drops and achievements. Old ones that are already in the world will stay.
+    B:relics.enabled=true
+
+    # Set this to false to make the Ring of Odin not apply fire resistance. Mostly for people who use Witchery transformations.
+    B:ringOfOdin.fireResist=true
+
+    # Set this to false to disable seasonal features, such as halloween and christmas.
+    B:seasonalFeatures.enabled=true
+
+    # Set this to false to disable the use of shaders for some of the mod's renders.
+    B:shaders.enabled=true
+
+    # The GL Texture Unit to use for the secondary sampler passed in to the Lexica Botania's category button shader. DO NOT TOUCH THIS IF YOU DON'T KNOW WHAT YOU'RE DOING
+    I:shaders.secondaryUnit=7
+
+    # Set this to true to enable the Shedding feature from 1.7.10. You'll need to load the game to generate the options. No options are enabled by default. This increases load time.
+    B:shedding.enable=false
+
+    # Do not ever touch this value if not asked to. Possible symptoms of doing so include your head turning backwards, the appearance of Titans near the walls or you being trapped in a game of Sword Art Online.
+    I:spreader.posShift=1
+
+    # How many ticks into the future will mana spreaders attempt to predict where mana bursts go? Setting this lower will improve spreader performance, but will cause them to not fire at targets that are too far away.
+    I:spreader.traceTime=400
+
+    # Set this to true if you use lots of floating flowers and are experiencing rendering lag. Will disable the floating flowers' animations and render them statically for a major performance boost. Hit F3+A in-world after toggling this.
+    B:staticFloaters.enabled=false
+
+    # Set this to false to disable Thaumcraft aspects on Botania items
+    B:thaumcraftAspects.enabled=true
+
+    # Set this to false to disable Thaumcraft Infusion Stabilizing in botania blocks
+    B:thaumraftStabilizers.enabled=true
+
+    # Set this to false to always display all particles regardless of the "Particles" setting in the Vanilla options menu.
+    B:vanillaParticleConfig.enabled=true
+
+    # Set this to true to use a static wand beam that shows every single position of the burst, similar to the way it used to work on old Botania versions. Warning: Disabled by default because it may be laggy.
+    B:wandBeam.static=false
+
+    # The density of each Botania flower patch generated, defaults to 2, the lower the number, the less each patch will have.
+    I:worldgen.flower.density=2
+
+    # The inverse chance for a Botania flower patch to be generated, defaults to 16. The higher this value is the less patches will exist and the more flower each will have.
+    I:worldgen.flower.patchChance=16
+
+    # The size of each Botania flower patch, defaults to 6. The larger this is the farther the each patch can spread
+    I:worldgen.flower.patchSize=6
+
+    # The quantity of Botania flower patches to generate in the world, defaults to 2, the lower the number the less patches generate.
+    I:worldgen.flower.quantity=2
+
+    # The chance for a Botania flower generated in a patch to be a tall flower. 0.1 is 10%, 1 is 100%. Defaults to 0.05
+    D:worldgen.flower.tallChance=0.05
+
+    # The quantity of Botania mushrooms to generate underground, in the world, defaults to 40, the lower the number the less patches generate.
+    I:worldgen.mushroom.quantity=40
+}
+
+

src/overrides/config/brandon3055/BrandonsCore.cfg

@@ -0,0 +1,30 @@
+# Configuration file
+
+##########################################################################################################
+# Misc
+#--------------------------------------------------------------------------------------------------------#
+# Comment for category: Misc
+##########################################################################################################
+
+Misc {
+    # Enable DEV log output.
+    B:devLog=false
+
+    # Allows you to disable the tpx command.
+    B:enableTpx=true
+}
+
+
+##########################################################################################################
+# Server
+#--------------------------------------------------------------------------------------------------------#
+# Comment for category: Server
+##########################################################################################################
+
+Server {
+    # This disables the gui that is shown to clients if a server side config that cant be hot swapped has changed.
+    # It is replaced by a chat message that has an option to open the gui
+    B:disableInvasiveConfigGui=false
+}
+
+

src/overrides/config/brandon3055/Custom Fusion Recipe Info.txt

@@ -0,0 +1,124 @@
+//The recipe format has recently been updated! Old recipes will still work but may be disabled in a future MC version.
+
+It is now possible to add custom fusion recipes and/or remove existing ones.
+This feature is intended for Mod pack creators.
+
+Recipes are specified using json file which you will need to place in config/brandon3055 (The same folder you should have found this text document in)
+The json MUST be named "CustomFusionRecipes.json" (Without the quotes)
+
+The following is an example of what the json file should look like (See further down for an explanation of what everything means)
+
+[
+    {
+        "mode": "ADD",
+        "result": "minecraft:beacon",
+        "catalyst": "minecraft:nether_star",
+        "energy": 1000,
+        "tier": 1,
+        "ingredients": [
+            "minecraft:glass",
+            "minecraft:glass",
+            "minecraft:glass",
+            "minecraft:glass",
+            "minecraft:glass",
+            "minecraft:obsidian"
+        ]
+    },
+    {
+        "mode": "ADD",
+        "result": "minecraft:diamond_sword,1,0,{ench:[0:{lvl:5s,id:21s},1:{lvl:5s,id:20s},2:{lvl:5s,id:19s}]}",
+        "catalyst": "minecraft:golden_apple,1,1",
+        "energy": 1000,
+        "tier": 1,
+        "ingredients": [
+            "ore:oreGold",
+            "ore:blockGold",
+            "ore:ingotGold",
+            "minecraft:stone,1,0,{ench:[0:{lvl:5s,id:21s},1:{lvl:5s,id:20s},2:{lvl:5s,id:19s}]}"
+        ]
+    },
+    {
+        "mode": "REMOVE",
+        "result": "draconicevolution:draconic_staff_of_power",
+        "catalyst": "draconicevolution:draconic_pick",
+        "ingredients": [
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_ingot",
+            "draconicevolution:draconic_shovel",
+            "draconicevolution:draconic_sword",
+            "draconicevolution:awakened_core"
+        ]
+    },
+    {
+        "mode": "REMOVE",
+        "result": "draconicevolution:draconic_shovel",
+        "catalyst": "draconicevolution:wyvern_shovel"
+    }    
+]
+
+
+The above json adds 2 recipes for vanilla items and removes 2 recipes from Draconic Evolution. It should be fairly clear how those examples work
+The following explains the recipes in more detail
+
+# Adding Recipes #
+
+"mode":
+- For adding recipes mode can be set to "ADD" or it can be left out and the recipe will default to the ADD function
+
+"result":
+- This is the item stack that the recipe will create.
+- This should be a specific item. It can not be an ore dictionary item.
+
+"catalyst":
+- The catalyst is the item that gets combined with the ingredients to create the result. 
+- This should be a specific item. It can not be an ore dictionary item.
+
+"energy":
+- This id the energy required for the crafting. Note that this number is multiplied by the number of ingredients.
+Meaning if you specifies 1000 for a recipe that has 8 ingredients the total energy cost would be 8000RF.
+
+"tier":
+- This is the crafting tier of this recipe 0 = basic, 1 = wyvern, 2 = awakened, 3 = chaotic
+
+"ingredients":
+- This is a list of ingredients required for the recipe.
+- These can be ore dictionary items.
+
+
+# Removing Recipes #
+
+"mode":
+- Mode must be set to "REMOVE" when removing a recipe
+
+When removing recipes you to not need to specify the tier or energy cost of the target recipe.
+You can instead just specify the result, catalyst and ingredients of the target recipe.
+Optionally if you leave out the ingredients it will remove any recipe matching the result and catalyst items.
+
+
+## Item Stack Strings ##
+
+Example:      minecraft:wool,16,14     - This is 16 red wool
+Ore Example:  ore:ingotCopper          - This is 1 copper ingots using the ore dictionary
+Note: Ore entries do not support more that 1 stack size, Item damage or nbt
+More on the ore dictionary http://www.minecraftuniversity.com/forge/ore_dictionary_list/
+
+The name used in the item/block registry name or an ore dictionary name. Both the number of items and the damage value are optional
+
+Examples:
+name, stack size, meta, NBT
+ore:stone
+minecraft:stone         
+minecraft:stone,64       
+minecraft:stone,64,3 
+minecraft:stone,64,3,{NBT}
+
+
+### Notes ###
+The order in which you add/remove recipes dose not matter when replacing recipes. 
+Meaning for example you can add a recipe for a DE item then remove the original recipe and it will not remove the one you jsut added.
+
+You can use ore dictionary items for the catalyst and result when adding recipes but the default fusion implementation dose not support that. 
+So they will be replaced with the first item stack from the ore dictionary that matches that name.

src/overrides/config/brandon3055/DraconicEvolution.cfg

@@ -0,0 +1,477 @@
+# Configuration file
+
+##########################################################################################################
+# Client Settings
+#--------------------------------------------------------------------------------------------------------#
+# These are client side properties that have no effect server side.
+##########################################################################################################
+
+"Client Settings" {
+    # Disables the 3D tool and armor models. This is required if you want to use a 2D resource pack.
+    B:disable3DModels=false
+
+    # This option is mainly here in case there are conflicts with other mods.
+    B:disableArmorFOVCorrection=false
+
+    # If true, the custom arrow models used by DE will be replaced by the vanilla model.
+    B:disableCustomArrowModel=false
+
+    # If true, the item dislocator will not make the pickup sound when it collects items.
+    B:disableDislocatorSound=false
+
+    # If true, the range of the Celestial Manipulator's sound effect will be significantly reduced.
+    B:disableLoudCelestialManipulator=false
+
+    # If true, the armor shield will not render when you take damage (this is only a visual change).
+    B:disableShieldHitEffect=false
+
+    # If true, the armor shield hit sound will be disabled.
+    B:disableShieldHitSound=false
+
+    # This is where the settings for the in game hud are stored. You should not need to adjust these unless something breaks.
+    # Warning: Changing the number of entries in this list will crash your game.
+    I:hudSettings <
+        996
+        825
+        69
+        907
+        90
+        100
+        3
+        0
+        1
+        1
+        1
+        1
+     >
+
+    # Invert Dislocator Pedestal display name shift behavior.
+    B:invertDPDSB=false
+
+    # This allows you to disable just the Energy Crystal shader. This shader can be a lot lagier than the reactor's shader since there are usually a lot more of them (The fallback crystal texture is not soooo bad...).
+    B:useCrystalShaders=true
+
+    # Set this to false if you prefer the original look of the reactor beams.
+    B:useReactorBeamShaders=true
+
+    # Set this to false if your system can not handle the awesomeness that is shaders! (Warning: Will make cool things look horrible!)
+    B:useShaders=true
+}
+
+
+##########################################################################################################
+# Misc
+#--------------------------------------------------------------------------------------------------------#
+# Just some misc settings.
+##########################################################################################################
+
+Misc {
+    # Set this to false to disable the Chaos Guardian's chunkloading ability.
+    # Note. The chaos guardian is ONLY loaded when a player is within a couple hundred blocks.
+    # This setting is here to avoid issues where the guardian would fly out of the loaded chunks 
+    # and freeze; especially an issue on servers with reduced render distance.
+    B:chaosGuardianLoading=true
+
+    # This enables dev log output. I primarily use this for development purposes, so it won't be very useful to regular users.
+    B:devLog=false
+}
+
+
+##########################################################################################################
+# Stat Tweaks
+#--------------------------------------------------------------------------------------------------------#
+# These allow you to tweak the stats of the tools, weapons and armor.
+##########################################################################################################
+
+"Stat Tweaks" {
+    I:bowBaseDamage=2
+    I:bowBaseSpeed=100
+    I:bowDraconicMaxZoom=600
+    I:bowMaxExplosionPower=4
+    I:bowTierMultiplierDamage=1
+    I:bowTierMultiplierSpeed=100
+    I:bowUpgradeMultiplierDamage=2
+    I:bowUpgradeMultiplierSpeed=100
+    I:bowWyvernMaxZoom=300
+    D:draconicAxeAttackDMG=45.0
+    D:draconicAxeAttackSpeed=-3.2
+    D:draconicAxeMineSpeed=18.0
+    I:draconicBaseMineAOE=1
+    I:draconicBaseRFCapacity=16000000
+
+    # Allows you to adjust the total shield capacity of a full set of Draconic Armor.
+    I:draconicBaseShieldCapacity=512
+    D:draconicHoeAttackDMG=10.0
+    D:draconicHoeAttackSpeed=0.0
+
+    # Allows you to adjust how fast Draconic Armor is able to recieve RF/tick.
+    I:draconicMaxRecieve=1000000
+    D:draconicPicAttackDMG=20.0
+    D:draconicPicAttackSpeed=-2.9
+    D:draconicPicMineSpeed=18.0
+
+    # Allows you to adjust the amount of RF that Draconic Armor requires to recharge 1 shield point.
+    I:draconicShieldRechargeCost=1000
+
+    # Allows you to adjust how fast Draconic Armor is able to recover entropy.  Value is {this number}% every 5 seconds.
+    D:draconicShieldRecovery=4.0
+    D:draconicShovelAttackDMG=20.0
+    D:draconicShovelAttackSpeed=-2.9
+    D:draconicShovelMineSpeed=18.0
+    D:draconicStaffAttackDMG=60.0
+    D:draconicStaffAttackSpeed=-3.0
+    D:draconicStaffMineSpeed=60.0
+    D:draconicSwordAttackDMG=35.0
+    D:draconicSwordAttackSpeed=-2.0
+    D:flightSpeedModifier=1.0
+    I:lastStandEnergyRequirement=10000000
+    D:wyvernAttackSpeed=-3.0
+    D:wyvernAxeAttackDMG=25.0
+    D:wyvernAxeMineSpeed=12.0
+    I:wyvernBaseMineAOE=0
+    I:wyvernBaseRFCapacity=4000000
+
+    # Allows you to adjust the total shield capacity of a full set of Wyvern Armor.
+    I:wyvernBaseShieldCapacity=256
+
+    # Allows you to adjust how fast Wyvern Armor is able to recieve RF/tick.
+    I:wyvernMaxRecieve=512000
+    D:wyvernPicAttackDMG=12.0
+    D:wyvernPicAttackSpeed=-3.0
+    D:wyvernPicMineSpeed=12.0
+
+    # Allows you to adjust the amount of RF that Wyvern Armor requires to recharge 1 shield point.
+    I:wyvernShieldRechargeCost=1000
+
+    # Allows you to adjust how fast Wyvern Armor is able to recover entropy.  Value is {this number}% every 5 seconds.
+    D:wyvernShieldRecovery=2.0
+    D:wyvernShovelAttackDMG=12.0
+    D:wyvernShovelMineSpeed=12.0
+    D:wyvernSwordAttackDMG=15.0
+    D:wyvernSwordAttackSpeed=-2.2
+}
+
+
+##########################################################################################################
+# Tweaks
+#--------------------------------------------------------------------------------------------------------#
+# Just what the name says. Tweaks. Allows you to tweak stuff.
+##########################################################################################################
+
+Tweaks {
+    # Enabling this allows boss souls to drop. Use with caution!
+    B:allowBossSouls=false
+
+    # Set to false to prevent the bows explosion effect from breaking blocks.
+    B:bowBlockDamage=true
+
+    # Allows you to tweak the chaos guardians health (will only affect new guardians).
+    I:chaosGuardianHealth=2000
+
+    # This allows you to prevent certain items from being placed in the draconium chest using their registry name
+    S:chestBlackList <
+     >
+
+    # Adds recipes to clear all nbt data from items such as Energy Crystals and Crafting Injectors.
+    B:clearDataRecipes=false
+
+    # Allows you to adjust the capacity of each energy core tier.
+    # Warning changing the number entries in this list will crash your game.
+    D:coreCapacity <
+        4.55E7
+        2.73E8
+        1.64E9
+        9.88E9
+        5.93E10
+        3.56E11
+        2.14E12
+        9.223372036854776E18
+     >
+
+    # If true, this will disable the destruction of chaos islands after the chaos crystal is broken.
+    B:disableChaosIslandExplosion=false
+
+    # (Wuss mode) Setting this to true will disable the Chaos Guardian's ability to respawn healing crystals.
+    B:disableGuardianCrystalRespawn=false
+
+    # If true, this will disable the massive reactor explosion and replace it with a much smaller one.
+    B:disableLargeReactorBoom=false
+
+    # This will disable loot cores (The "Blobs" of items dropped by the tools.).
+    B:disableLootCores=false
+
+    # Sets the number of teleports you get per ender pearl with the Advanced Dislocator.
+    I:dislocatorUsesPerPearl=1
+
+    # Allows you to adjust the cost of disenchanting items via the Disenchanter.
+    D:dissenchnaterCostMultiplier=1.0
+
+    # This allows you to adjust the base capacity of the Draconic Flux Capacitor.
+    I:draconicFluxCapBaseCap=256000000
+
+    # This can be used to adjust the amount of Draconium Dust the Ender Dragon drops when killed.
+    # The amount dropped will be this number +/- 10%
+    I:dragonDustLootModifier=1
+
+    # By default, the dragon egg only ever spawns once. This forces it to spawn every time the dragon is killed.
+    B:dragonEggSpawnOverride=true
+
+    # Set this to false if you would like to disable the draconic armors flight.
+    B:enableFlight=true
+
+    # Allows you to adjust the power requirement of the entity detector.
+    # Set to 0 to disable completely
+    D:entityDetectorPowerModifier=1.0
+
+    # Lets face it. The biggest issue with the new dragon ritual is it is too darn cheap! This modifies the recipe to make it a bit more expensive.
+    B:expensiveDragonRitual=true
+
+    # Use this to limit the max flight speed modifier a player can set on the draconic chestplate.
+    # Setting this to 200 for example would limit the flight speed to +200%.
+    # Default -1 removes the limit and allows the full +600% flight speed.
+    I:flightSpeedLimit=-1
+
+    # For some reason, Forge decided to not set the owner of an item when dropped from an inventory screen.
+    # DE overrides this and sets the stack owner when possible.
+    # If this causes issues, set this value to false.
+    B:forceDroppedItemOwner=true
+
+    # This allows you to prevent the mob grinder from attempting to kill specific entities.
+    S:grinderBlackList <
+        evilcraft:vengeance_spirit
+     >
+
+    # Sets the energy per use per heart of damage for the grinder.
+    I:grinderEnergyPerHeart=80
+
+    # Set to false if you dont want the guardian to be able to kill creative players.
+    # Alternatively... Just dont poke the guardian if you dont want to die!
+    B:guardianCanKillCreative=true
+
+    # When true, everything is just a little harder. (Currently only effects recipes but that will probably change in the future)
+    B:hardMode=false
+
+    # If true fusion crafting injectors will be set to single item mode by default.
+    B:injectorSingleItemDefault=false
+
+    # A list of items of items that should be ignored by the item dislocator. Use the item's registry name (e.g. minecraft:apple) You can also add a meta value after the name (e.g. minecraft:wool|4).
+    S:itemDislocatorBlacklist <
+        appliedenergistics2:crystal_seed
+     >
+
+    # Add ore names (e.g. oreIron) to this list to prevent them from being doubled by the DE chest.
+    S:oreDoublingBlacklist <
+     >
+
+    # When doubling ores with the Draconium Chest, the output will prioritise thermal ingots if TF is installed. This allows you to change that by specifying a different mod id to target.
+    S:oreDoublingOutputPriority=thermalfoundation
+
+    # Passive (Animals) Mobs have a 1 in {this number} chance to drop a soul when killed with the Reaper enchantment.  Note: This is the base value; higher enchantment levels increase this chance.
+    I:passiveSoulDropChance=800
+
+    # Allows you to adjust the overall scale of the reactor explosion. Use "disableLargeReactorBoom" to disable explosion completely.
+    D:reactorExplosionScale=1.0
+
+    # Adjusts the fuel usage multiplier of the reactor.
+    D:reactorFuelUsageMultiplier=1.0
+
+    # Adjusts the energy output multiplier of the reactor.
+    D:reactorOutputMultiplier=1.0
+
+    # Mobs have a 1 in {this number} chance to drop a soul when killed with the Reaper enchantment.  Note: This is the base value; higher enchantment levels increase this chance.
+    I:soulDropChance=1000
+
+    # Sets the min and max spawn delay in ticks for each spawner tier. Order is as follows.
+    # Basic MIN, MAX, Wyvern MIN, MAX, Draconic MIN, MAX, Chaotic MIN MAX
+    I:spawnerDelays <
+        200
+        800
+        100
+        400
+        50
+        200
+        25
+        100
+     >
+
+    # By default, any entities added to this list will not drop their souls and will not be spawnable by the Stabilized Spawner.
+    S:spawnerList <
+     >
+
+    # Changes the spawner list to a whitelist instead of a blacklist.
+    B:spawnerListWhiteList=false
+
+    # This allows you to adjust the base capacity of the Wyvern Flux Capacitor.
+    I:wyvernFluxCapBaseCap=64000000
+}
+
+
+##########################################################################################################
+# World
+#--------------------------------------------------------------------------------------------------------#
+# This category contains config properties related to world gen.
+##########################################################################################################
+
+World {
+    # This is the distance between Chaos Islands.
+    I:chaosIslandSeparation=10000
+
+    # If true, the Chaos Guardian, Crystals, and Healing Crystals will still spawn, but NO other blocks will be placed. (This only exists because someone wanted it for some reason).
+    B:chaosIslandVoidMode=false
+
+    # This allows you to offset the y position of Chaos Islands.
+    I:chaosIslandYOffset=0
+
+    # Ender Comets have a 1 in {this number} chance to spawn in each chunk.
+    I:cometRarity=10000
+
+    # Disables draconium ore generation in the end.
+    B:disableOreSpawnEnd=false
+
+    # Disables draconium ore generation in the nether.
+    B:disableOreSpawnNether=false
+
+    # Disables draconium ore generation in the overworld.
+    B:disableOreSpawnOverworld=false
+
+    # Set this to false if you do not want ore added to chunks that have not previously been generated by DE (this can almost always be left true).
+    B:enableRetroGen=true
+
+    # Set to false to disable the generation of Chaos Islands.
+    B:generateChaosIslands=true
+
+    # Set to false to disable the generation of Ender Comets.
+    B:generateEnderComets=true
+
+    # Add the ID of any mod's dimensions that you don't want Draconium Ore generated in.
+    I:oreGenDimentionBlacklist <
+     >
+
+    # Setting this to false will just completely disable ALL DE world gen!
+    B:worldGenEnabled=true
+}
+
+
+##########################################################################################################
+# |Mod Items/Blocks
+#--------------------------------------------------------------------------------------------------------#
+# These settings allow you to disable Blocks and Items added by this mod.
+# By default disabling a block or item will not remove it completely.
+# But its recipe will be removed and it will be hidden from JEI
+# If you want to completely remove items or blocks you can set hardDisableMode to true.
+# This is not recommended unless you know what you are doing.
+##########################################################################################################
+
+"|Mod Items/Blocks" {
+
+    ##########################################################################################################
+    # Blocks
+    #--------------------------------------------------------------------------------------------------------#
+    # This section allows you to disable/enable blocks from this mod.
+    ##########################################################################################################
+
+    Blocks {
+        B:celestial_manipulator=true
+        B:chaos_crystal=true
+        B:chaos_shard_atmos=true
+        B:crafting_injector=true
+        B:creative_rf_source=true
+        B:dislocator_pedestal=true
+        B:dislocator_receptacle=true
+        B:diss_enchanter=true
+        B:draconic_block=true
+        B:draconic_spawner=true
+        B:draconium_block=true
+        B:draconium_chest=true
+        B:draconium_ore=true
+        B:energy_crystal=true
+        B:energy_infuser=true
+        B:energy_pylon=true
+        B:energy_storage_core=true
+        B:entity_detector=true
+        B:flow_gate=true
+        B:fusion_crafting_core=true
+        B:generator=true
+        B:grinder=true
+        B:infused_obsidian=true
+        B:invis_e_core_block=true
+        B:item_dislocation_inhibitor=true
+        B:particle_generator=true
+        B:placed_item=true
+        B:portal=true
+        B:potentiometer=true
+        B:rain_sensor=true
+        B:reactor_component=true
+        B:reactor_core=true
+    }
+
+    ##########################################################################################################
+    # Items
+    #--------------------------------------------------------------------------------------------------------#
+    # This section allows you to disable/enable items from this mod.
+    ##########################################################################################################
+
+    Items {
+        B:awakened_core=true
+        B:chaos_shard=true
+        B:chaotic_core=true
+        B:creative_exchanger=true
+        B:crystal_binder=true
+        B:debugger=true
+        B:dislocator=true
+        B:dislocator_advanced=true
+        B:dislocator_bound=true
+        B:draconic_axe=true
+        B:draconic_boots=true
+        B:draconic_bow=true
+        B:draconic_chest=true
+        B:draconic_core=true
+        B:draconic_energy_core=true
+        B:draconic_helm=true
+        B:draconic_hoe=true
+        B:draconic_ingot=true
+        B:draconic_legs=true
+        B:draconic_pick=true
+        B:draconic_shovel=true
+        B:draconic_staff_of_power=true
+        B:draconic_sword=true
+        B:draconium_capacitor=true
+        B:draconium_dust=true
+        B:draconium_ingot=true
+        B:dragon_heart=true
+        B:ender_energy_manipulator=true
+        B:info_tablet=true
+        B:magnet=true
+        B:mob_soul=true
+        B:nugget=true
+        B:reactor_part=true
+        B:tool_upgrade=true
+        B:wyvern_axe=true
+        B:wyvern_boots=true
+        B:wyvern_bow=true
+        B:wyvern_chest=true
+        B:wyvern_core=true
+        B:wyvern_energy_core=true
+        B:wyvern_helm=true
+        B:wyvern_legs=true
+        B:wyvern_pick=true
+        B:wyvern_shovel=true
+        B:wyvern_sword=true
+    }
+
+    ##########################################################################################################
+    # Loader Settings
+    #--------------------------------------------------------------------------------------------------------#
+    # These are settings which define what happens when you disable a block or item.
+    ##########################################################################################################
+
+    "Loader Settings" {
+        # If set to true blocks and items will be completely removed from the game when disabled.
+        # When set to softDisableMode they will just have their recipes removed and will not show up in NEI/JEI or the Creative Inventory.
+        # Soft mode is recommended. Only use hard mode if you know what you are doing.
+        B:hardDisableMode=false
+    }
+
+}
+
+

src/overrides/config/brandon3055/ProjectIntelligence/manifest.json

@@ -0,0 +1,9 @@
+[
+	{
+		"name": "Draconic Evolution",
+		"modid": "draconicevolution",
+		"downloads": {
+			"https://raw.githubusercontent.com/brandon3055/Project-Intelligence-Docs/master/ModDocs/Draconic%20Evolution/draconicevolution-en_US.xml": 16
+		}
+	}
+]

src/overrides/config/brandon3055/ProjectIntelligence/options.json

@@ -0,0 +1,9 @@
+{
+	"colourNavWindow": "ff3c3f41",
+	"colourContentWindow": "ff3c3f41",
+	"colourMenuBar": "ff3c3f41",
+	"colourNavText": "ffff",
+	"colourText2": "8c8c8c",
+	"editMode": false,
+	"editTarget": "[CONFIG]"
+}

src/overrides/config/brandon3055/ProjectIntelligence/projectintelligence.xml

@@ -0,0 +1,16 @@
+<?xml version="1.0" encoding="UTF-8" standalone="no"?>
+<mod docRevision="0" lang="en_US" modName="pi" modid="PI">
+    <content index="4" type="textArea">Project Intelligence AKA "Project Intel" or "PI" is an ingame documentation mod i am currently building as a part of Draconic Evolution. 
+
+At first this will just be used for Draconic Evolution but once it is complete it will be split off into its own separate mod. 
+
+My goal for this mod is for it to one day have documentation for almost all mods in existence. 
+
+But obviously there is no way one person could handle that much work so i will be leaving it up to the community to document as many mods as possible.
+
+(Project intelligence downloads all of its content (Not including this page) from github. So if this is the only page you see check that you are connected to the internet. You can also check the console for errors.)</content>
+    <content index="3" size="8" type="vSpacer"/>
+    <content index="1" size="4" type="vSpacer"/>
+    <content alignment="CENTER" index="2" shadow="true" size="0" type="heading">Document All The Things!!!!</content>
+    <content alignment="CENTER" index="0" shadow="true" size="2" type="heading">§o§nProject Intelligence</content>
+</mod>

src/overrides/config/calculator/AtomicMultiplier-BlackList.cfg

@@ -0,0 +1,17 @@
+# Configuration file
+
+"atomic multiplier blacklist" {
+    S:disabled <
+        minecraft:nether_star
+        Calculator:AtomicMultiplier
+        Calculator:EndBlock
+        Calculator:ElectricBlock
+        Calculator:FlawlessFireBlock
+        Calculator:FlawlessBlock
+        Calculator:ElectricDiamond
+        Calculator:FlawlessFireDiamond
+        Calculator:FlawlessDiamond
+     >
+}
+
+

src/overrides/config/calculator/Blocks-BlackList.cfg

@@ -0,0 +1,10 @@
+# Configuration file
+
+"block config" {
+    S:Disabled <
+        ExampleBlock
+        ExampleBlock2
+     >
+}
+
+

src/overrides/config/calculator/Calculator-Config.cfg

@@ -0,0 +1,381 @@
+# Configuration file
+
+"advanced greenhouse" {
+    I:"Energy Storage"=350000
+    I:"Transfer Rate"=3200
+}
+
+
+"advanced power cube" {
+    I:"Charging Rate"=100000
+    I:"Energy Storage"=100000
+    I:"Transfer Rate"=64000
+}
+
+
+"advanced terrain module" {
+    I:"Energy Storage"=2000
+    I:"Energy Usage"=1
+}
+
+
+"algorithm seperator" {
+    I:"Base Speed"=200
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=5000
+    I:"Transfer Rate"=3200
+}
+
+
+"analysing chamber" {
+    I:"Energy Storage"=100000
+    I:"Transfer Rate"=12800
+}
+
+
+api {
+    # Waila [default: true]
+    B:"enable Waila integration"=true
+}
+
+
+"atomic multiplier" {
+    I:"Base Speed"=1000
+    I:"Energy Storage"=1500000000
+    I:"Energy Usage"=1500000000
+    I:"Transfer Rate"=2147483647
+}
+
+
+"basic greenhouse" {
+    I:"Energy Storage"=350000
+    I:"Transfer Rate"=400
+}
+
+
+calculator {
+    I:"Energy Storage"=1000
+}
+
+
+"calculator locator" {
+    I:"Charging Rate"=5000000
+    I:"Energy Storage"=50000000
+
+    #  [default: true]
+    B:"Locator Can Change Time"=true
+    I:"Transfer Rate"=2147483647
+}
+
+
+"carbon dioxide generator" {
+    I:"Energy Storage"=1000000
+    I:"Transfer Rate"=64000
+}
+
+
+"conductor mast" {
+    I:"Base Speed"=50
+    I:"Charging Rate"=100000
+    I:"Energy Storage"=50000000
+    I:Generation=5000
+    I:"Transfer Rate"=2147483647
+    I:"Weather Station Generation"=1000
+}
+
+
+"crafting calculator" {
+    I:"Energy Storage"=5000
+}
+
+
+"creative power cube" {
+    I:"Transfer Rate"=2147483647
+}
+
+
+damage {
+    S:"Tool Material: Electric Diamond"=10.0
+    S:"Tool Material: End Diamond"=16.0
+    S:"Tool Material: Enriched Gold"=0.0
+    S:"Tool Material: Fire Diamond"=7.0
+    S:"Tool Material: Flawless Diamond"=5.0
+    S:"Tool Material: Redstone Ingot"=2.5
+    S:"Tool Material: Reinforced Iron"=2.0
+    S:"Tool Material: Reinforced Stone"=1.5
+    S:"Tool Material: Weakened Diamond"=3.0
+}
+
+
+"docking station" {
+    I:"Base Speed"=200
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=10
+    I:"Transfer Rate"=3200
+}
+
+
+efficiency {
+    S:"Tool Material: Electric Diamond"=18.0
+    S:"Tool Material: End Diamond"=50.0
+    S:"Tool Material: Enriched Gold"=8.0
+    S:"Tool Material: Fire Diamond"=16.0
+    S:"Tool Material: Flawless Diamond"=14.0
+    S:"Tool Material: Redstone Ingot"=7.5
+    S:"Tool Material: Reinforced Iron"=7.0
+    S:"Tool Material: Reinforced Stone"=5.0
+    S:"Tool Material: Weakened Diamond"=8.0
+}
+
+
+"energy module" {
+    I:"Energy Storage"=100000
+}
+
+
+"extraction chamber" {
+    I:"Base Speed"=1000
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=5000
+    I:"Transfer Rate"=3200
+}
+
+
+"flawless calculator" {
+    I:"Ender Pearl Module - Energy Usage"=1000
+    I:"Grenade Module - Energy Usage"=10000
+}
+
+
+"flawless greenhouse" {
+    I:"Energy Storage"=500000
+    I:"Transfer Rate"=64000
+}
+
+
+generation {
+    # MULTIPLIER [range: 0.1 ~ 64.0, default: 2.0]
+    S:"Calculator Locator"=2.0
+}
+
+
+"glowstone extractor" {
+    I:"Energy Storage"=1000000
+    I:Generation=160
+    I:"Generator Capacity"=5000
+    I:"Generator Requirement"=400
+    I:"Transfer Rate"=3200
+}
+
+
+greenhouses {
+    I:"Adding Farmland"=50
+    I:"Adding Water"=1000
+    I:"Build Energy"=100
+    I:"Growth Energy"=150
+    I:"Plant Energy"=50
+}
+
+
+"hand cranked generator" {
+    I:"Energy Storage"=1000
+    I:Generation=8
+    I:"Transfer Rate"=400
+}
+
+
+"health module" {
+    I:"Health Capacity"=1000
+}
+
+
+"hunger module" {
+    I:"Hunger Capacity"=1000
+}
+
+
+"jump module" {
+    I:"Energy Storage"=10000
+}
+
+
+"nutrition module" {
+    I:"Health Capacity"=-1
+    I:"Hunger Capacity"=-1
+}
+
+
+"power cube" {
+    I:"Charging Rate"=4
+    I:"Energy Storage"=50000
+    I:"Transfer Rate"=400
+}
+
+
+"precision chamber" {
+    I:"Base Speed"=500
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=5000
+    I:"Transfer Rate"=3200
+}
+
+
+"processing chamber" {
+    I:"Base Speed"=500
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=1000
+    I:"Transfer Rate"=3200
+}
+
+
+"reassembly chamber" {
+    I:"Base Speed"=1000
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=1000
+    I:"Transfer Rate"=3200
+}
+
+
+"redstone extractor" {
+    I:"Energy Storage"=1000000
+    I:Generation=80
+    I:"Generator Capacity"=5000
+    I:"Generator Requirement"=400
+    I:"Transfer Rate"=3200
+}
+
+
+"reinforced furnace" {
+    I:"Base Speed"=200
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=500
+    I:"Transfer Rate"=3200
+}
+
+
+"restoration chamber" {
+    I:"Base Speed"=1000
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=1000
+    I:"Transfer Rate"=3200
+}
+
+
+scarecrow {
+    I:"Scarecrow Range"=3
+    I:"Scarecrow Tick Rate"=500
+}
+
+
+"scientific calculator" {
+    I:"Energy Storage"=2000
+}
+
+
+settings {
+    # Tool Models [default: true]
+    B:"Enable Tool Models"=true
+
+    # Grenades [default: true]
+    B:"allow grenades?"=true
+}
+
+
+"starch extractor" {
+    I:"Energy Storage"=1000000
+    I:Generation=40
+    I:"Generator Capacity"=5000
+    I:"Generator Requirement"=400
+    I:"Transfer Rate"=3200
+}
+
+
+"stone seperator" {
+    I:"Base Speed"=200
+    I:"Energy Storage"=50000
+    I:"Energy Usage"=500
+    I:"Transfer Rate"=3200
+}
+
+
+"terrain module" {
+    I:"Energy Storage"=400
+    I:"Energy Usage"=1
+}
+
+
+"tool material: electric diamond" {
+    I:Enchantibility=30
+    I:"Harvest Level"=4
+    I:"Max Uses"=10000
+}
+
+
+"tool material: end diamond" {
+    I:Enchantibility=30
+    I:"Harvest Level"=6
+    I:"Max Uses"=-1
+}
+
+
+"tool material: enriched gold" {
+    I:Enchantibility=20
+    I:"Harvest Level"=3
+    I:"Max Uses"=1000
+}
+
+
+"tool material: fire diamond" {
+    I:Enchantibility=30
+    I:"Harvest Level"=3
+    I:"Max Uses"=2600
+}
+
+
+"tool material: flawless diamond" {
+    I:Enchantibility=30
+    I:"Harvest Level"=3
+    I:"Max Uses"=1800
+}
+
+
+"tool material: redstone ingot" {
+    I:Enchantibility=18
+    I:"Harvest Level"=2
+    I:"Max Uses"=800
+}
+
+
+"tool material: reinforced iron" {
+    I:Enchantibility=10
+    I:"Harvest Level"=2
+    I:"Max Uses"=400
+}
+
+
+"tool material: reinforced stone" {
+    I:Enchantibility=5
+    I:"Harvest Level"=1
+    I:"Max Uses"=250
+}
+
+
+"tool material: weakened diamond" {
+    I:Enchantibility=10
+    I:"Harvest Level"=3
+    I:"Max Uses"=1400
+}
+
+
+"warp module" {
+    I:"Energy Storage"=10000
+}
+
+
+"weather controller" {
+    I:"Energy Storage"=1000000
+    I:"Energy Usage"=250000
+    I:"Transfer Rate"=64000
+}
+
+

src/overrides/config/calculator/Items-BlackList.cfg

@@ -0,0 +1,10 @@
+# Configuration file
+
+"item config" {
+    S:Disabled <
+        ExampleItem
+        ExampleItem2
+     >
+}
+
+

src/overrides/config/car/car.json

@@ -0,0 +1,42 @@
+{"cars": [
+ {
+  "acceleration": 0.032,
+  "reverseSpeed": 0.2,
+  "id": "car_wood",
+  "speed": 0.5,
+  "fluids": [{
+   "efficiency": 0.3,
+   "fluid": "bio_diesel"
+  }]
+ },
+ {
+  "acceleration": 0.032,
+  "reverseSpeed": 0.2,
+  "id": "car_big_wood",
+  "speed": 0.48,
+  "fluids": [{
+   "efficiency": 0.2,
+   "fluid": "bio_diesel"
+  }]
+ },
+ {
+  "acceleration": 0.032,
+  "reverseSpeed": 0.2,
+  "id": "car_transporter",
+  "speed": 0.4,
+  "fluids": [{
+   "efficiency": 0.3,
+   "fluid": "bio_diesel"
+  }]
+ },
+ {
+  "acceleration": 0.04,
+  "reverseSpeed": 0.2,
+  "id": "car_sport",
+  "speed": 0.65,
+  "fluids": [{
+   "efficiency": 0.12,
+   "fluid": "bio_diesel"
+  }]
+ }
+]}

src/overrides/config/car/fuel_station.json

@@ -0,0 +1 @@
+{"valid_fluids": ["bio_diesel"]}

src/overrides/config/car/generator.json

@@ -0,0 +1,4 @@
+{"generator_fluids": [{
+ "fluid": "bio_diesel",
+ "energy": 500
+}]}

src/overrides/config/car/main.cfg

@@ -0,0 +1,244 @@
+# Configuration file
+
+car {
+    # The height a car can drive up [range: 0.1 ~ 128.0, default: 0.6]
+    S:car_step_height=0.6
+
+    #  [range: 0.0 ~ 1.0, default: 0.1]
+    S:car_volume=0.1
+
+    # Whether the cars should collide with other entities (except cars) [default: false]
+    B:collide_with_entities=false
+
+    # Whether the cars should damage other entities on collision [default: true]
+    B:damage_entities=true
+
+    # Whether cars should emit light when the DynamicLights mod is installed [default: true]
+    B:dynamic_lights=true
+
+    # Whether animals flee from the car when the horn is activted [default: true]
+    B:horn_flee=true
+
+    # A list of blocks the car can drive faster on (only if 'road_blocks_enabled' is set to true) [default: [car:tar], [car:tar_slab], [car:tar_slope_flat_upper], [car:tar_slope_flat_lower], [car:tar_slope]]
+    S:road_blocks <
+        car:tar
+        car:tar_slab
+        car:tar_slope_flat_upper
+        car:tar_slope_flat_lower
+        car:tar_slope
+     >
+
+    # Whether the cars drive slower on non road blocks [default: false]
+    B:road_blocks_enabled=false
+
+    # True if the car temperature should be displayed in farenheit [default: false]
+    B:temp_farenheit=false
+
+    #  [default: true]
+    B:third_person_when_enter_car=true
+
+    # True if starting the car should use battery [default: true]
+    B:use_battery=true
+}
+
+
+drops {
+    #  [default: true]
+    B:canola_seed_drop=true
+}
+
+
+items {
+
+    repair_kit {
+        #  [range: 0.1 ~ 100.0, default: 5.0]
+        S:repair_kit_repair_amount=5.0
+    }
+
+    canister {
+        #  [range: 1 ~ 1000, default: 100]
+        I:canister_max_fuel=100
+    }
+
+}
+
+
+machines {
+
+    backmix_reactor {
+        #  [range: 1 ~ 32767, default: 50]
+        I:backmix_reactor_canola_usage=50
+
+        #  [range: 100 ~ 32767, default: 10000]
+        I:backmix_reactor_energy_storage=10000
+
+        #  [range: 1 ~ 32767, default: 10]
+        I:backmix_reactor_energy_usage=10
+
+        #  [range: 1000 ~ 32767, default: 3000]
+        I:backmix_reactor_fluid_storage=3000
+
+        #  [range: 10 ~ 32767, default: 200]
+        I:backmix_reactor_generating_time=200
+
+        #  [range: 1 ~ 32767, default: 50]
+        I:backmix_reactor_methanol_usage=50
+
+        #  [range: 1 ~ 32767, default: 100]
+        I:backmix_reactor_mix_generation=100
+    }
+
+    blast_furnace {
+        #  [range: 1000 ~ 32767, default: 10000]
+        I:blast_furnace_energy_storage=10000
+
+        #  [range: 1 ~ 32767, default: 10]
+        I:blast_furnace_energy_usage=10
+
+        #  [range: 1 ~ 32767, default: 100]
+        I:blast_furnace_fluid_generation=100
+
+        #  [range: 1000 ~ 32767, default: 3000]
+        I:blast_furnace_fluid_storage=3000
+
+        #  [range: 10 ~ 32767, default: 200]
+        I:blast_furnace_generating_time=200
+    }
+
+    oil_mill {
+        #  [range: 1000 ~ 32767, default: 10000]
+        I:oil_mill_energy_storage=10000
+
+        #  [range: 1 ~ 32767, default: 10]
+        I:oil_mill_energy_usage=10
+
+        #  [range: 1 ~ 32767, default: 100]
+        I:oil_mill_fluid_generation=100
+
+        #  [range: 1000 ~ 32767, default: 3000]
+        I:oil_mill_fluid_storage=3000
+
+        #  [range: 10 ~ 32767, default: 200]
+        I:oil_mill_generating_time=200
+    }
+
+    cable {
+        #  [range: 64 ~ 32767, default: 256]
+        I:cable_transfer_rate=256
+    }
+
+    dynamo {
+        #  [range: 1 ~ 32767, default: 25]
+        I:dynamo_energy_generation=25
+
+        #  [range: 100 ~ 32767, default: 1000]
+        I:dynamo_energy_storage=1000
+
+        #  [default: true]
+        B:dynamo_recipe=true
+    }
+
+    fluid_extractor {
+        #  [range: 5 ~ 32767, default: 25]
+        I:fluid_extractor_drain_speed=25
+    }
+
+    fuel_station {
+        #  [range: 1 ~ 32767, default: 5]
+        I:fuel_station_transfer_rate=5
+    }
+
+    generator {
+        #  [range: 1000 ~ 32767, default: 30000]
+        I:generator_energy_storage=30000
+
+        #  [range: 1000 ~ 32767, default: 3000]
+        I:generator_fluid_storage=3000
+    }
+
+    split_tank {
+        #  [range: 1 ~ 32767, default: 100]
+        I:split_tank_bio_diesel_generation=100
+
+        #  [range: 1000 ~ 32767, default: 3000]
+        I:split_tank_fluid_storage=3000
+
+        #  [range: 10 ~ 32767, default: 800]
+        I:split_tank_generating_time=800
+
+        #  [range: 1 ~ 32767, default: 10]
+        I:split_tank_glycerin_generation=10
+
+        #  [range: 1 ~ 32767, default: 100]
+        I:split_tank_mix_usage=100
+    }
+
+}
+
+
+recipes {
+    #  [default: true]
+    B:backmix_reactor_recipe=true
+
+    #  [default: true]
+    B:battery_recipe=true
+
+    #  [default: true]
+    B:blast_furnace_recipe=true
+
+    #  [default: true]
+    B:cable_recipe=true
+
+    #  [default: true]
+    B:canister_recipe=true
+
+    #  [default: true]
+    B:car_parts_recipe=true
+
+    #  [default: true]
+    B:car_workshop_recipe=true
+
+    #  [default: true]
+    B:crash_barrier_recipe=true
+
+    #  [default: true]
+    B:dynamo_recipe=true
+
+    #  [default: true]
+    B:fluid_extractor_recipe=true
+
+    #  [default: true]
+    B:fluid_pipe_recipe=true
+
+    #  [default: true]
+    B:fuel_station_recipe=true
+
+    #  [default: true]
+    B:generator_recipe=true
+
+    #  [default: true]
+    B:key_clone_recipe=true
+
+    #  [default: true]
+    B:number_plate_recipe=true
+
+    #  [default: true]
+    B:oil_mill_recipe=true
+
+    #  [default: true]
+    B:painter_recipe=true
+
+    #  [default: true]
+    B:repair_kit_recipe=true
+
+    #  [default: true]
+    B:sign_recipe=true
+
+    #  [default: true]
+    B:split_tank_recipe=true
+
+    #  [default: true]
+    B:tar_recipe=true
+}
+
+

src/overrides/config/catwalks.cfg

@@ -0,0 +1,7 @@
+# Configuration file
+
+general {
+    B:supportOptifine=false
+}
+
+

src/overrides/config/cdm.cfg

@@ -0,0 +1,41 @@
+# Configuration file
+
+laptop-settings {
+    # The amount of ticks the laptop waits until sending another ping to it's connected router.
+    I:pingRate=20
+}
+
+
+pixel-painter {
+    # Enable or disable this app
+    B:enabled=true
+
+    # Should the pixels on printed pictures render in 3D. Warning, this will decrease the performance of the game. You should not enable if you have a slow computer!
+    B:render-printed-in-3d=false
+}
+
+
+printer-settings {
+    # The amount of seconds it should take for the printer to addToQueue a document
+    I:customPrintSpeed=20
+
+    # The amount of paper that can be loaded into the printer
+    I:maxPaperCount=64
+
+    # If enable, overrides all printing times with customPrintSpeed property
+    B:overridePrintSpeed=false
+}
+
+
+router-settings {
+    # The amount of ticks the router waits before sending out a beacon signal. Higher number will increase performance but devices won't know as quick if they lost connection.
+    I:beaconInterval=20
+
+    # The maximum amount of devices that can be connected to the router.
+    I:maxDevices=16
+
+    # The range that routers can produce a signal to devices. This is the radius in blocks. Be careful when increasing this value, the performance is O(n^3) and larger numbers will have a bigger impact on the server
+    I:signalRange=20
+}
+
+

src/overrides/config/ceu.cfg

@@ -0,0 +1,204 @@
+# Configuration file
+
+general {
+    B:constrainBattery=false
+    B:disableGregicalityCompat=false
+    B:exactVoltage=false
+
+    ceu {
+
+        ulv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        lv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        mv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        hv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        ev {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        iv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        luv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        zpm {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        uv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+        max {
+            S:conversionRatio=1:4
+            B:disable=false
+        }
+
+    }
+
+    cef {
+
+        ulv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        lv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        mv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        hv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        ev {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        iv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        luv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        zpm {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        uv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+        max {
+            S:conversionRatio=4:1
+            B:disable=false
+        }
+
+    }
+
+    iceu {
+
+        lv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=false
+        }
+
+        mv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=false
+        }
+
+        hv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=false
+        }
+
+        ev {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=false
+        }
+
+    }
+
+    icef {
+
+        lv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=false
+        }
+
+        mv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=false
+        }
+
+        hv {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=false
+        }
+
+        ev {
+            # Conversion ratio between two energy units (INPUT:OUTPUT)
+            S:conversionRatio=1:1
+            B:disable=false
+        }
+
+    }
+
+    infinite_energy_emitter {
+        B:disableFEEmitter=false
+        B:disableGTEUEmitter=false
+        B:disableIC2EUEmitter=true
+    }
+
+    infinite_energy_receiver {
+        B:disableFEReceiver=false
+        B:disableGTEUReceiver=false
+        B:disableIC2EUReceiver=true
+    }
+
+}
+
+

src/overrides/config/cfm.cfg

@@ -0,0 +1,306 @@
+# Configuration file
+
+##########################################################################################################
+# recipe-api
+#--------------------------------------------------------------------------------------------------------#
+# RecipeAPI Configuration. How to use: http://mrcrayfishs-furniture-mod.wikia.com/wiki/Configuration
+##########################################################################################################
+
+recipe-api {
+    # Insert custom recipes here [default: ]
+    S:custom-recipes <
+     >
+}
+
+
+##########################################################################################################
+# recipe-settings
+#--------------------------------------------------------------------------------------------------------#
+# Enabled or disable the default recipes
+##########################################################################################################
+
+recipe-settings {
+    # Fruit Crush [default: true]
+    B:blender-1=true
+
+    # Veggie Juice [default: true]
+    B:blender-2=true
+
+    # Fishy Blend [default: true]
+    B:blender-3=true
+
+    # Energy Drink [default: true]
+    B:blender-4=true
+
+    # Bread -> 6 Bread Slices [default: true]
+    B:chopping-board-1=true
+
+    # Bow [default: true]
+    B:dishwasher-1=true
+
+    # Stone Hoe [default: true]
+    B:dishwasher-10=true
+
+    # Stone Sword [default: true]
+    B:dishwasher-11=true
+
+    # Iron Pickaxe [default: true]
+    B:dishwasher-12=true
+
+    # Iron Axe [default: true]
+    B:dishwasher-13=true
+
+    # Iron Shovel [default: true]
+    B:dishwasher-14=true
+
+    # Iron Hoe [default: true]
+    B:dishwasher-15=true
+
+    # Iron Sword [default: true]
+    B:dishwasher-16=true
+
+    # Golden Pickaxe [default: true]
+    B:dishwasher-17=true
+
+    # Golden Axe [default: true]
+    B:dishwasher-18=true
+
+    # Golden Shovel [default: true]
+    B:dishwasher-19=true
+
+    # Wooden Pickaxe [default: true]
+    B:dishwasher-2=true
+
+    # Golden Hoe [default: true]
+    B:dishwasher-20=true
+
+    # Golden Sword [default: true]
+    B:dishwasher-21=true
+
+    # Diamond Pickaxe [default: true]
+    B:dishwasher-22=true
+
+    # Diamond Axe [default: true]
+    B:dishwasher-23=true
+
+    # Diamond Shovel [default: true]
+    B:dishwasher-24=true
+
+    # Diamond Hoe [default: true]
+    B:dishwasher-25=true
+
+    # Diamond Sword [default: true]
+    B:dishwasher-26=true
+
+    # Fishing Rod [default: true]
+    B:dishwasher-27=true
+
+    # Flint and Steel [default: true]
+    B:dishwasher-28=true
+
+    # Shears [default: true]
+    B:dishwasher-29=true
+
+    # Wooden Axe [default: true]
+    B:dishwasher-3=true
+
+    # Shield [default: true]
+    B:dishwasher-30=true
+
+    # Wooden Shovel [default: true]
+    B:dishwasher-4=true
+
+    # Wooden Hoe [default: true]
+    B:dishwasher-5=true
+
+    # Wooden Sword [default: true]
+    B:dishwasher-6=true
+
+    # Stone Pickaxe [default: true]
+    B:dishwasher-7=true
+
+    # Stone Axe [default: true]
+    B:dishwasher-8=true
+
+    # Stone Shovel [default: true]
+    B:dishwasher-9=true
+
+    # Water Bucket -> Ice [default: true]
+    B:freezer-1=true
+
+    # Ice -> Packet Ice [default: true]
+    B:freezer-2=true
+
+    # Lava Bucket -> Obsidian [default: true]
+    B:freezer-3=true
+
+    # Slime Ball -> Snow Ball [default: true]
+    B:freezer-4=true
+
+    # Poinsonous Potato -> Potato [default: true]
+    B:freezer-5=true
+
+    # Rotten Flesh -> Flesh [default: true]
+    B:freezer-6=true
+
+    # Beef -> Cooked Beef [default: true]
+    B:grill-1=true
+
+    # Sausage -> Cooked Sausage [default: true]
+    B:grill-2=true
+
+    # Raw Kebab -> Cooked Kebab [default: true]
+    B:grill-3=true
+
+    # Beef -> Cooked Beef [default: true]
+    B:microwave-1=true
+
+    # Potato -> Baked Potato [default: true]
+    B:microwave-2=true
+
+    # 16 Hardened Clay for 1 Emerald [default: true]
+    B:minebay-1=true
+
+    # 1 Recipe Book for 1 Emerald [default: true]
+    B:minebay-10=true
+
+    # 1 Skeleton Skull for 8 Emeralds [default: true]
+    B:minebay-2=true
+
+    # 1 Saddle for 4 Emeralds [default: true]
+    B:minebay-3=true
+
+    # 1 Horse Spawn Egg for 8 Emeralds [default: true]
+    B:minebay-4=true
+
+    # 1 Diamond Horse Armour for 8 Diamonds [default: true]
+    B:minebay-5=true
+
+    # 1 Experience Bottle for 1 Iron Ingot [default: true]
+    B:minebay-6=true
+
+    # 4 Christmas Firework for 1 Iron Ingot [default: true]
+    B:minebay-7=true
+
+    # 1 Silk Touch Book for 8 Emeralds [default: true]
+    B:minebay-8=true
+
+    # 2 Night Vision Potion for 1 Emerald [default: true]
+    B:minebay-9=true
+
+    # Beef -> Cooked Beef [default: true]
+    B:oven-1=true
+
+    # Porkchop -> Cooked Porkchop [default: true]
+    B:oven-2=true
+
+    # Potato -> Cooked Potato [default: true]
+    B:oven-3=true
+
+    # Chicken -> Cooked Chicken [default: true]
+    B:oven-4=true
+
+    # Raw Fish -> Cooked Fish [default: true]
+    B:oven-5=true
+
+    # Raw Salmon -> Cooked Salmon [default: true]
+    B:oven-6=true
+
+    # Flesh -> Cooked Flesh [default: true]
+    B:oven-7=true
+
+    # Enchanted Book [default: true]
+    B:printer-1=true
+
+    # Written Book [default: true]
+    B:printer-2=true
+
+    # Bread Slice -> Toast [default: true]
+    B:toast-2=true
+
+    # Leather Helmet [default: true]
+    B:washing-machine-1=true
+
+    # Iron Chestplate [default: true]
+    B:washing-machine-10=true
+
+    # Iron Leggings [default: true]
+    B:washing-machine-11=true
+
+    # Iron Boots [default: true]
+    B:washing-machine-12=true
+
+    # Golden Helmet [default: true]
+    B:washing-machine-13=true
+
+    # Golden Chestplate [default: true]
+    B:washing-machine-14=true
+
+    # Golden Leggings [default: true]
+    B:washing-machine-15=true
+
+    # Golden Boots [default: true]
+    B:washing-machine-16=true
+
+    # Diamond Helmet [default: true]
+    B:washing-machine-17=true
+
+    # Diamond Chestplate [default: true]
+    B:washing-machine-18=true
+
+    # Diamond Leggings [default: true]
+    B:washing-machine-19=true
+
+    # Leather Chestplate [default: true]
+    B:washing-machine-2=true
+
+    # Diamond Boots [default: true]
+    B:washing-machine-20=true
+
+    # Elytra [default: true]
+    B:washing-machine-21=true
+
+    # Leather Leggings [default: true]
+    B:washing-machine-3=true
+
+    # Leather Boots [default: true]
+    B:washing-machine-4=true
+
+    # Chainmail Helmet [default: true]
+    B:washing-machine-5=true
+
+    # Chainmail Chestplate [default: true]
+    B:washing-machine-6=true
+
+    # Chainmail Leggings [default: true]
+    B:washing-machine-7=true
+
+    # Chainmail Boots [default: true]
+    B:washing-machine-8=true
+
+    # Iron Helmet [default: true]
+    B:washing-machine-9=true
+}
+
+
+settings {
+    # Set whether the mirror should render clouds. [default: false]
+    B:mirror-clouds=false
+
+    # Determines whether the mirror will be rendered. [default: true]
+    B:mirror-enabled=true
+
+    # Sets the field of view for the mirror. [range: 10.0 ~ 100.0, default: 80.0]
+    S:mirror-fov=80.0
+
+    # Sets the resolution for the mirror. High number means better quality but worse performace. [range: 16 ~ 512, default: 64]
+    I:mirror-quality=64
+
+    # If true, prints out information about RecipeAPI. Recommended 'true' for people trying to add custom recipes. [default: false]
+    B:recipe-api-debug=false
+
+    # Enabled or disable the welcome message [default: true]
+    B:welcome_message=true
+}
+
+

src/overrides/config/chickens/chickens.json

@@ -0,0 +1,471 @@
+{
+  "_comment": {
+    "name": "Just a Reference to the old system naming. Changing does nothing.",
+    "is_enabled": "Is chicken enabled?",
+    "lay_item": "Item the chicken will Lay.               modid:itemid:metadata:amount #example: minecraft:log:2:3",
+    "drop_item": "Item the chicken drops on death.        modid:itemid:metadata:amount #example: minecraft:bone",
+    "spawn_type": "Chicken spawn type, can be: NORMAL,SNOW,NONE,HELL",
+    "parent_1": "First parent, empty if it cant be breed. modid:chickenid #example: chickens:waterchicken",
+    "parent_2": "Second parent, empty if it cant be breed. "
+  },
+  "chickens:smartchicken": {
+    "name": "SmartChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:egg",
+    "drop_item": "minecraft:egg",
+    "spawn_type": "NONE",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:whitechicken": {
+    "name": "WhiteChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:15",
+    "drop_item": "minecraft:bone",
+    "spawn_type": "NORMAL",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:yellowchicken": {
+    "name": "YellowChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:11",
+    "drop_item": "minecraft:dye:11",
+    "spawn_type": "NONE",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:bluechicken": {
+    "name": "BlueChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:4",
+    "drop_item": "minecraft:dye:4",
+    "spawn_type": "NONE",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:greenchicken": {
+    "name": "GreenChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:2",
+    "drop_item": "minecraft:dye:2",
+    "spawn_type": "NONE",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:redchicken": {
+    "name": "RedChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:1",
+    "drop_item": "minecraft:dye:1",
+    "spawn_type": "NONE",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:blackchicken": {
+    "name": "BlackChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye",
+    "drop_item": "minecraft:dye",
+    "spawn_type": "NONE",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:pinkchicken": {
+    "name": "PinkChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:9",
+    "drop_item": "minecraft:dye:9",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:redchicken",
+    "parent_2": "chickens:whitechicken"
+  },
+  "chickens:purplechicken": {
+    "name": "PurpleChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:5",
+    "drop_item": "minecraft:dye:5",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:bluechicken",
+    "parent_2": "chickens:redchicken"
+  },
+  "chickens:orangechicken": {
+    "name": "OrangeChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:14",
+    "drop_item": "minecraft:dye:14",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:redchicken",
+    "parent_2": "chickens:yellowchicken"
+  },
+  "chickens:lightbluechicken": {
+    "name": "LightBlueChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:12",
+    "drop_item": "minecraft:dye:12",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:whitechicken",
+    "parent_2": "chickens:bluechicken"
+  },
+  "chickens:limechicken": {
+    "name": "LimeChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:10",
+    "drop_item": "minecraft:dye:10",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:greenchicken",
+    "parent_2": "chickens:whitechicken"
+  },
+  "chickens:graychicken": {
+    "name": "GrayChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:8",
+    "drop_item": "minecraft:dye:8",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:blackchicken",
+    "parent_2": "chickens:whitechicken"
+  },
+  "chickens:cyanchicken": {
+    "name": "CyanChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:6",
+    "drop_item": "minecraft:dye:6",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:bluechicken",
+    "parent_2": "chickens:greenchicken"
+  },
+  "chickens:silverdyechicken": {
+    "name": "SilverDyeChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:7",
+    "drop_item": "minecraft:dye:7",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:graychicken",
+    "parent_2": "chickens:whitechicken"
+  },
+  "chickens:magentachicken": {
+    "name": "MagentaChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:13",
+    "drop_item": "minecraft:dye:13",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:purplechicken",
+    "parent_2": "chickens:pinkchicken"
+  },
+  "chickens:flintchicken": {
+    "name": "FlintChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:flint",
+    "drop_item": "minecraft:flint",
+    "spawn_type": "NORMAL",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:quartzchicken": {
+    "name": "QuartzChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:quartz",
+    "drop_item": "minecraft:quartz",
+    "spawn_type": "HELL",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:logchicken": {
+    "name": "LogChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:log",
+    "drop_item": "minecraft:log",
+    "spawn_type": "NORMAL",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:sandchicken": {
+    "name": "SandChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:sand",
+    "drop_item": "minecraft:sand",
+    "spawn_type": "NORMAL",
+    "parent_1": "",
+    "parent_2": ""
+  },
+  "chickens:stringchicken": {
+    "name": "StringChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:string",
+    "drop_item": "minecraft:spider_eye",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:blackchicken",
+    "parent_2": "chickens:logchicken"
+  },
+  "chickens:glowstonechicken": {
+    "name": "GlowstoneChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:glowstone_dust",
+    "drop_item": "minecraft:glowstone_dust",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:quartzchicken",
+    "parent_2": "chickens:yellowchicken"
+  },
+  "chickens:gunpowderchicken": {
+    "name": "GunpowderChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:gunpowder",
+    "drop_item": "minecraft:gunpowder",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:sandchicken",
+    "parent_2": "chickens:flintchicken"
+  },
+  "chickens:redstonechicken": {
+    "name": "RedstoneChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:redstone",
+    "drop_item": "minecraft:redstone",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:redchicken",
+    "parent_2": "chickens:sandchicken"
+  },
+  "chickens:glasschicken": {
+    "name": "GlassChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:glass",
+    "drop_item": "minecraft:glass",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:quartzchicken",
+    "parent_2": "chickens:redstonechicken"
+  },
+  "chickens:ironchicken": {
+    "name": "IronChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:iron_ingot",
+    "drop_item": "minecraft:iron_ingot",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:flintchicken",
+    "parent_2": "chickens:whitechicken"
+  },
+  "chickens:coalchicken": {
+    "name": "CoalChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:coal",
+    "drop_item": "minecraft:coal",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:flintchicken",
+    "parent_2": "chickens:logchicken"
+  },
+  "chickens:brownchicken": {
+    "name": "BrownChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:dye:3",
+    "drop_item": "minecraft:dye:3",
+    "spawn_type": "NONE",
+    "parent_1": "chickens:redchicken",
+    "parent_2": "chickens:greenchicken"
+  },
+  "chickens:goldchicken": {
+    "name": "GoldChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:gold_nugget",
+    "drop_item": "minecraft:gold_nugget",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:ironchicken",
+    "parent_2": "chickens:yellowchicken"
+  },
+  "chickens:snowballchicken": {
+    "name": "SnowballChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:snowball",
+    "drop_item": "minecraft:snowball",
+    "spawn_type": "SNOW",
+    "parent_1": "chickens:bluechicken",
+    "parent_2": "chickens:logchicken"
+  },
+  "chickens:waterchicken": {
+    "name": "WaterChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "chickens:liquid_egg",
+    "drop_item": "chickens:liquid_egg",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:gunpowderchicken",
+    "parent_2": "chickens:snowballchicken"
+  },
+  "chickens:lavachicken": {
+    "name": "LavaChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "chickens:liquid_egg:1",
+    "drop_item": "chickens:liquid_egg:1",
+    "spawn_type": "HELL",
+    "parent_1": "chickens:coalchicken",
+    "parent_2": "chickens:quartzchicken"
+  },
+  "chickens:claychicken": {
+    "name": "ClayChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:clay_ball",
+    "drop_item": "minecraft:clay_ball",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:snowballchicken",
+    "parent_2": "chickens:sandchicken"
+  },
+  "chickens:leatherchicken": {
+    "name": "LeatherChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:leather",
+    "drop_item": "minecraft:leather",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:stringchicken",
+    "parent_2": "chickens:brownchicken"
+  },
+  "chickens:netherwartchicken": {
+    "name": "NetherwartChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:nether_wart",
+    "drop_item": "minecraft:nether_wart",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:brownchicken",
+    "parent_2": "chickens:glowstonechicken"
+  },
+  "chickens:diamondchicken": {
+    "name": "DiamondChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:diamond",
+    "drop_item": "minecraft:diamond",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:glasschicken",
+    "parent_2": "chickens:goldchicken"
+  },
+  "chickens:blazechicken": {
+    "name": "BlazeChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:blaze_rod",
+    "drop_item": "minecraft:blaze_rod",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:goldchicken",
+    "parent_2": "chickens:lavachicken"
+  },
+  "chickens:slimechicken": {
+    "name": "SlimeChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:slime_ball",
+    "drop_item": "minecraft:slime_ball",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:claychicken",
+    "parent_2": "chickens:greenchicken"
+  },
+  "chickens:enderchicken": {
+    "name": "EnderChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:ender_pearl",
+    "drop_item": "minecraft:ender_pearl",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:diamondchicken",
+    "parent_2": "chickens:netherwartchicken"
+  },
+  "chickens:ghastchicken": {
+    "name": "GhastChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:ghast_tear",
+    "drop_item": "minecraft:ghast_tear",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:whitechicken",
+    "parent_2": "chickens:blazechicken"
+  },
+  "chickens:emeraldchicken": {
+    "name": "EmeraldChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:emerald",
+    "drop_item": "minecraft:emerald",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:diamondchicken",
+    "parent_2": "chickens:greenchicken"
+  },
+  "chickens:magmachicken": {
+    "name": "MagmaChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:magma_cream",
+    "drop_item": "minecraft:magma_cream",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:slimechicken",
+    "parent_2": "chickens:blazechicken"
+  },
+  "chickens:pshardchicken": {
+    "name": "pShardChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:prismarine_shard",
+    "drop_item": "minecraft:prismarine_shard",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:waterchicken",
+    "parent_2": "chickens:bluechicken"
+  },
+  "chickens:pcrystalchicken": {
+    "name": "pCrystalChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:prismarine_crystals",
+    "drop_item": "minecraft:prismarine_crystals",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:waterchicken",
+    "parent_2": "chickens:emeraldchicken"
+  },
+  "chickens:obsidianchicken": {
+    "name": "obsidianChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:obsidian",
+    "drop_item": "minecraft:obsidian",
+    "spawn_type": "NORMAL",
+    "parent_1": "chickens:waterchicken",
+    "parent_2": "chickens:lavachicken"
+  },
+  "chickens:soulsandchicken": {
+    "name": "soulSandChicken",
+    "is_enabled": true,
+    "lay_coefficient": 1.0,
+    "lay_item": "minecraft:soul_sand",
+    "drop_item": "minecraft:soul_sand",
+    "spawn_type": "HELL",
+    "parent_1": "",
+    "parent_2": ""
+  }
+}

src/overrides/config/chickens/main_chickens.cfg

@@ -0,0 +1,23 @@
+# Configuration file
+
+general {
+    # Stats will be always shown in WAILA without the need to analyze chickens first when enabled. [default: false]
+    B:alwaysShowStats=false
+
+    # Chicken Entity ID [range: -2147483648 ~ 2147483647, default: 30000]
+    I:entityId=30000
+
+    # Maximal brood size, must be greater than the minimal size [range: 2 ~ 2147483647, default: 5]
+    I:maxBroodSize=5
+
+    # Minimal brood size [range: 1 ~ 2147483647, default: 3]
+    I:minBroodSize=3
+
+    # Nether chicken spawn chance multiplier, e.g. 0=no initial spawn, 2=two times more spawn rate [range: 0.0 ~ 3.4028235E38, default: 1.0]
+    S:netherSpawnChanceMultiplier=1.0
+
+    # Spawn probability [range: -2147483648 ~ 2147483647, default: 10]
+    I:spawnProbability=10
+}
+
+

src/overrides/config/chisel.cfg

@@ -0,0 +1,172 @@
+# Configuration file
+
+autochisel {
+    # If true, the auto chisel will not function at all without power.
+    B:autoChiselNeedsPower=false
+
+    # If false, the auto chisel will always run at full speed, and will not accept FE.
+    B:autoChiselTakesPower=true
+}
+
+
+chisel {
+    # Should the chisel be damageable and take damage when it chisels something.
+    B:allowChiselDamage=true
+
+    # The extra attack damage points (in half hearts) that the diamond chisel inflicts when it is used to attack an entity.
+    I:diamondChiselAttackDamage=3
+
+    # The max damage of the diamond chisel. [range: 1 ~ 32767, default: 5056]
+    I:diamondChiselMaxDamage=5056
+
+    # The extra attack damage points (in half hearts) that the iChisel inflicts when it is used to attack an entity.
+    I:hitechChiselAttackDamage=3
+
+    # The max damage of the iChisel. [range: 1 ~ 32767, default: 10048]
+    I:hitechChiselMaxDamage=10048
+
+    # The extra attack damage points (in half hearts) that the iron chisel inflicts when it is used to attack an entity.
+    I:ironChiselAttackDamage=2
+
+    # If this is true, the iron chisel can left click chisel blocks. If false, it cannot.
+    B:ironChiselCanLeftClick=true
+
+    # If this is true, the iron chisel can change its chisel mode just as the diamond chisel can.
+    B:ironChiselHasModes=false
+
+    # The max damage of the standard iron chisel. [range: 1 ~ 32767, default: 512]
+    I:ironChiselMaxDamage=512
+}
+
+
+client {
+    # Use old pillar textures
+    B:pillarOldGraphics=false
+
+    # Make variations of blocks have the same name, and use the description in tooltip to distinguish them.
+    B:tooltipsUseBlockDescriptions=true
+}
+
+
+features {
+    B:aluminum=true
+    B:andesite=true
+    B:antiblock=true
+    B:arcaneStone=true
+    B:autochisel=true
+    B:basalt=true
+    B:bloodMagic=true
+    B:bookshelf=true
+    B:bricks=true
+    B:bronze=true
+    B:brownstone=true
+    B:carpet=true
+    B:certus=true
+    B:charcoal=true
+    B:chisel=true
+    B:cloud=true
+    B:coal=true
+    B:coalCoke=true
+    B:cobalt=true
+    B:cobblestone=true
+    B:cobblestonemossy=true
+    B:concrete=true
+    B:copper=true
+    B:diamond=true
+    B:diorite=true
+    B:dirt=true
+    B:electrum=true
+    B:emerald=true
+    B:endPurpur=true
+    B:endstone=true
+    B:factory=true
+    B:futura=true
+    B:glass=true
+    B:glassdyed=true
+    B:glowstone=true
+    B:gold=true
+    B:granite=true
+    B:hardenedClay=true
+    B:ice=true
+    B:invar=true
+    B:iron=true
+    B:ironpane=true
+    B:laboratory=true
+    B:lapis=true
+    B:lavastone=true
+    B:lead=true
+    B:limestone=true
+    B:marble=true
+    B:marblepillar=true
+    B:netherbrick=true
+    B:netherrack=true
+    B:nickel=true
+    B:obsidian=true
+    B:paper=true
+    B:planks=true
+    B:platinum=true
+    B:prismarine=true
+    B:quartz=true
+    B:redstone=true
+    B:sandstone=true
+    B:sandstoneRed=true
+    B:sandstoneScribbles=true
+    B:sandstoneredScribbles=true
+    B:silver=true
+    B:steel=true
+    B:stonebrick=true
+    B:technical=true
+    B:temple=true
+    B:tin=true
+    B:tyrian=true
+    B:uranium=true
+    B:valentines=true
+    B:voidstone=true
+    B:waterstone=true
+    B:wool=true
+}
+
+
+general {
+    # If true, you can chisel stone brick to mossy stone brick.
+    B:allowBrickToMossyInChisel=true
+    I:amountYouGetFromFactoryBlockCrafting=32
+
+    # Use alternative crafting recipe for the chisel
+    B:chiselAlternateRecipe=false
+
+    # If this is true, you can chisel from the chisel leaves back to vanilla ones. If it is false, you cannot.
+    B:chiselBackToVanillaLeaves=false
+
+    # Allow stone to be chiseled to/from stone bricks.
+    B:chiselStoneToStoneBricks=true
+
+    # The factor that concrete_white increases your velocity. Default is 1.35, set to 1 for no change.
+    D:concreteVelocityMult=1.35
+}
+
+
+worldgen {
+    # Amount of limestone to generate in the world; use 0 for none [range: 0 ~ 30, default: 18]
+    I:limestoneAmount=18
+
+    # Amount of marble to generate in the world; use 0 for none [range: 0 ~ 30, default: 20]
+    I:marbleAmount=20
+
+    basalt {
+        # Thickness of the basalt at the bottom of lava lakes. 0 for none. [range: 0 ~ 5, default: 3]
+        I:bottomThickness=3
+
+        # Thickness of the basalt around the sides of lava lakes. 0 for none. [range: 0 ~ 5, default: 1]
+        I:sideThickness=1
+
+        # True to generate basalt only around lava lakes. False to do standard vein generation. [default: true]
+        B:specialGen=true
+
+        # Amount of basalt to generate in the world if not using special generation. Has no effect if basaltSpecialGen is true. Use 0 for none [range: 0 ~ 30, default: 15]
+        I:veinAmount=15
+    }
+
+}
+
+